Compare commits
50 Commits
bb6728b6ec
...
master
| Author | SHA1 | Date | |
|---|---|---|---|
|
4eefa1bf07
|
|||
|
|
31d210ca47 | ||
|
|
dae68b4f13 | ||
|
|
8516ebe2b7 | ||
|
|
b83227aaf5 | ||
|
0e707271a4
|
|||
|
f68e234ea6
|
|||
|
|
404b06b5f3 | ||
|
|
2b922c049a | ||
|
948a0fdc5c
|
|||
|
|
78101df2cc | ||
|
|
12bbddf204 | ||
|
|
4979d07f2e | ||
|
|
f038b53fa2 | ||
|
|
4748311f8d | ||
|
|
d47eb8f0eb | ||
|
|
1657eeb769 | ||
|
|
25df682094 | ||
|
|
53edbbc4e9 | ||
|
|
5b4a3fe691 | ||
|
d3d825dc50
|
|||
|
|
f8a17fdaa5 | ||
|
b4d2f9aec9
|
|||
|
2e122dbcb1
|
|||
|
56762c9026
|
|||
|
3d9a7e3014
|
|||
|
|
b0d9c1d51a | ||
|
dba8410146
|
|||
|
704db60297
|
|||
|
73360e6972
|
|||
|
62a4347b96
|
|||
|
443996df96
|
|||
|
441ea68fd7
|
|||
|
2fd13de8e1
|
|||
|
4e05923cd8
|
|||
|
5a79ec025a
|
|||
|
644cda63a0
|
|||
|
|
78d788b27f | ||
|
49dc4b4f00
|
|||
|
c654cdf57e
|
|||
|
a7e8f3add0
|
|||
|
ce1139e335
|
|||
|
3845fb1213
|
|||
|
4df434a7c6
|
|||
|
57a1fc6820
|
|||
|
8d87371763
|
|||
|
2e2a96d7d8
|
|||
|
5e60c28ce5
|
|||
|
3256ba8b03
|
|||
|
b45ae21354
|
@@ -24,15 +24,22 @@ hmacKey = "secretkey" # random key for cryptographic signing of video urls
|
||||
base64Media = false # use base64 encoding for proxied media urls
|
||||
enableRSS = true # set this to false to disable RSS feeds
|
||||
enableDebug = false # enable request logs and debug endpoints (/.sessions)
|
||||
logLevel = "info" # log level (debug, info, warn, error, fatal)
|
||||
proxy = "" # http/https url, SOCKS proxies are not supported
|
||||
proxyAuth = ""
|
||||
defaultFollowedAccounts = "eff,fsf" # default accounts to show when user follows none
|
||||
disableTid = false # enable this if cookie-based auth is failing
|
||||
|
||||
# Change default preferences here, see src/prefs_impl.nim for a complete list
|
||||
[Preferences]
|
||||
theme = "Nitter"
|
||||
replaceTwitter = "nitter.net"
|
||||
replaceYouTube = "piped.video"
|
||||
replaceReddit = "teddit.net"
|
||||
theme = "Kuuro"
|
||||
replaceTwitter = "nt.kuuro.net"
|
||||
replaceYouTube = "inv.nadeko.net"
|
||||
replaceReddit = "rd.kuuro.net"
|
||||
replaceImgur = "rd.kuuro.net"
|
||||
replaceFandom = "ph.kuuro.net"
|
||||
replaceSoundCloud = "sc.kuuro.net"
|
||||
proxyVideos = true
|
||||
hlsPlayback = false
|
||||
infiniteScroll = false
|
||||
hideNsfw = true
|
||||
|
||||
@@ -10,7 +10,7 @@ bin = @["nitter"]
|
||||
|
||||
# Dependencies
|
||||
|
||||
requires "nim >= 1.6.10"
|
||||
requires "nim >= 2.0.0"
|
||||
requires "jester#baca3f"
|
||||
requires "karax#5cf360c"
|
||||
requires "sass#7dfdd03"
|
||||
|
||||
59
public/css/themes/kuuro.css
Normal file
59
public/css/themes/kuuro.css
Normal file
@@ -0,0 +1,59 @@
|
||||
body {
|
||||
--bg_color: #050505;
|
||||
--fg_color: #d2d2d2;
|
||||
--fg_faded: #949494;
|
||||
--fg_dark: var(--accent);
|
||||
--fg_nav: var(--accent);
|
||||
|
||||
--bg_panel: #0a0a0a;
|
||||
--bg_elements: #0f0f0f;
|
||||
--bg_overlays: var(--bg_panel);
|
||||
--bg_hover: #151515;
|
||||
|
||||
--grey: #949494;
|
||||
--dark_grey: #444444;
|
||||
--darker_grey: #333333;
|
||||
--darkest_grey: #111111;
|
||||
--border_grey: rgba(255, 255, 255, 0.06);
|
||||
|
||||
--accent: #f3c2e6;
|
||||
--accent_light: #ffd6f2;
|
||||
--accent_dark: #a6859d;
|
||||
--accent_border: #f3c2e660;
|
||||
|
||||
--play_button: var(--accent);
|
||||
--play_button_hover: var(--accent_light);
|
||||
|
||||
--more_replies_dots: #5f6364;
|
||||
--error_red: #ec5f67;
|
||||
|
||||
--verified_blue: #6699cc;
|
||||
--icon_text: var(--fg_color);
|
||||
|
||||
--tab: var(--fg_color);
|
||||
--tab_selected: var(--accent);
|
||||
|
||||
--profile_stat: var(--fg_color);
|
||||
}
|
||||
|
||||
*:not(.avatar) {
|
||||
border-radius: 0 !important;
|
||||
}
|
||||
|
||||
input, textarea, select, button,
|
||||
.card-container,
|
||||
.profile-card,
|
||||
.photo-rail-card,
|
||||
.timeline-item,
|
||||
.search-field,
|
||||
nav,
|
||||
.timeline-footer,
|
||||
.show-more,
|
||||
.unavailable-box,
|
||||
.tweet-embed,
|
||||
.overlay-panel,
|
||||
.timeline-header,
|
||||
.tab {
|
||||
outline: 1px solid var(--border_grey) !important;
|
||||
outline-offset: -1px !important;
|
||||
}
|
||||
@@ -37,6 +37,10 @@ function fetchAndParse(url) {
|
||||
window.onload = function () {
|
||||
const url = window.location.pathname;
|
||||
const isTweet = url.indexOf("/status/") !== -1;
|
||||
const isHomepage = url === "/" || url === "";
|
||||
|
||||
if (isHomepage) return;
|
||||
|
||||
const isIncompleteThread =
|
||||
isTweet && document.querySelector(".timeline-item.more-replies") != null;
|
||||
|
||||
|
||||
BIN
screenshot.png
BIN
screenshot.png
Binary file not shown.
|
Before Width: | Height: | Size: 957 KiB After Width: | Height: | Size: 790 KiB |
140
src/api.nim
140
src/api.nim
@@ -1,96 +1,101 @@
|
||||
# SPDX-License-Identifier: AGPL-3.0-only
|
||||
import asyncdispatch, httpclient, uri, strutils, sequtils, sugar
|
||||
import asyncdispatch, httpclient, strutils, sequtils, sugar
|
||||
import packedjson
|
||||
import types, query, formatters, consts, apiutils, parser
|
||||
import experimental/parser as newParser
|
||||
|
||||
proc mediaUrl(id: string; cursor: string): SessionAwareUrl =
|
||||
let
|
||||
cookieVariables = userMediaVariables % [id, cursor]
|
||||
oauthVariables = restIdVariables % [id, cursor]
|
||||
result = SessionAwareUrl(
|
||||
cookieUrl: graphUserMedia ? {"variables": cookieVariables, "features": gqlFeatures},
|
||||
oauthUrl: graphUserMediaV2 ? {"variables": oauthVariables, "features": gqlFeatures}
|
||||
# Helper to generate params object for GraphQL requests
|
||||
proc genParams(variables: string; fieldToggles = ""): seq[(string, string)] =
|
||||
result.add ("variables", variables)
|
||||
result.add ("features", gqlFeatures)
|
||||
if fieldToggles.len > 0:
|
||||
result.add ("fieldToggles", fieldToggles)
|
||||
|
||||
proc apiUrl(endpoint, variables: string; fieldToggles = ""): ApiUrl =
|
||||
return ApiUrl(endpoint: endpoint, params: genParams(variables, fieldToggles))
|
||||
|
||||
proc apiReq(endpoint, variables: string; fieldToggles = ""): ApiReq =
|
||||
let url = apiUrl(endpoint, variables, fieldToggles)
|
||||
return ApiReq(cookie: url, oauth: url)
|
||||
|
||||
proc mediaUrl(id: string; cursor: string): ApiReq =
|
||||
result = ApiReq(
|
||||
cookie: apiUrl(graphUserMedia, userMediaVars % [id, cursor]),
|
||||
oauth: apiUrl(graphUserMediaV2, restIdVars % [id, cursor])
|
||||
)
|
||||
|
||||
proc userTweetsUrl(id: string; cursor: string): SessionAwareUrl =
|
||||
let
|
||||
cookieVariables = userTweetsVariables % [id, cursor]
|
||||
oauthVariables = restIdVariables % [id, cursor]
|
||||
result = SessionAwareUrl(
|
||||
cookieUrl: graphUserTweets ? {"variables": cookieVariables, "features": gqlFeatures, "fieldToggles": fieldToggles},
|
||||
oauthUrl: graphUserTweetsV2 ? {"variables": oauthVariables, "features": gqlFeatures}
|
||||
proc userTweetsUrl(id: string; cursor: string): ApiReq =
|
||||
result = ApiReq(
|
||||
# cookie: apiUrl(graphUserTweets, userTweetsVars % [id, cursor], userTweetsFieldToggles),
|
||||
oauth: apiUrl(graphUserTweetsV2, restIdVars % [id, cursor])
|
||||
)
|
||||
# might change this in the future pending testing
|
||||
result.cookie = result.oauth
|
||||
|
||||
proc userTweetsAndRepliesUrl(id: string; cursor: string): ApiReq =
|
||||
let cookieVars = userTweetsAndRepliesVars % [id, cursor]
|
||||
result = ApiReq(
|
||||
cookie: apiUrl(graphUserTweetsAndReplies, cookieVars, userTweetsFieldToggles),
|
||||
oauth: apiUrl(graphUserTweetsAndRepliesV2, restIdVars % [id, cursor])
|
||||
)
|
||||
|
||||
proc userTweetsAndRepliesUrl(id: string; cursor: string): SessionAwareUrl =
|
||||
let
|
||||
cookieVariables = userTweetsAndRepliesVariables % [id, cursor]
|
||||
oauthVariables = restIdVariables % [id, cursor]
|
||||
result = SessionAwareUrl(
|
||||
cookieUrl: graphUserTweetsAndReplies ? {"variables": cookieVariables, "features": gqlFeatures, "fieldToggles": fieldToggles},
|
||||
oauthUrl: graphUserTweetsAndRepliesV2 ? {"variables": oauthVariables, "features": gqlFeatures}
|
||||
proc tweetDetailUrl(id: string; cursor: string): ApiReq =
|
||||
let cookieVars = tweetDetailVars % [id, cursor]
|
||||
result = ApiReq(
|
||||
cookie: apiUrl(graphTweetDetail, cookieVars, tweetDetailFieldToggles),
|
||||
oauth: apiUrl(graphTweet, tweetVars % [id, cursor])
|
||||
)
|
||||
|
||||
proc tweetDetailUrl(id: string; cursor: string): SessionAwareUrl =
|
||||
let
|
||||
cookieVariables = tweetDetailVariables % [id, cursor]
|
||||
oauthVariables = tweetVariables % [id, cursor]
|
||||
result = SessionAwareUrl(
|
||||
cookieUrl: graphTweetDetail ? {"variables": cookieVariables, "features": gqlFeatures, "fieldToggles": tweetDetailFieldToggles},
|
||||
oauthUrl: graphTweet ? {"variables": oauthVariables, "features": gqlFeatures}
|
||||
proc userUrl(username: string): ApiReq =
|
||||
let cookieVars = """{"screen_name":"$1","withGrokTranslatedBio":false}""" % username
|
||||
result = ApiReq(
|
||||
cookie: apiUrl(graphUser, cookieVars, tweetDetailFieldToggles),
|
||||
oauth: apiUrl(graphUserV2, """{"screen_name": "$1"}""" % username)
|
||||
)
|
||||
|
||||
proc getGraphUser*(username: string): Future[User] {.async.} =
|
||||
if username.len == 0: return
|
||||
let
|
||||
variables = """{"screen_name": "$1"}""" % username
|
||||
params = {"variables": variables, "features": gqlFeatures}
|
||||
js = await fetchRaw(graphUser ? params, Api.userScreenName)
|
||||
let js = await fetchRaw(userUrl(username))
|
||||
result = parseGraphUser(js)
|
||||
|
||||
proc getGraphUserById*(id: string): Future[User] {.async.} =
|
||||
if id.len == 0 or id.any(c => not c.isDigit): return
|
||||
let
|
||||
variables = """{"rest_id": "$1"}""" % id
|
||||
params = {"variables": variables, "features": gqlFeatures}
|
||||
js = await fetchRaw(graphUserById ? params, Api.userRestId)
|
||||
url = apiReq(graphUserById, """{"rest_id": "$1"}""" % id)
|
||||
js = await fetchRaw(url)
|
||||
result = parseGraphUser(js)
|
||||
|
||||
proc getGraphUserTweets*(id: string; kind: TimelineKind; after=""): Future[Profile] {.async.} =
|
||||
if id.len == 0: return
|
||||
let
|
||||
cursor = if after.len > 0: "\"cursor\":\"$1\"," % after else: ""
|
||||
js = case kind
|
||||
of TimelineKind.tweets:
|
||||
await fetch(userTweetsUrl(id, cursor), Api.userTweets)
|
||||
of TimelineKind.replies:
|
||||
await fetch(userTweetsAndRepliesUrl(id, cursor), Api.userTweetsAndReplies)
|
||||
of TimelineKind.media:
|
||||
await fetch(mediaUrl(id, cursor), Api.userMedia)
|
||||
url = case kind
|
||||
of TimelineKind.tweets: userTweetsUrl(id, cursor)
|
||||
of TimelineKind.replies: userTweetsAndRepliesUrl(id, cursor)
|
||||
of TimelineKind.media: mediaUrl(id, cursor)
|
||||
js = await fetch(url)
|
||||
result = parseGraphTimeline(js, after)
|
||||
|
||||
proc getGraphListTweets*(id: string; after=""): Future[Timeline] {.async.} =
|
||||
if id.len == 0: return
|
||||
let
|
||||
cursor = if after.len > 0: "\"cursor\":\"$1\"," % after else: ""
|
||||
variables = restIdVariables % [id, cursor]
|
||||
params = {"variables": variables, "features": gqlFeatures}
|
||||
js = await fetch(graphListTweets ? params, Api.listTweets)
|
||||
url = apiReq(graphListTweets, restIdVars % [id, cursor])
|
||||
js = await fetch(url)
|
||||
result = parseGraphTimeline(js, after).tweets
|
||||
|
||||
proc getGraphListBySlug*(name, list: string): Future[List] {.async.} =
|
||||
let
|
||||
variables = %*{"screenName": name, "listSlug": list}
|
||||
params = {"variables": $variables, "features": gqlFeatures}
|
||||
url = graphListBySlug ? params
|
||||
result = parseGraphList(await fetch(url, Api.listBySlug))
|
||||
url = apiReq(graphListBySlug, $variables)
|
||||
js = await fetch(url)
|
||||
result = parseGraphList(js)
|
||||
|
||||
proc getGraphList*(id: string): Future[List] {.async.} =
|
||||
let
|
||||
variables = """{"listId": "$1"}""" % id
|
||||
params = {"variables": variables, "features": gqlFeatures}
|
||||
url = graphListById ? params
|
||||
result = parseGraphList(await fetch(url, Api.list))
|
||||
url = apiReq(graphListById, """{"listId": "$1"}""" % id)
|
||||
js = await fetch(url)
|
||||
result = parseGraphList(js)
|
||||
|
||||
proc getGraphListMembers*(list: List; after=""): Future[Result[User]] {.async.} =
|
||||
if list.id.len == 0: return
|
||||
@@ -104,22 +109,23 @@ proc getGraphListMembers*(list: List; after=""): Future[Result[User]] {.async.}
|
||||
}
|
||||
if after.len > 0:
|
||||
variables["cursor"] = % after
|
||||
let url = graphListMembers ? {"variables": $variables, "features": gqlFeatures}
|
||||
result = parseGraphListMembers(await fetchRaw(url, Api.listMembers), after)
|
||||
let
|
||||
url = apiReq(graphListMembers, $variables)
|
||||
js = await fetchRaw(url)
|
||||
result = parseGraphListMembers(js, after)
|
||||
|
||||
proc getGraphTweetResult*(id: string): Future[Tweet] {.async.} =
|
||||
if id.len == 0: return
|
||||
let
|
||||
variables = """{"rest_id": "$1"}""" % id
|
||||
params = {"variables": variables, "features": gqlFeatures}
|
||||
js = await fetch(graphTweetResult ? params, Api.tweetResult)
|
||||
url = apiReq(graphTweetResult, """{"rest_id": "$1"}""" % id)
|
||||
js = await fetch(url)
|
||||
result = parseGraphTweetResult(js)
|
||||
|
||||
proc getGraphTweet(id: string; after=""): Future[Conversation] {.async.} =
|
||||
if id.len == 0: return
|
||||
let
|
||||
cursor = if after.len > 0: "\"cursor\":\"$1\"," % after else: ""
|
||||
js = await fetch(tweetDetailUrl(id, cursor), Api.tweetDetail)
|
||||
js = await fetch(tweetDetailUrl(id, cursor))
|
||||
result = parseGraphConversation(js, id)
|
||||
|
||||
proc getReplies*(id, after: string): Future[Result[Chain]] {.async.} =
|
||||
@@ -139,6 +145,7 @@ proc getGraphTweetSearch*(query: Query; after=""): Future[Timeline] {.async.} =
|
||||
var
|
||||
variables = %*{
|
||||
"rawQuery": q,
|
||||
"query_source": "typedQuery",
|
||||
"count": 20,
|
||||
"product": "Latest",
|
||||
"withDownvotePerspective": false,
|
||||
@@ -147,8 +154,10 @@ proc getGraphTweetSearch*(query: Query; after=""): Future[Timeline] {.async.} =
|
||||
}
|
||||
if after.len > 0:
|
||||
variables["cursor"] = % after
|
||||
let url = graphSearchTimeline ? {"variables": $variables, "features": gqlFeatures}
|
||||
result = parseGraphSearch[Tweets](await fetch(url, Api.search), after)
|
||||
let
|
||||
url = apiReq(graphSearchTimeline, $variables)
|
||||
js = await fetch(url)
|
||||
result = parseGraphSearch[Tweets](js, after)
|
||||
result.query = query
|
||||
|
||||
