Compare commits
72 Commits
032b121a90
...
master
| Author | SHA1 | Date | |
|---|---|---|---|
|
4eefa1bf07
|
|||
|
|
31d210ca47 | ||
|
|
dae68b4f13 | ||
|
|
8516ebe2b7 | ||
|
|
b83227aaf5 | ||
|
0e707271a4
|
|||
|
f68e234ea6
|
|||
|
|
404b06b5f3 | ||
|
|
2b922c049a | ||
|
948a0fdc5c
|
|||
|
|
78101df2cc | ||
|
|
12bbddf204 | ||
|
|
4979d07f2e | ||
|
|
f038b53fa2 | ||
|
|
4748311f8d | ||
|
|
d47eb8f0eb | ||
|
|
1657eeb769 | ||
|
|
25df682094 | ||
|
|
53edbbc4e9 | ||
|
|
5b4a3fe691 | ||
|
d3d825dc50
|
|||
|
|
f8a17fdaa5 | ||
|
b4d2f9aec9
|
|||
|
2e122dbcb1
|
|||
|
56762c9026
|
|||
|
3d9a7e3014
|
|||
|
|
b0d9c1d51a | ||
|
dba8410146
|
|||
|
704db60297
|
|||
|
73360e6972
|
|||
|
62a4347b96
|
|||
|
443996df96
|
|||
|
441ea68fd7
|
|||
|
2fd13de8e1
|
|||
|
4e05923cd8
|
|||
|
5a79ec025a
|
|||
|
644cda63a0
|
|||
|
|
78d788b27f | ||
|
49dc4b4f00
|
|||
|
c654cdf57e
|
|||
|
a7e8f3add0
|
|||
|
ce1139e335
|
|||
|
3845fb1213
|
|||
|
4df434a7c6
|
|||
|
57a1fc6820
|
|||
|
8d87371763
|
|||
|
2e2a96d7d8
|
|||
|
5e60c28ce5
|
|||
|
3256ba8b03
|
|||
|
b45ae21354
|
|||
|
bb6728b6ec
|
|||
|
e430765516
|
|||
|
3167cab01d
|
|||
|
0e4dbdef99
|
|||
|
9950260662
|
|||
|
dc0e894443
|
|||
|
6ef9816c4f
|
|||
|
f03a4e311f
|
|||
|
045baf1529
|
|||
|
|
9c8310f473
|
||
|
|
824a7e346a | ||
|
|
e8de18317e | ||
|
|
6b655cddd8 | ||
|
|
886f2d2a45 | ||
|
|
bb6eb81a20 | ||
|
|
0bb0b7e78c | ||
|
|
a666c4867c | ||
|
|
778eb35ee3 | ||
|
|
c3ff68b061
|
||
|
|
da72089568
|
||
|
|
a009028a74
|
||
|
|
3f3196d103 |
3
.github/FUNDING.yml
vendored
3
.github/FUNDING.yml
vendored
@@ -1,3 +0,0 @@
|
|||||||
github: zedeus
|
|
||||||
liberapay: zedeus
|
|
||||||
patreon: nitter
|
|
||||||
63
.github/workflows/build-docker.yml
vendored
63
.github/workflows/build-docker.yml
vendored
@@ -1,63 +0,0 @@
|
|||||||
name: Docker
|
|
||||||
|
|
||||||
on:
|
|
||||||
push:
|
|
||||||
paths-ignore:
|
|
||||||
- "README.md"
|
|
||||||
branches:
|
|
||||||
- master
|
|
||||||
|
|
||||||
jobs:
|
|
||||||
tests:
|
|
||||||
uses: ./.github/workflows/run-tests.yml
|
|
||||||
secrets: inherit
|
|
||||||
build-docker-amd64:
|
|
||||||
needs: [tests]
|
|
||||||
runs-on: buildjet-2vcpu-ubuntu-2204
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@v3
|
|
||||||
with:
|
|
||||||
fetch-depth: 0
|
|
||||||
- name: Set up Docker Buildx
|
|
||||||
id: buildx
|
|
||||||
uses: docker/setup-buildx-action@v2
|
|
||||||
with:
|
|
||||||
version: latest
|
|
||||||
- name: Login to DockerHub
|
|
||||||
uses: docker/login-action@v2
|
|
||||||
with:
|
|
||||||
username: ${{ secrets.DOCKER_USERNAME }}
|
|
||||||
password: ${{ secrets.DOCKER_PASSWORD }}
|
|
||||||
- name: Build and push AMD64 Docker image
|
|
||||||
uses: docker/build-push-action@v3
|
|
||||||
with:
|
|
||||||
context: .
|
|
||||||
file: ./Dockerfile
|
|
||||||
platforms: linux/amd64
|
|
||||||
push: true
|
|
||||||
tags: zedeus/nitter:latest,zedeus/nitter:${{ github.sha }}
|
|
||||||
build-docker-arm64:
|
|
||||||
needs: [tests]
|
|
||||||
runs-on: buildjet-2vcpu-ubuntu-2204-arm
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@v3
|
|
||||||
with:
|
|
||||||
fetch-depth: 0
|
|
||||||
- name: Set up Docker Buildx
|
|
||||||
id: buildx
|
|
||||||
uses: docker/setup-buildx-action@v2
|
|
||||||
with:
|
|
||||||
version: latest
|
|
||||||
- name: Login to DockerHub
|
|
||||||
uses: docker/login-action@v2
|
|
||||||
with:
|
|
||||||
username: ${{ secrets.DOCKER_USERNAME }}
|
|
||||||
password: ${{ secrets.DOCKER_PASSWORD }}
|
|
||||||
- name: Build and push ARM64 Docker image
|
|
||||||
uses: docker/build-push-action@v3
|
|
||||||
with:
|
|
||||||
context: .
|
|
||||||
file: ./Dockerfile.arm64
|
|
||||||
platforms: linux/arm64
|
|
||||||
push: true
|
|
||||||
tags: zedeus/nitter:latest-arm64,zedeus/nitter:${{ github.sha }}-arm64
|
|
||||||
108
.github/workflows/run-tests.yml
vendored
108
.github/workflows/run-tests.yml
vendored
@@ -1,108 +0,0 @@
|
|||||||
name: Tests
|
|
||||||
|
|
||||||
on:
|
|
||||||
push:
|
|
||||||
paths-ignore:
|
|
||||||
- "*.md"
|
|
||||||
branches-ignore:
|
|
||||||
- master
|
|
||||||
workflow_call:
|
|
||||||
|
|
||||||
# Ensure that multiple runs on the same branch do not overlap.
|
|
||||||
concurrency:
|
|
||||||
group: ${{ github.workflow }}-${{ github.ref }}
|
|
||||||
cancel-in-progress: true
|
|
||||||
|
|
||||||
defaults:
|
|
||||||
run:
|
|
||||||
shell: bash
|
|
||||||
|
|
||||||
jobs:
|
|
||||||
build-test:
|
|
||||||
name: Build and test
|
|
||||||
runs-on: buildjet-2vcpu-ubuntu-2204
|
|
||||||
strategy:
|
|
||||||
matrix:
|
|
||||||
nim: ["1.6.x", "2.0.x", "2.2.x", "devel"]
|
|
||||||
steps:
|
|
||||||
- name: Checkout Code
|
|
||||||
uses: actions/checkout@v4
|
|
||||||
with:
|
|
||||||
fetch-depth: 0
|
|
||||||
|
|
||||||
- name: Cache Nimble Dependencies
|
|
||||||
id: cache-nimble
|
|
||||||
uses: buildjet/cache@v4
|
|
||||||
with:
|
|
||||||
path: ~/.nimble
|
|
||||||
key: ${{ matrix.nim }}-nimble-v2-${{ hashFiles('*.nimble') }}
|
|
||||||
restore-keys: |
|
|
||||||
${{ matrix.nim }}-nimble-v2-
|
|
||||||
|
|
||||||
- name: Setup Nim
|
|
||||||
uses: jiro4989/setup-nim-action@v2
|
|
||||||
with:
|
|
||||||
nim-version: ${{ matrix.nim }}
|
|
||||||
use-nightlies: true
|
|
||||||
repo-token: ${{ secrets.GITHUB_TOKEN }}
|
|
||||||
|
|
||||||
- name: Build Project
|
|
||||||
run: nimble build -d:release -Y
|
|
||||||
|
|
||||||
integration-test:
|
|
||||||
needs: [build-test]
|
|
||||||
name: Integration test
|
|
||||||
runs-on: buildjet-2vcpu-ubuntu-2204
|
|
||||||
steps:
|
|
||||||
- name: Checkout code
|
|
||||||
uses: actions/checkout@v4
|
|
||||||
with:
|
|
||||||
fetch-depth: 0
|
|
||||||
|
|
||||||
- name: Cache Nimble Dependencies
|
|
||||||
id: cache-nimble
|
|
||||||
uses: buildjet/cache@v4
|
|
||||||
with:
|
|
||||||
path: ~/.nimble
|
|
||||||
key: devel-nimble-v2-${{ hashFiles('*.nimble') }}
|
|
||||||
restore-keys: |
|
|
||||||
devel-nimble-v2-
|
|
||||||
|
|
||||||
- name: Setup Python (3.10) with pip cache
|
|
||||||
uses: buildjet/setup-python@v4
|
|
||||||
with:
|
|
||||||
python-version: "3.10"
|
|
||||||
cache: pip
|
|
||||||
|
|
||||||
- name: Setup Nim
|
|
||||||
uses: jiro4989/setup-nim-action@v2
|
|
||||||
with:
|
|
||||||
nim-version: devel
|
|
||||||
use-nightlies: true
|
|
||||||
repo-token: ${{ secrets.GITHUB_TOKEN }}
|
|
||||||
|
|
||||||
- name: Build Project
|
|
||||||
run: nimble build -d:release -Y
|
|
||||||
|
|
||||||
- name: Install SeleniumBase and Chromedriver
|
|
||||||
run: |
|
|
||||||
pip install seleniumbase
|
|
||||||
seleniumbase install chromedriver
|
|
||||||
|
|
||||||
- name: Start Redis Service
|
|
||||||
uses: supercharge/redis-github-action@1.5.0
|
|
||||||
|
|
||||||
- name: Prepare Nitter Environment
|
|
||||||
run: |
|
|
||||||
sudo apt-get update && sudo apt-get install -y libsass-dev
|
|
||||||
cp nitter.example.conf nitter.conf
|
|
||||||
sed -i 's/enableDebug = false/enableDebug = true/g' nitter.conf
|
|
||||||
nimble md
|
|
||||||
nimble scss
|
|
||||||
echo '${{ secrets.SESSIONS }}' | head -n1
|
|
||||||
echo '${{ secrets.SESSIONS }}' > ./sessions.jsonl
|
|
||||||
|
|
||||||
- name: Run Tests
|
|
||||||
run: |
|
|
||||||
./nitter &
|
|
||||||
pytest -n1 tests
|
|
||||||
51
.travis.yml
51
.travis.yml
@@ -1,51 +0,0 @@
|
|||||||
jobs:
|
|
||||||
include:
|
|
||||||
- stage: test
|
|
||||||
if: (NOT type IN (pull_request)) AND (branch = master)
|
|
||||||
dist: bionic
|
|
||||||
language: python
|
|
||||||
python:
|
|
||||||
- 3.6
|
|
||||||
services:
|
|
||||||
- docker
|
|
||||||
- xvfb
|
|
||||||
script:
|
|
||||||
- sudo apt update
|
|
||||||
- sudo apt install --force-yes chromium-chromedriver
|
|
||||||
- wget https://www.dropbox.com/s/ckuoaubd1crrj2k/Linux_x64_737173_chrome-linux.zip -O chrome.zip
|
|
||||||
- unzip chrome.zip
|
|
||||||
- cd chrome-linux
|
|
||||||
- sudo rm /usr/bin/google-chrome
|
|
||||||
- sudo ln -s chrome /usr/bin/google-chrome
|
|
||||||
- cd ..
|
|
||||||
- pip3 install --upgrade pip
|
|
||||||
- pip3 install -U seleniumbase pytest
|
|
||||||
- docker run -d -p 127.0.0.1:8080:8080/tcp $IMAGE_NAME:$TRAVIS_COMMIT
|
|
||||||
- sleep 10
|
|
||||||
- cd tests
|
|
||||||
- pytest --headless -n 8 --reruns 10 --reruns-delay 2
|
|
||||||
- stage: pr
|
|
||||||
if: type IN (pull_request)
|
|
||||||
dist: bionic
|
|
||||||
language: python
|
|
||||||
python:
|
|
||||||
- 3.6
|
|
||||||
services:
|
|
||||||
- docker
|
|
||||||
- xvfb
|
|
||||||
script:
|
|
||||||
- sudo apt update
|
|
||||||
- sudo apt install --force-yes chromium-chromedriver
|
|
||||||
- wget https://www.dropbox.com/s/ckuoaubd1crrj2k/Linux_x64_737173_chrome-linux.zip -O chrome.zip
|
|
||||||
- unzip chrome.zip
|
|
||||||
- cd chrome-linux
|
|
||||||
- sudo rm /usr/bin/google-chrome
|
|
||||||
- sudo ln -s chrome /usr/bin/google-chrome
|
|
||||||
- cd ..
|
|
||||||
- pip3 install --upgrade pip
|
|
||||||
- pip3 install -U seleniumbase pytest
|
|
||||||
- docker build -t $IMAGE_NAME:$TRAVIS_COMMIT .
|
|
||||||
- docker run -d -p 127.0.0.1:8080:8080/tcp $IMAGE_NAME:$TRAVIS_COMMIT
|
|
||||||
- sleep 10
|
|
||||||
- cd tests
|
|
||||||
- pytest --headless -n 8 --reruns 3 --reruns-delay 2
|
|
||||||
@@ -1,25 +0,0 @@
|
|||||||
FROM alpine:3.20.6 as nim
|
|
||||||
LABEL maintainer="setenforce@protonmail.com"
|
|
||||||
|
|
||||||
RUN apk --no-cache add libsass-dev pcre gcc git libc-dev nim nimble
|
|
||||||
|
|
||||||
WORKDIR /src/nitter
|
|
||||||
|
|
||||||
COPY nitter.nimble .
|
|
||||||
RUN nimble install -y --depsOnly
|
|
||||||
|
|
||||||
COPY . .
|
|
||||||
RUN nimble build -d:danger -d:lto -d:strip --mm:refc \
|
|
||||||
&& nimble scss \
|
|
||||||
&& nimble md
|
|
||||||
|
|
||||||
FROM alpine:3.20.6
|
|
||||||
WORKDIR /src/
|
|
||||||
RUN apk --no-cache add pcre ca-certificates openssl
|
|
||||||
COPY --from=nim /src/nitter/nitter ./
|
|
||||||
COPY --from=nim /src/nitter/nitter.example.conf ./nitter.conf
|
|
||||||
COPY --from=nim /src/nitter/public ./public
|
|
||||||
EXPOSE 8080
|
|
||||||
RUN adduser -h /src/ -D -s /bin/sh nitter
|
|
||||||
USER nitter
|
|
||||||
CMD ./nitter
|
|
||||||
@@ -24,15 +24,22 @@ hmacKey = "secretkey" # random key for cryptographic signing of video urls
|
|||||||
base64Media = false # use base64 encoding for proxied media urls
|
base64Media = false # use base64 encoding for proxied media urls
|
||||||
enableRSS = true # set this to false to disable RSS feeds
|
enableRSS = true # set this to false to disable RSS feeds
|
||||||
enableDebug = false # enable request logs and debug endpoints (/.sessions)
|
enableDebug = false # enable request logs and debug endpoints (/.sessions)
|
||||||
|
logLevel = "info" # log level (debug, info, warn, error, fatal)
|
||||||
proxy = "" # http/https url, SOCKS proxies are not supported
|
proxy = "" # http/https url, SOCKS proxies are not supported
|
||||||
proxyAuth = ""
|
proxyAuth = ""
|
||||||
|
defaultFollowedAccounts = "eff,fsf" # default accounts to show when user follows none
|
||||||
|
disableTid = false # enable this if cookie-based auth is failing
|
||||||
|
|
||||||
# Change default preferences here, see src/prefs_impl.nim for a complete list
|
# Change default preferences here, see src/prefs_impl.nim for a complete list
|
||||||
[Preferences]
|
[Preferences]
|
||||||
theme = "Nitter"
|
theme = "Kuuro"
|
||||||
replaceTwitter = "nitter.net"
|
replaceTwitter = "nt.kuuro.net"
|
||||||
replaceYouTube = "piped.video"
|
replaceYouTube = "inv.nadeko.net"
|
||||||
replaceReddit = "teddit.net"
|
replaceReddit = "rd.kuuro.net"
|
||||||
|
replaceImgur = "rd.kuuro.net"
|
||||||
|
replaceFandom = "ph.kuuro.net"
|
||||||
|
replaceSoundCloud = "sc.kuuro.net"
|
||||||
proxyVideos = true
|
proxyVideos = true
|
||||||
hlsPlayback = false
|
hlsPlayback = false
|
||||||
infiniteScroll = false
|
infiniteScroll = false
|
||||||
|
hideNsfw = true
|
||||||
|
|||||||
@@ -10,7 +10,7 @@ bin = @["nitter"]
|
|||||||
|
|
||||||
# Dependencies
|
# Dependencies
|
||||||
|
|
||||||
requires "nim >= 1.6.10"
|
requires "nim >= 2.0.0"
|
||||||
requires "jester#baca3f"
|
requires "jester#baca3f"
|
||||||
requires "karax#5cf360c"
|
requires "karax#5cf360c"
|
||||||
requires "sass#7dfdd03"
|
requires "sass#7dfdd03"
|
||||||
|
|||||||
42
public/css/fontello.css
vendored
42
public/css/fontello.css
vendored
@@ -1,16 +1,15 @@
|
|||||||
@font-face {
|
@font-face {
|
||||||
font-family: 'fontello';
|
font-family: 'fontello';
|
||||||
src: url('/fonts/fontello.eot?21002321');
|
src: url('/fonts/fontello.eot?61663884');
|
||||||
src: url('/fonts/fontello.eot?21002321#iefix') format('embedded-opentype'),
|
src: url('/fonts/fontello.eot?61663884#iefix') format('embedded-opentype'),
|
||||||
url('/fonts/fontello.woff2?21002321') format('woff2'),
|
url('/fonts/fontello.woff2?61663884') format('woff2'),
|
||||||
url('/fonts/fontello.woff?21002321') format('woff'),
|
url('/fonts/fontello.woff?61663884') format('woff'),
|
||||||
url('/fonts/fontello.ttf?21002321') format('truetype'),
|
url('/fonts/fontello.ttf?61663884') format('truetype'),
|
||||||
url('/fonts/fontello.svg?21002321#fontello') format('svg');
|
url('/fonts/fontello.svg?61663884#fontello') format('svg');
|
||||||
font-weight: normal;
|
font-weight: normal;
|
||||||
font-style: normal;
|
font-style: normal;
|
||||||
}
|
}
|
||||||
|
[class^="icon-"]:before, [class*=" icon-"]:before {
|
||||||
[class^="icon-"]:before, [class*=" icon-"]:before {
|
|
||||||
font-family: "fontello";
|
font-family: "fontello";
|
||||||
font-style: normal;
|
font-style: normal;
|
||||||
font-weight: normal;
|
font-weight: normal;
|
||||||
@@ -33,21 +32,22 @@
|
|||||||
-moz-osx-font-smoothing: grayscale;
|
-moz-osx-font-smoothing: grayscale;
|
||||||
}
|
}
|
||||||
|
|
||||||
.icon-heart:before { content: '\2665'; } /* '♥' */
|
.icon-views:before { content: '\e800'; } /* '' */
|
||||||
.icon-quote:before { content: '\275e'; } /* '❞' */
|
.icon-heart:before { content: '\e801'; } /* '' */
|
||||||
.icon-comment:before { content: '\e802'; } /* '' */
|
.icon-quote:before { content: '\e802'; } /* '' */
|
||||||
.icon-ok:before { content: '\e803'; } /* '' */
|
.icon-comment:before { content: '\e803'; } /* '' */
|
||||||
.icon-play:before { content: '\e804'; } /* '' */
|
.icon-ok:before { content: '\e804'; } /* '' */
|
||||||
.icon-link:before { content: '\e805'; } /* '' */
|
.icon-play:before { content: '\e805'; } /* '' */
|
||||||
.icon-calendar:before { content: '\e806'; } /* '' */
|
.icon-link:before { content: '\e806'; } /* '' */
|
||||||
.icon-location:before { content: '\e807'; } /* '' */
|
.icon-calendar:before { content: '\e807'; } /* '' */
|
||||||
|
.icon-location:before { content: '\e808'; } /* '' */
|
||||||
.icon-picture:before { content: '\e809'; } /* '' */
|
.icon-picture:before { content: '\e809'; } /* '' */
|
||||||
.icon-lock:before { content: '\e80a'; } /* '' */
|
.icon-lock:before { content: '\e80a'; } /* '' */
|
||||||
.icon-down:before { content: '\e80b'; } /* '' */
|
.icon-down:before { content: '\e80b'; } /* '' */
|
||||||
.icon-retweet:before { content: '\e80d'; } /* '' */
|
.icon-retweet:before { content: '\e80c'; } /* '' */
|
||||||
.icon-search:before { content: '\e80e'; } /* '' */
|
.icon-search:before { content: '\e80d'; } /* '' */
|
||||||
.icon-pin:before { content: '\e80f'; } /* '' */
|
.icon-pin:before { content: '\e80e'; } /* '' */
|
||||||
.icon-cog:before { content: '\e812'; } /* '' */
|
.icon-cog:before { content: '\e80f'; } /* '' */
|
||||||
.icon-rss-feed:before { content: '\e813'; } /* '' */
|
.icon-rss:before { content: '\e810'; } /* '' */
|
||||||
.icon-info:before { content: '\f128'; } /* '' */
|
.icon-info:before { content: '\f128'; } /* '' */
|
||||||
.icon-bird:before { content: '\f309'; } /* '' */
|
.icon-bird:before { content: '\f309'; } /* '' */
|
||||||
|
|||||||
@@ -1,30 +1,30 @@
|
|||||||
body {
|
body {
|
||||||
--bg_color: #000000;
|
--bg_color: #000;
|
||||||
--fg_color: #FFFFFF;
|
--fg_color: #EEE;
|
||||||
--fg_faded: #FFFFFFD4;
|
--fg_faded: #EEEEEED4;
|
||||||
--fg_dark: var(--accent);
|
--fg_dark: var(--accent);
|
||||||
--fg_nav: var(--accent);
|
--fg_nav: var(--accent);
|
||||||
|
|
||||||
--bg_panel: #0C0C0C;
|
--bg_panel: #0C0C0C;
|
||||||
--bg_elements: #000000;
|
--bg_elements: #000000;
|
||||||
--bg_overlays: var(--bg_panel);
|
--bg_overlays: var(--bg_panel);
|
||||||
--bg_hover: #131313;
|
--bg_hover: #0F0F0F;
|
||||||
|
|
||||||
--grey: #E2E2E2;
|
--grey: #939393;
|
||||||
--dark_grey: #4E4E4E;
|
--dark_grey: #404040;
|
||||||
--darker_grey: #272727;
|
--darker_grey: #1F1F1F;
|
||||||
--darkest_grey: #212121;
|
--darkest_grey: #151515;
|
||||||
--border_grey: #7D7D7D;
|
--border_grey: #1c1c1c;
|
||||||
|
|
||||||
--accent: #FF6C60;
|
--accent: #FF6C60;
|
||||||
--accent_light: #FFACA0;
|
--accent_light: #FFACA0;
|
||||||
--accent_dark: #909090;
|
--accent_dark: #707070;
|
||||||
--accent_border: #FF6C6091;
|
--accent_border: #FF6C6060;
|
||||||
|
|
||||||
--play_button: var(--accent);
|
--play_button: var(--accent);
|
||||||
--play_button_hover: var(--accent_light);
|
--play_button_hover: var(--accent_light);
|
||||||
|
|
||||||
--more_replies_dots: #A7A7A7;
|
--more_replies_dots: #808080;
|
||||||
--error_red: #420A05;
|
--error_red: #420A05;
|
||||||
|
|
||||||
--verified_blue: #1DA1F2;
|
--verified_blue: #1DA1F2;
|
||||||
|
|||||||
59
public/css/themes/kuuro.css
Normal file
59
public/css/themes/kuuro.css
Normal file
@@ -0,0 +1,59 @@
|
|||||||
|
body {
|
||||||
|
--bg_color: #050505;
|
||||||
|
--fg_color: #d2d2d2;
|
||||||
|
--fg_faded: #949494;
|
||||||
|
--fg_dark: var(--accent);
|
||||||
|
--fg_nav: var(--accent);
|
||||||
|
|
||||||
|
--bg_panel: #0a0a0a;
|
||||||
|
--bg_elements: #0f0f0f;
|
||||||
|
--bg_overlays: var(--bg_panel);
|
||||||
|
--bg_hover: #151515;
|
||||||
|
|
||||||
|
--grey: #949494;
|
||||||
|
--dark_grey: #444444;
|
||||||
|
--darker_grey: #333333;
|
||||||
|
--darkest_grey: #111111;
|
||||||
|
--border_grey: rgba(255, 255, 255, 0.06);
|
||||||
|
|
||||||
|
--accent: #f3c2e6;
|
||||||
|
--accent_light: #ffd6f2;
|
||||||
|
--accent_dark: #a6859d;
|
||||||
|
--accent_border: #f3c2e660;
|
||||||
|
|
||||||
|
--play_button: var(--accent);
|
||||||
|
--play_button_hover: var(--accent_light);
|
||||||
|
|
||||||
|
--more_replies_dots: #5f6364;
|
||||||
|
--error_red: #ec5f67;
|
||||||
|
|
||||||
|
--verified_blue: #6699cc;
|
||||||
|
--icon_text: var(--fg_color);
|
||||||
|
|
||||||
|
--tab: var(--fg_color);
|
||||||
|
--tab_selected: var(--accent);
|
||||||
|
|
||||||
|
--profile_stat: var(--fg_color);
|
||||||
|
}
|
||||||
|
|
||||||
|
*:not(.avatar) {
|
||||||
|
border-radius: 0 !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
input, textarea, select, button,
|
||||||
|
.card-container,
|
||||||
|
.profile-card,
|
||||||
|
.photo-rail-card,
|
||||||
|
.timeline-item,
|
||||||
|
.search-field,
|
||||||
|
nav,
|
||||||
|
.timeline-footer,
|
||||||
|
.show-more,
|
||||||
|
.unavailable-box,
|
||||||
|
.tweet-embed,
|
||||||
|
.overlay-panel,
|
||||||
|
.timeline-header,
|
||||||
|
.tab {
|
||||||
|
outline: 1px solid var(--border_grey) !important;
|
||||||
|
outline-offset: -1px !important;
|
||||||
|
}
|
||||||
@@ -1,6 +1,15 @@
|
|||||||
Font license info
|
Font license info
|
||||||
|
|
||||||
|
|
||||||
|
## Modern Pictograms
|
||||||
|
|
||||||
|
Copyright (c) 2012 by John Caserta. All rights reserved.
|
||||||
|
|
||||||
|
Author: John Caserta
|
||||||
|
License: SIL (http://scripts.sil.org/OFL)
|
||||||
|
Homepage: http://thedesignoffice.org/project/modern-pictograms/
|
||||||
|
|
||||||
|
|
||||||
## Entypo
|
## Entypo
|
||||||
|
|
||||||
Copyright (C) 2012 by Daniel Bruce
|
Copyright (C) 2012 by Daniel Bruce
|
||||||
@@ -37,12 +46,3 @@ Font license info
|
|||||||
Homepage: http://aristeides.com/
|
Homepage: http://aristeides.com/
|
||||||
|
|
||||||
|
|
||||||
## Modern Pictograms
|
|
||||||
|
|
||||||
Copyright (c) 2012 by John Caserta. All rights reserved.
|
|
||||||
|
|
||||||
Author: John Caserta
|
|
||||||
License: SIL (http://scripts.sil.org/OFL)
|
|
||||||
Homepage: http://thedesignoffice.org/project/modern-pictograms/
|
|
||||||
|
|
||||||
|
|
||||||
|
|||||||
Binary file not shown.
@@ -1,26 +1,28 @@
|
|||||||
<?xml version="1.0" standalone="no"?>
|
<?xml version="1.0" standalone="no"?>
|
||||||
<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd">
|
<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd">
|
||||||
<svg xmlns="http://www.w3.org/2000/svg">
|
<svg xmlns="http://www.w3.org/2000/svg">
|
||||||
<metadata>Copyright (C) 2020 by original authors @ fontello.com</metadata>
|
<metadata>Copyright (C) 2025 by original authors @ fontello.com</metadata>
|
||||||
<defs>
|
<defs>
|
||||||
<font id="fontello" horiz-adv-x="1000" >
|
<font id="fontello" horiz-adv-x="1000" >
|
||||||
<font-face font-family="fontello" font-weight="400" font-stretch="normal" units-per-em="1000" ascent="850" descent="-150" />
|
<font-face font-family="fontello" font-weight="400" font-stretch="normal" units-per-em="1000" ascent="850" descent="-150" />
|
||||||
<missing-glyph horiz-adv-x="1000" />
|
<missing-glyph horiz-adv-x="1000" />
|
||||||
<glyph glyph-name="heart" unicode="♥" d="M790 644q70-64 70-156t-70-158l-360-330-360 330q-70 66-70 158t70 156q62 58 151 58t153-58l56-52 58 52q62 58 150 58t152-58z" horiz-adv-x="860" />
|
<glyph glyph-name="views" unicode="" d="M180 516l0-538-180 0 0 538 180 0z m250-138l0-400-180 0 0 400 180 0z m250 344l0-744-180 0 0 744 180 0z" horiz-adv-x="680" />
|
||||||
|
|
||||||
<glyph glyph-name="quote" unicode="❞" d="M18 685l335 0 0-334q0-140-98-238t-237-97l0 111q92 0 158 65t65 159l-223 0 0 334z m558 0l335 0 0-334q0-140-98-238t-237-97l0 111q92 0 158 65t65 159l-223 0 0 334z" horiz-adv-x="928" />
|
<glyph glyph-name="heart" unicode="" d="M790 644q70-64 70-156t-70-158l-360-330-360 330q-70 66-70 158t70 156q62 58 151 58t153-58l56-52 58 52q62 58 150 58t152-58z" horiz-adv-x="860" />
|
||||||
|
|
||||||
<glyph glyph-name="comment" unicode="" d="M1000 350q0-97-67-179t-182-130-251-48q-39 0-81 4-110-97-257-135-27-8-63-12-10-1-17 5t-10 16v1q-2 2 0 6t1 6 2 5l4 5t4 5 4 5q4 5 17 19t20 22 17 22 18 28 15 33 15 42q-88 50-138 123t-51 157q0 73 40 139t106 114 160 76 194 28q136 0 251-48t182-130 67-179z" horiz-adv-x="1000" />
|
<glyph glyph-name="quote" unicode="" d="M18 685l335 0 0-334q0-140-98-238t-237-97l0 111q92 0 158 65t65 159l-223 0 0 334z m558 0l335 0 0-334q0-140-98-238t-237-97l0 111q92 0 158 65t65 159l-223 0 0 334z" horiz-adv-x="928" />
|
||||||
|
|
||||||
<glyph glyph-name="ok" unicode="" d="M0 260l162 162 166-164 508 510 164-164-510-510-162-162-162 164z" horiz-adv-x="1000" />
|
<glyph glyph-name="comment" unicode="" d="M1000 350q0-97-67-179t-182-130-251-48q-39 0-81 4-110-97-257-135-27-8-63-12-10-1-17 5t-10 16v1q-2 2 0 6t1 6 2 5l4 5t4 5 4 5q4 5 17 19t20 22 17 22 18 28 15 33 15 42q-88 50-138 123t-51 157q0 73 40 139t106 114 160 76 194 28q136 0 251-48t182-130 67-179z" horiz-adv-x="1000" />
|
||||||
|
|
||||||
<glyph glyph-name="play" unicode="" d="M772 333l-741-412q-13-7-22-2t-9 20v822q0 14 9 20t22-2l741-412q13-7 13-17t-13-17z" horiz-adv-x="785.7" />
|
<glyph glyph-name="ok" unicode="" d="M0 260l162 162 166-164 508 510 164-164-510-510-162-162-162 164z" horiz-adv-x="1000" />
|
||||||
|
|
||||||
<glyph glyph-name="link" unicode="" d="M294 116q14 14 34 14t36-14q32-34 0-70l-42-40q-56-56-132-56-78 0-134 56t-56 132q0 78 56 134l148 148q70 68 144 77t128-43q16-16 16-36t-16-36q-36-32-70 0-50 48-132-34l-148-146q-26-26-26-64t26-62q26-26 63-26t63 26z m450 574q56-56 56-132 0-78-56-134l-158-158q-74-72-150-72-62 0-112 50-14 14-14 34t14 36q14 14 35 14t35-14q50-48 122 24l158 156q28 28 28 64 0 38-28 62-24 26-56 31t-60-21l-50-50q-16-14-36-14t-34 14q-34 34 0 70l50 50q54 54 127 51t129-61z" horiz-adv-x="800" />
|
<glyph glyph-name="play" unicode="" d="M772 333l-741-412q-13-7-22-2t-9 20v822q0 14 9 20t22-2l741-412q13-7 13-17t-13-17z" horiz-adv-x="785.7" />
|
||||||
|
|
||||||
<glyph glyph-name="calendar" unicode="" d="M800 700q42 0 71-29t29-71l0-600q0-40-29-70t-71-30l-700 0q-40 0-70 30t-30 70l0 600q0 42 30 71t70 29l46 0 0-100 160 0 0 100 290 0 0-100 160 0 0 100 44 0z m0-700l0 400-700 0 0-400 700 0z m-540 800l0-170-70 0 0 170 70 0z m450 0l0-170-70 0 0 170 70 0z" horiz-adv-x="900" />
|
<glyph glyph-name="link" unicode="" d="M294 116q14 14 34 14t36-14q32-34 0-70l-42-40q-56-56-132-56-78 0-134 56t-56 132q0 78 56 134l148 148q70 68 144 77t128-43q16-16 16-36t-16-36q-36-32-70 0-50 48-132-34l-148-146q-26-26-26-64t26-62q26-26 63-26t63 26z m450 574q56-56 56-132 0-78-56-134l-158-158q-74-72-150-72-62 0-112 50-14 14-14 34t14 36q14 14 35 14t35-14q50-48 122 24l158 156q28 28 28 64 0 38-28 62-24 26-56 31t-60-21l-50-50q-16-14-36-14t-34 14q-34 34 0 70l50 50q54 54 127 51t129-61z" horiz-adv-x="800" />
|
||||||
|
|
||||||
<glyph glyph-name="location" unicode="" d="M250 750q104 0 177-73t73-177q0-106-62-243t-126-223l-62-84q-10 12-27 35t-60 89-76 130-60 147-27 149q0 104 73 177t177 73z m0-388q56 0 96 40t40 96-40 95-96 39-95-39-39-95 39-96 95-40z" horiz-adv-x="500" />
|
<glyph glyph-name="calendar" unicode="" d="M800 700q42 0 71-29t29-71l0-600q0-40-29-70t-71-30l-700 0q-40 0-70 30t-30 70l0 600q0 42 30 71t70 29l46 0 0-100 160 0 0 100 290 0 0-100 160 0 0 100 44 0z m0-700l0 400-700 0 0-400 700 0z m-540 800l0-170-70 0 0 170 70 0z m450 0l0-170-70 0 0 170 70 0z" horiz-adv-x="900" />
|
||||||
|
|
||||||
|
<glyph glyph-name="location" unicode="" d="M250 750q104 0 177-73t73-177q0-106-62-243t-126-223l-62-84q-10 12-27 35t-60 89-76 130-60 147-27 149q0 104 73 177t177 73z m0-388q56 0 96 40t40 96-40 95-96 39-95-39-39-95 39-96 95-40z" horiz-adv-x="500" />
|
||||||
|
|
||||||
<glyph glyph-name="picture" unicode="" d="M357 529q0-45-31-76t-76-32-76 32-31 76 31 76 76 31 76-31 31-76z m572-215v-250h-786v107l178 179 90-89 285 285z m53 393h-893q-7 0-12-5t-6-13v-678q0-7 6-13t12-5h893q7 0 13 5t5 13v678q0 8-5 13t-13 5z m89-18v-678q0-37-26-63t-63-27h-893q-36 0-63 27t-26 63v678q0 37 26 63t63 27h893q37 0 63-27t26-63z" horiz-adv-x="1071.4" />
|
<glyph glyph-name="picture" unicode="" d="M357 529q0-45-31-76t-76-32-76 32-31 76 31 76 76 31 76-31 31-76z m572-215v-250h-786v107l178 179 90-89 285 285z m53 393h-893q-7 0-12-5t-6-13v-678q0-7 6-13t12-5h893q7 0 13 5t5 13v678q0 8-5 13t-13 5z m89-18v-678q0-37-26-63t-63-27h-893q-36 0-63 27t-26 63v678q0 37 26 63t63 27h893q37 0 63-27t26-63z" horiz-adv-x="1071.4" />