proc getGraphUserSearch*(query: Query; after=""): Future[Result[User]] {.async.} =
|
||||
@@ -158,6 +167,7 @@ proc getGraphUserSearch*(query: Query; after=""): Future[Result[User]] {.async.}
|
||||
var
|
||||
variables = %*{
|
||||
"rawQuery": query.text,
|
||||
"query_source": "typedQuery",
|
||||
"count": 20,
|
||||
"product": "People",
|
||||
"withDownvotePerspective": false,
|
||||
@@ -168,13 +178,15 @@ proc getGraphUserSearch*(query: Query; after=""): Future[Result[User]] {.async.}
|
||||
variables["cursor"] = % after
|
||||
result.beginning = false
|
||||
|
||||
let url = graphSearchTimeline ? {"variables": $variables, "features": gqlFeatures}
|
||||
result = parseGraphSearch[User](await fetch(url, Api.search), after)
|
||||
let
|
||||
url = apiReq(graphSearchTimeline, $variables)
|
||||
js = await fetch(url)
|
||||
result = parseGraphSearch[User](js, after)
|
||||
result.query = query
|
||||
|
||||
proc getPhotoRail*(id: string): Future[PhotoRail] {.async.} =
|
||||
if id.len == 0: return
|
||||
let js = await fetch(mediaUrl(id, ""), Api.userMedia)
|
||||
let js = await fetch(mediaUrl(id, ""))
|
||||
result = parseGraphPhotoRail(js)
|
||||
|
||||
proc resolve*(url: string; prefs: Prefs): Future[string] {.async.} =
|
||||
|
||||
@@ -1,16 +1,30 @@
|
||||
# SPDX-License-Identifier: AGPL-3.0-only
|
||||
import httpclient, asyncdispatch, options, strutils, uri, times, math, tables
|
||||
import httpclient, asyncdispatch, options, strutils, uri, times, math, tables, logging
|
||||
import jsony, packedjson, zippy, oauth1
|
||||
import types, auth, consts, parserutils, http_pool
|
||||
import types, auth, consts, parserutils, http_pool, tid
|
||||
import experimental/types/common
|
||||
|
||||
const
|
||||
rlRemaining = "x-rate-limit-remaining"
|
||||
rlReset = "x-rate-limit-reset"
|
||||
rlLimit = "x-rate-limit-limit"
|
||||
errorsToSkip = {doesntExist, tweetNotFound, timeout, unauthorized, badRequest}
|
||||
errorsToSkip = {null, doesntExist, tweetNotFound, timeout, unauthorized, badRequest}
|
||||
|
||||
var pool: HttpPool
|
||||
var
|
||||
pool: HttpPool
|
||||
disableTid: bool
|
||||
|
||||
proc setDisableTid*(disable: bool) =
|
||||
disableTid = disable
|
||||
|
||||
proc toUrl(req: ApiReq; sessionKind: SessionKind): Uri =
|
||||
case sessionKind
|
||||
of oauth:
|
||||
let o = req.oauth
|
||||
parseUri("https://api.x.com/graphql") / o.endpoint ? o.params
|
||||
of cookie:
|
||||
let c = req.cookie
|
||||
parseUri("https://x.com/i/api/graphql") / c.endpoint ? c.params
|
||||
|
||||
proc getOauthHeader(url, oauthToken, oauthTokenSecret: string): string =
|
||||
let
|
||||
@@ -32,15 +46,15 @@ proc getOauthHeader(url, oauthToken, oauthTokenSecret: string): string =
|
||||
proc getCookieHeader(authToken, ct0: string): string =
|
||||
"auth_token=" & authToken & "; ct0=" & ct0
|
||||
|
||||
proc genHeaders*(session: Session, url: string): HttpHeaders =
|
||||
proc genHeaders*(session: Session, url: Uri): Future[HttpHeaders] {.async.} =
|
||||
result = newHttpHeaders({
|
||||
"connection": "keep-alive",
|
||||
"content-type": "application/json",
|
||||
"x-twitter-active-user": "yes",
|
||||
"x-twitter-client-language": "en",
|
||||
"authority": "api.x.com",
|
||||
"origin": "https://x.com",
|
||||
"accept-encoding": "gzip",
|
||||
"accept-language": "en-US,en;q=0.9",
|
||||
"accept-language": "en-US,en;q=0.5",
|
||||
"accept": "*/*",
|
||||
"DNT": "1",
|
||||
"user-agent": "Mozilla/5.0 (Macintosh; Intel Mac OS X 10_15_7) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/122.0.0.0 Safari/537.36"
|
||||
@@ -48,23 +62,28 @@ proc genHeaders*(session: Session, url: string): HttpHeaders =
|
||||
|
||||
case session.kind
|
||||
of SessionKind.oauth:
|
||||
result["authorization"] = getOauthHeader(url, session.oauthToken, session.oauthSecret)
|
||||
result["authority"] = "api.x.com"
|
||||
result["authorization"] = getOauthHeader($url, session.oauthToken, session.oauthSecret)
|
||||
of SessionKind.cookie:
|
||||
result["authorization"] = "Bearer AAAAAAAAAAAAAAAAAAAAAFQODgEAAAAAVHTp76lzh3rFzcHbmHVvQxYYpTw%3DckAlMINMjmCwxUcaXbAN4XqJVdgMJaHqNOFgPMK0zN1qLqLQCF"
|
||||
result["x-twitter-auth-type"] = "OAuth2Session"
|
||||
result["x-csrf-token"] = session.ct0
|
||||
result["cookie"] = getCookieHeader(session.authToken, session.ct0)
|
||||
if disableTid:
|
||||
result["authorization"] = bearerToken2
|
||||
else:
|
||||
result["authorization"] = bearerToken
|
||||
result["x-client-transaction-id"] = await genTid(url.path)
|
||||
|
||||
proc getAndValidateSession*(api: Api): Future[Session] {.async.} =
|
||||
result = await getSession(api)
|
||||
proc getAndValidateSession*(req: ApiReq): Future[Session] {.async.} =
|
||||
result = await getSession(req)
|
||||
case result.kind
|
||||
of SessionKind.oauth:
|
||||
if result.oauthToken.len == 0:
|
||||
echo "[sessions] Empty oauth token, session: ", result.pretty
|
||||
warn "[sessions] Empty oauth token, session: ", result.pretty
|
||||
raise rateLimitError()
|
||||
of SessionKind.cookie:
|
||||
if result.authToken.len == 0 or result.ct0.len == 0:
|
||||
echo "[sessions] Empty cookie credentials, session: ", result.pretty
|
||||
warn "[sessions] Empty cookie credentials, session: ", result.pretty
|
||||
raise rateLimitError()
|
||||
|
||||
template fetchImpl(result, fetchBody) {.dirty.} =
|
||||
@@ -73,7 +92,7 @@ template fetchImpl(result, fetchBody) {.dirty.} =
|
||||
|
||||
try:
|
||||
var resp: AsyncResponse
|
||||
pool.use(genHeaders(session, $url)):
|
||||
pool.use(await genHeaders(session, url)):
|
||||
template getContent =
|
||||
resp = await c.get($url)
|
||||
result = await resp.body
|
||||
@@ -89,7 +108,7 @@ template fetchImpl(result, fetchBody) {.dirty.} =
|
||||
remaining = parseInt(resp.headers[rlRemaining])
|
||||
reset = parseInt(resp.headers[rlReset])
|
||||
limit = parseInt(resp.headers[rlLimit])
|
||||
session.setRateLimit(api, remaining, reset, limit)
|
||||
session.setRateLimit(req, remaining, reset, limit)
|
||||
|
||||
if result.len > 0:
|
||||
if resp.headers.getOrDefault("content-encoding") == "gzip":
|
||||
@@ -98,24 +117,22 @@ template fetchImpl(result, fetchBody) {.dirty.} =
|
||||
if result.startsWith("{\"errors"):
|
||||
let errors = result.fromJson(Errors)
|
||||
if errors notin errorsToSkip:
|
||||
echo "Fetch error, API: ", api, ", errors: ", errors
|
||||
error "Fetch error, API: ", url.path, ", errors: ", errors
|
||||
if errors in {expiredToken, badToken, locked}:
|
||||
invalidate(session)
|
||||
raise rateLimitError()
|
||||
elif errors in {rateLimited}:
|
||||
# rate limit hit, resets after 24 hours
|
||||
setLimited(session, api)
|
||||
setLimited(session, req)
|
||||
raise rateLimitError()
|
||||
elif result.startsWith("429 Too Many Requests"):
|
||||
echo "[sessions] 429 error, API: ", api, ", session: ", session.pretty
|
||||
session.apis[api].remaining = 0
|
||||
# rate limit hit, resets after the 15 minute window
|
||||
warn "[sessions] 429 error, API: ", url.path, ", session: ", session.pretty
|
||||
raise rateLimitError()
|
||||
|
||||
fetchBody
|
||||
|
||||
if resp.status == $Http400:
|
||||
echo "ERROR 400, ", api, ": ", result
|
||||
error "ERROR 400, ", url.path, ": ", result
|
||||
raise newException(InternalError, $url)
|
||||
except InternalError as e:
|
||||
raise e
|
||||
@@ -125,7 +142,10 @@ template fetchImpl(result, fetchBody) {.dirty.} =
|
||||
raise e
|
||||
except Exception as e:
|
||||
let s = session.pretty
|
||||
echo "error: ", e.name, ", msg: ", e.msg, ", session: ", s, ", url: ", url
|
||||
var safeUrl = $url
|
||||
if safeUrl.len > 100:
|
||||
safeUrl = safeUrl[0 .. 100] & "..."
|
||||
error "error: ", e.name, ", msg: ", e.msg, ", session: ", s, ", url: ", safeUrl
|
||||
raise rateLimitError()
|
||||
finally:
|
||||
release(session)
|
||||
@@ -134,44 +154,37 @@ template retry(bod) =
|
||||
try:
|
||||
bod
|
||||
except RateLimitError:
|
||||
echo "[sessions] Rate limited, retrying ", api, " request..."
|
||||
info "[sessions] Rate limited, retrying ", req.cookie.endpoint, " request..."
|
||||
bod
|
||||
|
||||
proc fetch*(url: Uri | SessionAwareUrl; api: Api): Future[JsonNode] {.async.} =
|
||||
proc fetch*(req: ApiReq): Future[JsonNode] {.async.} =
|
||||
retry:
|
||||
var
|
||||
body: string
|
||||
session = await getAndValidateSession(api)
|
||||
session = await getAndValidateSession(req)
|
||||
|
||||
when url is SessionAwareUrl:
|
||||
let url = case session.kind
|
||||
of SessionKind.oauth: url.oauthUrl
|
||||
of SessionKind.cookie: url.cookieUrl
|
||||
let url = req.toUrl(session.kind)
|
||||
|
||||
fetchImpl body:
|
||||
if body.startsWith('{') or body.startsWith('['):
|
||||
result = parseJson(body)
|
||||
else:
|
||||
echo resp.status, ": ", body, " --- url: ", url
|
||||
warn resp.status, ": ", body, " --- url: ", url
|
||||
result = newJNull()
|
||||
|
||||
let error = result.getError
|
||||
if error != null and error notin errorsToSkip:
|
||||
echo "Fetch error, API: ", api, ", error: ", error
|
||||
error "Fetch error, API: ", url.path, ", error: ", error
|
||||
if error in {expiredToken, badToken, locked}:
|
||||
invalidate(session)
|
||||
raise rateLimitError()
|
||||
|
||||
proc fetchRaw*(url: Uri | SessionAwareUrl; api: Api): Future[string] {.async.} =
|
||||
proc fetchRaw*(req: ApiReq): Future[string] {.async.} =
|
||||
retry:
|
||||
var session = await getAndValidateSession(api)
|
||||
|
||||
when url is SessionAwareUrl:
|
||||
let url = case session.kind
|
||||
of SessionKind.oauth: url.oauthUrl
|
||||
of SessionKind.cookie: url.cookieUrl
|
||||
var session = await getAndValidateSession(req)
|
||||
let url = req.toUrl(session.kind)
|
||||
|
||||
fetchImpl result:
|
||||
if not (result.startsWith('{') or result.startsWith('[')):
|
||||
echo resp.status, ": ", result, " --- url: ", url
|
||||
warn resp.status, ": ", result, " --- url: ", url
|
||||
result.setLen(0)
|
||||
|
||||
53
src/auth.nim
53
src/auth.nim
@@ -1,6 +1,6 @@
|
||||
#SPDX-License-Identifier: AGPL-3.0-only
|
||||
import std/[asyncdispatch, times, json, random, sequtils, strutils, tables, packedsets, os]
|
||||
import types
|
||||
import std/[asyncdispatch, times, json, random, strutils, tables, packedsets, os, logging]
|
||||
import types, consts
|
||||
import experimental/parser/session
|
||||
|
||||
# max requests at a time per session to avoid race conditions
|
||||
@@ -12,8 +12,16 @@ var
|
||||
sessionPool: seq[Session]
|
||||
enableLogging = false
|
||||
|
||||
template log(str: varargs[string, `$`]) =
|
||||
echo "[sessions] ", str.join("")
|
||||
proc logSession(args: varargs[string, `$`]) =
|
||||
var s = "[sessions] "
|
||||
for arg in args:
|
||||
s.add arg
|
||||
info s
|
||||
|
||||
proc endpoint(req: ApiReq; session: Session): string =
|
||||
case session.kind
|
||||
of oauth: req.oauth.endpoint
|
||||
of cookie: req.cookie.endpoint
|
||||
|
||||
proc pretty*(session: Session): string =
|
||||
if session.isNil:
|
||||
@@ -122,14 +130,15 @@ proc rateLimitError*(): ref RateLimitError =
|
||||
proc noSessionsError*(): ref NoSessionsError =
|
||||
newException(NoSessionsError, "no sessions available")
|
||||
|
||||
proc isLimited(session: Session; api: Api): bool =
|
||||
proc isLimited(session: Session; req: ApiReq): bool =
|
||||
if session.isNil:
|
||||
return true
|
||||
|
||||
if session.limited and api != Api.userTweets:
|
||||
let api = req.endpoint(session)
|
||||
if session.limited and api != graphUserTweetsV2:
|
||||
if (epochTime().int - session.limitedAt) > hourInSeconds:
|
||||
session.limited = false
|
||||
log "resetting limit: ", session.pretty
|
||||
logSession "resetting limit: ", session.pretty
|
||||
return false
|
||||
else:
|
||||
return true
|
||||
@@ -140,12 +149,12 @@ proc isLimited(session: Session; api: Api): bool =
|
||||
else:
|
||||
return false
|
||||
|
||||
proc isReady(session: Session; api: Api): bool =
|
||||
not (session.isNil or session.pending > maxConcurrentReqs or session.isLimited(api))
|
||||
proc isReady(session: Session; req: ApiReq): bool =
|
||||
not (session.isNil or session.pending > maxConcurrentReqs or session.isLimited(req))
|
||||
|
||||
proc invalidate*(session: var Session) =
|
||||
if session.isNil: return
|
||||
log "invalidating: ", session.pretty
|
||||
logSession "invalidating: ", session.pretty
|
||||
|
||||
# TODO: This isn't sufficient, but it works for now
|
||||
let idx = sessionPool.find(session)
|
||||
@@ -156,24 +165,26 @@ proc release*(session: Session) =
|
||||
if session.isNil: return
|
||||
dec session.pending
|
||||
|
||||
proc getSession*(api: Api): Future[Session] {.async.} =
|
||||
proc getSession*(req: ApiReq): Future[Session] {.async.} =
|
||||
for i in 0 ..< sessionPool.len:
|
||||
if result.isReady(api): break
|
||||
if result.isReady(req): break
|
||||
result = sessionPool.sample()
|
||||
|
||||
if not result.isNil and result.isReady(api):
|
||||
if not result.isNil and result.isReady(req):
|
||||
inc result.pending
|
||||
else:
|
||||
log "no sessions available for API: ", api
|
||||
logSession "no sessions available for API: ", req.cookie.endpoint
|
||||
raise noSessionsError()
|
||||
|
||||
proc setLimited*(session: Session; api: Api) =
|
||||
proc setLimited*(session: Session; req: ApiReq) =
|
||||
let api = req.endpoint(session)
|
||||
session.limited = true
|
||||
session.limitedAt = epochTime().int
|
||||
log "rate limited by api: ", api, ", reqs left: ", session.apis[api].remaining, ", ", session.pretty
|
||||
logSession "rate limited by api: ", api, ", reqs left: ", session.apis[api].remaining, ", ", session.pretty
|
||||
|
||||
proc setRateLimit*(session: Session; api: Api; remaining, reset, limit: int) =
|
||||
proc setRateLimit*(session: Session; req: ApiReq; remaining, reset, limit: int) =
|
||||
# avoid undefined behavior in race conditions
|
||||
let api = req.endpoint(session)
|
||||
if api in session.apis:
|
||||
let rateLimit = session.apis[api]
|
||||
if rateLimit.reset >= reset and rateLimit.remaining < remaining:
|
||||
@@ -188,15 +199,15 @@ proc initSessionPool*(cfg: Config; path: string) =
|
||||
enableLogging = cfg.enableDebug
|
||||
|
||||
if path.endsWith(".json"):
|
||||
log "ERROR: .json is not supported, the file must be a valid JSONL file ending in .jsonl"
|
||||
fatal ".json is not supported, the file must be a valid JSONL file ending in .jsonl"
|
||||
quit 1
|
||||
|
||||
if not fileExists(path):
|
||||
log "ERROR: ", path, " not found. This file is required to authenticate API requests."
|
||||
fatal path, " not found. This file is required to authenticate API requests."