|
||||||
|
|
||||||
@@ -28,15 +30,15 @@
|
|||||||
|
|
||||||
<glyph glyph-name="down" unicode="" d="M939 399l-414-413q-10-11-25-11t-25 11l-414 413q-11 11-11 26t11 25l93 92q10 11 25 11t25-11l296-296 296 296q11 11 25 11t26-11l92-92q11-11 11-25t-11-26z" horiz-adv-x="1000" />
|
<glyph glyph-name="down" unicode="" d="M939 399l-414-413q-10-11-25-11t-25 11l-414 413q-11 11-11 26t11 25l93 92q10 11 25 11t25-11l296-296 296 296q11 11 25 11t26-11l92-92q11-11 11-25t-11-26z" horiz-adv-x="1000" />
|
||||||
|
|
||||||
<glyph glyph-name="retweet" unicode="" d="M714 11q0-7-5-13t-13-5h-535q-5 0-8 1t-5 4-3 4-2 7 0 6v335h-107q-15 0-25 11t-11 25q0 13 8 23l179 214q11 12 27 12t28-12l178-214q9-10 9-23 0-15-11-25t-25-11h-107v-214h321q9 0 14-6l89-108q4-5 4-11z m357 232q0-13-8-23l-178-214q-12-13-28-13t-27 13l-179 214q-8 10-8 23 0 14 11 25t25 11h107v214h-322q-9 0-14 7l-89 107q-4 5-4 11 0 7 5 12t13 6h536q4 0 7-1t5-4 3-5 2-6 1-7v-334h107q14 0 25-11t10-25z" horiz-adv-x="1071.4" />
|
<glyph glyph-name="retweet" unicode="" d="M714 11q0-7-5-13t-13-5h-535q-5 0-8 1t-5 4-3 4-2 7 0 6v335h-107q-15 0-25 11t-11 25q0 13 8 23l179 214q11 12 27 12t28-12l178-214q9-10 9-23 0-15-11-25t-25-11h-107v-214h321q9 0 14-6l89-108q4-5 4-11z m357 232q0-13-8-23l-178-214q-12-13-28-13t-27 13l-179 214q-8 10-8 23 0 14 11 25t25 11h107v214h-322q-9 0-14 7l-89 107q-4 5-4 11 0 7 5 12t13 6h536q4 0 7-1t5-4 3-5 2-6 1-7v-334h107q14 0 25-11t10-25z" horiz-adv-x="1071.4" />
|
||||||
|
|
||||||
<glyph glyph-name="search" unicode="" d="M772 78q30-34 6-62l-46-46q-36-32-68 0l-190 190q-74-42-156-42-128 0-223 95t-95 223 90 219 218 91 224-95 96-223q0-88-46-162z m-678 358q0-88 68-156t156-68 151 63 63 153q0 88-68 155t-156 67-151-63-63-151z" horiz-adv-x="789" />
|
<glyph glyph-name="search" unicode="" d="M772 78q30-34 6-62l-46-46q-36-32-68 0l-190 190q-74-42-156-42-128 0-223 95t-95 223 90 219 218 91 224-95 96-223q0-88-46-162z m-678 358q0-88 68-156t156-68 151 63 63 153q0 88-68 155t-156 67-151-63-63-151z" horiz-adv-x="789" />
|
||||||
|
|
||||||
<glyph glyph-name="pin" unicode="" d="M268 368v250q0 8-5 13t-13 5-13-5-5-13v-250q0-8 5-13t13-5 13 5 5 13z m375-197q0-14-11-25t-25-10h-239l-29-270q-1-7-6-11t-11-5h-1q-15 0-17 15l-43 271h-225q-15 0-25 10t-11 25q0 69 44 124t99 55v286q-29 0-50 21t-22 50 22 50 50 22h357q29 0 50-22t21-50-21-50-50-21v-286q55 0 99-55t44-124z" horiz-adv-x="642.9" />
|
<glyph glyph-name="pin" unicode="" d="M268 368v250q0 8-5 13t-13 5-13-5-5-13v-250q0-8 5-13t13-5 13 5 5 13z m375-197q0-14-11-25t-25-10h-239l-29-270q-1-7-6-11t-11-5h-1q-15 0-17 15l-43 271h-225q-15 0-25 10t-11 25q0 69 44 124t99 55v286q-29 0-50 21t-22 50 22 50 50 22h357q29 0 50-22t21-50-21-50-50-21v-286q55 0 99-55t44-124z" horiz-adv-x="642.9" />
|
||||||
|
|
||||||
<glyph glyph-name="cog" unicode="" d="M911 295l-133-56q-8-22-12-31l55-133-79-79-135 53q-9-4-31-12l-55-134-112 0-56 133q-11 4-33 13l-132-55-78 79 53 134q-1 3-4 9t-6 12-4 11l-131 55 0 112 131 56 14 33-54 132 78 79 133-54q22 9 33 13l55 132 112 0 56-132q14-5 31-13l133 55 80-79-54-135q6-12 12-30l133-56 0-112z m-447-111q69 0 118 48t49 118-49 119-118 50-119-50-49-119 49-118 119-48z" horiz-adv-x="928" />
|
<glyph glyph-name="cog" unicode="" d="M911 295l-133-56q-8-22-12-31l55-133-79-79-135 53q-9-4-31-12l-55-134-112 0-56 133q-11 4-33 13l-132-55-78 79 53 134q-1 3-4 9t-6 12-4 11l-131 55 0 112 131 56 14 33-54 132 78 79 133-54q22 9 33 13l55 132 112 0 56-132q14-5 31-13l133 55 80-79-54-135q6-12 12-30l133-56 0-112z m-447-111q69 0 118 48t49 118-49 119-118 50-119-50-49-119 49-118 119-48z" horiz-adv-x="928" />
|
||||||
|
|
||||||
<glyph glyph-name="rss-feed" unicode="" d="M184 93c0-51-43-91-93-91s-91 40-91 91c0 50 41 91 91 91s93-41 93-91z m261-85l-125 0c0 174-140 323-315 323l0 118c231 0 440-163 440-441z m259 0l-136 0c0 300-262 561-563 561l0 129c370 0 699-281 699-690z" horiz-adv-x="704" />
|
<glyph glyph-name="rss" unicode="" d="M184 93c0-51-43-91-93-91s-91 40-91 91c0 50 41 91 91 91s93-41 93-91z m261-85l-125 0c0 174-140 323-315 323l0 118c231 0 440-163 440-441z m259 0l-136 0c0 300-262 561-563 561l0 129c370 0 699-281 699-690z" horiz-adv-x="704" />
|
||||||
|
|
||||||
<glyph glyph-name="info" unicode="" d="M393 149v-134q0-9-7-15t-15-7h-134q-9 0-16 7t-7 15v134q0 9 7 16t16 6h134q9 0 15-6t7-16z m176 335q0-30-8-56t-20-43-31-33-32-25-34-19q-23-13-38-37t-15-37q0-10-7-18t-16-9h-134q-8 0-14 11t-6 20v26q0 46 37 87t79 60q33 16 47 32t14 42q0 24-26 41t-60 18q-36 0-60-16-20-14-60-64-7-9-17-9-7 0-14 4l-91 70q-8 6-9 14t3 16q89 148 259 148 45 0 90-17t81-46 59-72 23-88z" horiz-adv-x="571.4" />
|
<glyph glyph-name="info" unicode="" d="M393 149v-134q0-9-7-15t-15-7h-134q-9 0-16 7t-7 15v134q0 9 7 16t16 6h134q9 0 15-6t7-16z m176 335q0-30-8-56t-20-43-31-33-32-25-34-19q-23-13-38-37t-15-37q0-10-7-18t-16-9h-134q-8 0-14 11t-6 20v26q0 46 37 87t79 60q33 16 47 32t14 42q0 24-26 41t-60 18q-36 0-60-16-20-14-60-64-7-9-17-9-7 0-14 4l-91 70q-8 6-9 14t3 16q89 148 259 148 45 0 90-17t81-46 59-72 23-88z" horiz-adv-x="571.4" />
|
||||||
|
|
||||||
|
|||||||
|
Before Width: | Height: | Size: 5.9 KiB After Width: | Height: | Size: 6.1 KiB |
Binary file not shown.
Binary file not shown.
Binary file not shown.
@@ -1,5 +1,7 @@
|
|||||||
// @license http://www.gnu.org/licenses/agpl-3.0.html AGPL-3.0
|
// @license http://www.gnu.org/licenses/agpl-3.0.html AGPL-3.0
|
||||||
// SPDX-License-Identifier: AGPL-3.0-only
|
// SPDX-License-Identifier: AGPL-3.0-only
|
||||||
|
const LOADING_TEXT = "Loading...";
|
||||||
|
|
||||||
function insertBeforeLast(node, elem) {
|
function insertBeforeLast(node, elem) {
|
||||||
node.insertBefore(elem, node.childNodes[node.childNodes.length - 2]);
|
node.insertBefore(elem, node.childNodes[node.childNodes.length - 2]);
|
||||||
}
|
}
|
||||||
@@ -15,63 +17,177 @@ function isDuplicate(item, itemClass) {
|
|||||||
return document.querySelector(itemClass + " .tweet-link[href='" + href + "']") != null;
|
return document.querySelector(itemClass + " .tweet-link[href='" + href + "']") != null;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
function addScrollToURL(href) {
|
||||||
|
const url = new URL(href);
|
||||||
|
url.searchParams.append("scroll", "true");
|
||||||
|
return url.toString();
|
||||||
|
}
|
||||||
|
|
||||||
|
function fetchAndParse(url) {
|
||||||
|
return fetch(url)
|
||||||
|
.then(function (response) {
|
||||||
|
return response.text();
|
||||||
|
})
|
||||||
|
.then(function (html) {
|
||||||
|
var parser = new DOMParser();
|
||||||
|
return parser.parseFromString(html, "text/html");
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
window.onload = function () {
|
window.onload = function () {
|
||||||
const url = window.location.pathname;
|
const url = window.location.pathname;
|
||||||
const isTweet = url.indexOf("/status/") !== -1;
|
const isTweet = url.indexOf("/status/") !== -1;
|
||||||
|
const isHomepage = url === "/" || url === "";
|
||||||
|
|
||||||
|
if (isHomepage) return;
|
||||||
|
|
||||||
|
const isIncompleteThread =
|
||||||
|
isTweet && document.querySelector(".timeline-item.more-replies") != null;
|
||||||
|
|
||||||
const containerClass = isTweet ? ".replies" : ".timeline";
|
const containerClass = isTweet ? ".replies" : ".timeline";
|
||||||
const itemClass = containerClass + " > div:not(.top-ref)";
|
const itemClass = containerClass + " > div:not(.top-ref)";
|
||||||
|
|
||||||
var html = document.querySelector("html");
|
var html = document.querySelector("html");
|
||||||
var container = document.querySelector(containerClass);
|
var mainContainer = document.querySelector(containerClass);
|
||||||
var loading = false;
|
var loading = false;
|
||||||
|
|
||||||
function handleScroll(failed) {
|
function catchErrors(err) {
|
||||||
if (loading) return;
|
console.warn("Something went wrong.", err);
|
||||||
|
loading = true;
|
||||||
if (html.scrollTop + html.clientHeight >= html.scrollHeight - 3000) {
|
|
||||||
loading = true;
|
|
||||||
var loadMore = getLoadMore(document);
|
|
||||||
if (loadMore == null) return;
|
|
||||||
|
|
||||||
loadMore.children[0].text = "Loading...";
|
|
||||||
|
|
||||||
var url = new URL(loadMore.children[0].href);
|
|
||||||
url.searchParams.append("scroll", "true");
|
|
||||||
|
|
||||||
fetch(url.toString()).then(function (response) {
|
|
||||||
if (response.status === 404) throw "error";
|
|
||||||
|
|
||||||
return response.text();
|
|
||||||
}).then(function (html) {
|
|
||||||
var parser = new DOMParser();
|
|
||||||
var doc = parser.parseFromString(html, "text/html");
|
|
||||||
loadMore.remove();
|
|
||||||
|
|
||||||
for (var item of doc.querySelectorAll(itemClass)) {
|
|
||||||
if (item.className == "timeline-item show-more") continue;
|
|
||||||
if (isDuplicate(item, itemClass)) continue;
|
|
||||||
if (isTweet) container.appendChild(item);
|
|
||||||
else insertBeforeLast(container, item);
|
|
||||||
}
|
|
||||||
|
|
||||||
loading = false;
|
|
||||||
const newLoadMore = getLoadMore(doc);
|
|
||||||
if (newLoadMore == null) return;
|
|
||||||
if (isTweet) container.appendChild(newLoadMore);
|
|
||||||
else insertBeforeLast(container, newLoadMore);
|
|
||||||
}).catch(function (err) {
|
|
||||||
console.warn("Something went wrong.", err);
|
|
||||||
if (failed > 3) {
|
|
||||||
loadMore.children[0].text = "Error";
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
|
|
||||||
loading = false;
|
|
||||||
handleScroll((failed || 0) + 1);
|
|
||||||
});
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
window.addEventListener("scroll", () => handleScroll());
|
function appendLoadedReplies(loadMore) {
|
||||||
|
return function (doc) {
|
||||||
|
loadMore.remove();
|
||||||
|
|
||||||
|
for (var item of doc.querySelectorAll(itemClass)) {
|
||||||
|
if (item.className == "timeline-item show-more") continue;
|
||||||
|
if (isDuplicate(item, itemClass)) continue;
|
||||||
|
if (isTweet) mainContainer.appendChild(item);
|
||||||
|
else insertBeforeLast(mainContainer, item);
|
||||||
|
}
|
||||||
|
|
||||||
|
loading = false;
|
||||||
|
const newLoadMore = getLoadMore(doc);
|
||||||
|
if (newLoadMore == null) return;
|
||||||
|
if (isTweet) mainContainer.appendChild(newLoadMore);
|
||||||
|
else insertBeforeLast(mainContainer, newLoadMore);
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
var scrollListener = null;
|
||||||
|
if (!isIncompleteThread) {
|
||||||
|
scrollListener = (e) => {
|
||||||
|
if (loading) return;
|
||||||
|
|
||||||
|
if (html.scrollTop + html.clientHeight >= html.scrollHeight - 3000) {
|
||||||
|
loading = true;
|
||||||
|
var loadMore = getLoadMore(document);
|
||||||
|
if (loadMore == null) return;
|
||||||
|
|
||||||
|
loadMore.children[0].text = LOADING_TEXT;
|
||||||
|
|
||||||
|
const fetchUrl = addScrollToURL(loadMore.children[0].href);
|
||||||
|
fetchAndParse(fetchUrl)
|
||||||
|
.then(appendLoadedReplies(loadMore))
|
||||||
|
.catch(catchErrors);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
} else {
|
||||||
|
function getEarlierReplies(doc) {
|
||||||
|
return doc.querySelector(".timeline-item.more-replies.earlier-replies");
|
||||||
|
}
|
||||||
|
|
||||||
|
function getLaterReplies(doc) {
|
||||||
|
return doc.querySelector(".after-tweet > .timeline-item.more-replies");
|
||||||
|
}
|
||||||
|
|
||||||
|
function prependLoadedThread(loadMore) {
|
||||||
|
return function (doc) {
|
||||||
|
loadMore.remove();
|
||||||
|
|
||||||
|
const targetSelector = ".before-tweet.thread-line";
|
||||||
|
const threadContainer = document.querySelector(targetSelector);
|
||||||
|
|
||||||
|
const earlierReplies = doc.querySelector(targetSelector);
|
||||||
|
for (var i = earlierReplies.children.length - 1; i >= 0; i--) {
|
||||||
|
threadContainer.insertBefore(
|
||||||
|
earlierReplies.children[i],
|
||||||
|
threadContainer.children[0]
|
||||||
|
);
|
||||||
|
}
|
||||||
|
loading = false;
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
function appendLoadedThread(loadMore) {
|
||||||
|
return function (doc) {
|
||||||
|
const targetSelector = ".after-tweet.thread-line";
|
||||||
|
const threadContainer = document.querySelector(targetSelector);
|
||||||
|
|
||||||
|
const laterReplies = doc.querySelector(targetSelector);
|
||||||
|
while (laterReplies && laterReplies.firstChild) {
|
||||||
|
threadContainer.appendChild(laterReplies.firstChild);
|
||||||
|
}
|
||||||
|
|
||||||
|
const finalReply = threadContainer.lastElementChild;
|
||||||
|
if (finalReply.classList.contains("thread-last")) {
|
||||||
|
fetchAndParse(finalReply.children[0].href).then(function (lastDoc) {
|
||||||
|
loadMore.remove();
|
||||||
|
const anyResponses = lastDoc.querySelector(".replies");
|
||||||
|
anyResponses &&
|
||||||
|
insertBeforeLast(
|
||||||
|
threadContainer.parentElement.parentElement,
|
||||||
|
anyResponses
|
||||||
|
);
|
||||||
|
loading = false;
|
||||||
|
});
|
||||||
|
} else {
|
||||||
|
loadMore.remove();
|
||||||
|
loading = false;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
scrollListener = (e) => {
|
||||||
|
if (loading) return;
|
||||||
|
|
||||||
|
if (html.scrollTop <= html.clientHeight) {
|
||||||
|
var loadMore = getEarlierReplies(document);
|
||||||
|
if (loadMore == null) return;
|
||||||
|
loading = true;
|
||||||
|
|
||||||
|
loadMore.children[0].text = LOADING_TEXT;
|
||||||
|
|
||||||
|
fetchAndParse(loadMore.children[0].href)
|
||||||
|
.then(prependLoadedThread(loadMore))
|
||||||
|
.catch(catchErrors);
|
||||||
|
} else if (html.scrollTop + html.clientHeight >= html.scrollHeight - 3000) {
|
||||||
|
var loadMore = getLaterReplies(document);
|
||||||
|
if (loadMore != null) {
|
||||||
|
loading = true;
|
||||||
|
|
||||||
|
loadMore.children[0].text = LOADING_TEXT;
|
||||||
|
|
||||||
|
fetchAndParse(loadMore.children[0].href)
|
||||||
|
.then(appendLoadedThread(loadMore))
|
||||||
|
.catch(catchErrors);
|
||||||
|
} else {
|
||||||
|
loadMore = getLoadMore(document);
|
||||||
|
if (loadMore == null) return;
|
||||||
|
loading = true;
|
||||||
|
|
||||||
|
loadMore.children[0].text = LOADING_TEXT;
|
||||||
|
|
||||||
|
mainContainer = document.querySelector(containerClass);
|
||||||
|
fetchAndParse(loadMore.children[0].href)
|
||||||
|
.then(appendLoadedReplies(loadMore))
|
||||||
|
.catch(catchErrors);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
window.addEventListener("scroll", scrollListener);
|
||||||
};
|
};
|
||||||
// @license-end
|
// @license-end
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
# About
|
# About
|
||||||
|
|
||||||
|
This Nitter instance is hosted by [Kuuro.net](https://kuuro.net/services)
|
||||||
|
|
||||||
Nitter is a free and open source alternative Twitter front-end focused on
|
Nitter is a free and open source alternative Twitter front-end focused on
|
||||||
privacy and performance. The source is available on GitHub at
|
privacy and performance. The source is available on GitHub at
|
||||||
<https://github.com/zedeus/nitter>
|
<https://github.com/zedeus/nitter>
|
||||||
@@ -43,6 +45,28 @@ Twitter account.
|
|||||||
|
|
||||||
## Donating
|
## Donating
|
||||||
|
|
||||||
|
You can either donate to me for hosting this instance, or to the Nitter project for development.
|
||||||
|
|
||||||
|
Donating to me helps keep this Nitter instance running for everyone. Donating to the Nitter project helps the development of the software itself. Both are appreciated!
|
||||||
|
|
||||||
|
### Donating to me
|
||||||
|
<br>
|
||||||
|
|
||||||
|
#### Credit/debit card and bank transfer
|
||||||
|
|
||||||
|
Buy Me A Coffee: <https://buymeacoffee.com/kuu7o>
|
||||||
|
|
||||||
|
#### Cryptocurrency
|
||||||
|
|
||||||
|
Monero: 44AAFK5nJEM8CMFGHh1DnPDVLnsAXu9y7VcKTAar5F1AGwQcoCi5hwC22efxGWsp4HfwRRwRRMj2X5ypTo3vkjpJPMxwynZ \
|
||||||
|
Bitcoin: bc1q8uzvmm3y23kfmvmvva2n2uptqty5hzmlg2vjyt \
|
||||||
|
Ethereum: 0xe7Bf8f78Ffc92F4b50f879AEc7Fd41A463DC9c28 \
|
||||||
|
Litecoin: LaqWXCsNBinE5ho2cUJiDZ4MFmPH6QYZ4s \
|
||||||
|
Wownero: Wo4NPaJdM3yETa2JXfjJbgKbD4BHXSEsk4Vj6F5gbcb99yaG7fAgZQGLp2EwvNDqE4QKWm63mtWfvfkbbX8dipeR31zPxDbsd \
|
||||||
|
Tron: TMbMarrcsiVVgB5CRMqhShcGHMXYozpocg
|
||||||
|
|
||||||
|
### Donating to the Nitter project
|
||||||
|
|
||||||
Liberapay: https://liberapay.com/zedeus \
|
Liberapay: https://liberapay.com/zedeus \
|
||||||
Patreon: https://patreon.com/nitter \
|
Patreon: https://patreon.com/nitter \
|
||||||
BTC: bc1qpqpzjkcpgluhzf7x9yqe7jfe8gpfm5v08mdr55 \
|
BTC: bc1qpqpzjkcpgluhzf7x9yqe7jfe8gpfm5v08mdr55 \
|
||||||
@@ -53,4 +77,4 @@ ZEC: u1vndfqtzyy6qkzhkapxelel7ams38wmfeccu3fdpy2wkuc4erxyjm8ncjhnyg747x6t0kf0faq
|
|||||||
|
|
||||||
## Contact
|
## Contact
|
||||||
|
|
||||||
Feel free to join our [Matrix channel](https://matrix.to/#/#nitter:matrix.org).
|
Feel free to join Nitter [Matrix channel](https://matrix.to/#/#nitter:matrix.org).
|
||||||
|
|||||||
BIN
screenshot.png
BIN
screenshot.png
Binary file not shown.
|
Before Width: | Height: | Size: 957 KiB After Width: | Height: | Size: 790 KiB |
129
src/api.nim
129
src/api.nim
@@ -1,71 +1,101 @@
|
|||||||
# SPDX-License-Identifier: AGPL-3.0-only
|
# SPDX-License-Identifier: AGPL-3.0-only
|
||||||
import asyncdispatch, httpclient, uri, strutils, sequtils, sugar
|
import asyncdispatch, httpclient, strutils, sequtils, sugar
|
||||||
import packedjson
|
import packedjson
|
||||||
import types, query, formatters, consts, apiutils, parser
|
import types, query, formatters, consts, apiutils, parser
|
||||||
import experimental/parser as newParser
|
import experimental/parser as newParser
|
||||||
|
|
||||||
proc mediaUrl(id: string; cursor: string): SessionAwareUrl =
|
# Helper to generate params object for GraphQL requests
|
||||||
let
|
proc genParams(variables: string; fieldToggles = ""): seq[(string, string)] =
|
||||||
cookieVariables = userMediaVariables % [id, cursor]
|
result.add ("variables", variables)
|
||||||
oauthVariables = userTweetsVariables % [id, cursor]
|
result.add ("features", gqlFeatures)
|
||||||
result = SessionAwareUrl(
|
if fieldToggles.len > 0:
|
||||||
cookieUrl: graphUserMedia ? {"variables": cookieVariables, "features": gqlFeatures},
|
result.add ("fieldToggles", fieldToggles)
|
||||||
oauthUrl: graphUserMediaV2 ? {"variables": oauthVariables, "features": gqlFeatures}
|
|
||||||
|
proc apiUrl(endpoint, variables: string; fieldToggles = ""): ApiUrl =
|
||||||
|
return ApiUrl(endpoint: endpoint, params: genParams(variables, fieldToggles))
|
||||||
|
|
||||||
|
proc apiReq(endpoint, variables: string; fieldToggles = ""): ApiReq =
|
||||||
|
let url = apiUrl(endpoint, variables, fieldToggles)
|
||||||
|
return ApiReq(cookie: url, oauth: url)
|
||||||
|
|
||||||
|
proc mediaUrl(id: string; cursor: string): ApiReq =
|
||||||
|
result = ApiReq(
|
||||||
|
cookie: apiUrl(graphUserMedia, userMediaVars % [id, cursor]),
|
||||||
|
oauth: apiUrl(graphUserMediaV2, restIdVars % [id, cursor])
|
||||||
|
)
|
||||||
|
|
||||||
|
proc userTweetsUrl(id: string; cursor: string): ApiReq =
|
||||||
|
result = ApiReq(
|
||||||
|
# cookie: apiUrl(graphUserTweets, userTweetsVars % [id, cursor], userTweetsFieldToggles),
|
||||||
|
oauth: apiUrl(graphUserTweetsV2, restIdVars % [id, cursor])
|
||||||
|
)
|
||||||
|
# might change this in the future pending testing
|
||||||
|
result.cookie = result.oauth
|
||||||
|
|
||||||
|
proc userTweetsAndRepliesUrl(id: string; cursor: string): ApiReq =
|
||||||
|
let cookieVars = userTweetsAndRepliesVars % [id, cursor]
|
||||||
|
result = ApiReq(
|
||||||
|
cookie: apiUrl(graphUserTweetsAndReplies, cookieVars, userTweetsFieldToggles),
|
||||||
|
oauth: apiUrl(graphUserTweetsAndRepliesV2, restIdVars % [id, cursor])
|
||||||
|
)
|
||||||
|
|
||||||
|
proc tweetDetailUrl(id: string; cursor: string): ApiReq =
|
||||||
|
let cookieVars = tweetDetailVars % [id, cursor]
|
||||||
|
result = ApiReq(
|
||||||
|
cookie: apiUrl(graphTweetDetail, cookieVars, tweetDetailFieldToggles),
|
||||||
|
oauth: apiUrl(graphTweet, tweetVars % [id, cursor])
|
||||||
|
)
|
||||||
|
|
||||||
|
proc userUrl(username: string): ApiReq =
|
||||||
|
let cookieVars = """{"screen_name":"$1","withGrokTranslatedBio":false}""" % username
|
||||||
|
result = ApiReq(
|
||||||
|
cookie: apiUrl(graphUser, cookieVars, tweetDetailFieldToggles),
|
||||||
|
oauth: apiUrl(graphUserV2, """{"screen_name": "$1"}""" % username)
|
||||||
)
|
)
|
||||||
|
|
||||||
proc getGraphUser*(username: string): Future[User] {.async.} =
|
proc getGraphUser*(username: string): Future[User] {.async.} =
|
||||||
if username.len == 0: return
|
if username.len == 0: return
|
||||||
let
|
let js = await fetchRaw(userUrl(username))
|
||||||
variables = """{"screen_name": "$1"}""" % username
|
|
||||||
params = {"variables": variables, "features": gqlFeatures}
|
|
||||||
js = await fetchRaw(graphUser ? params, Api.userScreenName)
|
|
||||||
result = parseGraphUser(js)
|
result = parseGraphUser(js)
|
||||||
|
|
||||||
proc getGraphUserById*(id: string): Future[User] {.async.} =
|
proc getGraphUserById*(id: string): Future[User] {.async.} =
|
||||||
if id.len == 0 or id.any(c => not c.isDigit): return
|
if id.len == 0 or id.any(c => not c.isDigit): return
|
||||||
let
|
let
|
||||||
variables = """{"rest_id": "$1"}""" % id
|
url = apiReq(graphUserById, """{"rest_id": "$1"}""" % id)
|
||||||
params = {"variables": variables, "features": gqlFeatures}
|
js = await fetchRaw(url)
|
||||||
js = await fetchRaw(graphUserById ? params, Api.userRestId)
|
|
||||||
result = parseGraphUser(js)
|
result = parseGraphUser(js)
|
||||||
|
|
||||||
proc getGraphUserTweets*(id: string; kind: TimelineKind; after=""): Future[Profile] {.async.} =
|
proc getGraphUserTweets*(id: string; kind: TimelineKind; after=""): Future[Profile] {.async.} =
|
||||||
if id.len == 0: return
|
if id.len == 0: return
|
||||||
let
|
let
|
||||||
cursor = if after.len > 0: "\"cursor\":\"$1\"," % after else: ""
|
cursor = if after.len > 0: "\"cursor\":\"$1\"," % after else: ""
|
||||||
variables = userTweetsVariables % [id, cursor]
|
url = case kind
|
||||||
params = {"variables": variables, "features": gqlFeatures}
|
of TimelineKind.tweets: userTweetsUrl(id, cursor)
|
||||||
js = case kind
|
of TimelineKind.replies: userTweetsAndRepliesUrl(id, cursor)
|
||||||
of TimelineKind.tweets:
|
of TimelineKind.media: mediaUrl(id, cursor)
|
||||||
await fetch(graphUserTweets ? params, Api.userTweets)
|
js = await fetch(url)
|
||||||
of TimelineKind.replies:
|
|
||||||
await fetch(graphUserTweetsAndReplies ? params, Api.userTweetsAndReplies)
|
|
||||||
of TimelineKind.media:
|
|
||||||
await fetch(mediaUrl(id, cursor), Api.userMedia)
|
|
||||||
result = parseGraphTimeline(js, after)
|
result = parseGraphTimeline(js, after)
|
||||||
|
|
||||||
proc getGraphListTweets*(id: string; after=""): Future[Timeline] {.async.} =
|
proc getGraphListTweets*(id: string; after=""): Future[Timeline] {.async.} =
|
||||||
if id.len == 0: return
|
if id.len == 0: return
|
||||||
let
|
let
|
||||||
cursor = if after.len > 0: "\"cursor\":\"$1\"," % after else: ""
|
cursor = if after.len > 0: "\"cursor\":\"$1\"," % after else: ""
|
||||||
variables = listTweetsVariables % [id, cursor]
|
url = apiReq(graphListTweets, restIdVars % [id, cursor])
|
||||||
params = {"variables": variables, "features": gqlFeatures}
|
js = await fetch(url)
|
||||||
js = await fetch(graphListTweets ? params, Api.listTweets)
|
|
||||||
result = parseGraphTimeline(js, after).tweets
|
result = parseGraphTimeline(js, after).tweets
|
||||||
|
|
||||||
proc getGraphListBySlug*(name, list: string): Future[List] {.async.} =
|
proc getGraphListBySlug*(name, list: string): Future[List] {.async.} =
|
||||||
let
|
let
|
||||||
variables = %*{"screenName": name, "listSlug": list}
|
variables = %*{"screenName": name, "listSlug": list}
|
||||||
params = {"variables": $variables, "features": gqlFeatures}
|
url = apiReq(graphListBySlug, $variables)
|
||||||
url = graphListBySlug ? params
|
js = await fetch(url)
|
||||||
result = parseGraphList(await fetch(url, Api.listBySlug))
|
result = parseGraphList(js)
|
||||||
|
|
||||||
proc getGraphList*(id: string): Future[List] {.async.} =
|
proc getGraphList*(id: string): Future[List] {.async.} =
|
||||||
let
|
let
|
||||||
variables = """{"listId": "$1"}""" % id
|
url = apiReq(graphListById, """{"listId": "$1"}""" % id)
|
||||||
params = {"variables": variables, "features": gqlFeatures}
|
js = await fetch(url)
|
||||||
url = graphListById ? params
|
result = parseGraphList(js)
|
||||||
result = parseGraphList(await fetch(url, Api.list))
|
|
||||||
|
|
||||||
proc getGraphListMembers*(list: List; after=""): Future[Result[User]] {.async.} =
|
proc getGraphListMembers*(list: List; after=""): Future[Result[User]] {.async.} =
|
||||||
if list.id.len == 0: return
|
if list.id.len == 0: return
|
||||||
@@ -79,24 +109,23 @@ proc getGraphListMembers*(list: List; after=""): Future[Result[User]] {.async.}
|
|||||||
}
|
}
|
||||||
if after.len > 0:
|
if after.len > 0:
|
||||||
variables["cursor"] = % after
|
variables["cursor"] = % after
|
||||||
let url = graphListMembers ? {"variables": $variables, "features": gqlFeatures}
|
let
|
||||||
result = parseGraphListMembers(await fetchRaw(url, Api.listMembers), after)
|
url = apiReq(graphListMembers, $variables)
|
||||||
|
js = await fetchRaw(url)
|
||||||
|
result = parseGraphListMembers(js, after)
|
||||||
|
|
||||||
proc getGraphTweetResult*(id: string): Future[Tweet] {.async.} =
|
proc getGraphTweetResult*(id: string): Future[Tweet] {.async.} =
|
||||||
if id.len == 0: return
|
if id.len == 0: return
|
||||||
let
|
let
|
||||||
variables = """{"rest_id": "$1"}""" % id
|
url = apiReq(graphTweetResult, """{"rest_id": "$1"}""" % id)
|
||||||
params = {"variables": variables, "features": gqlFeatures}
|
js = await fetch(url)
|
||||||
js = await fetch(graphTweetResult ? params, Api.tweetResult)
|
|
||||||
result = parseGraphTweetResult(js)
|
result = parseGraphTweetResult(js)
|
||||||
|
|
||||||
proc getGraphTweet(id: string; after=""): Future[Conversation] {.async.} =
|
proc getGraphTweet(id: string; after=""): Future[Conversation] {.async.} =
|
||||||
if id.len == 0: return
|
if id.len == 0: return
|
||||||
let
|
let
|
||||||
cursor = if after.len > 0: "\"cursor\":\"$1\"," % after else: ""
|
cursor = if after.len > 0: "\"cursor\":\"$1\"," % after else: ""
|
||||||
variables = tweetVariables % [id, cursor]
|
js = await fetch(tweetDetailUrl(id, cursor))
|
||||||
params = {"variables": variables, "features": gqlFeatures}
|
|
||||||
js = await fetch(graphTweet ? params, Api.tweetDetail)
|
|
||||||
result = parseGraphConversation(js, id)
|
result = parseGraphConversation(js, id)
|
||||||
|
|
||||||
proc getReplies*(id, after: string): Future[Result[Chain]] {.async.} =
|
proc getReplies*(id, after: string): Future[Result[Chain]] {.async.} =
|
||||||
@@ -116,6 +145,7 @@ proc getGraphTweetSearch*(query: Query; after=""): Future[Timeline] {.async.} =
|
|||||||
var
|
var
|
||||||
variables = %*{
|
variables = %*{
|
||||||
"rawQuery": q,
|
"rawQuery": q,
|
||||||
|
"query_source": "typedQuery",
|
||||||
"count": 20,
|
"count": 20,
|
||||||
"product": "Latest",
|
"product": "Latest",
|
||||||
"withDownvotePerspective": false,
|
"withDownvotePerspective": false,
|
||||||
@@ -124,8 +154,10 @@ proc getGraphTweetSearch*(query: Query; after=""): Future[Timeline] {.async.} =
|
|||||||
}
|
}
|
||||||
if after.len > 0:
|
if after.len > 0:
|
||||||
variables["cursor"] = % after
|
variables["cursor"] = % after
|
||||||
let url = graphSearchTimeline ? {"variables": $variables, "features": gqlFeatures}
|
let
|
||||||
result = parseGraphSearch[Tweets](await fetch(url, Api.search), after)
|
url = apiReq(graphSearchTimeline, $variables)
|
||||||
|
js = await fetch(url)
|
||||||
|
result = parseGraphSearch[Tweets](js, after)
|
||||||
result.query = query
|
result.query = query
|
||||||
|
|
||||||
proc getGraphUserSearch*(query: Query; after=""): Future[Result[User]] {.async.} =
|
proc getGraphUserSearch*(query: Query; after=""): Future[Result[User]] {.async.} =
|
||||||
@@ -135,6 +167,7 @@ proc getGraphUserSearch*(query: Query; after=""): Future[Result[User]] {.async.}
|
|||||||
var
|
var
|
||||||
variables = %*{
|
variables = %*{
|
||||||
"rawQuery": query.text,
|
"rawQuery": query.text,
|
||||||
|
"query_source": "typedQuery",
|
||||||
"count": 20,
|
"count": 20,
|
||||||
"product": "People",
|
"product": "People",
|
||||||
"withDownvotePerspective": false,
|
"withDownvotePerspective": false,
|
||||||
@@ -145,13 +178,15 @@ proc getGraphUserSearch*(query: Query; after=""): Future[Result[User]] {.async.}
|
|||||||
variables["cursor"] = % after
|
variables["cursor"] = % after
|
||||||
result.beginning = false
|
result.beginning = false
|
||||||
|
|
||||||
let url = graphSearchTimeline ? {"variables": $variables, "features": gqlFeatures}
|
let
|
||||||
result = parseGraphSearch[User](await fetch(url, Api.search), after)
|
url = apiReq(graphSearchTimeline, $variables)
|
||||||
|
js = await fetch(url)
|
||||||
|
result = parseGraphSearch[User](js, after)
|
||||||
result.query = query
|
result.query = query
|
||||||
|
|
||||||
proc getPhotoRail*(id: string): Future[PhotoRail] {.async.} =
|
proc getPhotoRail*(id: string): Future[PhotoRail] {.async.} =
|
||||||
if id.len == 0: return
|
if id.len == 0: return
|
||||||
let js = await fetch(mediaUrl(id, ""), Api.userMedia)
|
let js = await fetch(mediaUrl(id, ""))
|
||||||
result = parseGraphPhotoRail(js)
|
result = parseGraphPhotoRail(js)
|
||||||
|
|
||||||
proc resolve*(url: string; prefs: Prefs): Future[string] {.async.} =
|
proc resolve*(url: string; prefs: Prefs): Future[string] {.async.} =
|
||||||
|
|||||||
@@ -1,16 +1,30 @@
|
|||||||
# SPDX-License-Identifier: AGPL-3.0-only
|
# SPDX-License-Identifier: AGPL-3.0-only
|
||||||
import httpclient, asyncdispatch, options, strutils, uri, times, math, tables
|
import httpclient, asyncdispatch, options, strutils, uri, times, math, tables, logging
|
||||||
import jsony, packedjson, zippy, oauth1
|
import jsony, packedjson, zippy, oauth1
|
||||||
import types, auth, consts, parserutils, http_pool
|
import types, auth, consts, parserutils, http_pool, tid
|
||||||
import experimental/types/common
|
import experimental/types/common
|
||||||
|
|
||||||
const
|
const
|
||||||
rlRemaining = "x-rate-limit-remaining"
|
rlRemaining = "x-rate-limit-remaining"
|
||||||
rlReset = "x-rate-limit-reset"
|
rlReset = "x-rate-limit-reset"
|
||||||
rlLimit = "x-rate-limit-limit"
|
rlLimit = "x-rate-limit-limit"
|
||||||
errorsToSkip = {doesntExist, tweetNotFound, timeout, unauthorized, badRequest}
|
errorsToSkip = {null, doesntExist, tweetNotFound, timeout, unauthorized, badRequest}
|
||||||
|
|
||||||
var pool: HttpPool
|
var
|
||||||
|
pool: HttpPool
|
||||||
|
disableTid: bool
|
||||||
|
|
||||||
|
proc setDisableTid*(disable: bool) =
|
||||||
|
disableTid = disable
|
||||||
|
|
||||||
|
proc toUrl(req: ApiReq; sessionKind: SessionKind): Uri =
|
||||||
|
case sessionKind
|
||||||
|
of oauth:
|
||||||
|
let o = req.oauth
|
||||||
|
parseUri("https://api.x.com/graphql") / o.endpoint ? o.params
|
||||||
|
of cookie:
|
||||||
|
let c = req.cookie
|
||||||
|
parseUri("https://x.com/i/api/graphql") / c.endpoint ? c.params
|
||||||
|
|
||||||
proc getOauthHeader(url, oauthToken, oauthTokenSecret: string): string =
|
proc getOauthHeader(url, oauthToken, oauthTokenSecret: string): string =
|
||||||
let
|
let
|
||||||
@@ -32,15 +46,15 @@ proc getOauthHeader(url, oauthToken, oauthTokenSecret: string): string =
|
|||||||
proc getCookieHeader(authToken, ct0: string): string =
|
proc getCookieHeader(authToken, ct0: string): string =
|
||||||
"auth_token=" & authToken & "; ct0=" & ct0
|
"auth_token=" & authToken & "; ct0=" & ct0
|
||||||
|
|
||||||
proc genHeaders*(session: Session, url: string): HttpHeaders =
|
proc genHeaders*(session: Session, url: Uri): Future[HttpHeaders] {.async.} =
|
||||||
result = newHttpHeaders({
|
result = newHttpHeaders({
|
||||||
"connection": "keep-alive",
|
"connection": "keep-alive",
|
||||||
"content-type": "application/json",
|
"content-type": "application/json",
|
||||||
"x-twitter-active-user": "yes",
|
"x-twitter-active-user": "yes",
|
||||||
"x-twitter-client-language": "en",
|
"x-twitter-client-language": "en",
|
||||||
"authority": "api.x.com",
|
"origin": "https://x.com",
|
||||||
"accept-encoding": "gzip",
|
"accept-encoding": "gzip",
|
||||||
"accept-language": "en-US,en;q=0.9",
|
"accept-language": "en-US,en;q=0.5",
|
||||||
"accept": "*/*",
|
"accept": "*/*",
|
||||||
"DNT": "1",
|
"DNT": "1",
|
||||||
"user-agent": "Mozilla/5.0 (Macintosh; Intel Mac OS X 10_15_7) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/122.0.0.0 Safari/537.36"
|
"user-agent": "Mozilla/5.0 (Macintosh; Intel Mac OS X 10_15_7) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/122.0.0.0 Safari/537.36"
|
||||||
@@ -48,23 +62,28 @@ proc genHeaders*(session: Session, url: string): HttpHeaders =