|
||||
quit 1
|
||||
|
||||
log "parsing JSONL account sessions file: ", path
|
||||
logSession "parsing JSONL account sessions file: ", path
|
||||
for line in path.lines:
|
||||
sessionPool.add parseSession(line)
|
||||
|
||||
log "successfully added ", sessionPool.len, " valid account sessions"
|
||||
logSession "successfully added ", sessionPool.len, " valid account sessions"
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
# SPDX-License-Identifier: AGPL-3.0-only
|
||||
import parsecfg except Config
|
||||
import types, strutils
|
||||
import types, strutils, sequtils
|
||||
|
||||
proc get*[T](config: parseCfg.Config; section, key: string; default: T): T =
|
||||
let val = config.getSectionValue(section, key)
|
||||
@@ -9,6 +9,7 @@ proc get*[T](config: parseCfg.Config; section, key: string; default: T): T =
|
||||
when T is int: parseInt(val)
|
||||
elif T is bool: parseBool(val)
|
||||
elif T is string: val
|
||||
elif T is seq[string]: val.split(',').mapIt(it.strip())
|
||||
|
||||
proc getConfig*(path: string): (Config, parseCfg.Config) =
|
||||
var cfg = loadConfig(path)
|
||||
@@ -39,8 +40,11 @@ proc getConfig*(path: string): (Config, parseCfg.Config) =
|
||||
minTokens: cfg.get("Config", "tokenCount", 10),
|
||||
enableRss: cfg.get("Config", "enableRSS", true),
|
||||
enableDebug: cfg.get("Config", "enableDebug", false),
|
||||
logLevel: cfg.get("Config", "logLevel", ""),
|
||||
proxy: cfg.get("Config", "proxy", ""),
|
||||
proxyAuth: cfg.get("Config", "proxyAuth", "")
|
||||
proxyAuth: cfg.get("Config", "proxyAuth", ""),
|
||||
defaultFollowedAccounts: cfg.get("Config", "defaultFollowedAccounts", @["eff", "fsf"]),
|
||||
disableTid: cfg.get("Config", "disableTid", false)
|
||||
)
|
||||
|
||||
return (conf, cfg)
|
||||
|
||||
@@ -1,32 +1,36 @@
|
||||
# SPDX-License-Identifier: AGPL-3.0-only
|
||||
import uri, strutils
|
||||
import strutils
|
||||
|
||||
const
|
||||
consumerKey* = "3nVuSoBZnx6U4vzUxf5w"
|
||||
consumerSecret* = "Bcs59EFbbsdF6Sl9Ng71smgStWEGwXXKSjYvPVt7qys"
|
||||
bearerToken* = "Bearer AAAAAAAAAAAAAAAAAAAAANRILgAAAAAAnNwIzUejRCOuH5E6I8xnZz4puTs%3D1Zv7ttfk8LF81IUq16cHjhLTvJu4FA33AGWWjCpTnA"
|
||||
bearerToken2* = "Bearer AAAAAAAAAAAAAAAAAAAAAFXzAwAAAAAAMHCxpeSDG1gLNLghVe8d74hl6k4%3DRUMF4xAQLsbeBhTSRrCiQpJtxoGWeyHrDb5te2jpGskWDFW82F"
|
||||
|
||||
gql = parseUri("https://api.x.com") / "graphql"
|
||||
|
||||
graphUser* = gql / "u7wQyGi6oExe8_TRWGMq4Q/UserResultByScreenNameQuery"
|
||||
graphUserById* = gql / "oPppcargziU1uDQHAUmH-A/UserResultByIdQuery"
|
||||
graphUserTweetsV2* = gql / "JLApJKFY0MxGTzCoK6ps8Q/UserWithProfileTweetsQueryV2"
|
||||
graphUserTweetsAndRepliesV2* = gql / "Y86LQY7KMvxn5tu3hFTyPg/UserWithProfileTweetsAndRepliesQueryV2"
|
||||
graphUserTweets* = gql / "oRJs8SLCRNRbQzuZG93_oA/UserTweets"
|
||||
graphUserTweetsAndReplies* = gql / "kkaJ0Mf34PZVarrxzLihjg/UserTweetsAndReplies"
|
||||
graphUserMedia* = gql / "36oKqyQ7E_9CmtONGjJRsA/UserMedia"
|
||||
graphUserMediaV2* = gql / "PDfFf8hGeJvUCiTyWtw4wQ/MediaTimelineV2"
|
||||
graphTweet* = gql / "Vorskcd2tZ-tc4Gx3zbk4Q/ConversationTimelineV2"
|
||||
graphTweetDetail* = gql / "YVyS4SfwYW7Uw5qwy0mQCA/TweetDetail"
|
||||
graphTweetResult* = gql / "sITyJdhRPpvpEjg4waUmTA/TweetResultByIdQuery"
|
||||
graphSearchTimeline* = gql / "7r8ibjHuK3MWUyzkzHNMYQ/SearchTimeline"
|
||||
graphListById* = gql / "cIUpT1UjuGgl_oWiY7Snhg/ListByRestId"
|
||||
graphListBySlug* = gql / "K6wihoTiTrzNzSF8y1aeKQ/ListBySlug"
|
||||
graphListMembers* = gql / "fuVHh5-gFn8zDBBxb8wOMA/ListMembers"
|
||||
graphListTweets* = gql / "BbGLL1ZfMibdFNWlk7a0Pw/ListTimeline"
|
||||
graphUser* = "-oaLodhGbbnzJBACb1kk2Q/UserByScreenName"
|
||||
graphUserV2* = "WEoGnYB0EG1yGwamDCF6zg/UserResultByScreenNameQuery"
|
||||
graphUserById* = "VN33vKXrPT7p35DgNR27aw/UserResultByIdQuery"
|
||||
graphUserTweetsV2* = "6QdSuZ5feXxOadEdXa4XZg/UserWithProfileTweetsQueryV2"
|
||||
graphUserTweetsAndRepliesV2* = "BDX77Xzqypdt11-mDfgdpQ/UserWithProfileTweetsAndRepliesQueryV2"
|
||||
graphUserTweets* = "oRJs8SLCRNRbQzuZG93_oA/UserTweets"
|
||||
graphUserTweetsAndReplies* = "kkaJ0Mf34PZVarrxzLihjg/UserTweetsAndReplies"
|
||||
graphUserMedia* = "36oKqyQ7E_9CmtONGjJRsA/UserMedia"
|
||||
graphUserMediaV2* = "bp0e_WdXqgNBIwlLukzyYA/MediaTimelineV2"
|
||||
graphTweet* = "Y4Erk_-0hObvLpz0Iw3bzA/ConversationTimeline"
|
||||
graphTweetDetail* = "YVyS4SfwYW7Uw5qwy0mQCA/TweetDetail"
|
||||
graphTweetResult* = "nzme9KiYhfIOrrLrPP_XeQ/TweetResultByIdQuery"
|
||||
graphSearchTimeline* = "bshMIjqDk8LTXTq4w91WKw/SearchTimeline"
|
||||
graphListById* = "cIUpT1UjuGgl_oWiY7Snhg/ListByRestId"
|
||||
graphListBySlug* = "K6wihoTiTrzNzSF8y1aeKQ/ListBySlug"
|
||||
graphListMembers* = "fuVHh5-gFn8zDBBxb8wOMA/ListMembers"
|
||||
graphListTweets* = "VQf8_XQynI3WzH6xopOMMQ/ListTimeline"
|
||||
|
||||
gqlFeatures* = """{
|
||||
"android_ad_formats_media_component_render_overlay_enabled": false,
|
||||
"android_graphql_skip_api_media_color_palette": false,
|
||||
"android_professional_link_spotlight_display_enabled": false,
|
||||
"blue_business_profile_image_shape_enabled": false,
|
||||
"commerce_android_shop_module_enabled": false,
|
||||
"creator_subscriptions_subscription_count_enabled": false,
|
||||
"creator_subscriptions_tweet_preview_api_enabled": true,
|
||||
"freedom_of_speech_not_reach_fetch_enabled": true,
|
||||
@@ -36,8 +40,9 @@ const
|
||||
"interactive_text_enabled": false,
|
||||
"longform_notetweets_consumption_enabled": true,
|
||||
"longform_notetweets_inline_media_enabled": true,
|
||||
"longform_notetweets_richtext_consumption_enabled": true,
|
||||
"longform_notetweets_rich_text_read_enabled": true,
|
||||
"longform_notetweets_richtext_consumption_enabled": true,
|
||||
"mobile_app_spotlight_module_enabled": false,
|
||||
"responsive_web_edit_tweet_api_enabled": true,
|
||||
"responsive_web_enhance_cards_enabled": false,
|
||||
"responsive_web_graphql_exclude_directive_enabled": true,
|
||||
@@ -46,6 +51,7 @@ const
|
||||
"responsive_web_media_download_video_enabled": false,
|
||||
"responsive_web_text_conversations_enabled": false,
|
||||
"responsive_web_twitter_article_tweet_consumption_enabled": true,
|
||||
"unified_cards_destination_url_params_enabled": false,
|
||||
"responsive_web_twitter_blue_verified_badge_is_enabled": true,
|
||||
"rweb_lists_timeline_redesign_enabled": true,
|
||||
"spaces_2022_h2_clipping": true,
|
||||
@@ -86,11 +92,21 @@ const
|
||||
"payments_enabled": false,
|
||||
"responsive_web_profile_redirect_enabled": false,
|
||||
"responsive_web_grok_show_grok_translated_post": false,
|
||||
"responsive_web_grok_community_note_auto_translation_is_enabled": false
|
||||
"responsive_web_grok_community_note_auto_translation_is_enabled": false,
|
||||
"profile_label_improvements_pcf_label_in_profile_enabled": false,
|
||||
"grok_android_analyze_trend_fetch_enabled": false,
|
||||
"grok_translations_community_note_auto_translation_is_enabled": false,
|
||||
"grok_translations_post_auto_translation_is_enabled": false,
|
||||
"grok_translations_community_note_translation_is_enabled": false,
|
||||
"grok_translations_timeline_user_bio_auto_translation_is_enabled": false,
|
||||
"subscriptions_feature_can_gift_premium": false,
|
||||
"responsive_web_twitter_article_notes_tab_enabled": false,
|
||||
"subscriptions_verification_info_is_identity_verified_enabled": false,
|
||||
"hidden_profile_subscriptions_enabled": false
|
||||
}""".replace(" ", "").replace("\n", "")
|
||||
|
||||
tweetVariables* = """{
|
||||
"focalTweetId": "$1",
|
||||
tweetVars* = """{
|
||||
"postId": "$1",
|
||||
$2
|
||||
"includeHasBirdwatchNotes": false,
|
||||
"includePromotedContent": false,
|
||||
@@ -99,7 +115,7 @@ const
|
||||
"withV2Timeline": true
|
||||
}""".replace(" ", "").replace("\n", "")
|
||||
|
||||
tweetDetailVariables* = """{
|
||||
tweetDetailVars* = """{
|
||||
"focalTweetId": "$1",
|
||||
$2
|
||||
"referrer": "profile",
|
||||
@@ -112,12 +128,12 @@ const
|
||||
"withVoice": true
|
||||
}""".replace(" ", "").replace("\n", "")
|
||||
|
||||
restIdVariables* = """{
|
||||
restIdVars* = """{
|
||||
"rest_id": "$1", $2
|
||||
"count": 20
|
||||
}"""
|
||||
|
||||
userMediaVariables* = """{
|
||||
userMediaVars* = """{
|
||||
"userId": "$1", $2
|
||||
"count": 20,
|
||||
"includePromotedContent": false,
|
||||
@@ -126,7 +142,7 @@ const
|
||||
"withVoice": true
|
||||
}""".replace(" ", "").replace("\n", "")
|
||||
|
||||
userTweetsVariables* = """{
|
||||
userTweetsVars* = """{
|
||||
"userId": "$1", $2
|
||||
"count": 20,
|
||||
"includePromotedContent": false,
|
||||
@@ -134,7 +150,7 @@ const
|
||||
"withVoice": true
|
||||
}""".replace(" ", "").replace("\n", "")
|
||||
|
||||
userTweetsAndRepliesVariables* = """{
|
||||
userTweetsAndRepliesVars* = """{
|
||||
"userId": "$1", $2
|
||||
"count": 20,
|
||||
"includePromotedContent": false,
|
||||
@@ -143,4 +159,6 @@ const
|
||||
}""".replace(" ", "").replace("\n", "")
|
||||
|
||||
fieldToggles* = """{"withArticlePlainText":false,"withViewCounts":true}"""
|
||||
tweetDetailFieldToggles* = """{"withArticleRichContentState":true,"withArticlePlainText":false,"withGrokAnalyze":false,"withDisallowedReplyControls":false,"withViewCounts":true}"""
|
||||
userFieldToggles = """{"withPayments":false,"withAuxiliaryUserLabels":true}"""
|
||||
userTweetsFieldToggles* = """{"withArticlePlainText":false}"""
|
||||
tweetDetailFieldToggles* = """{"withArticleRichContentState":true,"withArticlePlainText":false,"withGrokAnalyze":false,"withDisallowedReplyControls":false}"""
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
import options, strutils
|
||||
import jsony
|
||||
import user, ../types/[graphuser, graphlistmembers]
|
||||
import user, utils, ../types/[graphuser, graphlistmembers]
|
||||
from ../../types import User, VerifiedType, Result, Query, QueryKind
|
||||
|
||||
proc parseUserResult*(userResult: UserResult): User =
|
||||
@@ -15,22 +15,36 @@ proc parseUserResult*(userResult: UserResult): User =
|
||||
result.fullname = userResult.core.name
|
||||
result.userPic = userResult.avatar.imageUrl.replace("_normal", "")
|
||||
|
||||
if userResult.privacy.isSome:
|
||||
result.protected = userResult.privacy.get.protected
|
||||
|
||||
if userResult.location.isSome:
|
||||
result.location = userResult.location.get.location
|
||||
|
||||
if userResult.core.createdAt.len > 0:
|
||||
result.joinDate = parseTwitterDate(userResult.core.createdAt)
|
||||
|
||||
if userResult.verification.isSome:
|
||||
let v = userResult.verification.get
|
||||
if v.verifiedType != VerifiedType.none:
|
||||
result.verifiedType = v.verifiedType
|
||||
|
||||
if userResult.profileBio.isSome:
|
||||
if userResult.profileBio.isSome and result.bio.len == 0:
|
||||
result.bio = userResult.profileBio.get.description
|
||||
|
||||
proc parseGraphUser*(json: string): User =
|
||||
if json.len == 0 or json[0] != '{':
|
||||
return
|
||||
|
||||
let raw = json.fromJson(GraphUser)
|
||||
let userResult = raw.data.userResult.result
|
||||
let
|
||||
raw = json.fromJson(GraphUser)
|
||||
userResult =
|
||||
if raw.data.userResult.isSome: raw.data.userResult.get.result
|
||||
elif raw.data.user.isSome: raw.data.user.get.result
|
||||
else: UserResult()
|
||||
|
||||
if userResult.unavailableReason.get("") == "Suspended":
|
||||
if userResult.unavailableReason.get("") == "Suspended" or
|
||||
userResult.reason.get("") == "Suspended":
|
||||
return User(suspended: true)
|
||||
|
||||
result = parseUserResult(userResult)
|
||||
|
||||
8
src/experimental/parser/tid.nim
Normal file
8
src/experimental/parser/tid.nim
Normal file
@@ -0,0 +1,8 @@
|
||||
import jsony
|
||||
import ../types/tid
|
||||
export TidPair
|
||||
|
||||
proc parseTidPairs*(raw: string): seq[TidPair] =
|
||||
result = raw.fromJson(seq[TidPair])
|
||||
if result.len == 0:
|
||||
raise newException(ValueError, "Parsing pairs failed: " & raw)
|
||||
@@ -1,4 +1,6 @@
|
||||
import std/[options, tables, strutils, strformat, sugar]
|
||||
|
||||
import std/[options, tables, strutils, strformat, sugar, logging]
|
||||
|
||||
import jsony
|
||||
import user, ../types/unifiedcard
|
||||
import ../../formatters
|
||||
@@ -112,7 +114,7 @@ proc parseUnifiedCard*(json: string): Card =
|
||||
of ComponentType.hidden:
|
||||
result.kind = CardKind.hidden
|
||||
of ComponentType.unknown:
|
||||
echo "ERROR: Unknown component type: ", json
|
||||
error "ERROR: Unknown component type: ", json
|
||||
|
||||
case component.kind
|
||||
of twitterListDetails:
|
||||
|
||||
@@ -58,11 +58,13 @@ proc toUser*(raw: RawUser): User =
|
||||
media: raw.mediaCount,
|
||||
verifiedType: raw.verifiedType,
|
||||
protected: raw.protected,
|
||||
joinDate: parseTwitterDate(raw.createdAt),
|
||||
banner: getBanner(raw),
|
||||
userPic: getImageUrl(raw.profileImageUrlHttps).replace("_normal", "")
|
||||
)
|
||||
|
||||
if raw.createdAt.len > 0:
|
||||
result.joinDate = parseTwitterDate(raw.createdAt)
|
||||
|
||||
if raw.pinnedTweetIdsStr.len > 0:
|
||||
result.pinnedTweet = parseBiggestInt(raw.pinnedTweetIdsStr[0])
|
||||
|
||||
|
||||
@@ -3,7 +3,7 @@ from ../../types import User, VerifiedType
|
||||
|
||||
type
|
||||
GraphUser* = object
|
||||
data*: tuple[userResult: UserData]
|
||||
data*: tuple[userResult: Option[UserData], user: Option[UserData]]
|
||||
|
||||
UserData* = object
|
||||
result*: UserResult
|
||||
@@ -22,15 +22,24 @@ type
|
||||
Verification* = object
|
||||
verifiedType*: VerifiedType
|
||||
|
||||
Location* = object
|
||||
location*: string
|
||||
|
||||
Privacy* = object
|
||||
protected*: bool
|
||||
|
||||
UserResult* = object
|
||||
legacy*: User
|
||||
restId*: string
|
||||
isBlueVerified*: bool
|
||||
unavailableReason*: Option[string]
|
||||
core*: UserCore
|
||||
avatar*: UserAvatar
|
||||
unavailableReason*: Option[string]
|
||||
reason*: Option[string]
|
||||
privacy*: Option[Privacy]
|
||||
profileBio*: Option[UserBio]
|
||||
verification*: Option[Verification]
|
||||
location*: Option[Location]
|
||||
|
||||
proc enumHook*(s: string; v: var VerifiedType) =
|
||||
v = try:
|
||||
|
||||
4
src/experimental/types/tid.nim
Normal file
4
src/experimental/types/tid.nim
Normal file
@@ -0,0 +1,4 @@
|
||||
type
|
||||
TidPair* = object
|
||||
animationKey*: string
|
||||
verification*: string
|
||||
@@ -1,4 +1,6 @@
|
||||
import std/[options, tables, times]
|
||||
|
||||
import std/[options, tables, times, logging]
|
||||
|
||||
import jsony
|
||||
from ../../types import VideoType, VideoVariant, User
|
||||
|
||||
@@ -103,21 +105,21 @@ proc enumHook*(s: string; v: var ComponentType) =
|
||||
of "media_with_details_horizontal": mediaWithDetailsHorizontal
|
||||
of "commerce_drop_details": hidden
|
||||
of "grok_share": grokShare
|
||||
else: echo "ERROR: Unknown enum value (ComponentType): ", s; unknown
|
||||
else: error "ERROR: Unknown enum value (ComponentType): ", s; unknown
|
||||
|
||||
proc enumHook*(s: string; v: var AppType) =
|
||||
v = case s
|
||||
of "android_app": androidApp
|
||||
of "iphone_app": iPhoneApp
|
||||
of "ipad_app": iPadApp
|
||||
else: echo "ERROR: Unknown enum value (AppType): ", s; androidApp
|
||||
else: error "ERROR: Unknown enum value (AppType): ", s; androidApp
|
||||
|
||||
proc enumHook*(s: string; v: var MediaType) =
|
||||
v = case s
|
||||
of "video": video
|
||||
of "photo": photo
|
||||
of "model3d": model3d
|
||||
else: echo "ERROR: Unknown enum value (MediaType): ", s; photo
|
||||
else: error "ERROR: Unknown enum value (MediaType): ", s; photo
|
||||
|
||||
proc parseHook*(s: string; i: var int; v: var DateTime) =
|
||||
var str: string
|
||||
|
||||
@@ -6,13 +6,18 @@ import types, utils, query
|
||||
const
|
||||
cards = "cards.twitter.com/cards"
|
||||
tco = "https://t.co"
|
||||
twitter = parseUri("https://twitter.com")
|
||||
twitter = parseUri("https://x.com")
|
||||
|
||||
let
|
||||
twRegex = re"(?<=(?<!\S)https:\/\/|(?<=\s))(www\.|mobile\.)?twitter\.com"
|
||||
twLinkRegex = re"""<a href="https:\/\/twitter.com([^"]+)">twitter\.com(\S+)</a>"""
|
||||
xRegex = re"(?<=(?<!\S)https:\/\/|(?<=\s))(www\.|mobile\.)?x\.com"
|
||||
xLinkRegex = re"""<a href="https:\/\/x.com([^"]+)">x\.com(\S+)</a>"""
|
||||
imgurRegex = re"(?<=(?<!\S)https:\/\/|(?<=\s))(i\.)?imgur\.com"
|
||||
imgurLinkRegex = re"""<a href="https://(i\.)?imgur.com([^"]+)">(i\.)?imgur\.com(\S+)</a>"""
|
||||
fandomRegex = re"(?<=(?<!\S)https:\/\/|(?<=\s))([a-z0-9-]+)\.fandom\.com"
|
||||
fandomLinkRegex = re"""<a href="https://([a-z0-9-]+)\.fandom\.com([^"]+)">([a-z0-9-]+)\.fandom\.com(\S+)</a>"""
|
||||
soundcloudRegex = re"(?<=(?<!\S)https:\/\/|(?<=\s))(on\.|www\.)?soundcloud\.com"
|
||||
|
||||
ytRegex = re(r"([A-z.]+\.)?youtu(be\.com|\.be)", {reStudy, reIgnoreCase})
|
||||
|
||||
@@ -59,25 +64,44 @@ proc replaceUrls*(body: string; prefs: Prefs; absolute=""): string =
|
||||
result = body
|
||||
|
||||
if prefs.replaceYouTube.len > 0 and "youtu" in result:
|
||||
result = result.replace(ytRegex, prefs.replaceYouTube)
|
||||
let youtubeHost = strip(prefs.replaceYouTube, chars={'/'})
|
||||
result = result.replace(ytRegex, youtubeHost)
|
||||
|
||||
if prefs.replaceTwitter.len > 0:
|
||||
let twitterHost = strip(prefs.replaceTwitter, chars={'/'})
|
||||
if tco in result:
|
||||
result = result.replace(tco, https & prefs.replaceTwitter & "/t.co")
|
||||
result = result.replace(tco, https & twitterHost & "/t.co")
|
||||
if "x.com" in result:
|
||||
result = result.replace(xRegex, prefs.replaceTwitter)
|
||||
result = result.replace(xRegex, twitterHost)
|
||||
result = result.replacef(xLinkRegex, a(