|
|||||||
|
|
||||||
case session.kind
|
case session.kind
|
||||||
of SessionKind.oauth:
|
of SessionKind.oauth:
|
||||||
result["authorization"] = getOauthHeader(url, session.oauthToken, session.oauthSecret)
|
result["authority"] = "api.x.com"
|
||||||
|
result["authorization"] = getOauthHeader($url, session.oauthToken, session.oauthSecret)
|
||||||
of SessionKind.cookie:
|
of SessionKind.cookie:
|
||||||
result["authorization"] = "Bearer AAAAAAAAAAAAAAAAAAAAAFQODgEAAAAAVHTp76lzh3rFzcHbmHVvQxYYpTw%3DckAlMINMjmCwxUcaXbAN4XqJVdgMJaHqNOFgPMK0zN1qLqLQCF"
|
|
||||||
result["x-twitter-auth-type"] = "OAuth2Session"
|
result["x-twitter-auth-type"] = "OAuth2Session"
|
||||||
result["x-csrf-token"] = session.ct0
|
result["x-csrf-token"] = session.ct0
|
||||||
result["cookie"] = getCookieHeader(session.authToken, session.ct0)
|
result["cookie"] = getCookieHeader(session.authToken, session.ct0)
|
||||||
|
if disableTid:
|
||||||
|
result["authorization"] = bearerToken2
|
||||||
|
else:
|
||||||
|
result["authorization"] = bearerToken
|
||||||
|
result["x-client-transaction-id"] = await genTid(url.path)
|
||||||
|
|
||||||
proc getAndValidateSession*(api: Api): Future[Session] {.async.} =
|
proc getAndValidateSession*(req: ApiReq): Future[Session] {.async.} =
|
||||||
result = await getSession(api)
|
result = await getSession(req)
|
||||||
case result.kind
|
case result.kind
|
||||||
of SessionKind.oauth:
|
of SessionKind.oauth:
|
||||||
if result.oauthToken.len == 0:
|
if result.oauthToken.len == 0:
|
||||||
echo "[sessions] Empty oauth token, session: ", result.id
|
warn "[sessions] Empty oauth token, session: ", result.pretty
|
||||||
raise rateLimitError()
|
raise rateLimitError()
|
||||||
of SessionKind.cookie:
|
of SessionKind.cookie:
|
||||||
if result.authToken.len == 0 or result.ct0.len == 0:
|
if result.authToken.len == 0 or result.ct0.len == 0:
|
||||||
echo "[sessions] Empty cookie credentials, session: ", result.id
|
warn "[sessions] Empty cookie credentials, session: ", result.pretty
|
||||||
raise rateLimitError()
|
raise rateLimitError()
|
||||||
|
|
||||||
template fetchImpl(result, fetchBody) {.dirty.} =
|
template fetchImpl(result, fetchBody) {.dirty.} =
|
||||||
@@ -73,7 +92,7 @@ template fetchImpl(result, fetchBody) {.dirty.} =
|
|||||||
|
|
||||||
try:
|
try:
|
||||||
var resp: AsyncResponse
|
var resp: AsyncResponse
|
||||||
pool.use(genHeaders(session, $url)):
|
pool.use(await genHeaders(session, url)):
|
||||||
template getContent =
|
template getContent =
|
||||||
resp = await c.get($url)
|
resp = await c.get($url)
|
||||||
result = await resp.body
|
result = await resp.body
|
||||||
@@ -89,7 +108,7 @@ template fetchImpl(result, fetchBody) {.dirty.} =
|
|||||||
remaining = parseInt(resp.headers[rlRemaining])
|
remaining = parseInt(resp.headers[rlRemaining])
|
||||||
reset = parseInt(resp.headers[rlReset])
|
reset = parseInt(resp.headers[rlReset])
|
||||||
limit = parseInt(resp.headers[rlLimit])
|
limit = parseInt(resp.headers[rlLimit])
|
||||||
session.setRateLimit(api, remaining, reset, limit)
|
session.setRateLimit(req, remaining, reset, limit)
|
||||||
|
|
||||||
if result.len > 0:
|
if result.len > 0:
|
||||||
if resp.headers.getOrDefault("content-encoding") == "gzip":
|
if resp.headers.getOrDefault("content-encoding") == "gzip":
|
||||||
@@ -98,24 +117,22 @@ template fetchImpl(result, fetchBody) {.dirty.} =
|
|||||||
if result.startsWith("{\"errors"):
|
if result.startsWith("{\"errors"):
|
||||||
let errors = result.fromJson(Errors)
|
let errors = result.fromJson(Errors)
|
||||||
if errors notin errorsToSkip:
|
if errors notin errorsToSkip:
|
||||||
echo "Fetch error, API: ", api, ", errors: ", errors
|
error "Fetch error, API: ", url.path, ", errors: ", errors
|
||||||
if errors in {expiredToken, badToken, locked}:
|
if errors in {expiredToken, badToken, locked}:
|
||||||
invalidate(session)
|
invalidate(session)
|
||||||
raise rateLimitError()
|
raise rateLimitError()
|
||||||
elif errors in {rateLimited}:
|
elif errors in {rateLimited}:
|
||||||
# rate limit hit, resets after 24 hours
|
# rate limit hit, resets after 24 hours
|
||||||
setLimited(session, api)
|
setLimited(session, req)
|
||||||
raise rateLimitError()
|
raise rateLimitError()
|
||||||
elif result.startsWith("429 Too Many Requests"):
|
elif result.startsWith("429 Too Many Requests"):
|
||||||
echo "[sessions] 429 error, API: ", api, ", session: ", session.id
|
warn "[sessions] 429 error, API: ", url.path, ", session: ", session.pretty
|
||||||
session.apis[api].remaining = 0
|
|
||||||
# rate limit hit, resets after the 15 minute window
|
|
||||||
raise rateLimitError()
|
raise rateLimitError()
|
||||||
|
|
||||||
fetchBody
|
fetchBody
|
||||||
|
|
||||||
if resp.status == $Http400:
|
if resp.status == $Http400:
|
||||||
echo "ERROR 400, ", api, ": ", result
|
error "ERROR 400, ", url.path, ": ", result
|
||||||
raise newException(InternalError, $url)
|
raise newException(InternalError, $url)
|
||||||
except InternalError as e:
|
except InternalError as e:
|
||||||
raise e
|
raise e
|
||||||
@@ -124,8 +141,11 @@ template fetchImpl(result, fetchBody) {.dirty.} =
|
|||||||
except OSError as e:
|
except OSError as e:
|
||||||
raise e
|
raise e
|
||||||
except Exception as e:
|
except Exception as e:
|
||||||
let id = if session.isNil: "null" else: $session.id
|
let s = session.pretty
|
||||||
echo "error: ", e.name, ", msg: ", e.msg, ", sessionId: ", id, ", url: ", url
|
var safeUrl = $url
|
||||||
|
if safeUrl.len > 100:
|
||||||
|
safeUrl = safeUrl[0 .. 100] & "..."
|
||||||
|
error "error: ", e.name, ", msg: ", e.msg, ", session: ", s, ", url: ", safeUrl
|
||||||
raise rateLimitError()
|
raise rateLimitError()
|
||||||
finally:
|
finally:
|
||||||
release(session)
|
release(session)
|
||||||
@@ -134,44 +154,37 @@ template retry(bod) =
|
|||||||
try:
|
try:
|
||||||
bod
|
bod
|
||||||
except RateLimitError:
|
except RateLimitError:
|
||||||
echo "[sessions] Rate limited, retrying ", api, " request..."
|
info "[sessions] Rate limited, retrying ", req.cookie.endpoint, " request..."
|
||||||
bod
|
bod
|
||||||
|
|
||||||
proc fetch*(url: Uri | SessionAwareUrl; api: Api): Future[JsonNode] {.async.} =
|
proc fetch*(req: ApiReq): Future[JsonNode] {.async.} =
|
||||||
retry:
|
retry:
|
||||||
var
|
var
|
||||||
body: string
|
body: string
|
||||||
session = await getAndValidateSession(api)
|
session = await getAndValidateSession(req)
|
||||||
|
|
||||||
when url is SessionAwareUrl:
|
let url = req.toUrl(session.kind)
|
||||||
let url = case session.kind
|
|
||||||
of SessionKind.oauth: url.oauthUrl
|
|
||||||
of SessionKind.cookie: url.cookieUrl
|
|
||||||
|
|
||||||
fetchImpl body:
|
fetchImpl body:
|
||||||
if body.startsWith('{') or body.startsWith('['):
|
if body.startsWith('{') or body.startsWith('['):
|
||||||
result = parseJson(body)
|
result = parseJson(body)
|
||||||
else:
|
else:
|
||||||
echo resp.status, ": ", body, " --- url: ", url
|
warn resp.status, ": ", body, " --- url: ", url
|
||||||
result = newJNull()
|
result = newJNull()
|
||||||
|
|
||||||
let error = result.getError
|
let error = result.getError
|
||||||
if error != null and error notin errorsToSkip:
|
if error != null and error notin errorsToSkip:
|
||||||
echo "Fetch error, API: ", api, ", error: ", error
|
error "Fetch error, API: ", url.path, ", error: ", error
|
||||||
if error in {expiredToken, badToken, locked}:
|
if error in {expiredToken, badToken, locked}:
|
||||||
invalidate(session)
|
invalidate(session)
|
||||||
raise rateLimitError()
|
raise rateLimitError()
|
||||||
|
|
||||||
proc fetchRaw*(url: Uri | SessionAwareUrl; api: Api): Future[string] {.async.} =
|
proc fetchRaw*(req: ApiReq): Future[string] {.async.} =
|
||||||
retry:
|
retry:
|
||||||
var session = await getAndValidateSession(api)
|
var session = await getAndValidateSession(req)
|
||||||
|
let url = req.toUrl(session.kind)
|
||||||
when url is SessionAwareUrl:
|
|
||||||
let url = case session.kind
|
|
||||||
of SessionKind.oauth: url.oauthUrl
|
|
||||||
of SessionKind.cookie: url.cookieUrl
|
|
||||||
|
|
||||||
fetchImpl result:
|
fetchImpl result:
|
||||||
if not (result.startsWith('{') or result.startsWith('[')):
|
if not (result.startsWith('{') or result.startsWith('[')):
|
||||||
echo resp.status, ": ", result, " --- url: ", url
|
warn resp.status, ": ", result, " --- url: ", url
|
||||||
result.setLen(0)
|
result.setLen(0)
|
||||||
|
|||||||
84
src/auth.nim
84
src/auth.nim
@@ -1,33 +1,41 @@
|
|||||||
#SPDX-License-Identifier: AGPL-3.0-only
|
#SPDX-License-Identifier: AGPL-3.0-only
|
||||||
import std/[asyncdispatch, times, json, random, sequtils, strutils, tables, packedsets, os]
|
import std/[asyncdispatch, times, json, random, strutils, tables, packedsets, os, logging]
|
||||||
import types
|
import types, consts
|
||||||
import experimental/parser/session
|
import experimental/parser/session
|
||||||
|
|
||||||
# max requests at a time per session to avoid race conditions
|
# max requests at a time per session to avoid race conditions
|
||||||
const
|
const
|
||||||
maxConcurrentReqs = 2
|
maxConcurrentReqs = 2
|
||||||
hourInSeconds = 60 * 60
|
hourInSeconds = 60 * 60
|
||||||
apiMaxReqs: Table[Api, int] = {
|
|
||||||
Api.search: 50,
|
|
||||||
Api.tweetDetail: 500,
|
|
||||||
Api.userTweets: 500,
|
|
||||||
Api.userTweetsAndReplies: 500,
|
|
||||||
Api.userMedia: 500,
|
|
||||||
Api.userRestId: 500,
|
|
||||||
Api.userScreenName: 500,
|
|
||||||
Api.tweetResult: 500,
|
|
||||||
Api.list: 500,
|
|
||||||
Api.listTweets: 500,
|
|
||||||
Api.listMembers: 500,
|
|
||||||
Api.listBySlug: 500
|
|
||||||
}.toTable
|
|
||||||
|
|
||||||
var
|
var
|
||||||
sessionPool: seq[Session]
|
sessionPool: seq[Session]
|
||||||
enableLogging = false
|
enableLogging = false
|
||||||
|
|
||||||
template log(str: varargs[string, `$`]) =
|
proc logSession(args: varargs[string, `$`]) =
|
||||||
echo "[sessions] ", str.join("")
|
var s = "[sessions] "
|
||||||
|
for arg in args:
|
||||||
|
s.add arg
|
||||||
|
info s
|
||||||
|
|
||||||
|
proc endpoint(req: ApiReq; session: Session): string =
|
||||||
|
case session.kind
|
||||||
|
of oauth: req.oauth.endpoint
|
||||||
|
of cookie: req.cookie.endpoint
|
||||||
|
|
||||||
|
proc pretty*(session: Session): string =
|
||||||
|
if session.isNil:
|
||||||
|
return "<null>"
|
||||||
|
|
||||||
|
if session.id > 0 and session.username.len > 0:
|
||||||
|
result = $session.id & " (" & session.username & ")"
|
||||||
|
elif session.username.len > 0:
|
||||||
|
result = session.username
|
||||||
|
elif session.id > 0:
|
||||||
|
result = $session.id
|
||||||
|
else:
|
||||||
|
result = "<unknown>"
|
||||||
|
result = $session.kind & " " & result
|
||||||
|
|
||||||
proc snowflakeToEpoch(flake: int64): int64 =
|
proc snowflakeToEpoch(flake: int64): int64 =
|
||||||
int64(((flake shr 22) + 1288834974657) div 1000)
|
int64(((flake shr 22) + 1288834974657) div 1000)
|
||||||
@@ -57,8 +65,7 @@ proc getSessionPoolHealth*(): JsonNode =
|
|||||||
for api in session.apis.keys:
|
for api in session.apis.keys:
|
||||||
let
|
let
|
||||||
apiStatus = session.apis[api]
|
apiStatus = session.apis[api]
|
||||||
limit = if apiStatus.limit > 0: apiStatus.limit else: apiMaxReqs.getOrDefault(api, 0)
|
reqs = apiStatus.limit - apiStatus.remaining
|
||||||
reqs = limit - apiStatus.remaining
|
|
||||||
|
|
||||||
# no requests made with this session and endpoint since the limit reset
|
# no requests made with this session and endpoint since the limit reset
|
||||||
if apiStatus.reset < now:
|
if apiStatus.reset < now:
|
||||||
@@ -123,14 +130,15 @@ proc rateLimitError*(): ref RateLimitError =
|
|||||||
proc noSessionsError*(): ref NoSessionsError =
|
proc noSessionsError*(): ref NoSessionsError =
|
||||||
newException(NoSessionsError, "no sessions available")
|
newException(NoSessionsError, "no sessions available")
|
||||||
|
|
||||||
proc isLimited(session: Session; api: Api): bool =
|
proc isLimited(session: Session; req: ApiReq): bool =
|
||||||
if session.isNil:
|
if session.isNil:
|
||||||
return true
|
return true
|
||||||
|
|
||||||
if session.limited and api != Api.userTweets:
|
let api = req.endpoint(session)
|
||||||
|
if session.limited and api != graphUserTweetsV2:
|
||||||
if (epochTime().int - session.limitedAt) > hourInSeconds:
|
if (epochTime().int - session.limitedAt) > hourInSeconds:
|
||||||
session.limited = false
|
session.limited = false
|
||||||
log "resetting limit: ", session.id
|
logSession "resetting limit: ", session.pretty
|
||||||
return false
|
return false
|
||||||
else:
|
else:
|
||||||
return true
|
return true
|
||||||
@@ -141,12 +149,12 @@ proc isLimited(session: Session; api: Api): bool =
|
|||||||
else:
|
else:
|
||||||
return false
|
return false
|
||||||
|
|
||||||
proc isReady(session: Session; api: Api): bool =
|
proc isReady(session: Session; req: ApiReq): bool =
|
||||||
not (session.isNil or session.pending > maxConcurrentReqs or session.isLimited(api))
|
not (session.isNil or session.pending > maxConcurrentReqs or session.isLimited(req))
|
||||||
|
|
||||||
proc invalidate*(session: var Session) =
|
proc invalidate*(session: var Session) =
|
||||||
if session.isNil: return
|
if session.isNil: return
|
||||||
log "invalidating: ", session.id
|
logSession "invalidating: ", session.pretty
|
||||||
|
|
||||||
# TODO: This isn't sufficient, but it works for now
|
# TODO: This isn't sufficient, but it works for now
|
||||||
let idx = sessionPool.find(session)
|
let idx = sessionPool.find(session)
|
||||||
@@ -157,24 +165,26 @@ proc release*(session: Session) =
|
|||||||
if session.isNil: return
|
if session.isNil: return
|
||||||
dec session.pending
|
dec session.pending
|
||||||
|
|
||||||
proc getSession*(api: Api): Future[Session] {.async.} =
|
proc getSession*(req: ApiReq): Future[Session] {.async.} =
|
||||||
for i in 0 ..< sessionPool.len:
|
for i in 0 ..< sessionPool.len:
|
||||||
if result.isReady(api): break
|
if result.isReady(req): break
|
||||||
result = sessionPool.sample()
|
result = sessionPool.sample()
|
||||||
|
|
||||||
if not result.isNil and result.isReady(api):
|
if not result.isNil and result.isReady(req):
|
||||||
inc result.pending
|
inc result.pending
|
||||||
else:
|
else:
|
||||||
log "no sessions available for API: ", api
|
logSession "no sessions available for API: ", req.cookie.endpoint
|
||||||
raise noSessionsError()
|
raise noSessionsError()
|
||||||
|
|
||||||
proc setLimited*(session: Session; api: Api) =
|
proc setLimited*(session: Session; req: ApiReq) =
|
||||||
|
let api = req.endpoint(session)
|
||||||
session.limited = true
|
session.limited = true
|
||||||
session.limitedAt = epochTime().int
|
session.limitedAt = epochTime().int
|
||||||
log "rate limited by api: ", api, ", reqs left: ", session.apis[api].remaining, ", id: ", session.id
|
logSession "rate limited by api: ", api, ", reqs left: ", session.apis[api].remaining, ", ", session.pretty
|
||||||
|
|
||||||
proc setRateLimit*(session: Session; api: Api; remaining, reset, limit: int) =
|
proc setRateLimit*(session: Session; req: ApiReq; remaining, reset, limit: int) =
|
||||||
# avoid undefined behavior in race conditions
|
# avoid undefined behavior in race conditions
|
||||||
|
let api = req.endpoint(session)
|
||||||
if api in session.apis:
|
if api in session.apis:
|
||||||
let rateLimit = session.apis[api]
|
let rateLimit = session.apis[api]
|
||||||
if rateLimit.reset >= reset and rateLimit.remaining < remaining:
|
if rateLimit.reset >= reset and rateLimit.remaining < remaining:
|
||||||
@@ -189,15 +199,15 @@ proc initSessionPool*(cfg: Config; path: string) =
|
|||||||
enableLogging = cfg.enableDebug
|
enableLogging = cfg.enableDebug
|
||||||
|
|
||||||
if path.endsWith(".json"):
|
if path.endsWith(".json"):
|
||||||
log "ERROR: .json is not supported, the file must be a valid JSONL file ending in .jsonl"
|
fatal ".json is not supported, the file must be a valid JSONL file ending in .jsonl"
|
||||||
quit 1
|
quit 1
|
||||||
|
|
||||||
if not fileExists(path):
|
if not fileExists(path):
|
||||||
log "ERROR: ", path, " not found. This file is required to authenticate API requests."
|
fatal path, " not found. This file is required to authenticate API requests."
|
||||||
quit 1
|
quit 1
|
||||||
|
|
||||||
log "parsing JSONL account sessions file: ", path
|
logSession "parsing JSONL account sessions file: ", path
|
||||||
for line in path.lines:
|
for line in path.lines:
|
||||||
sessionPool.add parseSession(line)
|
sessionPool.add parseSession(line)
|
||||||
|
|
||||||
log "successfully added ", sessionPool.len, " valid account sessions"
|
logSession "successfully added ", sessionPool.len, " valid account sessions"
|
||||||
|
|||||||
@@ -1,6 +1,6 @@
|
|||||||
# SPDX-License-Identifier: AGPL-3.0-only
|
# SPDX-License-Identifier: AGPL-3.0-only
|
||||||
import parsecfg except Config
|
import parsecfg except Config
|
||||||
import types, strutils
|
import types, strutils, sequtils
|
||||||
|
|
||||||
proc get*[T](config: parseCfg.Config; section, key: string; default: T): T =
|
proc get*[T](config: parseCfg.Config; section, key: string; default: T): T =
|
||||||
let val = config.getSectionValue(section, key)
|
let val = config.getSectionValue(section, key)
|
||||||
@@ -9,6 +9,7 @@ proc get*[T](config: parseCfg.Config; section, key: string; default: T): T =
|
|||||||
when T is int: parseInt(val)
|
when T is int: parseInt(val)
|
||||||
elif T is bool: parseBool(val)
|
elif T is bool: parseBool(val)
|
||||||
elif T is string: val
|
elif T is string: val
|
||||||
|
elif T is seq[string]: val.split(',').mapIt(it.strip())
|
||||||
|
|
||||||
proc getConfig*(path: string): (Config, parseCfg.Config) =
|
proc getConfig*(path: string): (Config, parseCfg.Config) =
|
||||||
var cfg = loadConfig(path)
|
var cfg = loadConfig(path)
|
||||||
@@ -39,8 +40,11 @@ proc getConfig*(path: string): (Config, parseCfg.Config) =
|
|||||||
minTokens: cfg.get("Config", "tokenCount", 10),
|
minTokens: cfg.get("Config", "tokenCount", 10),
|
||||||
enableRss: cfg.get("Config", "enableRSS", true),
|
enableRss: cfg.get("Config", "enableRSS", true),
|
||||||
enableDebug: cfg.get("Config", "enableDebug", false),
|
enableDebug: cfg.get("Config", "enableDebug", false),
|
||||||
|
logLevel: cfg.get("Config", "logLevel", ""),
|
||||||
proxy: cfg.get("Config", "proxy", ""),
|
proxy: cfg.get("Config", "proxy", ""),
|
||||||
proxyAuth: cfg.get("Config", "proxyAuth", "")
|
proxyAuth: cfg.get("Config", "proxyAuth", ""),
|
||||||
|
defaultFollowedAccounts: cfg.get("Config", "defaultFollowedAccounts", @["eff", "fsf"]),
|
||||||
|
disableTid: cfg.get("Config", "disableTid", false)
|
||||||
)
|
)
|
||||||
|
|
||||||
return (conf, cfg)
|
return (conf, cfg)
|
||||||
|
|||||||
112
src/consts.nim
112
src/consts.nim
@@ -1,29 +1,36 @@
|
|||||||
# SPDX-License-Identifier: AGPL-3.0-only
|
# SPDX-License-Identifier: AGPL-3.0-only
|
||||||
import uri, strutils
|
import strutils
|
||||||
|
|
||||||
const
|
const
|
||||||
consumerKey* = "3nVuSoBZnx6U4vzUxf5w"
|
consumerKey* = "3nVuSoBZnx6U4vzUxf5w"
|
||||||
consumerSecret* = "Bcs59EFbbsdF6Sl9Ng71smgStWEGwXXKSjYvPVt7qys"
|
consumerSecret* = "Bcs59EFbbsdF6Sl9Ng71smgStWEGwXXKSjYvPVt7qys"
|
||||||
|
bearerToken* = "Bearer AAAAAAAAAAAAAAAAAAAAANRILgAAAAAAnNwIzUejRCOuH5E6I8xnZz4puTs%3D1Zv7ttfk8LF81IUq16cHjhLTvJu4FA33AGWWjCpTnA"
|
||||||
|
bearerToken2* = "Bearer AAAAAAAAAAAAAAAAAAAAAFXzAwAAAAAAMHCxpeSDG1gLNLghVe8d74hl6k4%3DRUMF4xAQLsbeBhTSRrCiQpJtxoGWeyHrDb5te2jpGskWDFW82F"
|
||||||
|
|
||||||
gql = parseUri("https://api.x.com") / "graphql"
|
graphUser* = "-oaLodhGbbnzJBACb1kk2Q/UserByScreenName"
|
||||||
|
graphUserV2* = "WEoGnYB0EG1yGwamDCF6zg/UserResultByScreenNameQuery"
|
||||||
graphUser* = gql / "u7wQyGi6oExe8_TRWGMq4Q/UserResultByScreenNameQuery"
|
graphUserById* = "VN33vKXrPT7p35DgNR27aw/UserResultByIdQuery"
|
||||||
graphUserById* = gql / "oPppcargziU1uDQHAUmH-A/UserResultByIdQuery"
|
graphUserTweetsV2* = "6QdSuZ5feXxOadEdXa4XZg/UserWithProfileTweetsQueryV2"
|
||||||
graphUserTweets* = gql / "JLApJKFY0MxGTzCoK6ps8Q/UserWithProfileTweetsQueryV2"
|
graphUserTweetsAndRepliesV2* = "BDX77Xzqypdt11-mDfgdpQ/UserWithProfileTweetsAndRepliesQueryV2"
|
||||||
graphUserTweetsAndReplies* = gql / "Y86LQY7KMvxn5tu3hFTyPg/UserWithProfileTweetsAndRepliesQueryV2"
|
graphUserTweets* = "oRJs8SLCRNRbQzuZG93_oA/UserTweets"
|
||||||
graphUserMedia* = gql / "36oKqyQ7E_9CmtONGjJRsA/UserMedia"
|
graphUserTweetsAndReplies* = "kkaJ0Mf34PZVarrxzLihjg/UserTweetsAndReplies"
|
||||||
graphUserMediaV2* = gql / "PDfFf8hGeJvUCiTyWtw4wQ/MediaTimelineV2"
|
graphUserMedia* = "36oKqyQ7E_9CmtONGjJRsA/UserMedia"
|
||||||
graphTweet* = gql / "Vorskcd2tZ-tc4Gx3zbk4Q/ConversationTimelineV2"
|
graphUserMediaV2* = "bp0e_WdXqgNBIwlLukzyYA/MediaTimelineV2"
|
||||||
graphTweetResult* = gql / "sITyJdhRPpvpEjg4waUmTA/TweetResultByIdQuery"
|
graphTweet* = "Y4Erk_-0hObvLpz0Iw3bzA/ConversationTimeline"
|
||||||
graphSearchTimeline* = gql / "KI9jCXUx3Ymt-hDKLOZb9Q/SearchTimeline"
|
graphTweetDetail* = "YVyS4SfwYW7Uw5qwy0mQCA/TweetDetail"
|
||||||
graphListById* = gql / "oygmAig8kjn0pKsx_bUadQ/ListByRestId"
|
graphTweetResult* = "nzme9KiYhfIOrrLrPP_XeQ/TweetResultByIdQuery"
|
||||||
graphListBySlug* = gql / "88GTz-IPPWLn1EiU8XoNVg/ListBySlug"
|
graphSearchTimeline* = "bshMIjqDk8LTXTq4w91WKw/SearchTimeline"
|
||||||
graphListMembers* = gql / "kSmxeqEeelqdHSR7jMnb_w/ListMembers"
|
graphListById* = "cIUpT1UjuGgl_oWiY7Snhg/ListByRestId"
|
||||||
graphListTweets* = gql / "BbGLL1ZfMibdFNWlk7a0Pw/ListTimeline"
|
graphListBySlug* = "K6wihoTiTrzNzSF8y1aeKQ/ListBySlug"
|
||||||
|
graphListMembers* = "fuVHh5-gFn8zDBBxb8wOMA/ListMembers"
|
||||||
|
graphListTweets* = "VQf8_XQynI3WzH6xopOMMQ/ListTimeline"
|
||||||
|
|
||||||
gqlFeatures* = """{
|
gqlFeatures* = """{
|
||||||
|
"android_ad_formats_media_component_render_overlay_enabled": false,
|
||||||
"android_graphql_skip_api_media_color_palette": false,
|
"android_graphql_skip_api_media_color_palette": false,
|
||||||
|
"android_professional_link_spotlight_display_enabled": false,
|
||||||
"blue_business_profile_image_shape_enabled": false,
|
"blue_business_profile_image_shape_enabled": false,
|
||||||
|
"commerce_android_shop_module_enabled": false,
|
||||||
"creator_subscriptions_subscription_count_enabled": false,
|
"creator_subscriptions_subscription_count_enabled": false,
|
||||||
"creator_subscriptions_tweet_preview_api_enabled": true,
|
"creator_subscriptions_tweet_preview_api_enabled": true,
|
||||||
"freedom_of_speech_not_reach_fetch_enabled": true,
|
"freedom_of_speech_not_reach_fetch_enabled": true,
|
||||||
@@ -33,8 +40,9 @@ const
|
|||||||
"interactive_text_enabled": false,
|
"interactive_text_enabled": false,
|
||||||
"longform_notetweets_consumption_enabled": true,
|
"longform_notetweets_consumption_enabled": true,
|
||||||
"longform_notetweets_inline_media_enabled": true,
|
"longform_notetweets_inline_media_enabled": true,
|
||||||
"longform_notetweets_richtext_consumption_enabled": true,
|
|
||||||
"longform_notetweets_rich_text_read_enabled": true,
|
"longform_notetweets_rich_text_read_enabled": true,
|
||||||
|
"longform_notetweets_richtext_consumption_enabled": true,
|
||||||
|
"mobile_app_spotlight_module_enabled": false,
|
||||||
"responsive_web_edit_tweet_api_enabled": true,
|
"responsive_web_edit_tweet_api_enabled": true,
|
||||||
"responsive_web_enhance_cards_enabled": false,
|
"responsive_web_enhance_cards_enabled": false,
|
||||||
"responsive_web_graphql_exclude_directive_enabled": true,
|
"responsive_web_graphql_exclude_directive_enabled": true,
|
||||||
@@ -43,6 +51,7 @@ const
|
|||||||
"responsive_web_media_download_video_enabled": false,
|
"responsive_web_media_download_video_enabled": false,
|
||||||
"responsive_web_text_conversations_enabled": false,
|
"responsive_web_text_conversations_enabled": false,
|
||||||
"responsive_web_twitter_article_tweet_consumption_enabled": true,
|
"responsive_web_twitter_article_tweet_consumption_enabled": true,
|
||||||
|
"unified_cards_destination_url_params_enabled": false,
|
||||||
"responsive_web_twitter_blue_verified_badge_is_enabled": true,
|
"responsive_web_twitter_blue_verified_badge_is_enabled": true,
|
||||||
"rweb_lists_timeline_redesign_enabled": true,
|
"rweb_lists_timeline_redesign_enabled": true,
|
||||||
"spaces_2022_h2_clipping": true,
|
"spaces_2022_h2_clipping": true,
|
||||||
@@ -83,11 +92,21 @@ const
|
|||||||
"payments_enabled": false,
|
"payments_enabled": false,
|
||||||
"responsive_web_profile_redirect_enabled": false,
|
"responsive_web_profile_redirect_enabled": false,
|
||||||
"responsive_web_grok_show_grok_translated_post": false,
|
"responsive_web_grok_show_grok_translated_post": false,
|
||||||
"responsive_web_grok_community_note_auto_translation_is_enabled": false
|
"responsive_web_grok_community_note_auto_translation_is_enabled": false,
|
||||||
|
"profile_label_improvements_pcf_label_in_profile_enabled": false,
|
||||||
|
"grok_android_analyze_trend_fetch_enabled": false,
|
||||||
|
"grok_translations_community_note_auto_translation_is_enabled": false,
|
||||||
|
"grok_translations_post_auto_translation_is_enabled": false,
|
||||||
|
"grok_translations_community_note_translation_is_enabled": false,
|
||||||
|
"grok_translations_timeline_user_bio_auto_translation_is_enabled": false,
|
||||||
|
"subscriptions_feature_can_gift_premium": false,
|
||||||
|
"responsive_web_twitter_article_notes_tab_enabled": false,
|
||||||
|
"subscriptions_verification_info_is_identity_verified_enabled": false,
|
||||||
|
"hidden_profile_subscriptions_enabled": false
|
||||||
}""".replace(" ", "").replace("\n", "")
|
}""".replace(" ", "").replace("\n", "")
|
||||||
|
|
||||||
tweetVariables* = """{
|
tweetVars* = """{
|
||||||
"focalTweetId": "$1",
|
"postId": "$1",
|
||||||
$2
|
$2
|
||||||
"includeHasBirdwatchNotes": false,
|
"includeHasBirdwatchNotes": false,
|
||||||
"includePromotedContent": false,
|
"includePromotedContent": false,
|
||||||
@@ -96,29 +115,25 @@ const
|
|||||||
"withV2Timeline": true
|
"withV2Timeline": true
|
||||||
}""".replace(" ", "").replace("\n", "")
|
}""".replace(" ", "").replace("\n", "")
|
||||||
|
|
||||||
# oldUserTweetsVariables* = """{
|
tweetDetailVars* = """{
|
||||||
# "userId": "$1", $2
|
"focalTweetId": "$1",
|
||||||
# "count": 20,
|
$2
|
||||||
# "includePromotedContent": false,
|
"referrer": "profile",
|
||||||
# "withDownvotePerspective": false,
|
"with_rux_injections": false,
|
||||||
# "withReactionsMetadata": false,
|
"rankingMode": "Relevance",
|
||||||
# "withReactionsPerspective": false,
|
"includePromotedContent": true,
|
||||||
# "withVoice": false,
|
"withCommunity": true,
|
||||||
# "withV2Timeline": true
|
"withQuickPromoteEligibilityTweetFields": true,
|
||||||
# }
|
"withBirdwatchNotes": true,
|
||||||
# """
|
"withVoice": true
|
||||||
|
}""".replace(" ", "").replace("\n", "")
|
||||||
|
|
||||||
userTweetsVariables* = """{
|
restIdVars* = """{
|
||||||
"rest_id": "$1", $2
|
"rest_id": "$1", $2
|
||||||
"count": 20
|
"count": 20
|
||||||
}"""
|
}"""
|
||||||
|
|
||||||
listTweetsVariables* = """{
|
userMediaVars* = """{
|
||||||
"rest_id": "$1", $2
|
|
||||||
"count": 20
|
|
||||||
}"""
|
|
||||||
|
|
||||||
userMediaVariables* = """{
|
|
||||||
"userId": "$1", $2
|
"userId": "$1", $2
|
||||||
"count": 20,
|
"count": 20,
|
||||||
"includePromotedContent": false,
|
"includePromotedContent": false,
|
||||||
@@ -126,3 +141,24 @@ const
|
|||||||
"withBirdwatchNotes": false,
|
"withBirdwatchNotes": false,
|
||||||
"withVoice": true
|
"withVoice": true
|
||||||
}""".replace(" ", "").replace("\n", "")
|
}""".replace(" ", "").replace("\n", "")
|
||||||
|
|
||||||
|
userTweetsVars* = """{
|
||||||
|
"userId": "$1", $2
|
||||||
|
"count": 20,
|
||||||
|
"includePromotedContent": false,
|
||||||
|
"withQuickPromoteEligibilityTweetFields": true,
|
||||||
|
"withVoice": true
|
||||||
|
}""".replace(" ", "").replace("\n", "")
|
||||||
|
|
||||||
|
userTweetsAndRepliesVars* = """{
|
||||||
|
"userId": "$1", $2
|
||||||
|
"count": 20,
|
||||||
|
"includePromotedContent": false,
|
||||||
|
"withCommunity": true,
|
||||||
|
"withVoice": true
|
||||||
|
}""".replace(" ", "").replace("\n", "")
|
||||||
|
|
||||||
|
fieldToggles* = """{"withArticlePlainText":false,"withViewCounts":true}"""
|
||||||
|
userFieldToggles = """{"withPayments":false,"withAuxiliaryUserLabels":true}"""
|
||||||
|
userTweetsFieldToggles* = """{"withArticlePlainText":false}"""
|
||||||
|
tweetDetailFieldToggles* = """{"withArticleRichContentState":true,"withArticlePlainText":false,"withGrokAnalyze":false,"withDisallowedReplyControls":false}"""
|
||||||
|
|||||||
@@ -1,21 +1,53 @@
|
|||||||
import options
|
import options, strutils
|
||||||
import jsony
|
import jsony
|
||||||
import user, ../types/[graphuser, graphlistmembers]
|
import user, utils, ../types/[graphuser, graphlistmembers]
|
||||||
from ../../types import User, VerifiedType, Result, Query, QueryKind
|
from ../../types import User, VerifiedType, Result, Query, QueryKind
|
||||||
|
|
||||||
|
proc parseUserResult*(userResult: UserResult): User =
|
||||||
|
result = userResult.legacy
|
||||||
|
|
||||||
|
if result.verifiedType == none and userResult.isBlueVerified:
|
||||||
|
result.verifiedType = blue
|
||||||
|
|
||||||
|
if result.username.len == 0 and userResult.core.screenName.len > 0:
|
||||||
|
result.id = userResult.restId
|
||||||
|
result.username = userResult.core.screenName
|
||||||
|
result.fullname = userResult.core.name
|
||||||
|
result.userPic = userResult.avatar.imageUrl.replace("_normal", "")
|
||||||
|
|
||||||
|
if userResult.privacy.isSome:
|
||||||
|
result.protected = userResult.privacy.get.protected
|
||||||
|
|
||||||
|
if userResult.location.isSome:
|
||||||
|
result.location = userResult.location.get.location
|
||||||
|
|
||||||
|
if userResult.core.createdAt.len > 0:
|
||||||
|
result.joinDate = parseTwitterDate(userResult.core.createdAt)
|
||||||
|
|
||||||
|
if userResult.verification.isSome:
|
||||||
|
let v = userResult.verification.get
|
||||||
|
if v.verifiedType != VerifiedType.none:
|
||||||
|
result.verifiedType = v.verifiedType
|
||||||
|
|
||||||
|
if userResult.profileBio.isSome and result.bio.len == 0:
|
||||||
|
result.bio = userResult.profileBio.get.description
|
||||||
|
|
||||||
proc parseGraphUser*(json: string): User =
|
proc parseGraphUser*(json: string): User =
|
||||||
if json.len == 0 or json[0] != '{':
|
if json.len == 0 or json[0] != '{':
|
||||||
return
|
return
|
||||||
|
|
||||||
let raw = json.fromJson(GraphUser)
|
let
|
||||||
|
raw = json.fromJson(GraphUser)
|
||||||
|
userResult =
|
||||||
|
if raw.data.userResult.isSome: raw.data.userResult.get.result
|
||||||
|
elif raw.data.user.isSome: raw.data.user.get.result
|
||||||
|
else: UserResult()
|
||||||
|
|
||||||
if raw.data.userResult.result.unavailableReason.get("") == "Suspended":
|
if userResult.unavailableReason.get("") == "Suspended" or
|
||||||
|
userResult.reason.get("") == "Suspended":
|
||||||
return User(suspended: true)
|
return User(suspended: true)
|
||||||
|
|
||||||
result = raw.data.userResult.result.legacy
|
result = parseUserResult(userResult)
|
||||||
result.id = raw.data.userResult.result.restId
|
|
||||||
if result.verifiedType == VerifiedType.none and raw.data.userResult.result.isBlueVerified:
|
|
||||||