|
||||
prefs.replaceTwitter & "$2", href = https & prefs.replaceTwitter & "$1"))
|
||||
twitterHost & "$2", href = https & twitterHost & "$1"))
|
||||
if "twitter.com" in result:
|
||||
result = result.replace(cards, prefs.replaceTwitter & "/cards")
|
||||
result = result.replace(twRegex, prefs.replaceTwitter)
|
||||
result = result.replace(cards, twitterHost & "/cards")
|
||||
result = result.replace(twRegex, twitterHost)
|
||||
result = result.replacef(twLinkRegex, a(
|
||||
prefs.replaceTwitter & "$2", href = https & prefs.replaceTwitter & "$1"))
|
||||
if "imgur.com" in result:
|
||||
result = result.replace(imgurRegex, prefs.replaceImgur)
|
||||
result = result.replacef(imgurLinkRegex, a(
|
||||
prefs.replaceImgur & "$4", href = https & prefs.replaceImgur & "$2"))
|
||||
|
||||
if prefs.replaceFandom.len > 0 and "fandom.com" in result:
|
||||
result = result.replace(fandomRegex, prefs.replaceFandom & "/$1")
|
||||
result = result.replacef(fandomLinkRegex, a(
|
||||
prefs.replaceFandom & "/$1$2", href = https & prefs.replaceFandom & "/$1$2"))
|
||||
|
||||
if prefs.replaceSoundCloud.len > 0 and "soundcloud.com" in result:
|
||||
result = result.replace(soundcloudRegex, prefs.replaceSoundCloud)
|
||||
result = result.replacef(re"""<a href="https://on\.soundcloud\.com([^"]+)">on\.soundcloud\.com(\S+)</a>""", a(
|
||||
prefs.replaceSoundCloud & "/on$2", href = https & prefs.replaceSoundCloud & "/on$1"))
|
||||
result = result.replacef(re"""<a href="https://(www\.)?soundcloud\.com([^"]+)">(www\.)?soundcloud\.com(\S+)</a>""", a(
|
||||
prefs.replaceSoundCloud & "$4", href = https & prefs.replaceSoundCloud & "$2"))
|
||||
|
||||
if prefs.replaceReddit.len > 0 and ("reddit.com" in result or "redd.it" in result):
|
||||
result = result.replace(rdShortRegex, prefs.replaceReddit & "/comments/")
|
||||
result = result.replace(rdRegex, prefs.replaceReddit)
|
||||
if prefs.replaceReddit in result and "/gallery/" in result:
|
||||
let redditHost = strip(prefs.replaceReddit, chars={'/'})
|
||||
result = result.replace(rdShortRegex, redditHost & "/comments/")
|
||||
result = result.replace(rdRegex, redditHost)
|
||||
if redditHost in result and "/gallery/" in result:
|
||||
result = result.replace("/gallery/", "/comments/")
|
||||
|
||||
if absolute.len > 0 and "href" in result:
|
||||
|
||||
100
src/nitter.nim
100
src/nitter.nim
@@ -1,20 +1,48 @@
|
||||
# SPDX-License-Identifier: AGPL-3.0-only
|
||||
import asyncdispatch, strformat, logging
|
||||
import asyncdispatch, strformat, logging, terminal, times, strutils
|
||||
from net import Port
|
||||
from htmlgen import a
|
||||
from os import getEnv
|
||||
|
||||
import jester
|
||||
|
||||
import types, config, prefs, formatters, redis_cache, http_pool, auth
|
||||
import views/[general, about]
|
||||
import types, config, prefs, formatters, redis_cache, http_pool, auth, apiutils
|
||||
import views/[general, about, search, homepage]
|
||||
import karax/[vdom]
|
||||
import routes/[
|
||||
preferences, timeline, status, media, search, rss, list, debug,
|
||||
unsupported, embed, resolver, router_utils]
|
||||
unsupported, embed, resolver, router_utils, follow]
|
||||
|
||||
const instancesUrl = "https://github.com/zedeus/nitter/wiki/Instances"
|
||||
const issuesUrl = "https://github.com/zedeus/nitter/issues"
|
||||
|
||||
type ColoredLogger = ref object of Logger
|
||||
|
||||
method log(logger: ColoredLogger, level: Level, args: varargs[string, `$`]) =
|
||||
if level < logger.levelThreshold: return
|
||||
|
||||
let color = case level
|
||||
of lvlFatal, lvlError: fgRed
|
||||
of lvlWarn: fgYellow
|
||||
of lvlInfo: fgGreen
|
||||
of lvlDebug: fgCyan
|
||||
else: fgWhite
|
||||
|
||||
let levelStr = case level
|
||||
of lvlFatal: "fatal"
|
||||
of lvlError: "error"
|
||||
of lvlWarn: "warn"
|
||||
of lvlInfo: "info"
|
||||
of lvlDebug: "debug"
|
||||
else: "other"
|
||||
|
||||
let timeStr = format(now(), "HH:mm:ss")
|
||||
stdout.styledWrite(fgWhite, "[", timeStr, "] ", color, levelStr, fgWhite, ": ")
|
||||
for arg in args:
|
||||
stdout.write(arg)
|
||||
stdout.write("\n")
|
||||
stdout.flushFile()
|
||||
|
||||
let
|
||||
configPath = getEnv("NITTER_CONF_FILE", "./nitter.conf")
|
||||
(cfg, fullCfg) = getConfig(configPath)
|
||||
@@ -23,13 +51,21 @@ let
|
||||
|
||||
initSessionPool(cfg, sessionsPath)
|
||||
|
||||
if not cfg.enableDebug:
|
||||
# Silence Jester's query warning
|
||||
addHandler(newConsoleLogger())
|
||||
setLogFilter(lvlError)
|
||||
addHandler(new(ColoredLogger))
|
||||
|
||||
stdout.write &"Starting Nitter at {getUrlPrefix(cfg)}\n"
|
||||
stdout.flushFile
|
||||
let level = case cfg.logLevel.toLowerAscii
|
||||
of "debug": lvlDebug
|
||||
of "info": lvlInfo
|
||||
of "warn": lvlWarn
|
||||
of "error": lvlError
|
||||
of "fatal": lvlFatal
|
||||
of "none": lvlNone
|
||||
else:
|
||||
if cfg.enableDebug: lvlDebug else: lvlInfo
|
||||
|
||||
setLogFilter(level)
|
||||
|
||||
info &"Starting Nitter at {getUrlPrefix(cfg)}"
|
||||
|
||||
updateDefaultPrefs(fullCfg)
|
||||
setCacheTimes(cfg)
|
||||
@@ -37,13 +73,14 @@ setHmacKey(cfg.hmacKey)
|
||||
setProxyEncoding(cfg.base64Media)
|
||||
setMaxHttpConns(cfg.httpMaxConns)
|
||||
setHttpProxy(cfg.proxy, cfg.proxyAuth)
|
||||
setDisableTid(cfg.disableTid)
|
||||
initAboutPage(cfg.staticDir)
|
||||
|
||||
waitFor initRedisPool(cfg)
|
||||
stdout.write &"Connected to Redis at {cfg.redisHost}:{cfg.redisPort}\n"
|
||||
stdout.flushFile
|
||||
info &"Connected to Redis at {cfg.redisHost}:{cfg.redisPort}"
|
||||
|
||||
createUnsupportedRouter(cfg)
|
||||
createFollowRouter(cfg)
|
||||
createResolverRouter(cfg)
|
||||
createPrefRouter(cfg)
|
||||
createTimelineRouter(cfg)
|
||||
@@ -63,6 +100,40 @@ settings:
|
||||
|
||||
routes:
|
||||
get "/":
|
||||
let prefs = cookiePrefs()
|
||||
|
||||
if prefs.following.len > 0 or cfg.defaultFollowedAccounts.len > 0:
|
||||
let
|
||||
cursor = getCursor()
|
||||
accounts = if prefs.following.len > 0: prefs.following else: cfg.defaultFollowedAccounts
|
||||
isDefault = prefs.following.len == 0
|
||||
currentPath = if @"f".len > 0: "/?f=" & @"f" else: "/"
|
||||
|
||||
var homepageQuery = initQuery(params(request))
|
||||
if @"f".len == 0:
|
||||
homepageQuery.kind = tweets
|
||||
|
||||
homepageQuery.fromUser = accounts
|
||||
|
||||
let
|
||||
timeline = await getGraphTweetSearch(homepageQuery, cursor)
|
||||
html = if isDefault:
|
||||
renderDefaultTimeline(timeline, prefs, getPath())
|
||||
else:
|
||||
renderHomepageTimeline(timeline, prefs, getPath())
|
||||
|
||||
var users: seq[User]
|
||||
for username in accounts:
|
||||
try:
|
||||
let user = await getCachedUser(username)
|
||||
users.add(user)
|
||||
except:
|
||||
continue
|
||||
|
||||
let homepageHtml = renderHomepage(users, html, prefs, currentPath)
|
||||
|
||||
resp renderMain(homepageHtml, request, cfg, prefs, "Following")
|
||||
else:
|
||||
resp renderMain(renderSearch(), request, cfg, themePrefs())
|
||||
|
||||
get "/about":
|
||||
@@ -83,13 +154,13 @@ routes:
|
||||
resp Http404, showError("Page not found", cfg)
|
||||
|
||||
error InternalError:
|
||||
echo error.exc.name, ": ", error.exc.msg
|
||||
error error.exc.name, ": ", error.exc.msg
|
||||
const link = a("open a GitHub issue", href = issuesUrl)
|
||||
resp Http500, showError(
|
||||
&"An error occurred, please {link} with the URL you tried to visit.", cfg)
|
||||
|
||||
error BadClientError:
|
||||
echo error.exc.name, ": ", error.exc.msg
|
||||
error error.exc.name, ": ", error.exc.msg
|
||||
resp Http500, showError("Network error occurred, please try again.", cfg)
|
||||
|
||||
error RateLimitError:
|
||||
@@ -111,5 +182,6 @@ routes:
|
||||
extend preferences, ""
|
||||
extend resolver, ""
|
||||
extend embed, ""
|
||||
extend follow, ""
|
||||
extend debug, ""
|
||||
extend unsupported, ""
|
||||
|
||||
314
src/parser.nim
314
src/parser.nim
@@ -1,10 +1,10 @@
|
||||
# SPDX-License-Identifier: AGPL-3.0-only
|
||||
import strutils, options, times, math
|
||||
import strutils, options, times, math, tables
|
||||
import packedjson, packedjson/deserialiser
|
||||
import types, parserutils, utils
|
||||
import experimental/parser/unifiedcard
|
||||
|
||||
proc parseGraphTweet(js: JsonNode; isLegacy=false): Tweet
|
||||
proc parseGraphTweet(js: JsonNode): Tweet
|
||||
|
||||
proc parseUser(js: JsonNode; id=""): User =
|
||||
if js.isNull: return
|
||||
@@ -21,11 +21,17 @@ proc parseUser(js: JsonNode; id=""): User =
|
||||
tweets: js{"statuses_count"}.getInt,
|
||||
likes: js{"favourites_count"}.getInt,
|
||||
media: js{"media_count"}.getInt,
|
||||
verifiedType: parseEnum[VerifiedType](js{"verified_type"}.getStr("None")),
|
||||
protected: js{"protected"}.getBool,
|
||||
protected: js{"protected"}.getBool(js{"privacy", "protected"}.getBool),
|
||||
sensitive: "sensitive" in js{"profile_interstitial_type"}.getStr("") or js{"possibly_sensitive"}.getBool,
|
||||
joinDate: js{"created_at"}.getTime
|
||||
)
|
||||
|
||||
if js{"is_blue_verified"}.getBool(false):
|
||||
result.verifiedType = blue
|
||||
|
||||
with verifiedType, js{"verified_type"}:
|
||||
result.verifiedType = parseEnum[VerifiedType](verifiedType.getStr)
|
||||
|
||||
result.expandUserEntities(js)
|
||||
|
||||
proc parseGraphUser(js: JsonNode): User =
|
||||
@@ -41,6 +47,9 @@ proc parseGraphUser(js: JsonNode): User =
|
||||
|
||||
result = parseUser(user{"legacy"}, user{"rest_id"}.getStr)
|
||||
|
||||
if result.verifiedType == none and user{"is_blue_verified"}.getBool(false):
|
||||
result.verifiedType = blue
|
||||
|
||||
# fallback to support UserMedia/recent GraphQL updates
|
||||
if result.username.len == 0:
|
||||
result.username = user{"core", "screen_name"}.getStr
|
||||
@@ -90,16 +99,24 @@ proc parsePoll(js: JsonNode): Poll =
|
||||
result.leader = result.values.find(max(result.values))
|
||||
result.votes = result.values.sum
|
||||
|
||||
proc parseGif(js: JsonNode): Gif =
|
||||
result = Gif(
|
||||
url: js{"video_info", "variants"}[0]{"url"}.getImageStr,
|
||||
thumb: js{"media_url_https"}.getImageStr
|
||||
proc parseVideoVariants(variants: JsonNode): seq[VideoVariant] =
|
||||
result = @[]
|
||||
for v in variants:
|
||||
let
|
||||
url = v{"url"}.getStr
|
||||
contentType = parseEnum[VideoType](v{"content_type"}.getStr("video/mp4"))
|
||||
bitrate = v{"bit_rate"}.getInt(v{"bitrate"}.getInt(0))
|
||||
|
||||
result.add VideoVariant(
|
||||
contentType: contentType,
|
||||
bitrate: bitrate,
|
||||
url: url,
|
||||
resolution: if contentType == mp4: getMp4Resolution(url) else: 0
|
||||
)
|
||||
|
||||
proc parseVideo(js: JsonNode): Video =
|
||||
result = Video(
|
||||
thumb: js{"media_url_https"}.getImageStr,
|
||||
views: getVideoViewCount(js),
|
||||
available: true,
|
||||
title: js{"ext_alt_text"}.getStr,
|
||||
durationMs: js{"video_info", "duration_millis"}.getInt
|
||||
@@ -116,17 +133,62 @@ proc parseVideo(js: JsonNode): Video =
|
||||
with description, js{"additional_media_info", "description"}:
|
||||
result.description = description.getStr
|
||||
|
||||
for v in js{"video_info", "variants"}:
|
||||
let
|
||||
contentType = parseEnum[VideoType](v{"content_type"}.getStr("summary"))
|
||||
url = v{"url"}.getStr
|
||||
result.variants = parseVideoVariants(js{"video_info", "variants"})
|
||||
|
||||
result.variants.add VideoVariant(
|
||||
contentType: contentType,
|
||||
bitrate: v{"bitrate"}.getInt,
|
||||
url: url,
|
||||
resolution: if contentType == mp4: getMp4Resolution(url) else: 0
|
||||
proc parseLegacyMediaEntities(js: JsonNode; result: var Tweet) =
|
||||
with jsMedia, js{"extended_entities", "media"}:
|
||||
for m in jsMedia:
|
||||
case m.getTypeName:
|
||||
of "photo":
|
||||
result.photos.add m{"media_url_https"}.getImageStr
|
||||
of "video":
|
||||
result.video = some(parseVideo(m))
|
||||
with user, m{"additional_media_info", "source_user"}:
|
||||
if user{"id"}.getInt > 0:
|
||||
result.attribution = some(parseUser(user))
|
||||
else:
|
||||
result.attribution = some(parseGraphUser(user))
|
||||
of "animated_gif":
|
||||
result.gif = some Gif(
|
||||
url: m{"video_info", "variants"}[0]{"url"}.getImageStr,
|
||||
thumb: m{"media_url_https"}.getImageStr
|
||||
)
|
||||
else: discard
|
||||
|
||||
with url, m{"url"}:
|
||||
if result.text.endsWith(url.getStr):
|
||||
result.text.removeSuffix(url.getStr)
|
||||
result.text = result.text.strip()
|
||||
|
||||
proc parseMediaEntities(js: JsonNode; result: var Tweet) =
|
||||
with mediaEntities, js{"media_entities"}:
|
||||
for mediaEntity in mediaEntities:
|
||||
with mediaInfo, mediaEntity{"media_results", "result", "media_info"}:
|
||||
case mediaInfo.getTypeName
|
||||
of "ApiImage":
|
||||
result.photos.add mediaInfo{"original_img_url"}.getImageStr
|
||||
of "ApiVideo":
|
||||
let status = mediaEntity{"media_results", "result", "media_availability_v2", "status"}
|
||||
result.video = some Video(
|
||||
available: status.getStr == "Available",
|
||||
thumb: mediaInfo{"preview_image", "original_img_url"}.getImageStr,
|
||||
durationMs: mediaInfo{"duration_millis"}.getInt,
|
||||
variants: parseVideoVariants(mediaInfo{"variants"})
|
||||
)
|
||||
of "ApiGif":
|
||||
result.gif = some Gif(
|
||||
url: mediaInfo{"variants"}[0]{"url"}.getImageStr,
|
||||
thumb: mediaInfo{"preview_image", "original_img_url"}.getImageStr
|
||||
)
|
||||
else: discard
|
||||
|
||||
# Remove media URLs from text
|
||||
with mediaList, js{"legacy", "entities", "media"}:
|
||||
for url in mediaList:
|
||||
let expandedUrl = url.getExpandedUrl
|
||||
if result.text.endsWith(expandedUrl):
|
||||
result.text.removeSuffix(expandedUrl)
|
||||
result.text = result.text.strip()
|
||||
|
||||
proc parsePromoVideo(js: JsonNode): Video =
|
||||
result = Video(
|
||||
@@ -206,7 +268,7 @@ proc parseCard(js: JsonNode; urls: JsonNode): Card =
|
||||
|
||||
for u in ? urls:
|
||||
if u{"url"}.getStr == result.url:
|
||||
result.url = u{"expanded_url"}.getStr
|
||||
result.url = u.getExpandedUrl(result.url)
|
||||
break
|
||||
|
||||
if kind in {videoDirectMessage, imageDirectMessage}:
|
||||
@@ -218,20 +280,25 @@ proc parseCard(js: JsonNode; urls: JsonNode): Card =
|
||||
|
||||
proc parseTweet(js: JsonNode; jsCard: JsonNode = newJNull()): Tweet =
|
||||
if js.isNull: return
|
||||
|
||||
let time =
|
||||
if js{"created_at"}.notNull: js{"created_at"}.getTime
|
||||
else: js{"created_at_ms"}.getTimeFromMs
|
||||
|
||||
result = Tweet(
|
||||
id: js{"id_str"}.getId,
|
||||
threadId: js{"conversation_id_str"}.getId,
|
||||
replyId: js{"in_reply_to_status_id_str"}.getId,
|
||||
text: js{"full_text"}.getStr,
|
||||
time: js{"created_at"}.getTime,
|
||||
time: time,
|
||||
hasThread: js{"self_thread"}.notNull,
|
||||
sensitive: js{"possibly_sensitive"}.getBool,
|
||||
available: true,
|
||||
user: User(id: js{"user_id_str"}.getStr),
|
||||
stats: TweetStats(
|
||||
replies: js{"reply_count"}.getInt,
|
||||
retweets: js{"retweet_count"}.getInt,
|
||||
likes: js{"favorite_count"}.getInt,
|
||||
quotes: js{"quote_count"}.getInt,
|
||||
views: js{"views_count"}.getInt
|
||||
)
|
||||
)
|
||||
@@ -257,6 +324,12 @@ proc parseTweet(js: JsonNode; jsCard: JsonNode = newJNull()): Tweet =
|
||||
result.retweet = some parseGraphTweet(rt)
|
||||
return
|
||||
|
||||
with reposts, js{"repostedStatusResults"}:
|
||||
with rt, reposts{"result"}:
|
||||
if "legacy" in rt:
|
||||
result.retweet = some parseGraphTweet(rt)
|
||||
return
|
||||
|
||||
if jsCard.kind != JNull:
|
||||
let name = jsCard{"name"}.getStr
|
||||
if "poll" in name:
|
||||
@@ -270,27 +343,7 @@ proc parseTweet(js: JsonNode; jsCard: JsonNode = newJNull()): Tweet =
|
||||
result.card = some parseCard(jsCard, js{"entities", "urls"})
|
||||
|
||||
result.expandTweetEntities(js)
|
||||
|
||||
with jsMedia, js{"extended_entities", "media"}:
|
||||
for m in jsMedia:
|
||||
case m{"type"}.getStr
|
||||
of "photo":
|
||||
result.photos.add m{"media_url_https"}.getImageStr
|
||||
of "video":
|
||||
result.video = some(parseVideo(m))
|
||||
with user, m{"additional_media_info", "source_user"}:
|
||||
if user{"id"}.getInt > 0:
|
||||
result.attribution = some(parseUser(user))
|
||||
else:
|
||||
result.attribution = some(parseGraphUser(user))
|
||||
of "animated_gif":
|
||||
result.gif = some(parseGif(m))
|
||||
else: discard
|
||||
|
||||
with url, m{"url"}:
|
||||
if result.text.endsWith(url.getStr):
|
||||
result.text.removeSuffix(url.getStr)
|
||||
result.text = result.text.strip()
|
||||
parseLegacyMediaEntities(js, result)
|
||||
|
||||
with jsWithheld, js{"withheld_in_countries"}:
|
||||
let withheldInCountries: seq[string] =
|
||||
@@ -306,95 +359,108 @@ proc parseTweet(js: JsonNode; jsCard: JsonNode = newJNull()): Tweet =
|
||||
result.text.removeSuffix(" Learn more.")
|
||||
result.available = false
|
||||
|
||||
proc parseGraphTweet(js: JsonNode; isLegacy=false): Tweet =
|
||||
proc parseGraphTweet(js: JsonNode): Tweet =
|
||||
if js.kind == JNull:
|
||||
return Tweet()
|
||||
|
||||
case js{"__typename"}.getStr
|
||||
case js.getTypeName:
|
||||
of "TweetUnavailable":
|
||||
return Tweet()
|
||||
of "TweetTombstone":
|
||||
with text, js{"tombstone", "richText"}:
|
||||
return Tweet(text: text.getTombstone)
|
||||
with text, js{"tombstone", "text"}:
|
||||
with text, select(js{"tombstone", "richText"}, js{"tombstone", "text"}):
|
||||
return Tweet(text: text.getTombstone)
|
||||
return Tweet()
|
||||
of "TweetPreviewDisplay":
|
||||
return Tweet(text: "You're unable to view this Tweet because it's only available to the Subscribers of the account owner.")