result.verifiedType = blue
|
|
||||||
|
|
||||||
proc parseGraphListMembers*(json, cursor: string): Result[User] =
|
proc parseGraphListMembers*(json, cursor: string): Result[User] =
|
||||||
result = Result[User](
|
result = Result[User](
|
||||||
@@ -31,7 +63,7 @@ proc parseGraphListMembers*(json, cursor: string): Result[User] =
|
|||||||
of TimelineTimelineItem:
|
of TimelineTimelineItem:
|
||||||
let userResult = entry.content.itemContent.userResults.result
|
let userResult = entry.content.itemContent.userResults.result
|
||||||
if userResult.restId.len > 0:
|
if userResult.restId.len > 0:
|
||||||
result.content.add userResult.legacy
|
result.content.add parseUserResult(userResult)
|
||||||
of TimelineTimelineCursor:
|
of TimelineTimelineCursor:
|
||||||
if entry.content.cursorType == "Bottom":
|
if entry.content.cursorType == "Bottom":
|
||||||
result.bottom = entry.content.value
|
result.bottom = entry.content.value
|
||||||
|
|||||||
@@ -13,6 +13,7 @@ proc parseSession*(raw: string): Session =
|
|||||||
result = Session(
|
result = Session(
|
||||||
kind: SessionKind.oauth,
|
kind: SessionKind.oauth,
|
||||||
id: parseBiggestInt(id),
|
id: parseBiggestInt(id),
|
||||||
|
username: session.username,
|
||||||
oauthToken: session.oauthToken,
|
oauthToken: session.oauthToken,
|
||||||
oauthSecret: session.oauthTokenSecret
|
oauthSecret: session.oauthTokenSecret
|
||||||
)
|
)
|
||||||
@@ -21,6 +22,7 @@ proc parseSession*(raw: string): Session =
|
|||||||
result = Session(
|
result = Session(
|
||||||
kind: SessionKind.cookie,
|
kind: SessionKind.cookie,
|
||||||
id: id,
|
id: id,
|
||||||
|
username: session.username,
|
||||||
authToken: session.authToken,
|
authToken: session.authToken,
|
||||||
ct0: session.ct0
|
ct0: session.ct0
|
||||||
)
|
)
|
||||||
|
|||||||
8
src/experimental/parser/tid.nim
Normal file
8
src/experimental/parser/tid.nim
Normal file
@@ -0,0 +1,8 @@
|
|||||||
|
import jsony
|
||||||
|
import ../types/tid
|
||||||
|
export TidPair
|
||||||
|
|
||||||
|
proc parseTidPairs*(raw: string): seq[TidPair] =
|
||||||
|
result = raw.fromJson(seq[TidPair])
|
||||||
|
if result.len == 0:
|
||||||
|
raise newException(ValueError, "Parsing pairs failed: " & raw)
|
||||||
@@ -1,6 +1,9 @@
|
|||||||
import std/[options, tables, strutils, strformat, sugar]
|
|
||||||
|
import std/[options, tables, strutils, strformat, sugar, logging]
|
||||||
|
|
||||||
import jsony
|
import jsony
|
||||||
import user, ../types/unifiedcard
|
import user, ../types/unifiedcard
|
||||||
|
import ../../formatters
|
||||||
from ../../types import Card, CardKind, Video
|
from ../../types import Card, CardKind, Video
|
||||||
from ../../utils import twimg, https
|
from ../../utils import twimg, https
|
||||||
|
|
||||||
@@ -77,6 +80,18 @@ proc parseMedia(component: Component; card: UnifiedCard; result: var Card) =
|
|||||||
of model3d:
|
of model3d:
|
||||||
result.title = "Unsupported 3D model ad"
|
result.title = "Unsupported 3D model ad"
|
||||||
|
|
||||||
|
proc parseGrokShare(data: ComponentData; card: UnifiedCard; result: var Card) =
|
||||||
|
result.kind = summaryLarge
|
||||||
|
|
||||||
|
data.destination.parseDestination(card, result)
|
||||||
|
result.dest = "Answer by Grok"
|
||||||
|
|
||||||
|
for msg in data.conversationPreview:
|
||||||
|
if msg.sender == "USER":
|
||||||
|
result.title = msg.message.shorten(70)
|
||||||
|
elif msg.sender == "AGENT":
|
||||||
|
result.text = msg.message.shorten(500)
|
||||||
|
|
||||||
proc parseUnifiedCard*(json: string): Card =
|
proc parseUnifiedCard*(json: string): Card =
|
||||||
let card = json.fromJson(UnifiedCard)
|
let card = json.fromJson(UnifiedCard)
|
||||||
|
|
||||||
@@ -92,12 +107,14 @@ proc parseUnifiedCard*(json: string): Card =
|
|||||||
component.parseMedia(card, result)
|
component.parseMedia(card, result)
|
||||||
of buttonGroup:
|
of buttonGroup:
|
||||||
discard
|
discard
|
||||||
|
of grokShare:
|
||||||
|
component.data.parseGrokShare(card, result)
|
||||||
of ComponentType.jobDetails:
|
of ComponentType.jobDetails:
|
||||||
component.data.parseJobDetails(card, result)
|
component.data.parseJobDetails(card, result)
|
||||||
of ComponentType.hidden:
|
of ComponentType.hidden:
|
||||||
result.kind = CardKind.hidden
|
result.kind = CardKind.hidden
|
||||||
of ComponentType.unknown:
|
of ComponentType.unknown:
|
||||||
echo "ERROR: Unknown component type: ", json
|
error "ERROR: Unknown component type: ", json
|
||||||
|
|
||||||
case component.kind
|
case component.kind
|
||||||
of twitterListDetails:
|
of twitterListDetails:
|
||||||
|
|||||||
@@ -58,11 +58,13 @@ proc toUser*(raw: RawUser): User =
|
|||||||
media: raw.mediaCount,
|
media: raw.mediaCount,
|
||||||
verifiedType: raw.verifiedType,
|
verifiedType: raw.verifiedType,
|
||||||
protected: raw.protected,
|
protected: raw.protected,
|
||||||
joinDate: parseTwitterDate(raw.createdAt),
|
|
||||||
banner: getBanner(raw),
|
banner: getBanner(raw),
|
||||||
userPic: getImageUrl(raw.profileImageUrlHttps).replace("_normal", "")
|
userPic: getImageUrl(raw.profileImageUrlHttps).replace("_normal", "")
|
||||||
)
|
)
|
||||||
|
|
||||||
|
if raw.createdAt.len > 0:
|
||||||
|
result.joinDate = parseTwitterDate(raw.createdAt)
|
||||||
|
|
||||||
if raw.pinnedTweetIdsStr.len > 0:
|
if raw.pinnedTweetIdsStr.len > 0:
|
||||||
result.pinnedTweet = parseBiggestInt(raw.pinnedTweetIdsStr[0])
|
result.pinnedTweet = parseBiggestInt(raw.pinnedTweetIdsStr[0])
|
||||||
|
|
||||||
@@ -72,21 +74,3 @@ proc parseHook*(s: string; i: var int; v: var User) =
|
|||||||
var u: RawUser
|
var u: RawUser
|
||||||
parseHook(s, i, u)
|
parseHook(s, i, u)
|
||||||
v = toUser u
|
v = toUser u
|
||||||
|
|
||||||
proc parseUser*(json: string; username=""): User =
|
|
||||||
handleErrors:
|
|
||||||
case error.code
|
|
||||||
of suspended: return User(username: username, suspended: true)
|
|
||||||
of userNotFound: return
|
|
||||||
else: echo "[error - parseUser]: ", error
|
|
||||||
|
|
||||||
result = json.fromJson(User)
|
|
||||||
|
|
||||||
proc parseUsers*(json: string; after=""): Result[User] =
|
|
||||||
result = Result[User](beginning: after.len == 0)
|
|
||||||
|
|
||||||
# starting with '{' means it's an error
|
|
||||||
if json[0] == '[':
|
|
||||||
let raw = json.fromJson(seq[RawUser])
|
|
||||||
for user in raw:
|
|
||||||
result.content.add user.toUser
|
|
||||||
|
|||||||
@@ -1,15 +1,48 @@
|
|||||||
import options
|
import options, strutils
|
||||||
from ../../types import User
|
from ../../types import User, VerifiedType
|
||||||
|
|
||||||
type
|
type
|
||||||
GraphUser* = object
|
GraphUser* = object
|
||||||
data*: tuple[userResult: UserData]
|
data*: tuple[userResult: Option[UserData], user: Option[UserData]]
|
||||||
|
|
||||||
UserData* = object
|
UserData* = object
|
||||||
result*: UserResult
|
result*: UserResult
|
||||||
|
|
||||||
UserResult = object
|
UserCore* = object
|
||||||
|
name*: string
|
||||||
|
screenName*: string
|
||||||
|
createdAt*: string
|
||||||
|
|
||||||
|
UserBio* = object
|
||||||
|
description*: string
|
||||||
|
|
||||||
|
UserAvatar* = object
|
||||||
|
imageUrl*: string
|
||||||
|
|
||||||
|
Verification* = object
|
||||||
|
verifiedType*: VerifiedType
|
||||||
|
|
||||||
|
Location* = object
|
||||||
|
location*: string
|
||||||
|
|
||||||
|
Privacy* = object
|
||||||
|
protected*: bool
|
||||||
|
|
||||||
|
UserResult* = object
|
||||||
legacy*: User
|
legacy*: User
|
||||||
restId*: string
|
restId*: string
|
||||||
isBlueVerified*: bool
|
isBlueVerified*: bool
|
||||||
|
core*: UserCore
|
||||||
|
avatar*: UserAvatar
|
||||||
unavailableReason*: Option[string]
|
unavailableReason*: Option[string]
|
||||||
|
reason*: Option[string]
|
||||||
|
privacy*: Option[Privacy]
|
||||||
|
profileBio*: Option[UserBio]
|
||||||
|
verification*: Option[Verification]
|
||||||
|
location*: Option[Location]
|
||||||
|
|
||||||
|
proc enumHook*(s: string; v: var VerifiedType) =
|
||||||
|
v = try:
|
||||||
|
parseEnum[VerifiedType](s)
|
||||||
|
except:
|
||||||
|
VerifiedType.none
|
||||||
|
|||||||
@@ -1,8 +1,8 @@
|
|||||||
type
|
type
|
||||||
RawSession* = object
|
RawSession* = object
|
||||||
kind*: string
|
kind*: string
|
||||||
username*: string
|
|
||||||
id*: string
|
id*: string
|
||||||
|
username*: string
|
||||||
oauthToken*: string
|
oauthToken*: string
|
||||||
oauthTokenSecret*: string
|
oauthTokenSecret*: string
|
||||||
authToken*: string
|
authToken*: string
|
||||||
|
|||||||
4
src/experimental/types/tid.nim
Normal file
4
src/experimental/types/tid.nim
Normal file
@@ -0,0 +1,4 @@
|
|||||||
|
type
|
||||||
|
TidPair* = object
|
||||||
|
animationKey*: string
|
||||||
|
verification*: string
|
||||||
@@ -1,23 +0,0 @@
|
|||||||
import std/tables
|
|
||||||
from ../../types import User
|
|
||||||
|
|
||||||
type
|
|
||||||
Search* = object
|
|
||||||
globalObjects*: GlobalObjects
|
|
||||||
timeline*: Timeline
|
|
||||||
|
|
||||||
GlobalObjects = object
|
|
||||||
users*: Table[string, User]
|
|
||||||
|
|
||||||
Timeline = object
|
|
||||||
instructions*: seq[Instructions]
|
|
||||||
|
|
||||||
Instructions = object
|
|
||||||
addEntries*: tuple[entries: seq[Entry]]
|
|
||||||
|
|
||||||
Entry = object
|
|
||||||
entryId*: string
|
|
||||||
content*: tuple[operation: Operation]
|
|
||||||
|
|
||||||
Operation = object
|
|
||||||
cursor*: tuple[value, cursorType: string]
|
|
||||||
@@ -1,4 +1,6 @@
|
|||||||
import std/[options, tables, times]
|
|
||||||
|
import std/[options, tables, times, logging]
|
||||||
|
|
||||||
import jsony
|
import jsony
|
||||||
from ../../types import VideoType, VideoVariant, User
|
from ../../types import VideoType, VideoVariant, User
|
||||||
|
|
||||||
@@ -22,6 +24,7 @@ type
|
|||||||
communityDetails
|
communityDetails
|
||||||
mediaWithDetailsHorizontal
|
mediaWithDetailsHorizontal
|
||||||
hidden
|
hidden
|
||||||
|
grokShare
|
||||||
unknown
|
unknown
|
||||||
|
|
||||||
Component* = object
|
Component* = object
|
||||||
@@ -42,6 +45,7 @@ type
|
|||||||
topicDetail*: tuple[title: Text]
|
topicDetail*: tuple[title: Text]
|
||||||
profileUser*: User
|
profileUser*: User
|
||||||
shortDescriptionText*: string
|
shortDescriptionText*: string
|
||||||
|
conversationPreview*: seq[GrokConversation]
|
||||||
|
|
||||||
MediaItem* = object
|
MediaItem* = object
|
||||||
id*: string
|
id*: string
|
||||||
@@ -76,6 +80,10 @@ type
|
|||||||
title*: Text
|
title*: Text
|
||||||
category*: Text
|
category*: Text
|
||||||
|
|
||||||
|
GrokConversation* = object
|
||||||
|
message*: string
|
||||||
|
sender*: string
|
||||||
|
|
||||||
TypeField = Component | Destination | MediaEntity | AppStoreData
|
TypeField = Component | Destination | MediaEntity | AppStoreData
|
||||||
|
|
||||||
converter fromText*(text: Text): string = string(text)
|
converter fromText*(text: Text): string = string(text)
|
||||||
@@ -96,21 +104,22 @@ proc enumHook*(s: string; v: var ComponentType) =
|
|||||||
of "community_details": communityDetails
|
of "community_details": communityDetails
|
||||||
of "media_with_details_horizontal": mediaWithDetailsHorizontal
|
of "media_with_details_horizontal": mediaWithDetailsHorizontal
|
||||||
of "commerce_drop_details": hidden
|
of "commerce_drop_details": hidden
|
||||||
else: echo "ERROR: Unknown enum value (ComponentType): ", s; unknown
|
of "grok_share": grokShare
|
||||||
|
else: error "ERROR: Unknown enum value (ComponentType): ", s; unknown
|
||||||
|
|
||||||
proc enumHook*(s: string; v: var AppType) =
|
proc enumHook*(s: string; v: var AppType) =
|
||||||
v = case s
|
v = case s
|
||||||
of "android_app": androidApp
|
of "android_app": androidApp
|
||||||
of "iphone_app": iPhoneApp
|
of "iphone_app": iPhoneApp
|
||||||
of "ipad_app": iPadApp
|
of "ipad_app": iPadApp
|
||||||
else: echo "ERROR: Unknown enum value (AppType): ", s; androidApp
|
else: error "ERROR: Unknown enum value (AppType): ", s; androidApp
|
||||||
|
|
||||||
proc enumHook*(s: string; v: var MediaType) =
|
proc enumHook*(s: string; v: var MediaType) =
|
||||||
v = case s
|
v = case s
|
||||||
of "video": video
|
of "video": video
|
||||||
of "photo": photo
|
of "photo": photo
|
||||||
of "model3d": model3d
|
of "model3d": model3d
|
||||||
else: echo "ERROR: Unknown enum value (MediaType): ", s; photo
|
else: error "ERROR: Unknown enum value (MediaType): ", s; photo
|
||||||
|
|
||||||
proc parseHook*(s: string; i: var int; v: var DateTime) =
|
proc parseHook*(s: string; i: var int; v: var DateTime) =
|
||||||
var str: string
|
var str: string
|
||||||
|
|||||||
@@ -6,13 +6,18 @@ import types, utils, query
|
|||||||
const
|
const
|
||||||
cards = "cards.twitter.com/cards"
|
cards = "cards.twitter.com/cards"
|
||||||
tco = "https://t.co"
|
tco = "https://t.co"
|
||||||
twitter = parseUri("https://twitter.com")
|
twitter = parseUri("https://x.com")
|
||||||
|
|
||||||
let
|
let
|
||||||
twRegex = re"(?<=(?<!\S)https:\/\/|(?<=\s))(www\.|mobile\.)?twitter\.com"
|
twRegex = re"(?<=(?<!\S)https:\/\/|(?<=\s))(www\.|mobile\.)?twitter\.com"
|
||||||
twLinkRegex = re"""<a href="https:\/\/twitter.com([^"]+)">twitter\.com(\S+)</a>"""
|
twLinkRegex = re"""<a href="https:\/\/twitter.com([^"]+)">twitter\.com(\S+)</a>"""
|
||||||
xRegex = re"(?<=(?<!\S)https:\/\/|(?<=\s))(www\.|mobile\.)?x\.com"
|
xRegex = re"(?<=(?<!\S)https:\/\/|(?<=\s))(www\.|mobile\.)?x\.com"
|
||||||
xLinkRegex = re"""<a href="https:\/\/x.com([^"]+)">x\.com(\S+)</a>"""
|
xLinkRegex = re"""<a href="https:\/\/x.com([^"]+)">x\.com(\S+)</a>"""
|
||||||
|
imgurRegex = re"(?<=(?<!\S)https:\/\/|(?<=\s))(i\.)?imgur\.com"
|
||||||
|
imgurLinkRegex = re"""<a href="https://(i\.)?imgur.com([^"]+)">(i\.)?imgur\.com(\S+)</a>"""
|
||||||
|
fandomRegex = re"(?<=(?<!\S)https:\/\/|(?<=\s))([a-z0-9-]+)\.fandom\.com"
|
||||||
|
fandomLinkRegex = re"""<a href="https://([a-z0-9-]+)\.fandom\.com([^"]+)">([a-z0-9-]+)\.fandom\.com(\S+)</a>"""
|
||||||
|
soundcloudRegex = re"(?<=(?<!\S)https:\/\/|(?<=\s))(on\.|www\.)?soundcloud\.com"
|
||||||
|
|
||||||
ytRegex = re(r"([A-z.]+\.)?youtu(be\.com|\.be)", {reStudy, reIgnoreCase})
|
ytRegex = re(r"([A-z.]+\.)?youtu(be\.com|\.be)", {reStudy, reIgnoreCase})
|
||||||
|
|
||||||
@@ -33,11 +38,14 @@ proc getUrlPrefix*(cfg: Config): string =
|
|||||||
if cfg.useHttps: https & cfg.hostname
|
if cfg.useHttps: https & cfg.hostname
|
||||||
else: "http://" & cfg.hostname
|
else: "http://" & cfg.hostname
|
||||||
|
|
||||||
proc shortLink*(text: string; length=28): string =
|
proc shorten*(text: string; length=28): string =
|
||||||
result = text.replace(wwwRegex, "")
|
result = text
|
||||||
if result.len > length:
|
if result.len > length:
|
||||||
result = result[0 ..< length] & "…"
|
result = result[0 ..< length] & "…"
|
||||||
|
|
||||||
|
proc shortLink*(text: string; length=28): string =
|
||||||
|
result = text.replace(wwwRegex, "").shorten(length)
|
||||||
|
|
||||||
proc stripHtml*(text: string; shorten=false): string =
|
proc stripHtml*(text: string; shorten=false): string =
|
||||||
var html = parseHtml(text)
|
var html = parseHtml(text)
|
||||||
for el in html.findAll("a"):
|
for el in html.findAll("a"):
|
||||||
@@ -56,25 +64,44 @@ proc replaceUrls*(body: string; prefs: Prefs; absolute=""): string =