|
||||
of "TweetWithVisibilityResults":
|
||||
return parseGraphTweet(js{"tweet"}, isLegacy)
|
||||
return parseGraphTweet(js{"tweet"})
|
||||
else:
|
||||
discard
|
||||
|
||||
if not js.hasKey("legacy"):
|
||||
return Tweet()
|
||||
|
||||
var jsCard = copy(js{if isLegacy: "card" else: "tweet_card", "legacy"})
|
||||
var jsCard = select(js{"card"}, js{"tweet_card"}, js{"legacy", "tweet_card"})
|
||||
if jsCard.kind != JNull:
|
||||
var values = newJObject()
|
||||
for val in jsCard["binding_values"]:
|
||||
values[val["key"].getStr] = val["value"]
|
||||
jsCard["binding_values"] = values
|
||||
let legacyCard = jsCard{"legacy"}
|
||||
if legacyCard.kind != JNull:
|
||||
let bindingArray = legacyCard{"binding_values"}
|
||||
if bindingArray.kind == JArray:
|
||||
var bindingObj: seq[(string, JsonNode)]
|
||||
for item in bindingArray:
|
||||
bindingObj.add((item{"key"}.getStr, item{"value"}))
|
||||
# Create a new card object with flattened structure
|
||||
jsCard = %*{
|
||||
"name": legacyCard{"name"},
|
||||
"url": legacyCard{"url"},
|
||||
"binding_values": %bindingObj
|
||||
}
|
||||
|
||||
result = parseTweet(js{"legacy"}, jsCard)
|
||||
result.id = js{"rest_id"}.getId
|
||||
result.user = parseGraphUser(js{"core"})
|
||||
|
||||
if result.replyId == 0:
|
||||
result.replyId = js{"reply_to_results", "rest_id"}.getId
|
||||
|
||||
with count, js{"views", "count"}:
|
||||
result.stats.views = count.getStr("0").parseInt
|
||||
|
||||
with noteTweet, js{"note_tweet", "note_tweet_results", "result"}:
|
||||
result.expandNoteTweetEntities(noteTweet)
|
||||
|
||||
parseMediaEntities(js, result)
|
||||
|
||||
if result.quote.isSome:
|
||||
result.quote = some(parseGraphTweet(js{"quoted_status_result", "result"}, isLegacy))
|
||||
result.quote = some(parseGraphTweet(js{"quoted_status_result", "result"}))
|
||||
|
||||
with quoted, js{"quotedPostResults", "result"}:
|
||||
result.quote = some(parseGraphTweet(quoted))
|
||||
|
||||
proc parseGraphThread(js: JsonNode): tuple[thread: Chain; self: bool] =
|
||||
for t in js{"content", "items"}:
|
||||
let entryId = t{"entryId"}.getStr
|
||||
for t in ? js{"content", "items"}:
|
||||
let entryId = t.getEntryId
|
||||
if "cursor-showmore" in entryId:
|
||||
let cursor = t{"item", "content", "value"}
|
||||
result.thread.cursor = cursor.getStr
|
||||
result.thread.hasMore = true
|
||||
elif "tweet" in entryId and "promoted" notin entryId:
|
||||
let
|
||||
isLegacy = t{"item"}.hasKey("itemContent")
|
||||
(contentKey, resultKey) = if isLegacy: ("itemContent", "tweet_results")
|
||||
else: ("content", "tweetResult")
|
||||
with tweet, t.getTweetResult("item"):
|
||||
result.thread.content.add parseGraphTweet(tweet)
|
||||
|
||||
with content, t{"item", contentKey}:
|
||||
result.thread.content.add parseGraphTweet(content{resultKey, "result"}, isLegacy)
|
||||
|
||||
if content{"tweetDisplayType"}.getStr == "SelfThread":
|
||||
let tweetDisplayType = select(
|
||||
t{"item", "content", "tweet_display_type"},
|
||||
t{"item", "itemContent", "tweetDisplayType"}
|
||||
)
|
||||
if tweetDisplayType.getStr == "SelfThread":
|
||||
result.self = true
|
||||
|
||||
proc parseGraphTweetResult*(js: JsonNode): Tweet =
|
||||
with tweet, js{"data", "tweet_result", "result"}:
|
||||
result = parseGraphTweet(tweet, false)
|
||||
result = parseGraphTweet(tweet)
|
||||
|
||||
proc parseGraphConversation*(js: JsonNode; tweetId: string): Conversation =
|
||||
result = Conversation(replies: Result[Chain](beginning: true))
|
||||
let
|
||||
v2 = js{"data", "timeline_response"}.notNull
|
||||
rootKey = if v2: "timeline_response" else: "threaded_conversation_with_injections_v2"
|
||||
contentKey = if v2: "content" else: "itemContent"
|
||||
resultKey = if v2: "tweetResult" else: "tweet_results"
|
||||
|
||||
let instructions = ? js{"data", rootKey, "instructions"}
|
||||
let instructions = ? select(
|
||||
js{"data", "timelineResponse", "instructions"},
|
||||
js{"data", "timeline_response", "instructions"},
|
||||
js{"data", "threaded_conversation_with_injections_v2", "instructions"}
|
||||
)
|
||||
if instructions.len == 0:
|
||||
return
|
||||
|
||||
for i in instructions:
|
||||
let instrType = i{"type"}.getStr(i{"__typename"}.getStr)
|
||||
if instrType == "TimelineAddEntries":
|
||||
if i.getTypeName == "TimelineAddEntries":
|
||||
for e in i{"entries"}:
|
||||
let entryId = e{"entryId"}.getStr
|
||||
let entryId = e.getEntryId
|
||||
if entryId.startsWith("tweet"):
|
||||
with tweetResult, e{"content", contentKey, resultKey, "result"}:
|
||||
let tweet = parseGraphTweet(tweetResult, not v2)
|
||||
let tweetResult = getTweetResult(e)
|
||||
if tweetResult.notNull:
|
||||
let tweet = parseGraphTweet(tweetResult)
|
||||
|
||||
if not tweet.available:
|
||||
tweet.id = parseBiggestInt(entryId.getId())
|
||||
tweet.id = entryId.getId
|
||||
|
||||
if $tweet.id == tweetId:
|
||||
result.tweet = tweet
|
||||
@@ -407,67 +473,65 @@ proc parseGraphConversation*(js: JsonNode; tweetId: string): Conversation =
|
||||
elif thread.content.len > 0:
|
||||
result.replies.content.add thread
|
||||
elif entryId.startsWith("tombstone"):
|
||||
let id = entryId.getId()
|
||||
let tweet = Tweet(
|
||||
id: parseBiggestInt(id),
|
||||
let
|
||||
content = select(e{"content", "content"}, e{"content", "itemContent"})
|
||||
tweet = Tweet(
|
||||
id: entryId.getId,
|
||||
available: false,
|
||||
text: e{"content", contentKey, "tombstoneInfo", "richText"}.getTombstone
|
||||
text: content{"tombstoneInfo", "richText"}.getTombstone
|
||||
)
|
||||
|
||||
if id == tweetId:
|
||||
if $tweet.id == tweetId:
|
||||
result.tweet = tweet
|
||||
else:
|
||||
result.before.content.add tweet
|
||||
elif entryId.startsWith("cursor-bottom"):
|
||||
result.replies.bottom = e{"content", contentKey, "value"}.getStr
|
||||
var cursorValue = select(
|
||||
e{"content", "value"},
|
||||
e{"content", "content", "value"},
|
||||
e{"content", "itemContent", "value"}
|
||||
)
|
||||
result.replies.bottom = cursorValue.getStr
|
||||
|
||||
proc extractTweetsFromEntry*(e: JsonNode): seq[Tweet] =
|
||||
var tweetResult = e{"content", "itemContent", "tweet_results", "result"}
|
||||
if tweetResult.isNull:
|
||||
tweetResult = e{"content", "content", "tweetResult", "result"}
|
||||
|
||||
if tweetResult.notNull:
|
||||
var tweet = parseGraphTweet(tweetResult, false)
|
||||
with tweetResult, getTweetResult(e):
|
||||
var tweet = parseGraphTweet(tweetResult)
|
||||
if not tweet.available:
|
||||
tweet.id = parseBiggestInt(e.getEntryId())
|
||||
tweet.id = e.getEntryId.getId
|
||||
result.add tweet
|
||||
return
|
||||
|
||||
for item in e{"content", "items"}:
|
||||
with tweetResult, item{"item", "itemContent", "tweet_results", "result"}:
|
||||
var tweet = parseGraphTweet(tweetResult, false)
|
||||
with tweetResult, item.getTweetResult("item"):
|
||||
var tweet = parseGraphTweet(tweetResult)
|
||||
if not tweet.available:
|
||||
tweet.id = parseBiggestInt(item{"entryId"}.getStr.getId())
|
||||
tweet.id = item.getEntryId.getId
|
||||
result.add tweet
|
||||
|
||||
proc parseGraphTimeline*(js: JsonNode; after=""): Profile =
|
||||
result = Profile(tweets: Timeline(beginning: after.len == 0))
|
||||
|
||||
let instructions =
|
||||
if js{"data", "list"}.notNull:
|
||||
? js{"data", "list", "timeline_response", "timeline", "instructions"}
|
||||
elif js{"data", "user"}.notNull:
|
||||
? js{"data", "user", "result", "timeline", "timeline", "instructions"}
|
||||
else:
|
||||
? js{"data", "user_result", "result", "timeline_response", "timeline", "instructions"}
|
||||
|
||||
let instructions = ? select(
|
||||
js{"data", "list", "timeline_response", "timeline", "instructions"},
|
||||
js{"data", "user", "result", "timeline", "timeline", "instructions"},
|
||||
js{"data", "user_result", "result", "timeline_response", "timeline", "instructions"}
|
||||
)
|
||||
if instructions.len == 0:
|
||||
return
|
||||
|
||||
for i in instructions:
|
||||
# TimelineAddToModule instruction is used by UserMedia
|
||||
if i{"moduleItems"}.notNull:
|
||||
for item in i{"moduleItems"}:
|
||||
with tweetResult, item{"item", "itemContent", "tweet_results", "result"}:
|
||||
let tweet = parseGraphTweet(tweetResult, false)
|
||||
with tweetResult, item.getTweetResult("item"):
|
||||
let tweet = parseGraphTweet(tweetResult)
|
||||
if not tweet.available:
|
||||
tweet.id = parseBiggestInt(item{"entryId"}.getStr.getId())
|
||||
tweet.id = item.getEntryId.getId
|
||||
result.tweets.content.add tweet
|
||||
continue
|
||||
|
||||
if i{"entries"}.notNull:
|
||||
for e in i{"entries"}:
|
||||
let entryId = e{"entryId"}.getStr
|
||||
let entryId = e.getEntryId
|
||||
if entryId.startsWith("tweet") or entryId.startsWith("profile-grid"):
|
||||
for tweet in extractTweetsFromEntry(e):
|
||||
result.tweets.content.add tweet
|
||||
@@ -478,8 +542,7 @@ proc parseGraphTimeline*(js: JsonNode; after=""): Profile =
|
||||
result.tweets.bottom = e{"content", "value"}.getStr
|
||||
|
||||
if after.len == 0:
|
||||
let instrType = i{"type"}.getStr(i{"__typename"}.getStr)
|
||||
if instrType == "TimelinePinEntry":
|
||||
if i.getTypeName == "TimelinePinEntry":
|
||||
let tweets = extractTweetsFromEntry(i{"entry"})
|
||||
if tweets.len > 0:
|
||||
var tweet = tweets[0]
|
||||
@@ -489,23 +552,20 @@ proc parseGraphTimeline*(js: JsonNode; after=""): Profile =
|
||||
proc parseGraphPhotoRail*(js: JsonNode): PhotoRail =
|
||||
result = @[]
|
||||
|
||||
let instructions =
|
||||
if js{"data", "user"}.notNull:
|
||||
? js{"data", "user", "result", "timeline", "timeline", "instructions"}
|
||||
else:
|
||||
? js{"data", "user_result", "result", "timeline_response", "timeline", "instructions"}
|
||||
|
||||
let instructions = select(
|
||||
js{"data", "user", "result", "timeline", "timeline", "instructions"},
|
||||
js{"data", "user_result", "result", "timeline_response", "timeline", "instructions"}
|
||||
)
|
||||
if instructions.len == 0:
|
||||
return
|
||||
|
||||
for i in instructions:
|
||||
# TimelineAddToModule instruction is used by MediaTimelineV2
|
||||
if i{"moduleItems"}.notNull:
|
||||
for item in i{"moduleItems"}:
|
||||
with tweetResult, item{"item", "itemContent", "tweet_results", "result"}:
|
||||
let t = parseGraphTweet(tweetResult, false)
|
||||
with tweetResult, item.getTweetResult("item"):
|
||||
let t = parseGraphTweet(tweetResult)
|
||||
if not t.available:
|
||||
t.id = parseBiggestInt(item{"entryId"}.getStr.getId())
|
||||
t.id = item.getEntryId.getId
|
||||
|
||||
let photo = extractGalleryPhoto(t)
|
||||
if photo.url.len > 0:
|
||||
@@ -515,12 +575,11 @@ proc parseGraphPhotoRail*(js: JsonNode): PhotoRail =
|
||||
return
|
||||
continue
|
||||
|
||||
let instrType = i{"type"}.getStr(i{"__typename"}.getStr)
|
||||
if instrType != "TimelineAddEntries":
|
||||
if i.getTypeName != "TimelineAddEntries":
|
||||
continue
|
||||
|
||||
for e in i{"entries"}:
|
||||
let entryId = e{"entryId"}.getStr
|
||||
let entryId = e.getEntryId
|
||||
if entryId.startsWith("tweet") or entryId.startsWith("profile-grid"):
|
||||
for t in extractTweetsFromEntry(e):
|
||||
let photo = extractGalleryPhoto(t)
|
||||
@@ -533,21 +592,24 @@ proc parseGraphPhotoRail*(js: JsonNode): PhotoRail =
|
||||
proc parseGraphSearch*[T: User | Tweets](js: JsonNode; after=""): Result[T] =
|
||||
result = Result[T](beginning: after.len == 0)
|
||||
|
||||
let instructions = js{"data", "search_by_raw_query", "search_timeline", "timeline", "instructions"}
|
||||
let instructions = select(
|
||||
js{"data", "search", "timeline_response", "timeline", "instructions"},
|
||||
js{"data", "search_by_raw_query", "search_timeline", "timeline", "instructions"}
|
||||
)
|
||||
if instructions.len == 0:
|
||||
return
|
||||
|
||||
for instruction in instructions:
|
||||
let typ = instruction{"type"}.getStr
|
||||
let typ = getTypeName(instruction)
|
||||
if typ == "TimelineAddEntries":
|
||||
for e in instruction{"entries"}:
|
||||
let entryId = e{"entryId"}.getStr
|
||||
let entryId = e.getEntryId
|
||||
when T is Tweets:
|
||||
if entryId.startsWith("tweet"):
|
||||
with tweetRes, e{"content", "itemContent", "tweet_results", "result"}:
|
||||
with tweetRes, getTweetResult(e):
|
||||
let tweet = parseGraphTweet(tweetRes)
|
||||
if not tweet.available:
|
||||
tweet.id = parseBiggestInt(entryId.getId())
|
||||
tweet.id = entryId.getId
|
||||
result.content.add tweet
|
||||
elif T is User:
|
||||
if entryId.startsWith("user"):
|
||||
|
||||
@@ -36,6 +36,12 @@ template `?`*(js: JsonNode): untyped =
|
||||
if j.isNull: return
|
||||
j
|
||||
|
||||
template select*(a, b: JsonNode): untyped =
|
||||
if a.notNull: a else: b
|
||||
|
||||
template select*(a, b, c: JsonNode): untyped =
|
||||
if a.notNull: a elif b.notNull: b else: c
|
||||
|
||||
template with*(ident, value, body): untyped =
|
||||
if true:
|
||||
let ident {.inject.} = value
|
||||
@@ -44,8 +50,7 @@ template with*(ident, value, body): untyped =
|
||||
template with*(ident; value: JsonNode; body): untyped =
|
||||
if true:
|
||||
let ident {.inject.} = value
|
||||
# value.notNull causes a compilation error for versions < 1.6.14
|
||||
if notNull(value): body
|
||||
if value.notNull: body
|
||||
|
||||
template getCursor*(js: JsonNode): string =
|
||||
js{"content", "operation", "cursor", "value"}.getStr
|
||||
@@ -54,6 +59,20 @@ template getError*(js: JsonNode): Error =
|
||||
if js.kind != JArray or js.len == 0: null
|
||||
else: Error(js[0]{"code"}.getInt)
|
||||
|
||||
proc getTweetResult*(js: JsonNode; root="content"): JsonNode =
|
||||
select(
|
||||
js{root, "content", "tweet_results", "result"},
|
||||
js{root, "itemContent", "tweet_results", "result"},
|
||||
js{root, "content", "tweetResult", "result"}
|
||||
)
|
||||
|
||||
template getTypeName*(js: JsonNode): string =
|
||||
js{"__typename"}.getStr(js{"type"}.getStr)
|
||||
|
||||
template getEntryId*(e: JsonNode): string =
|
||||
e{"entryId"}.getStr(e{"entry_id"}.getStr)
|
||||
|
||||
|
||||
template parseTime(time: string; f: static string; flen: int): DateTime =
|
||||
if time.len != flen: return
|
||||
parse(time, f, utc())
|
||||
@@ -64,29 +83,24 @@ proc getDateTime*(js: JsonNode): DateTime =
|
||||
proc getTime*(js: JsonNode): DateTime =
|
||||
parseTime(js.getStr, "ddd MMM dd hh:mm:ss \'+0000\' yyyy", 30)
|
||||
|
||||
proc getId*(id: string): string {.inline.} =
|
||||
proc getTimeFromMs*(js: JsonNode): DateTime =
|
||||
let ms = js.getInt(0)
|
||||
if ms == 0: return
|
||||
let seconds = ms div 1000
|
||||
return fromUnix(seconds).utc()
|
||||
|
||||
proc getId*(id: string): int64 {.inline.} =
|
||||
let start = id.rfind("-")
|
||||
if start < 0: return id
|
||||
id[start + 1 ..< id.len]
|
||||
if start < 0:
|
||||
return parseBiggestInt(id)
|
||||
return parseBiggestInt(id[start + 1 ..< id.len])
|
||||
|
||||
proc getId*(js: JsonNode): int64 {.inline.} =
|
||||
case js.kind
|
||||
of JString: return parseBiggestInt(js.getStr("0"))
|
||||
of JString: return js.getStr("0").getId
|
||||
of JInt: return js.getBiggestInt()
|
||||
else: return 0
|
||||
|
||||
proc getEntryId*(js: JsonNode): string {.inline.} =
|
||||
let entry = js{"entryId"}.getStr
|
||||
if entry.len == 0: return
|
||||
|
||||
if "tweet" in entry or "sq-I-t" in entry:
|
||||
return entry.getId
|
||||
elif "tombstone" in entry:
|
||||
return js{"content", "item", "content", "tombstone", "tweet", "id"}.getStr
|
||||
else:
|
||||
echo "unknown entry: ", entry
|
||||
return
|
||||
|
||||
template getStrVal*(js: JsonNode; default=""): string =
|
||||
js{"string_value"}.getStr(default)
|
||||
|
||||
@@ -98,6 +112,9 @@ proc getImageStr*(js: JsonNode): string =
|
||||
template getImageVal*(js: JsonNode): string =
|
||||
js{"image_value", "url"}.getImageStr
|
||||
|
||||
template getExpandedUrl*(js: JsonNode; fallback=""): string =
|
||||
js{"expanded_url"}.getStr(js{"url"}.getStr(fallback))
|
||||
|
||||
proc getCardUrl*(js: JsonNode; kind: CardKind): string =
|
||||
result = js{"website_url"}.getStrVal
|
||||
if kind == promoVideoConvo:
|
||||
@@ -157,19 +174,13 @@ proc getMp4Resolution*(url: string): int =
|
||||
# cannot determine resolution (e.g. m3u8/non-mp4 video)
|
||||
return 0
|
||||
|
||||
proc getVideoViewCount*(js: JsonNode): string =
|
||||
with stats, js{"ext_media_stats"}:
|
||||
return stats{"view_count"}.getStr($stats{"viewCount"}.getInt)
|
||||
|
||||
return $js{"mediaStats", "viewCount"}.getInt(0)
|
||||
|
||||
proc extractSlice(js: JsonNode): Slice[int] =
|
||||
result = js["indices"][0].getInt ..< js["indices"][1].getInt
|
||||
|
||||
proc extractUrls(result: var seq[ReplaceSlice]; js: JsonNode;
|
||||
textLen: int; hideTwitter = false) =
|
||||
let
|
||||
url = js["expanded_url"].getStr
|
||||
url = js.getExpandedUrl
|
||||
slice = js.extractSlice
|
||||
|
||||
if hideTwitter and slice.b.succ >= textLen and url.isTwitterUrl:
|
||||
@@ -230,7 +241,7 @@ proc expandUserEntities*(user: var User; js: JsonNode) =
|
||||
ent = ? js{"entities"}
|
||||
|
||||
with urls, ent{"url", "urls"}:
|
||||
user.website = urls[0]{"expanded_url"}.getStr
|
||||
user.website = urls[0].getExpandedUrl
|
||||
|
||||
var replacements = newSeq[ReplaceSlice]()
|
||||
|
||||
@@ -260,7 +271,7 @@ proc expandTextEntities(tweet: Tweet; entities: JsonNode; text: string; textSlic
|
||||
replacements.extractUrls(u, textSlice.b, hideTwitter = hasRedundantLink)
|
||||
|
||||
if hasCard and u{"url"}.getStr == get(tweet.card).url:
|
||||
get(tweet.card).url = u{"expanded_url"}.getStr
|
||||
get(tweet.card).url = u.getExpandedUrl
|
||||
|
||||
with media, entities{"media"}:
|
||||
for m in media:
|
||||
|
||||
@@ -1,5 +1,5 @@
|
||||
# SPDX-License-Identifier: AGPL-3.0-only
|
||||
import tables
|
||||
import tables, strutils, sequtils
|
||||
import types, prefs_impl
|
||||
from config import get
|
||||
from parsecfg import nil
|
||||
@@ -13,6 +13,8 @@ proc updateDefaultPrefs*(cfg: parsecfg.Config) =
|
||||
|
||||
proc getPrefs*(cookies: Table[string, string]): Prefs =
|
||||
result = defaultPrefs
|
||||
if "nitter_following" in cookies:
|
||||
result.following = cookies["nitter_following"].split(',').filterIt(it.len > 0)
|
||||
genCookiePrefs(cookies)
|
||||
|
||||
template getPref*(cookies: Table[string, string], pref): untyped =
|
||||
|
||||
@@ -54,6 +54,10 @@ genPrefs:
|
||||
theme(select, "Nitter"):
|
||||
"Theme"
|
||||
|
||||
verifiedBadge(select, "Show all"):
|
||||
"Verified badges"
|
||||
options: @["Show all", "Show official only", "Hide all"]
|
||||
|
||||
infiniteScroll(checkbox, false):
|
||||
"Infinite scrolling (experimental, requires JavaScript)"
|
||||
|
||||
@@ -78,6 +82,9 @@ genPrefs:
|
||||
squareAvatars(checkbox, false):
|
||||
"Square profile pictures"
|
||||
|
||||
hideNsfw(checkbox, true):
|
||||
"Hide NSFW content"
|
||||
|
||||
Media:
|
||||
mp4Playback(checkbox, true):
|
||||
"Enable mp4 video playback (only for gifs)"
|
||||
@@ -107,6 +114,18 @@ genPrefs:
|
||||
"Reddit -> Teddit/Libreddit"
|
||||
placeholder: "Teddit hostname"
|
||||
|
||||
replaceImgur(input, ""):
|
||||
"Imgur -> Rimgo"
|
||||
placeholder: "Rimgo hostname"
|
||||
|
||||
replaceFandom(input, ""):
|
||||
"Fandom -> Phantom"
|
||||
placeholder: "Phantom hostname"
|
||||
|
||||
replaceSoundCloud(input, ""):
|
||||
"SoundCloud -> SoundCloak"
|
||||
placeholder: "SoundCloak hostname"
|
||||
|
||||
iterator allPrefs*(): Pref =
|
||||
for k, v in prefList:
|
||||
for pref in v:
|
||||
@@ -206,6 +225,7 @@ macro genPrefsType*(): untyped =
|
||||
let name = nnkPostfix.newTree(ident("*"), ident("Prefs"))
|
||||
result = quote do:
|
||||
type `name` = object
|
||||
following*: seq[string]
|
||||
discard
|
||||
|
||||
for pref in allPrefs():
|
||||
|
||||
@@ -6,10 +6,9 @@ import types
|
||||
const
|
||||
validFilters* = @[
|
||||
"media", "images", "twimg", "videos",
|
||||
"native_video", "consumer_video", "pro_video",
|
||||
"native_video", "consumer_video", "spaces",
|
||||
"links", "news", "quote", "mentions",
|
||||
"replies", "retweets", "nativeretweets",
|
||||
"verified", "safe"
|
||||
"replies", "retweets", "nativeretweets"
|
||||
]
|
||||
|
||||
emptyQuery* = "include:nativeretweets"
|
||||
@@ -18,6 +17,11 @@ template `@`(param: string): untyped =
|
||||
if param in pms: pms[param]
|
||||
else: ""
|
||||
|
||||
proc validateNumber(value: string): string =
|
||||
if value.anyIt(not it.isDigit):
|
||||
return ""
|
||||
return value
|
||||
|
||||
proc initQuery*(pms: Table[string, string]; name=""): Query =
|
||||
result = Query(
|
||||
kind: parseEnum[QueryKind](@"f", tweets),
|
||||
@@ -26,7 +30,8 @@ proc initQuery*(pms: Table[string, string]; name=""): Query =
|
||||
excludes: validFilters.filterIt("e-" & it in pms),
|
||||
since: @"since",
|
||||
until: @"until",
|
||||
near: @"near"
|
||||
near: @"near",
|
||||
minLikes: validateNumber(@"min_faves")
|
||||
)
|
||||
|
||||
if name.len > 0:
|
||||
@@ -59,7 +64,10 @@ proc genQueryParam*(query: Query): string =
|
||||
if i < query.fromUser.high:
|
||||
param &= "OR "
|
||||
|
||||
if query.fromUser.len > 0 and query.kind in {posts, media}:
|
||||
if query.fromUser.len > 0:
|
||||
if query.kind in {posts, media}:
|
||||
param &= "filter:self_threads OR -filter:replies "
|
||||
elif query.kind == tweets and query.fromUser.len > 1:
|
||||
param &= "filter:self_threads OR -filter:replies "
|
||||
|
||||
if "nativeretweets" notin query.excludes:
|
||||
@@ -79,7 +87,9 @@ proc genQueryParam*(query: Query): string =
|
||||
if query.until.len > 0:
|
||||
result &= " until:" & query.until
|
||||
if query.near.len > 0:
|
||||
result &= &" near:\"{query.near}\" within:15mi"
|
||||
result &= " near:\"" & query.near & "\""
|
||||
if query.minLikes.len > 0:
|
||||
result &= " min_faves:" & query.minLikes
|
||||
if query.text.len > 0:
|
||||
if result.len > 0:
|
||||
result &= " " & query.text
|
||||
@@ -105,6 +115,8 @@ proc genQueryUrl*(query: Query): string =
|
||||
params.add "until=" & query.until
|
||||
if query.near.len > 0:
|
||||
params.add "near=" & query.near
|
||||
if query.minLikes.len > 0:
|
||||
params.add "min_faves=" & query.minLikes
|
||||
|
||||
if params.len > 0:
|
||||
result &= params.join("&")
|
||||
|
||||
@@ -1,5 +1,5 @@
|
||||
# SPDX-License-Identifier: AGPL-3.0-only
|
||||
import asyncdispatch, times, strformat, strutils, tables, hashes
|
||||
import asyncdispatch, times, strformat, strutils, tables, hashes, logging
|
||||
import redis, redpool, flatty, supersnappy
|
||||
|
||||
import types, api
|
||||
@@ -59,8 +59,7 @@ proc initRedisPool*(cfg: Config) {.async.} =
|
||||
await r.configSet("hash-max-ziplist-entries", "1000")
|
||||
|
||||
except OSError:
|
||||
stdout.write "Failed to connect to Redis.\n"
|
||||
stdout.flushFile
|
||||
fatal "Failed to connect to Redis."
|
||||
quit(1)
|
||||
|
||||
template uidKey(name: string): string = "pid:" & $(hash(name) div 1_000_000)
|
||||
@@ -112,7 +111,7 @@ template deserialize(data, T) =
|
||||
try:
|
||||
result = fromFlatty(uncompress(data), T)
|
||||
except:
|
||||
echo "Decompression failed($#): '$#'" % [astToStr(T), data]
|
||||
error "Decompression failed($#): '$#'" % [astToStr(T), data]
|
||||
|
||||
proc getUserId*(username: string): Future[string] {.async.} =
|
||||
let name = toLower(username)
|
||||
@@ -189,6 +188,6 @@ proc getCachedRss*(key: string): Future[Rss] {.async.} =
|
||||
let feed = await r.hGet(k, "rss")
|
||||
if feed.len > 0 and feed != redisNil:
|
||||
try: result.feed = uncompress feed
|
||||
except: echo "Decompressing RSS failed: ", feed
|
||||
except: error "Decompressing RSS failed: ", feed
|
||||
else:
|
||||
result.cursor.setLen 0
|
||||
|
||||
23
src/routes/follow.nim
Normal file
23
src/routes/follow.nim
Normal file
@@ -0,0 +1,23 @@
|
||||
# SPDX-License-Identifier: AGPL-3.0-only
|
||||
import strutils, sequtils
|
||||
import jester
|
||||
import router_utils
|
||||
import ".."/[types]
|
||||
|
||||
proc createFollowRouter*(cfg: Config) =
|
||||
router follow:
|
||||
post "/follow":
|
||||
let user = @"user"
|
||||
var prefs = cookiePrefs()
|
||||
if user.len > 0 and user notin prefs.following:
|
||||
prefs.following.add(user)
|
||||
setCookie("nitter_following", prefs.following.join(","), daysForward(360), path="/", httpOnly=true, secure=cfg.useHttps, sameSite=None)
|
||||
redirect(refPath())
|
||||
|
||||
post "/unfollow":
|
||||
let user = @"user"
|
||||
var prefs = cookiePrefs()
|
||||
if user.len > 0 and user in prefs.following:
|
||||
prefs.following.keepItIf(it != user)
|
||||
setCookie("nitter_following", prefs.following.join(","), daysForward(360), path="/", httpOnly=true, secure=cfg.useHttps, sameSite=None)
|
||||
redirect(refPath())
|
||||
@@ -1,5 +1,5 @@
|
||||
# SPDX-License-Identifier: AGPL-3.0-only
|
||||
import uri, strutils, httpclient, os, hashes, base64, re
|
||||
import uri, strutils, httpclient, os, hashes, base64, re, logging
|
||||
import asynchttpserver, asyncstreams, asyncfile, asyncnet
|
||||
|
||||
import jester
|
||||
@@ -38,7 +38,7 @@ proc proxyMedia*(req: jester.Request; url: string): Future[HttpCode] {.async.} =
|
||||
let res = await client.get(url)
|
||||
if res.status != "200 OK":
|
||||
if res.status != "404 Not Found":
|
||||
echo "[media] Proxying failed, status: $1, url: $2" % [res.status, url]
|
||||
warn "[media] Proxying failed, status: $1, url: $2" % [res.status, url]
|
||||
return Http404
|
||||
|
||||
let hashed = $hash(url)
|
||||
@@ -67,7 +67,7 @@ proc proxyMedia*(req: jester.Request; url: string): Future[HttpCode] {.async.} =
|
||||
await request.client.send(data)
|
||||
data.setLen 0
|
||||
except HttpRequestError, ProtocolError, OSError:
|
||||
echo "[media] Proxying exception, error: $1, url: $2" % [getCurrentExceptionMsg(), url]
|
||||
error "[media] Proxying exception, error: $1, url: $2" % [getCurrentExceptionMsg(), url]
|
||||
result = Http404
|
||||
finally:
|
||||
client.close()
|
||||
|
||||
@@ -32,7 +32,7 @@ proc createSearchRouter*(cfg: Config) =
|
||||
users = await getGraphUserSearch(query, getCursor())
|
||||
except InternalError:
|
||||
users = Result[User](beginning: true, query: query)
|
||||
resp renderMain(renderUserSearch(users, prefs), request, cfg, prefs, title)
|
||||
resp renderMain(renderUserSearch(users, prefs, getPath()), request, cfg, prefs, title)
|
||||
of tweets:
|
||||
let
|
||||
tweets = await getGraphTweetSearch(query, getCursor())
|
||||
|
||||
@@ -31,8 +31,6 @@ proc createStatusRouter*(cfg: Config) =
|
||||
resp $renderReplies(replies, prefs, getPath())
|
||||
|
||||
let conv = await getTweet(id, getCursor())
|
||||
if conv == nil:
|
||||
echo "nil conv"
|
||||
|
||||
if conv == nil or conv.tweet == nil or conv.tweet.id == 0:
|
||||
var error = "Tweet not found"
|
||||
@@ -68,7 +66,7 @@ proc createStatusRouter*(cfg: Config) =
|
||||
|
||||
get "/@name/@s/@id/@m/?@i?":
|
||||
cond @"s" in ["status", "statuses"]
|
||||
cond @"m" in ["video", "photo"]
|
||||
cond @"m" in ["video", "photo", "history"]
|
||||
redirect("/$1/status/$2" % [@"name", @"id"])
|
||||
|
||||
get "/@name/statuses/@id/?":
|
||||
|
||||
@@ -105,6 +105,12 @@ proc createTimelineRouter*(cfg: Config) =
|
||||
get "/intent/user":
|
||||
respUserId()
|
||||
|
||||
get "/intent/follow/?":
|
||||
let username = request.params.getOrDefault("screen_name")
|
||||
if username.len == 0:
|
||||
resp Http400, showError("Missing screen_name parameter", cfg)
|
||||
redirect("/" & username)
|
||||
|
||||
get "/@name/?@tab?/?":
|
||||
cond '.' notin @"name"
|
||||
cond @"name" notin ["pic", "gif", "video", "search", "settings", "login", "intent", "i"]
|
||||
|
||||
@@ -17,7 +17,7 @@ proc createUnsupportedRouter*(cfg: Config) =
|
||||
get "/@name/lists/?": feature()
|
||||
|
||||
get "/intent/?@i?":
|
||||
cond @"i" notin ["user"]
|
||||
cond @"i" notin ["user", "follow"]
|
||||
feature()
|
||||
|
||||
get "/i/@i?/?@j?":
|
||||
|
||||
@@ -37,3 +37,52 @@
|
||||
height: unset;
|
||||
}
|
||||
}
|
||||
|
||||
.follow-form {
|
||||
display: inline-block;
|
||||
pointer-events: all;
|
||||
}
|
||||
|
||||
.follow-button {
|
||||
background-color: transparent;
|
||||
color: var(--accent);
|
||||
border: 1px solid var(--accent);
|
||||
border-radius: 9999px;
|
||||
padding: 4px 12px;
|
||||
font-weight: 700;
|
||||
font-size: 14px;
|
||||
cursor: pointer;
|
||||
line-height: 1.2;
|
||||
transition: background-color 0.2s;
|
||||
outline: none;
|
||||
|
||||
&:hover {
|
||||
background-color: var(--bg_hover);
|
||||
}
|
||||
|
||||
&.unfollow {
|
||||
color: #e0245e;
|
||||
border-color: #e0245e;
|
||||
|
||||
&:hover {
|
||||
background-color: rgba(224, 36, 94, 0.1);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
.profile-header {
|
||||
display: flex;
|
||||
justify-content: space-between;
|
||||
align-items: flex-start;
|
||||
flex: 1;
|
||||
min-width: 0;
|
||||
}
|
||||
|
||||
.tweet-name-row .follow-form {
|
||||
margin-left: 10px;
|
||||
}
|
||||
|
||||
.tweet-name-row .follow-button {
|
||||
padding: 2px 10px;
|
||||
font-size: 13px;
|
||||
}
|
||||
|
||||
53
src/sass/homepage.scss
Normal file
53
src/sass/homepage.scss
Normal file
@@ -0,0 +1,53 @@
|
||||
@import '_variables';
|
||||
@import '_mixins';
|
||||
|
||||
.homepage-container {
|
||||
display: flex;
|
||||
gap: 5px;
|
||||
max-width: 1200px;
|
||||
margin: 0 auto;
|
||||
justify-content: center;
|
||||
}
|
||||
|
||||
.following-column,
|
||||
.timeline-users-column {
|
||||
width: 280px;
|
||||
flex-shrink: 0;
|
||||
}
|
||||
|
||||
.timeline-users-column {
|
||||
.timeline-item {
|
||||
flex-direction: column;
|
||||
|
||||
}
|
||||
}
|
||||
|
||||
.profile-cards {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 5px;
|
||||
}
|
||||
|
||||
.timeline-users-column > :first-child,
|
||||
.homepage-container .timeline-container > .timeline > :first-child {
|
||||
margin-top: 0;
|
||||
}
|
||||
|
||||
@media (max-width: 1200px) {
|
||||
.homepage-container {
|
||||
max-width: 100%;
|
||||
padding: 0 10px;
|
||||
}
|
||||
}
|
||||
|
||||
@media (max-width: 1100px) {
|
||||
.following-column {
|
||||
display: none;
|
||||
}
|
||||
}
|
||||
|
||||
@media (max-width: 800px) {
|
||||
.timeline-users-column {
|
||||
display: none;
|
||||
}
|
||||
}
|
||||
@@ -61,23 +61,8 @@
|
||||
|
||||
@mixin search-resize($width, $rows) {
|
||||
@media(max-width: $width) {
|
||||
.search-toggles {
|
||||
grid-template-columns: repeat($rows, auto);
|
||||
}
|
||||
|
||||
#search-panel-toggle:checked ~ .search-panel {
|
||||
@if $rows == 6 {
|
||||
max-height: 200px !important;
|
||||
}
|
||||
@if $rows == 5 {
|
||||
max-height: 300px !important;
|
||||
}
|
||||
@if $rows == 4 {
|
||||
max-height: 300px !important;
|
||||
}
|
||||
@if $rows == 3 {
|
||||
max-height: 365px !important;
|
||||
}
|
||||
max-height: 80vh !important;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -7,6 +7,7 @@
|
||||
@import 'inputs';
|
||||
@import 'timeline';
|
||||
@import 'search';
|
||||
@import 'homepage';
|
||||
|
||||
body {
|
||||
// colors
|
||||
@@ -51,7 +52,7 @@ body {
|
||||
background-color: var(--bg_color);
|
||||
color: var(--fg_color);
|
||||
font-family: $font_stack;
|
||||
font-size: 14px;
|
||||
font-size: 15px;
|
||||
line-height: 1.3;
|
||||
margin: 0;
|
||||
}
|
||||
@@ -127,7 +128,6 @@ ul {
|
||||
max-width: 600px;
|
||||
width: 100%;
|
||||
margin: 0 auto;
|
||||
margin-top: 10px;
|
||||
background-color: var(--bg_overlays);
|
||||
padding: 10px 15px;
|
||||
align-self: start;
|
||||
@@ -169,6 +169,14 @@ ul {
|
||||
}
|
||||
}
|
||||
|
||||
body.hide-verified-all .verified-icon {
|
||||
display: none !important;
|
||||
}
|
||||
|
||||
body.hide-verified-blue .verified-icon.blue {
|
||||
display: none !important;
|
||||
}
|
||||
|
||||
@media(max-width: 600px) {
|
||||
.preferences-container {
|
||||
max-width: 95vw;
|
||||
|
||||
@@ -14,6 +14,7 @@ button {
|
||||
|
||||
input[type="text"],
|
||||
input[type="date"],
|
||||
input[type="number"],
|
||||
select {
|
||||
@include input-colors;
|
||||
background-color: var(--bg_elements);
|
||||
@@ -24,7 +25,12 @@ select {
|
||||
font-size: 14px;
|
||||
}
|
||||
|
||||
input[type="text"] {
|
||||
input[type="number"] {
|
||||
-moz-appearance: textfield;
|
||||
}
|
||||
|
||||
input[type="text"],
|
||||
input[type="number"] {
|
||||
height: 16px;
|
||||
}
|
||||
|
||||
@@ -38,6 +44,17 @@ input[type="date"]::-webkit-inner-spin-button {
|
||||
display: none;
|
||||
}
|
||||
|
||||
input[type="number"] {
|
||||
-moz-appearance: textfield;
|
||||
}
|
||||
|
||||
input[type="number"]::-webkit-inner-spin-button,
|
||||
input[type="number"]::-webkit-outer-spin-button {
|
||||
display: none;
|
||||
-webkit-appearance: none;
|
||||
margin: 0;
|
||||
}
|
||||
|
||||
input[type="date"]::-webkit-clear-button {
|
||||
margin-left: 17px;
|
||||
filter: grayscale(100%);
|
||||
@@ -162,9 +179,22 @@ input::-webkit-datetime-edit-year-field:focus {
|
||||
-moz-appearance: none;
|
||||
-webkit-appearance: none;
|
||||
appearance: none;
|
||||
padding-right: 18px;
|
||||
}
|
||||
|
||||
input[type="text"] {
|
||||
.pref-select:after {
|
||||
content: '\e80b'; /* icon-down */
|
||||
font-family: $font_icon;
|
||||
font-size: 10px;
|
||||
pointer-events: none;
|
||||
position: absolute;
|
||||
right: 4px;
|
||||
top: 5px;
|
||||
color: var(--fg_color);
|
||||
}
|
||||
|
||||
input[type="text"],
|
||||
input[type="number"] {
|
||||
position: absolute;
|
||||
right: 0;
|
||||
max-width: 140px;
|
||||
|
||||
@@ -25,6 +25,14 @@ nav {
|
||||
align-items: center;
|
||||
flex-basis: 920px;
|
||||
height: 50px;
|
||||
gap: 15px;
|
||||
}
|
||||
|
||||
.inner-nav .search-field {
|
||||
flex: 1;
|
||||
margin: 0 auto;
|
||||
max-width: 350px;
|
||||
min-width: 0;
|
||||
}
|
||||
|
||||
.site-name {
|
||||
@@ -46,11 +54,11 @@ nav {
|
||||
|
||||
.nav-item {
|
||||
display: flex;
|
||||
flex: 1;
|
||||
flex: 0 0 auto;
|
||||
line-height: 50px;
|
||||
height: 50px;
|
||||
overflow: hidden;
|
||||
flex-wrap: wrap;
|
||||
flex-wrap: nowrap;
|
||||
align-items: center;
|
||||
|
||||
&.right {
|
||||
|
||||
@@ -9,70 +9,111 @@
|
||||
|
||||
.search-field {
|
||||
display: flex;
|
||||
flex-wrap: wrap;
|
||||
flex-wrap: nowrap;
|
||||
position: relative;
|
||||
|
||||
button {
|
||||
margin: 0 2px 0 0;
|
||||
height: 23px;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
flex: 0 0 auto;
|
||||
}
|
||||
|
||||
.pref-input {
|
||||
margin: 0 4px 0 0;
|
||||
flex-grow: 1;
|
||||
height: 23px;
|
||||
min-width: 0;
|
||||
}
|
||||
|
||||
input[type="text"] {
|
||||
input[type="text"],
|
||||
input[type="number"] {
|
||||
height: calc(100% - 4px);
|
||||
width: calc(100% - 8px);
|
||||
}
|
||||
|
||||
> label {
|
||||
display: inline;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
height: 23px;
|
||||
background-color: var(--bg_elements);
|
||||
color: var(--fg_color);
|
||||
border: 1px solid var(--accent_border);
|
||||
padding: 1px 6px 2px 6px;
|
||||
padding: 0 6px;
|
||||
font-size: 14px;
|
||||
cursor: pointer;
|
||||
margin-bottom: 2px;
|
||||
margin-bottom: 0;
|
||||
box-sizing: border-box;
|
||||
|
||||
@include input-colors;
|
||||
}
|
||||
|
||||
@include create-toggle(search-panel, 200px);
|
||||
@include create-toggle(search-panel, 600px);
|
||||
}
|
||||
|
||||
.search-panel {
|
||||
width: 100%;
|
||||
margin-top: 5px;
|
||||
border: 1px solid var(--accent_border);
|
||||
max-height: 0;
|
||||
overflow: hidden;
|
||||
overflow-y: auto;
|
||||
overflow-x: hidden;
|
||||
transition: max-height 0.4s;
|
||||
|
||||
flex-grow: 1;
|
||||
position: absolute;
|
||||
top: 100%;
|
||||
left: 0;
|
||||
background-color: var(--bg_overlays);
|
||||
box-shadow: 0 4px 6px rgba(0,0,0,0.3);
|
||||
border-radius: 0 0 4px 4px;
|
||||
z-index: 2000;
|
||||
padding: 5px 10px;
|
||||
box-sizing: border-box;
|
||||
|
||||
opacity: 0;
|
||||
visibility: hidden;
|
||||
transition: max-height 0.4s, opacity 0.4s, visibility 0.4s;
|
||||
|
||||
font-weight: initial;
|
||||
text-align: left;
|
||||
font-size: 13px;
|
||||
|
||||
> div {
|
||||
line-height: 1.7em;
|
||||
line-height: 1.4em;
|
||||
margin-bottom: 4px;
|
||||
}
|
||||
|
||||
.checkbox-container {
|
||||
display: inline;
|
||||
display: inline-flex;
|
||||
align-items: center;
|
||||
padding-right: unset;
|
||||
margin-bottom: unset;
|
||||
margin-left: 23px;
|
||||
margin-bottom: 2px;
|
||||
margin-left: 18px;
|
||||
margin-right: 0;
|
||||
white-space: nowrap;
|
||||
}
|
||||
|
||||
.checkbox {
|
||||
right: unset;
|
||||
left: -22px;
|
||||
left: -18px;
|
||||
width: 15px;
|
||||
height: 15px;
|
||||
}
|
||||
|
||||
.checkbox-container .checkbox:after {
|
||||
top: -4px;
|
||||
top: 0;
|
||||
left: 1px;
|
||||
bottom: unset;
|
||||
font-size: 13px;
|
||||
width: auto;
|
||||
height: auto;
|
||||
}
|
||||
|
||||
.search-title {
|
||||
font-size: 13px;
|
||||
margin-top: 2px;
|
||||
margin-bottom: 2px;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -92,11 +133,11 @@
|
||||
|
||||
.pref-input {
|
||||
display: block;
|
||||
padding-bottom: 5px;
|
||||
padding-bottom: 2px;
|
||||
|
||||
input {
|
||||
height: 21px;
|
||||
margin-top: 1px;
|
||||
margin-top: 0;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -104,19 +145,36 @@
|
||||
.search-toggles {
|
||||
flex-grow: 1;
|
||||
display: grid;
|
||||
grid-template-columns: repeat(6, auto);
|
||||
grid-column-gap: 10px;
|
||||
grid-template-columns: repeat(auto-fill, minmax(110px, 1fr));
|
||||
gap: 5px 10px;
|
||||
}
|
||||
|
||||
#search-panel-toggle:checked ~ .search-panel {
|
||||
opacity: 1;
|
||||
visibility: visible;
|
||||
}
|
||||
|
||||
.profile-tabs {
|
||||
@include search-resize(820px, 5);
|
||||
@include search-resize(725px, 4);
|
||||
@include search-resize(600px, 6);
|
||||
@include search-resize(560px, 5);
|
||||
@include search-resize(480px, 4);
|
||||
@include search-resize(715px, 4);
|
||||
@include search-resize(700px, 5);
|
||||
@include search-resize(485px, 4);
|
||||
@include search-resize(410px, 3);
|
||||
}
|
||||
|
||||
@include search-resize(560px, 5);
|
||||
@include search-resize(480px, 4);
|
||||
@include search-resize(700px, 5);
|
||||
@include search-resize(485px, 4);
|
||||
@include search-resize(410px, 3);
|
||||
|
||||
@media(max-width: 600px) {
|
||||
.search-panel {
|
||||
position: fixed;
|
||||
top: 50px;
|
||||
left: 0;
|
||||
right: 0;
|
||||
width: 100%;
|
||||
border-radius: 0;
|
||||
border-top: 1px solid var(--accent_border);
|
||||
box-shadow: 0 4px 6px rgba(0,0,0,0.3);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -2,13 +2,14 @@
|
||||
|
||||
.timeline-container {
|
||||
@include panel(100%, 600px);
|
||||
background-color: transparent;
|
||||
}
|
||||
|
||||
.timeline {
|
||||
background-color: var(--bg_panel);
|
||||
background-color: transparent;
|
||||
|
||||
> div:not(:first-child) {
|
||||
border-top: 1px solid var(--border_grey);
|
||||
border-top: none;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -25,6 +26,25 @@
|
||||
button {
|
||||
float: unset;
|
||||
}
|
||||
|
||||
&.timeline-default {
|
||||
background-color: var(--bg_panel);
|
||||
border-bottom: 1px solid var(--bg_elements);
|
||||
margin-bottom: 5px;
|
||||
|
||||
.timeline-default-message {
|
||||
color: var(--fg_color);
|
||||
font-size: 16px;
|
||||
font-weight: normal;
|
||||
margin: 0;
|
||||
padding: 5px;
|
||||
|
||||
strong {
|
||||
font-weight: bold;
|
||||
color: var(--accent);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
.timeline-banner img {
|
||||
@@ -159,4 +179,6 @@
|
||||
padding: .75em;
|
||||
display: flex;
|
||||
position: relative;
|
||||
margin-top: 5px;
|
||||
background-color: var(--bg_panel);
|
||||
}
|
||||
|
||||
62
src/tid.nim
Normal file
62
src/tid.nim
Normal file
@@ -0,0 +1,62 @@
|
||||
import std/[asyncdispatch, base64, httpclient, random, strutils, sequtils, times]
|
||||
import nimcrypto
|
||||
import experimental/parser/tid
|
||||
|
||||
randomize()
|
||||
|
||||
const defaultKeyword = "obfiowerehiring";
|
||||
const pairsUrl =
|
||||
"https://raw.githubusercontent.com/fa0311/x-client-transaction-id-pair-dict/refs/heads/main/pair.json";
|
||||
|
||||
var
|
||||
cachedPairs: seq[TidPair] = @[]
|
||||
lastCached = 0
|
||||
# refresh every hour
|
||||
ttlSec = 60 * 60
|
||||
|
||||
proc getPair(): Future[TidPair] {.async.} =
|
||||
if cachedPairs.len == 0 or int(epochTime()) - lastCached > ttlSec:
|
||||
lastCached = int(epochTime())
|
||||
|
||||
let client = newAsyncHttpClient()
|
||||
defer: client.close()
|
||||
|
||||
let resp = await client.get(pairsUrl)
|
||||
if resp.status == $Http200:
|
||||
cachedPairs = parseTidPairs(await resp.body)
|
||||
|
||||
return sample(cachedPairs)
|
||||
|
||||
proc encodeSha256(text: string): array[32, byte] =
|
||||
let
|
||||
data = cast[ptr byte](addr text[0])
|
||||
dataLen = uint(len(text))
|
||||
digest = sha256.digest(data, dataLen)
|
||||
return digest.data
|
||||
|
||||
proc encodeBase64[T](data: T): string =
|
||||
return encode(data).replace("=", "")
|
||||
|
||||
proc decodeBase64(data: string): seq[byte] =
|
||||
return cast[seq[byte]](decode(data))
|
||||
|
||||
proc genTid*(path: string): Future[string] {.async.} =
|
||||
let
|
||||
pair = await getPair()
|
||||
|
||||
timeNow = int(epochTime() - 1682924400)
|
||||
timeNowBytes = @[
|
||||
byte(timeNow and 0xff),
|
||||
byte((timeNow shr 8) and 0xff),
|
||||
byte((timeNow shr 16) and 0xff),
|
||||
byte((timeNow shr 24) and 0xff)
|
||||
]
|
||||
|
||||
data = "GET!" & path & "!" & $timeNow & defaultKeyword & pair.animationKey
|
||||
hashBytes = encodeSha256(data)
|
||||
keyBytes = decodeBase64(pair.verification)
|
||||
bytesArr = keyBytes & timeNowBytes & hashBytes[0 ..< 16] & @[3'u8]
|
||||
randomNum = byte(rand(256))
|
||||
tid = @[randomNum] & bytesArr.mapIt(it xor randomNum)
|
||||
|
||||
return encodeBase64(tid)
|
||||
@@ -1,5 +1,5 @@
|
||||
# SPDX-License-Identifier: AGPL-3.0-only
|
||||
import times, sequtils, options, tables, uri
|
||||
import times, sequtils, options, tables
|
||||
import prefs_impl
|
||||
|
||||
genPrefsType()
|
||||
@@ -13,19 +13,13 @@ type
|
||||
TimelineKind* {.pure.} = enum
|
||||
tweets, replies, media
|
||||
|
||||
Api* {.pure.} = enum
|
||||
tweetDetail
|
||||
tweetResult
|
||||
search
|
||||
list
|
||||
listBySlug
|
||||
listMembers
|
||||
listTweets
|
||||
userRestId
|
||||
userScreenName
|
||||
userTweets
|
||||
userTweetsAndReplies
|
||||
userMedia
|
||||
ApiUrl* = object
|
||||
endpoint*: string
|
||||
params*: seq[(string, string)]
|
||||
|
||||
ApiReq* = object
|
||||
oauth*: ApiUrl
|
||||
cookie*: ApiUrl
|
||||
|
||||
RateLimit* = object
|
||||
limit*: int
|
||||
@@ -42,7 +36,7 @@ type
|
||||
pending*: int
|
||||
limited*: bool
|
||||
limitedAt*: int
|
||||
apis*: Table[Api, RateLimit]
|
||||
apis*: Table[string, RateLimit]
|
||||
case kind*: SessionKind
|
||||
of oauth:
|
||||
oauthToken*: string
|
||||
@@ -51,10 +45,6 @@ type
|
||||
authToken*: string
|
||||
ct0*: string
|
||||
|
||||
SessionAwareUrl* = object
|
||||
oauthUrl*: Uri
|
||||
cookieUrl*: Uri
|
||||
|
||||
Error* = enum
|
||||
null = 0
|
||||
noUserMatches = 17
|
||||
@@ -103,6 +93,7 @@ type
|
||||
media*: int
|
||||
verifiedType*: VerifiedType
|
||||
protected*: bool
|
||||
sensitive*: bool
|
||||
suspended*: bool
|
||||
joinDate*: DateTime
|
||||
|
||||
@@ -121,7 +112,6 @@ type
|
||||
durationMs*: int
|
||||
url*: string
|
||||
thumb*: string
|
||||
views*: string
|
||||
available*: bool
|
||||
reason*: string
|
||||
title*: string
|
||||
@@ -142,6 +132,7 @@ type
|
||||
since*: string
|
||||
until*: string
|
||||
near*: string
|
||||
minLikes*: string
|
||||
sep*: string
|
||||
|
||||
Gif* = object
|
||||
@@ -202,7 +193,6 @@ type
|
||||
replies*: int
|
||||
retweets*: int
|
||||
likes*: int
|
||||
quotes*: int
|
||||
views*: int
|
||||
|
||||
Tweet* = ref object
|
||||
@@ -214,6 +204,7 @@ type
|
||||
time*: DateTime
|
||||
reply*: seq[string]
|
||||
pinned*: bool
|
||||
sensitive*: bool
|
||||
hasThread*: bool
|
||||
available*: bool
|
||||
tombstone*: string
|
||||
@@ -285,8 +276,11 @@ type
|
||||
minTokens*: int
|
||||
enableRss*: bool
|
||||
enableDebug*: bool
|
||||
logLevel*: string
|
||||
proxy*: string
|
||||
proxyAuth*: string
|
||||
defaultFollowedAccounts*: seq[string]
|
||||
disableTid*: bool
|
||||
|
||||
rssCacheTime*: int
|
||||
listCacheTime*: int
|
||||
|
||||
@@ -2,8 +2,8 @@
|
||||
import uri, strutils, strformat
|
||||
import karax/[karaxdsl, vdom]
|
||||
|
||||
import renderutils
|
||||
import ../utils, ../types, ../prefs, ../formatters
|
||||
import renderutils, search_panel
|
||||
import ../utils, ../types, ../prefs, ../formatters, ../query, tables
|
||||
|
||||
import jester
|
||||
|
||||
@@ -20,24 +20,27 @@ proc renderNavbar(cfg: Config; req: Request; rss, canonical: string): VNode =
|
||||
path = $(parseUri(req.path) ? filterParams(req.params))
|
||||
if "/status/" in path: path.add "#m"
|
||||
|
||||
let query = initQuery(req.params)
|
||||
|
||||
buildHtml(nav):
|
||||
tdiv(class="inner-nav"):
|
||||
tdiv(class="nav-item"):
|
||||
a(class="site-name", href="/"): text cfg.title
|
||||
a(href="/about"): text "(donate)"
|
||||
|
||||
renderSearchPanel(query)
|
||||
|
||||
tdiv(class="nav-item right"):
|
||||
icon "search", title="Search", href="/search"
|
||||
if cfg.enableRss and rss.len > 0:
|
||||
icon "rss", title="RSS Feed", href=rss
|
||||
icon "bird", title="Open in Twitter", href=canonical
|
||||
icon "bird", title="Open in X", href=canonical
|
||||
a(href="https://buymeacoffee.com/kuu7o"): verbatim lp
|
||||
icon "info", title="About", href="/about"
|
||||
icon "cog", title="Preferences", href=("/settings?referer=" & encodeUrl(path))
|
||||
|
||||
proc renderHead*(prefs: Prefs; cfg: Config; req: Request; titleText=""; desc="";
|
||||
video=""; images: seq[string] = @[]; banner=""; ogTitle="";
|
||||
rss=""; canonical=""): VNode =
|
||||
rss=""; alternate=""): VNode =
|
||||
var theme = prefs.theme.toTheme
|
||||
if "theme" in req.params:
|
||||
theme = req.params["theme"].toTheme
|
||||
@@ -51,7 +54,7 @@ proc renderHead*(prefs: Prefs; cfg: Config; req: Request; titleText=""; desc="";
|
||||
let opensearchUrl = getUrlPrefix(cfg) & "/opensearch"
|
||||
|
||||
buildHtml(head):
|
||||
link(rel="stylesheet", type="text/css", href="/css/style.css?v=19")
|
||||
link(rel="stylesheet", type="text/css", href="/css/style.css?v=21")
|
||||
link(rel="stylesheet", type="text/css", href="/css/fontello.css?v=3")
|
||||
|
||||
if theme.len > 0:
|
||||
@@ -65,8 +68,8 @@ proc renderHead*(prefs: Prefs; cfg: Config; req: Request; titleText=""; desc="";
|
||||
link(rel="search", type="application/opensearchdescription+xml", title=cfg.title,
|
||||
href=opensearchUrl)
|
||||
|
||||
if canonical.len > 0:
|
||||
link(rel="canonical", href=canonical)
|
||||
if alternate.len > 0:
|
||||
link(rel="alternate", href=alternate, title="View on X")
|
||||
|
||||
if cfg.enableRss and rss.len > 0:
|
||||
link(rel="alternate", type="application/rss+xml", href=rss, title="RSS feed")
|
||||
@@ -120,18 +123,24 @@ proc renderHead*(prefs: Prefs; cfg: Config; req: Request; titleText=""; desc="";
|
||||
link(rel="preload", type="font/woff2", `as`="font",
|
||||
href="/fonts/fontello.woff2?61663884", crossorigin="anonymous")
|
||||
|
||||
if prefs.hideNsfw:
|
||||
style:
|
||||
verbatim ".nsfw { display: none !important; }"
|
||||
|
||||
proc renderMain*(body: VNode; req: Request; cfg: Config; prefs=defaultPrefs;
|
||||
titleText=""; desc=""; ogTitle=""; rss=""; video="";
|
||||
images: seq[string] = @[]; banner=""): string =
|
||||
|
||||
let canonical = getTwitterLink(req.path, req.params)
|
||||
let twitterLink = getTwitterLink(req.path, req.params)
|
||||
|
||||
let node = buildHtml(html(lang="en")):
|
||||
renderHead(prefs, cfg, req, titleText, desc, video, images, banner, ogTitle,
|
||||
rss, canonical)
|
||||
rss, twitterLink)
|
||||
|
||||
body:
|
||||
renderNavbar(cfg, req, rss, canonical)
|
||||
body(class=if prefs.verifiedBadge == "Hide all": "hide-verified-all"
|
||||
elif prefs.verifiedBadge == "Show official only": "hide-verified-blue"
|
||||
else: ""):
|
||||
renderNavbar(cfg, req, rss, twitterLink)
|
||||
|
||||
tdiv(class="container"):
|
||||
body
|
||||
|
||||
19
src/views/homepage.nim
Normal file
19
src/views/homepage.nim
Normal file
@@ -0,0 +1,19 @@
|
||||
# SPDX-License-Identifier: AGPL-3.0-only
|
||||
import karax/[karaxdsl, vdom]
|
||||
|
||||
import timeline, profile
|
||||
import ".."/[types]
|
||||
|
||||
proc renderHomepage*(users: seq[User]; timeline: VNode; prefs: Prefs; path: string): VNode =
|
||||
buildHtml(tdiv(class="homepage-container")):
|
||||
tdiv(class="timeline-users-column"):
|
||||
for user in users:
|
||||
renderUser(user, prefs, path)
|
||||
|
||||
tdiv(class="timeline"):
|
||||
timeline
|
||||
|
||||
tdiv(class="following-column"):
|
||||
tdiv(class="profile-cards"):
|
||||
for user in users:
|
||||
renderUserCard(user, prefs, path)
|
||||
@@ -12,8 +12,9 @@ proc renderStat(num: int; class: string; text=""): VNode =
|
||||
span(class="profile-stat-num"):
|
||||
text insertSep($num, ',')
|
||||
|
||||
proc renderUserCard*(user: User; prefs: Prefs): VNode =
|
||||
buildHtml(tdiv(class="profile-card")):
|
||||
proc renderUserCard*(user: User; prefs: Prefs; path: string): VNode =
|
||||
let class = if user.sensitive: "profile-card nsfw" else: "profile-card"
|
||||
buildHtml(tdiv(class=class)):
|
||||
tdiv(class="profile-card-info"):
|
||||
let
|
||||
url = getPicUrl(user.getUserPic())
|
||||
@@ -24,10 +25,13 @@ proc renderUserCard*(user: User; prefs: Prefs): VNode =
|
||||
a(class="profile-card-avatar", href=url, target="_blank"):
|
||||
genImg(user.getUserPic(size))
|
||||
|
||||
tdiv(class="profile-header"):
|
||||
tdiv(class="profile-card-tabs-name"):
|
||||
linkUser(user, class="profile-card-fullname")
|
||||
linkUser(user, class="profile-card-username")
|
||||
|
||||
renderFollowButton(user, prefs, path)
|
||||
|
||||
tdiv(class="profile-card-extra"):
|
||||
if user.bio.len > 0:
|
||||
tdiv(class="profile-bio"):
|
||||
@@ -109,7 +113,7 @@ proc renderProfile*(profile: var Profile; prefs: Prefs; path: string): VNode =
|
||||
|
||||
let sticky = if prefs.stickyProfile: " sticky" else: ""
|
||||
tdiv(class=("profile-tab" & sticky)):
|
||||
renderUserCard(profile.user, prefs)
|
||||
renderUserCard(profile.user, prefs, path)
|
||||
if profile.photoRail.len > 0:
|
||||
renderPhotoRail(profile)
|
||||
|
||||
|
||||
@@ -77,7 +77,7 @@ proc genInput*(pref, label, state, placeholder: string; class=""; autofocus=true
|
||||
input(name=pref, `type`="text", placeholder=p, value=state, autofocus=(autofocus and state.len == 0))
|
||||
|
||||
proc genSelect*(pref, label, state: string; options: seq[string]): VNode =
|
||||
buildHtml(tdiv(class="pref-group pref-input")):
|
||||
buildHtml(tdiv(class="pref-group pref-input pref-select")):
|
||||
label(`for`=pref): text label
|
||||
select(name=pref):
|
||||
for opt in options:
|
||||
@@ -89,6 +89,13 @@ proc genDate*(pref, state: string): VNode =
|
||||
input(name=pref, `type`="date", value=state)
|
||||
icon "calendar"
|
||||
|
||||
proc genNumberInput*(pref, label, state, placeholder: string; class=""; autofocus=true; min="0"): VNode =
|
||||
let p = placeholder
|
||||
buildHtml(tdiv(class=("pref-group pref-input " & class))):
|
||||
if label.len > 0:
|
||||
label(`for`=pref): text label
|
||||
input(name=pref, `type`="number", placeholder=p, value=state, autofocus=(autofocus and state.len == 0), min=min, step="1")
|
||||
|
||||
proc genImg*(url: string; class=""): VNode =
|
||||
buildHtml():
|
||||
img(src=getPicUrl(url), class=class, alt="", loading="lazy")
|
||||
@@ -100,3 +107,15 @@ proc getTabClass*(query: Query; tab: QueryKind): string =
|
||||
proc getAvatarClass*(prefs: Prefs): string =
|
||||
if prefs.squareAvatars: "avatar"
|
||||
else: "avatar round"
|
||||
|
||||
proc renderFollowButton*(user: User; prefs: Prefs; path: string): VNode =
|
||||
let
|
||||
isFollowing = user.username in prefs.following
|
||||
action = if isFollowing: "/unfollow" else: "/follow"
|
||||
text = if isFollowing: "Unfollow" else: "Follow"
|
||||
class = if isFollowing: "follow-button unfollow" else: "follow-button"
|
||||
|
||||
buildHtml(form(action=action, `method`="post", class="follow-form")):
|
||||
refererField path
|
||||
hiddenField("user", user.username)
|
||||
button(class=class, `type`="submit"): text text
|
||||
|
||||
@@ -9,9 +9,9 @@
|
||||
#elif tweet.reply.len > 0: result = &"R to @{tweet.reply[0]}: "
|
||||
#end if
|
||||
#var text = stripHtml(tweet.text)
|
||||
##if unicode.runeLen(text) > 32:
|
||||
## text = unicode.runeSubStr(text, 0, 32) & "..."
|
||||
##end if
|
||||
#if unicode.runeLen(text) > 100:
|
||||
# text = unicode.runeSubStr(text, 0, 64) & "..."
|
||||
#end if
|
||||
#result &= xmltree.escape(text)
|
||||
#if result.len > 0: return
|
||||
#end if
|
||||
@@ -25,7 +25,7 @@
|
||||
#end proc
|
||||
#
|
||||
#proc getDescription(desc: string; cfg: Config): string =
|
||||
Twitter feed for: ${desc}. Generated by ${cfg.hostname}
|
||||
Twitter feed for: ${desc}. Generated by ${getUrlPrefix(cfg)}
|
||||
#end proc
|
||||
#
|
||||
#proc getTweetsWithPinned(profile: Profile): seq[Tweets] =
|
||||
@@ -56,7 +56,10 @@ Twitter feed for: ${desc}. Generated by ${cfg.hostname}
|
||||
<img src="${urlPrefix}${getPicUrl(photo)}" style="max-width:250px;" />
|
||||
# end for
|
||||
#elif tweet.video.isSome:
|
||||
<a href="${urlPrefix}${tweet.getLink}">
|
||||
<br>Video<br>
|
||||
<img src="${urlPrefix}${getPicUrl(get(tweet.video).thumb)}" style="max-width:250px;" />
|
||||
</a>
|
||||
#elif tweet.gif.isSome:
|
||||
# let thumb = &"{urlPrefix}{getPicUrl(get(tweet.gif).thumb)}"
|
||||
# let url = &"{urlPrefix}{getPicUrl(get(tweet.gif).url)}"
|
||||
@@ -69,13 +72,16 @@ Twitter feed for: ${desc}. Generated by ${cfg.hostname}
|
||||
# end if
|
||||
#end if
|
||||
#if tweet.quote.isSome and get(tweet.quote).available:
|
||||
# let quoteLink = getLink(get(tweet.quote))
|
||||
# let quoteTweet = get(tweet.quote)
|
||||
# let quoteLink = urlPrefix & getLink(quoteTweet)
|
||||
<hr/>
|
||||
<blockquote>
|
||||
<b>${quoteTweet.user.fullname} (@${quoteTweet.user.username})</b>
|
||||
<p>
|
||||
${renderRssTweet(get(tweet.quote), cfg)}
|
||||
${renderRssTweet(quoteTweet, cfg)}
|
||||
</p>
|
||||
<footer>
|
||||
— <cite><a href="${urlPrefix}${quoteLink}">${cfg.hostname}${quoteLink}</a></cite>
|
||||
— <cite><a href="${quoteLink}">${quoteLink}</a>
|
||||
</footer>
|
||||
</blockquote>
|
||||
#end if
|
||||
@@ -101,6 +107,18 @@ Twitter feed for: ${desc}. Generated by ${cfg.hostname}
|
||||
<title>${getTitle(tweet, retweet)}</title>
|
||||
<dc:creator>@${tweet.user.username}</dc:creator>
|
||||
<description><![CDATA[${renderRssTweet(tweet, cfg).strip(chars={'\n'})}]]></description>
|
||||
# let desc = renderRssTweet(tweet, cfg).strip(chars={'\n'})
|
||||
# if retweet.len > 0:
|
||||
<description><![CDATA[
|
||||
<blockquote>
|
||||
<b>${tweet.user.fullname} (@${tweet.user.username})</b>
|
||||
<p>${desc}</p>
|
||||
<footer>— <cite><a href="${urlPrefix & link}">${urlPrefix & link}</a></footer>
|
||||
</blockquote>
|
||||
]]></description>
|
||||
# else:
|
||||
<description><![CDATA[${desc}]]></description>
|
||||
# end if
|
||||
<pubDate>${getRfc822Time(tweet)}</pubDate>
|
||||
<guid>${urlPrefix & link}</guid>
|
||||
<link>${urlPrefix & link}</link>
|
||||
|
||||
@@ -1,33 +1,13 @@
|
||||
# SPDX-License-Identifier: AGPL-3.0-only
|
||||
import strutils, strformat, sequtils, unicode, tables, options
|
||||
import strutils, options
|
||||
import karax/[karaxdsl, vdom]
|
||||
|
||||
import renderutils, timeline
|
||||
import ".."/[types, query]
|
||||
|
||||
const toggles = {
|
||||
"nativeretweets": "Retweets",
|
||||
"media": "Media",
|
||||
"videos": "Videos",
|
||||
"news": "News",
|
||||
"verified": "Verified",
|
||||
"native_video": "Native videos",
|
||||
"replies": "Replies",
|
||||
"links": "Links",
|
||||
"images": "Images",
|
||||
"safe": "Safe",
|
||||
"quote": "Quotes",
|
||||
"pro_video": "Pro videos"
|
||||
}.toOrderedTable
|
||||
|
||||
proc renderSearch*(): VNode =
|
||||
buildHtml(tdiv(class="panel-container")):
|
||||
tdiv(class="search-bar"):
|
||||
form(`method`="get", action="/search", autocomplete="off"):
|
||||
hiddenField("f", "tweets")
|
||||
input(`type`="text", name="q", autofocus="",
|
||||
placeholder="Search...", dir="auto")
|
||||
button(`type`="submit"): icon "search"
|
||||
discard
|
||||
|
||||
proc renderProfileTabs*(query: Query; username: string): VNode =
|
||||
let link = "/" & username
|
||||
@@ -51,43 +31,6 @@ proc renderSearchTabs*(query: Query): VNode =
|
||||
q.kind = users
|
||||
a(href=("?" & genQueryUrl(q))): text "Users"
|
||||
|
||||
proc isPanelOpen(q: Query): bool =
|
||||
q.fromUser.len == 0 and (q.filters.len > 0 or q.excludes.len > 0 or
|
||||
@[q.near, q.until, q.since].anyIt(it.len > 0))
|
||||
|
||||
proc renderSearchPanel*(query: Query): VNode =
|
||||
let user = query.fromUser.join(",")
|
||||
let action = if user.len > 0: &"/{user}/search" else: "/search"
|
||||
buildHtml(form(`method`="get", action=action,
|
||||
class="search-field", autocomplete="off")):
|
||||
hiddenField("f", "tweets")
|
||||
genInput("q", "", query.text, "Enter search...", class="pref-inline")
|
||||
button(`type`="submit"): icon "search"
|
||||
|
||||
input(id="search-panel-toggle", `type`="checkbox", checked=isPanelOpen(query))
|
||||
label(`for`="search-panel-toggle"): icon "down"
|
||||
|
||||
tdiv(class="search-panel"):
|
||||
for f in @["filter", "exclude"]:
|
||||
span(class="search-title"): text capitalize(f)
|
||||
tdiv(class="search-toggles"):
|
||||
for k, v in toggles:
|
||||
let state =
|
||||
if f == "filter": k in query.filters
|
||||
else: k in query.excludes
|
||||
genCheckbox(&"{f[0]}-{k}", v, state)
|
||||
|
||||
tdiv(class="search-row"):
|
||||
tdiv:
|
||||
span(class="search-title"): text "Time range"
|
||||
tdiv(class="date-range"):
|
||||
genDate("since", query.since)
|
||||
span(class="search-title"): text "-"
|
||||
genDate("until", query.until)
|
||||
tdiv:
|
||||
span(class="search-title"): text "Near"
|
||||
genInput("near", "", query.near, "Location...", autofocus=false)
|
||||
|
||||
proc renderTweetSearch*(results: Timeline; prefs: Prefs; path: string;
|
||||
pinned=none(Tweet)): VNode =
|
||||
let query = results.query
|
||||
@@ -100,21 +43,42 @@ proc renderTweetSearch*(results: Timeline; prefs: Prefs; path: string;
|
||||
renderProfileTabs(query, query.fromUser.join(","))
|
||||
|
||||
if query.fromUser.len == 0 or query.kind == tweets:
|
||||
tdiv(class="timeline-header"):
|
||||
renderSearchPanel(query)
|
||||
discard
|
||||
|
||||
if query.fromUser.len == 0:
|
||||
renderSearchTabs(query)
|
||||
|
||||
renderTimelineTweets(results, prefs, path, pinned)
|
||||
|
||||
proc renderUserSearch*(results: Result[User]; prefs: Prefs): VNode =
|
||||
buildHtml(tdiv(class="timeline-container")):
|
||||
tdiv(class="timeline-header"):
|
||||
form(`method`="get", action="/search", class="search-field", autocomplete="off"):
|
||||
hiddenField("f", "users")
|
||||
genInput("q", "", results.query.text, "Enter username...", class="pref-inline")
|
||||
button(`type`="submit"): icon "search"
|
||||
proc renderHomepageTabs*(query: Query): VNode =
|
||||
buildHtml(ul(class="tab")):
|
||||
li(class=if query.kind == tweets: "tab-item active" else: "tab-item"):
|
||||
a(href="/?f=tweets"): text "Tweets"
|
||||
|
||||
li(class=if query.kind == replies: "tab-item active" else: "tab-item"):
|
||||
a(href="/?f=replies"): text "Tweets & Replies"
|
||||
|
||||
proc renderHomepageTimeline*(results: Timeline; prefs: Prefs; path: string): VNode =
|
||||
let query = results.query
|
||||
buildHtml(tdiv(class="timeline-container")):
|
||||
renderHomepageTabs(query)
|
||||
|
||||
renderTimelineTweets(results, prefs, path)
|
||||
|
||||
proc renderDefaultTimeline*(results: Timeline; prefs: Prefs; path: string): VNode =
|
||||
let query = results.query
|
||||
buildHtml(tdiv(class="timeline-container")):
|
||||
tdiv(class="timeline-header timeline-default"):
|
||||
h2(class="timeline-default-message"):
|
||||
text "Follow people to populate your "
|
||||
strong: text "own"
|
||||
text " feed"
|
||||
|
||||
renderHomepageTabs(query)
|
||||
|
||||
renderTimelineTweets(results, prefs, path)
|
||||
|
||||
proc renderUserSearch*(results: Result[User]; prefs: Prefs; path: string): VNode =
|
||||
buildHtml(tdiv(class="timeline-container")):
|
||||
renderSearchTabs(results.query)
|
||||
renderTimelineUsers(results, prefs)
|
||||
renderTimelineUsers(results, prefs, path)
|
||||
|
||||
58
src/views/search_panel.nim
Normal file
58
src/views/search_panel.nim
Normal file
@@ -0,0 +1,58 @@
|
||||
# SPDX-License-Identifier: AGPL-3.0-only
|
||||
import strutils, strformat, sequtils, unicode, tables
|
||||
import karax/[karaxdsl, vdom]
|
||||
|
||||
import renderutils
|
||||
import ".."/[types]
|
||||
|
||||
const toggles = {
|
||||
"nativeretweets": "Retweets",
|
||||
"media": "Media",
|
||||
"videos": "Videos",
|
||||
"news": "News",
|
||||
"verified": "Verified",
|
||||
"native_video": "Native videos",
|
||||
"replies": "Replies",
|
||||
"links": "Links",
|
||||
"images": "Images",
|
||||
"safe": "Safe",
|
||||
"quote": "Quotes",
|
||||
"pro_video": "Pro videos"
|
||||
}.toOrderedTable
|
||||
|
||||
proc isPanelOpen(q: Query): bool =
|
||||
q.fromUser.len == 0 and (q.filters.len > 0 or q.excludes.anyIt(it != "nativeretweets") or
|
||||
@[q.near, q.until, q.since].anyIt(it.len > 0))
|
||||
|
||||
proc renderSearchPanel*(query: Query): VNode =
|
||||
let user = query.fromUser.join(",")
|
||||
let action = if user.len > 0: &"/{user}/search" else: "/search"
|
||||
buildHtml(form(`method`="get", action=action,
|
||||
class="search-field", autocomplete="off")):
|
||||
hiddenField("f", "tweets")
|
||||
genInput("q", "", query.text, "Enter search...", class="pref-inline")
|
||||
button(`type`="submit"): icon "search"
|
||||
|
||||
input(id="search-panel-toggle", `type`="checkbox", checked=isPanelOpen(query))
|
||||
label(`for`="search-panel-toggle"): icon "down"
|
||||
|
||||
tdiv(class="search-panel"):
|
||||
for f in @["filter", "exclude"]:
|
||||
span(class="search-title"): text capitalize(f)
|
||||
tdiv(class="search-toggles"):
|
||||
for k, v in toggles:
|
||||
let state =
|
||||
if f == "filter": k in query.filters
|
||||
else: k in query.excludes
|
||||
genCheckbox(&"{f[0]}-{k}", v, state)
|
||||
|
||||
tdiv(class="search-row"):
|
||||
tdiv:
|
||||
span(class="search-title"): text "Time range"
|
||||
tdiv(class="date-range"):
|
||||
genDate("since", query.since)
|
||||
span(class="search-title"): text "-"
|
||||
genDate("until", query.until)
|
||||
tdiv:
|
||||
span(class="search-title"): text "Near"
|
||||
genInput("near", "", query.near, "Location...", autofocus=false)
|
||||
@@ -55,8 +55,9 @@ proc renderThread(thread: Tweets; prefs: Prefs; path: string): VNode =
|
||||
renderTweet(tweet, prefs, path, class=(header & "thread"),
|
||||
index=i, last=(i == thread.high), showThread=show)
|
||||
|
||||
proc renderUser(user: User; prefs: Prefs): VNode =
|
||||
buildHtml(tdiv(class="timeline-item")):
|
||||
proc renderUser*(user: User; prefs: Prefs; path: string): VNode =
|
||||
let class = if user.sensitive: "timeline-item nsfw" else: "timeline-item"
|
||||
buildHtml(tdiv(class=class, data-username=user.username)):
|
||||
a(class="tweet-link", href=("/" & user.username))
|
||||
tdiv(class="tweet-body profile-result"):
|
||||
tdiv(class="tweet-header"):
|
||||
@@ -66,6 +67,7 @@ proc renderUser(user: User; prefs: Prefs): VNode =
|
||||
tdiv(class="tweet-name-row"):
|
||||
tdiv(class="fullname-and-username"):
|
||||
linkUser(user, class="fullname")
|
||||
renderFollowButton(user, prefs, path)
|
||||
linkUser(user, class="username")
|
||||
|
||||
tdiv(class="tweet-content media-body", dir="auto"):
|
||||
@@ -78,7 +80,7 @@ proc renderTimelineUsers*(results: Result[User]; prefs: Prefs; path=""): VNode =
|
||||
|
||||
if results.content.len > 0:
|
||||
for user in results.content:
|
||||
renderUser(user, prefs)
|
||||
renderUser(user, prefs, path)
|
||||
if results.bottom.len > 0:
|
||||
renderMore(results.query, results.bottom)
|
||||
renderToTop()
|
||||
|
||||
@@ -1,5 +1,5 @@
|
||||
# SPDX-License-Identifier: AGPL-3.0-only
|
||||
import strutils, sequtils, strformat, options, algorithm, uri
|
||||
import strutils, sequtils, strformat, options, algorithm
|
||||
import karax/[karaxdsl, vdom, vstyles]
|
||||
from jester import Request
|
||||
|
||||
@@ -178,18 +178,12 @@ func formatStat(stat: int): string =
|
||||
if stat > 0: insertSep($stat, ',')
|
||||
else: ""
|
||||
|
||||
proc renderStats(tweet_id: int64; stats: TweetStats; views: string; published: string): VNode =
|
||||
proc renderStats(stats: TweetStats): VNode =
|
||||
buildHtml(tdiv(class="tweet-stats")):
|
||||
span(class="tweet-stat"): icon "comment", formatStat(stats.replies)
|
||||
span(class="tweet-stat"): icon "retweet", formatStat(stats.retweets)
|
||||
a(class="tweet-stat", href=("/search?q=" & encodeUrl(&"-from:quotedreplies url:{tweet_id}") & "&e-nativeretweets=on")): icon "quote", formatStat(stats.quotes)
|
||||
span(class="tweet-stat"): icon "heart", formatStat(stats.likes)
|
||||
if stats.views > 0:
|
||||
span(class="tweet-stat"): icon "views", formatStat(stats.views)
|
||||
if views.len > 0:
|
||||
span(class="tweet-stat"): icon "play", insertSep(views, ',')
|
||||
if published.len > 0:
|
||||
span(class="tweet-published"): text published
|
||||
|
||||
proc renderReply(tweet: Tweet): VNode =
|
||||
buildHtml(tdiv(class="replying-to")):
|
||||
@@ -277,8 +271,11 @@ proc renderTweet*(tweet: Tweet; prefs: Prefs; path: string; class=""; index=0;
|
||||
if index == -1 or last:
|
||||
divClass = "thread-last " & class
|
||||
|
||||
if tweet.sensitive:
|
||||
divClass.add " nsfw"
|
||||
|
||||
if not tweet.available:
|
||||
return buildHtml(tdiv(class=divClass & "unavailable timeline-item")):
|
||||
return buildHtml(tdiv(class=divClass & "unavailable timeline-item", data-username=tweet.user.username)):
|
||||
tdiv(class="unavailable-box"):
|
||||
if tweet.tombstone.len > 0:
|
||||
text tweet.tombstone
|
||||
@@ -300,12 +297,11 @@ proc renderTweet*(tweet: Tweet; prefs: Prefs; path: string; class=""; index=0;
|
||||
tweet = tweet.retweet.get
|
||||
retweet = fullTweet.user.fullname
|
||||
|
||||
buildHtml(tdiv(class=("timeline-item " & divClass))):
|
||||
buildHtml(tdiv(class=("timeline-item " & divClass), data-username=tweet.user.username)):
|
||||
if not mainTweet:
|
||||
a(class="tweet-link", href=getLink(tweet))
|
||||
|
||||
tdiv(class="tweet-body"):
|
||||
var views = ""
|
||||
renderHeader(tweet, retweet, pinned, prefs)
|
||||
|
||||
if not afterTweet and index == 0 and tweet.reply.len > 0 and
|
||||
@@ -329,10 +325,8 @@ proc renderTweet*(tweet: Tweet; prefs: Prefs; path: string; class=""; index=0;
|
||||
renderAlbum(tweet)
|
||||
elif tweet.video.isSome:
|
||||
renderVideo(tweet.video.get(), prefs, path)
|
||||
views = tweet.video.get().views
|
||||
elif tweet.gif.isSome:
|
||||
renderGif(tweet.gif.get(), prefs)
|
||||
views = "GIF"
|
||||
|
||||
if tweet.poll.isSome:
|
||||
renderPoll(tweet.poll.get())
|
||||
@@ -346,7 +340,7 @@ proc renderTweet*(tweet: Tweet; prefs: Prefs; path: string; class=""; index=0;
|
||||
renderMediaTags(tweet.mediaTags)
|
||||
|
||||
if not prefs.hideTweetStats:
|
||||
renderStats(tweet.id, tweet.stats, views, published)
|
||||
renderStats(tweet.stats)
|
||||
|
||||
if showThread:
|
||||
a(class="show-thread", href=("/i/status/" & $tweet.threadId)):
|
||||
|
||||
@@ -11,12 +11,7 @@ card = [
|
||||
['voidtarget/status/1094632512926605312',
|
||||
'Basic OBS Studio plugin, written in nim, supporting C++ (C fine too)',
|
||||
'Basic OBS Studio plugin, written in nim, supporting C++ (C fine too) - obsplugin.nim',
|
||||
'gist.github.com', True],
|
||||
|
||||
['nim_lang/status/1082989146040340480',
|
||||
'Nim in 2018: A short recap',
|
||||
'There were several big news in the Nim world in 2018 – two new major releases, partnership with Status, and much more. But let us go chronologically.',
|
||||
'nim-lang.org', True]
|
||||
'gist.github.com', True]
|
||||
]
|
||||
|
||||
no_thumb = [
|
||||
|
||||
@@ -94,7 +94,7 @@ async def login_and_get_cookies(username, password, totp_seed=None, headless=Fal
|
||||
|
||||
async def main():
|
||||
if len(sys.argv) < 3:
|
||||
print('Usage: python3 twitter-auth.py username password [totp_seed] [--append sessions.jsonl] [--headless]')
|
||||
print('Usage: python3 create_session_browser.py username password [totp_seed] [--append file.jsonl] [--headless]')
|
||||
sys.exit(1)
|
||||
|
||||
username = sys.argv[1]
|
||||
|
||||
Reference in New Issue
Block a user