|
|||||||
result = body
|
result = body
|
||||||
|
|
||||||
if prefs.replaceYouTube.len > 0 and "youtu" in result:
|
if prefs.replaceYouTube.len > 0 and "youtu" in result:
|
||||||
result = result.replace(ytRegex, prefs.replaceYouTube)
|
let youtubeHost = strip(prefs.replaceYouTube, chars={'/'})
|
||||||
|
result = result.replace(ytRegex, youtubeHost)
|
||||||
|
|
||||||
if prefs.replaceTwitter.len > 0:
|
if prefs.replaceTwitter.len > 0:
|
||||||
|
let twitterHost = strip(prefs.replaceTwitter, chars={'/'})
|
||||||
if tco in result:
|
if tco in result:
|
||||||
result = result.replace(tco, https & prefs.replaceTwitter & "/t.co")
|
result = result.replace(tco, https & twitterHost & "/t.co")
|
||||||
if "x.com" in result:
|
if "x.com" in result:
|
||||||
result = result.replace(xRegex, prefs.replaceTwitter)
|
result = result.replace(xRegex, twitterHost)
|
||||||
result = result.replacef(xLinkRegex, a(
|
result = result.replacef(xLinkRegex, a(
|
||||||
prefs.replaceTwitter & "$2", href = https & prefs.replaceTwitter & "$1"))
|
twitterHost & "$2", href = https & twitterHost & "$1"))
|
||||||
if "twitter.com" in result:
|
if "twitter.com" in result:
|
||||||
result = result.replace(cards, prefs.replaceTwitter & "/cards")
|
result = result.replace(cards, twitterHost & "/cards")
|
||||||
result = result.replace(twRegex, prefs.replaceTwitter)
|
result = result.replace(twRegex, twitterHost)
|
||||||
result = result.replacef(twLinkRegex, a(
|
result = result.replacef(twLinkRegex, a(
|
||||||
prefs.replaceTwitter & "$2", href = https & prefs.replaceTwitter & "$1"))
|
prefs.replaceTwitter & "$2", href = https & prefs.replaceTwitter & "$1"))
|
||||||
|
if "imgur.com" in result:
|
||||||
|
result = result.replace(imgurRegex, prefs.replaceImgur)
|
||||||
|
result = result.replacef(imgurLinkRegex, a(
|
||||||
|
prefs.replaceImgur & "$4", href = https & prefs.replaceImgur & "$2"))
|
||||||
|
|
||||||
|
if prefs.replaceFandom.len > 0 and "fandom.com" in result:
|
||||||
|
result = result.replace(fandomRegex, prefs.replaceFandom & "/$1")
|
||||||
|
result = result.replacef(fandomLinkRegex, a(
|
||||||
|
prefs.replaceFandom & "/$1$2", href = https & prefs.replaceFandom & "/$1$2"))
|
||||||
|
|
||||||
|
if prefs.replaceSoundCloud.len > 0 and "soundcloud.com" in result:
|
||||||
|
result = result.replace(soundcloudRegex, prefs.replaceSoundCloud)
|
||||||
|
result = result.replacef(re"""<a href="https://on\.soundcloud\.com([^"]+)">on\.soundcloud\.com(\S+)</a>""", a(
|
||||||
|
prefs.replaceSoundCloud & "/on$2", href = https & prefs.replaceSoundCloud & "/on$1"))
|
||||||
|
result = result.replacef(re"""<a href="https://(www\.)?soundcloud\.com([^"]+)">(www\.)?soundcloud\.com(\S+)</a>""", a(
|
||||||
|
prefs.replaceSoundCloud & "$4", href = https & prefs.replaceSoundCloud & "$2"))
|
||||||
|
|
||||||
if prefs.replaceReddit.len > 0 and ("reddit.com" in result or "redd.it" in result):
|
if prefs.replaceReddit.len > 0 and ("reddit.com" in result or "redd.it" in result):
|
||||||
result = result.replace(rdShortRegex, prefs.replaceReddit & "/comments/")
|
let redditHost = strip(prefs.replaceReddit, chars={'/'})
|
||||||
result = result.replace(rdRegex, prefs.replaceReddit)
|
result = result.replace(rdShortRegex, redditHost & "/comments/")
|
||||||
if prefs.replaceReddit in result and "/gallery/" in result:
|
result = result.replace(rdRegex, redditHost)
|
||||||
|
if redditHost in result and "/gallery/" in result:
|
||||||
result = result.replace("/gallery/", "/comments/")
|
result = result.replace("/gallery/", "/comments/")
|
||||||
|
|
||||||
if absolute.len > 0 and "href" in result:
|
if absolute.len > 0 and "href" in result:
|
||||||
|
|||||||
102
src/nitter.nim
102
src/nitter.nim
@@ -1,20 +1,48 @@
|
|||||||
# SPDX-License-Identifier: AGPL-3.0-only
|
# SPDX-License-Identifier: AGPL-3.0-only
|
||||||
import asyncdispatch, strformat, logging
|
import asyncdispatch, strformat, logging, terminal, times, strutils
|
||||||
from net import Port
|
from net import Port
|
||||||
from htmlgen import a
|
from htmlgen import a
|
||||||
from os import getEnv
|
from os import getEnv
|
||||||
|
|
||||||
import jester
|
import jester
|
||||||
|
|
||||||
import types, config, prefs, formatters, redis_cache, http_pool, auth
|
import types, config, prefs, formatters, redis_cache, http_pool, auth, apiutils
|
||||||
import views/[general, about]
|
import views/[general, about, search, homepage]
|
||||||
|
import karax/[vdom]
|
||||||
import routes/[
|
import routes/[
|
||||||
preferences, timeline, status, media, search, rss, list, debug,
|
preferences, timeline, status, media, search, rss, list, debug,
|
||||||
unsupported, embed, resolver, router_utils]
|
unsupported, embed, resolver, router_utils, follow]
|
||||||
|
|
||||||
const instancesUrl = "https://github.com/zedeus/nitter/wiki/Instances"
|
const instancesUrl = "https://github.com/zedeus/nitter/wiki/Instances"
|
||||||
const issuesUrl = "https://github.com/zedeus/nitter/issues"
|
const issuesUrl = "https://github.com/zedeus/nitter/issues"
|
||||||
|
|
||||||
|
type ColoredLogger = ref object of Logger
|
||||||
|
|
||||||
|
method log(logger: ColoredLogger, level: Level, args: varargs[string, `$`]) =
|
||||||
|
if level < logger.levelThreshold: return
|
||||||
|
|
||||||
|
let color = case level
|
||||||
|
of lvlFatal, lvlError: fgRed
|
||||||
|
of lvlWarn: fgYellow
|
||||||
|
of lvlInfo: fgGreen
|
||||||
|
of lvlDebug: fgCyan
|
||||||
|
else: fgWhite
|
||||||
|
|
||||||
|
let levelStr = case level
|
||||||
|
of lvlFatal: "fatal"
|
||||||
|
of lvlError: "error"
|
||||||
|
of lvlWarn: "warn"
|
||||||
|
of lvlInfo: "info"
|
||||||
|
of lvlDebug: "debug"
|
||||||
|
else: "other"
|
||||||
|
|
||||||
|
let timeStr = format(now(), "HH:mm:ss")
|
||||||
|
stdout.styledWrite(fgWhite, "[", timeStr, "] ", color, levelStr, fgWhite, ": ")
|
||||||
|
for arg in args:
|
||||||
|
stdout.write(arg)
|
||||||
|
stdout.write("\n")
|
||||||
|
stdout.flushFile()
|
||||||
|
|
||||||
let
|
let
|
||||||
configPath = getEnv("NITTER_CONF_FILE", "./nitter.conf")
|
configPath = getEnv("NITTER_CONF_FILE", "./nitter.conf")
|
||||||
(cfg, fullCfg) = getConfig(configPath)
|
(cfg, fullCfg) = getConfig(configPath)
|
||||||
@@ -23,13 +51,21 @@ let
|
|||||||
|
|
||||||
initSessionPool(cfg, sessionsPath)
|
initSessionPool(cfg, sessionsPath)
|
||||||
|
|
||||||
if not cfg.enableDebug:
|
addHandler(new(ColoredLogger))
|
||||||
# Silence Jester's query warning
|
|
||||||
addHandler(newConsoleLogger())
|
|
||||||
setLogFilter(lvlError)
|
|
||||||
|
|
||||||
stdout.write &"Starting Nitter at {getUrlPrefix(cfg)}\n"
|
let level = case cfg.logLevel.toLowerAscii
|
||||||
stdout.flushFile
|
of "debug": lvlDebug
|
||||||
|
of "info": lvlInfo
|
||||||
|
of "warn": lvlWarn
|
||||||
|
of "error": lvlError
|
||||||
|
of "fatal": lvlFatal
|
||||||
|
of "none": lvlNone
|
||||||
|
else:
|
||||||
|
if cfg.enableDebug: lvlDebug else: lvlInfo
|
||||||
|
|
||||||
|
setLogFilter(level)
|
||||||
|
|
||||||
|
info &"Starting Nitter at {getUrlPrefix(cfg)}"
|
||||||
|
|
||||||
updateDefaultPrefs(fullCfg)
|
updateDefaultPrefs(fullCfg)
|
||||||
setCacheTimes(cfg)
|
setCacheTimes(cfg)
|
||||||
@@ -37,13 +73,14 @@ setHmacKey(cfg.hmacKey)
|
|||||||
setProxyEncoding(cfg.base64Media)
|
setProxyEncoding(cfg.base64Media)
|
||||||
setMaxHttpConns(cfg.httpMaxConns)
|
setMaxHttpConns(cfg.httpMaxConns)
|
||||||
setHttpProxy(cfg.proxy, cfg.proxyAuth)
|
setHttpProxy(cfg.proxy, cfg.proxyAuth)
|
||||||
|
setDisableTid(cfg.disableTid)
|
||||||
initAboutPage(cfg.staticDir)
|
initAboutPage(cfg.staticDir)
|
||||||
|
|
||||||
waitFor initRedisPool(cfg)
|
waitFor initRedisPool(cfg)
|
||||||
stdout.write &"Connected to Redis at {cfg.redisHost}:{cfg.redisPort}\n"
|
info &"Connected to Redis at {cfg.redisHost}:{cfg.redisPort}"
|
||||||
stdout.flushFile
|
|
||||||
|
|
||||||
createUnsupportedRouter(cfg)
|
createUnsupportedRouter(cfg)
|
||||||
|
createFollowRouter(cfg)
|
||||||
createResolverRouter(cfg)
|
createResolverRouter(cfg)
|
||||||
createPrefRouter(cfg)
|
createPrefRouter(cfg)
|
||||||
createTimelineRouter(cfg)
|
createTimelineRouter(cfg)
|
||||||
@@ -63,7 +100,41 @@ settings:
|
|||||||
|
|
||||||
routes:
|
routes:
|
||||||
get "/":
|
get "/":
|
||||||
resp renderMain(renderSearch(), request, cfg, themePrefs())
|
let prefs = cookiePrefs()
|
||||||
|
|
||||||
|
if prefs.following.len > 0 or cfg.defaultFollowedAccounts.len > 0:
|
||||||
|
let
|
||||||
|
cursor = getCursor()
|
||||||
|
accounts = if prefs.following.len > 0: prefs.following else: cfg.defaultFollowedAccounts
|
||||||
|
isDefault = prefs.following.len == 0
|
||||||
|
currentPath = if @"f".len > 0: "/?f=" & @"f" else: "/"
|
||||||
|
|
||||||
|
var homepageQuery = initQuery(params(request))
|
||||||
|
if @"f".len == 0:
|
||||||
|
homepageQuery.kind = tweets
|
||||||
|
|
||||||
|
homepageQuery.fromUser = accounts
|
||||||
|
|
||||||
|
let
|
||||||
|
timeline = await getGraphTweetSearch(homepageQuery, cursor)
|
||||||
|
html = if isDefault:
|
||||||
|
renderDefaultTimeline(timeline, prefs, getPath())
|
||||||
|
else:
|
||||||
|
renderHomepageTimeline(timeline, prefs, getPath())
|
||||||
|
|
||||||
|
var users: seq[User]
|
||||||
|
for username in accounts:
|
||||||
|
try:
|
||||||
|
let user = await getCachedUser(username)
|
||||||
|
users.add(user)
|
||||||
|
except:
|
||||||
|
continue
|
||||||
|
|
||||||
|
let homepageHtml = renderHomepage(users, html, prefs, currentPath)
|
||||||
|
|
||||||
|
resp renderMain(homepageHtml, request, cfg, prefs, "Following")
|
||||||
|
else:
|
||||||
|
resp renderMain(renderSearch(), request, cfg, themePrefs())
|
||||||
|
|
||||||
get "/about":
|
get "/about":
|
||||||
resp renderMain(renderAbout(), request, cfg, themePrefs())
|
resp renderMain(renderAbout(), request, cfg, themePrefs())
|
||||||
@@ -83,13 +154,13 @@ routes:
|
|||||||
resp Http404, showError("Page not found", cfg)
|
resp Http404, showError("Page not found", cfg)
|
||||||
|
|
||||||
error InternalError:
|
error InternalError:
|
||||||
echo error.exc.name, ": ", error.exc.msg
|
error error.exc.name, ": ", error.exc.msg
|
||||||
const link = a("open a GitHub issue", href = issuesUrl)
|
const link = a("open a GitHub issue", href = issuesUrl)
|
||||||
resp Http500, showError(
|
resp Http500, showError(
|
||||||
&"An error occurred, please {link} with the URL you tried to visit.", cfg)
|
&"An error occurred, please {link} with the URL you tried to visit.", cfg)
|
||||||
|
|
||||||
error BadClientError:
|
error BadClientError:
|
||||||
echo error.exc.name, ": ", error.exc.msg
|
error error.exc.name, ": ", error.exc.msg
|
||||||
resp Http500, showError("Network error occurred, please try again.", cfg)
|
resp Http500, showError("Network error occurred, please try again.", cfg)
|
||||||
|
|
||||||
error RateLimitError:
|
error RateLimitError:
|
||||||
@@ -111,5 +182,6 @@ routes:
|
|||||||
extend preferences, ""
|
extend preferences, ""
|
||||||
extend resolver, ""
|
extend resolver, ""
|
||||||
extend embed, ""
|
extend embed, ""
|
||||||
|
extend follow, ""
|
||||||
extend debug, ""
|
extend debug, ""
|
||||||
extend unsupported, ""
|
extend unsupported, ""
|
||||||
|
|||||||
387
src/parser.nim
387
src/parser.nim
@@ -1,26 +1,10 @@
|
|||||||
# SPDX-License-Identifier: AGPL-3.0-only
|
# SPDX-License-Identifier: AGPL-3.0-only
|
||||||
import strutils, options, times, math
|
import strutils, options, times, math, tables
|
||||||
import packedjson, packedjson/deserialiser
|
import packedjson, packedjson/deserialiser
|
||||||
import types, parserutils, utils
|
import types, parserutils, utils
|
||||||
import experimental/parser/unifiedcard
|
import experimental/parser/unifiedcard
|
||||||
|
|
||||||
proc parseGraphTweet(js: JsonNode; isLegacy=false): Tweet
|
proc parseGraphTweet(js: JsonNode): Tweet
|
||||||
|
|
||||||
proc extractTweetsFromEntry(e: JsonNode; entryId: string): seq[Tweet] =
|
|
||||||
if e{"content", "items"}.notNull:
|
|
||||||
for item in e{"content", "items"}:
|
|
||||||
with tweetResult, item{"item", "itemContent", "tweet_results", "result"}:
|
|
||||||
var tweet = parseGraphTweet(tweetResult, false)
|
|
||||||
if not tweet.available:
|
|
||||||
tweet.id = parseBiggestInt(item{"entryId"}.getStr.getId())
|
|
||||||
result.add tweet
|
|
||||||
return
|
|
||||||
|
|
||||||
with tweetResult, e{"content", "content", "tweetResult", "result"}:
|
|
||||||
var tweet = parseGraphTweet(tweetResult, false)
|
|
||||||
if not tweet.available:
|
|
||||||
tweet.id = parseBiggestInt(entryId.getId())
|
|
||||||
result.add tweet
|
|
||||||
|
|
||||||
proc parseUser(js: JsonNode; id=""): User =
|
proc parseUser(js: JsonNode; id=""): User =
|
||||||
if js.isNull: return
|
if js.isNull: return
|
||||||
@@ -37,11 +21,17 @@ proc parseUser(js: JsonNode; id=""): User =
|
|||||||
tweets: js{"statuses_count"}.getInt,
|
tweets: js{"statuses_count"}.getInt,
|
||||||
likes: js{"favourites_count"}.getInt,
|
likes: js{"favourites_count"}.getInt,
|
||||||
media: js{"media_count"}.getInt,
|
media: js{"media_count"}.getInt,
|
||||||
verifiedType: parseEnum[VerifiedType](js{"verified_type"}.getStr("None")),
|
protected: js{"protected"}.getBool(js{"privacy", "protected"}.getBool),
|
||||||
protected: js{"protected"}.getBool,
|
sensitive: "sensitive" in js{"profile_interstitial_type"}.getStr("") or js{"possibly_sensitive"}.getBool,
|
||||||
joinDate: js{"created_at"}.getTime
|
joinDate: js{"created_at"}.getTime
|
||||||
)
|
)
|
||||||
|
|
||||||
|
if js{"is_blue_verified"}.getBool(false):
|
||||||
|
result.verifiedType = blue
|
||||||
|
|
||||||
|
with verifiedType, js{"verified_type"}:
|
||||||
|
result.verifiedType = parseEnum[VerifiedType](verifiedType.getStr)
|
||||||
|
|
||||||
result.expandUserEntities(js)
|
result.expandUserEntities(js)
|
||||||
|
|
||||||
proc parseGraphUser(js: JsonNode): User =
|
proc parseGraphUser(js: JsonNode): User =
|
||||||
@@ -57,17 +47,20 @@ proc parseGraphUser(js: JsonNode): User =
|
|||||||
|
|
||||||
result = parseUser(user{"legacy"}, user{"rest_id"}.getStr)
|
result = parseUser(user{"legacy"}, user{"rest_id"}.getStr)
|
||||||
|
|
||||||
|
if result.verifiedType == none and user{"is_blue_verified"}.getBool(false):
|
||||||
|
result.verifiedType = blue
|
||||||
|
|
||||||
# fallback to support UserMedia/recent GraphQL updates
|
# fallback to support UserMedia/recent GraphQL updates
|
||||||
if result.username.len == 0 and user{"core", "screen_name"}.notNull:
|
if result.username.len == 0:
|
||||||
result.username = user{"core", "screen_name"}.getStr
|
result.username = user{"core", "screen_name"}.getStr
|
||||||
result.fullname = user{"core", "name"}.getStr
|
result.fullname = user{"core", "name"}.getStr
|
||||||
result.userPic = user{"avatar", "image_url"}.getImageStr.replace("_normal", "")
|
result.userPic = user{"avatar", "image_url"}.getImageStr.replace("_normal", "")
|
||||||
|
|
||||||
if user{"is_blue_verified"}.getBool(false):
|
if user{"is_blue_verified"}.getBool(false):
|
||||||
result.verifiedType = blue
|
result.verifiedType = blue
|
||||||
elif user{"verification", "verified_type"}.notNull:
|
|
||||||
let verifiedType = user{"verification", "verified_type"}.getStr("None")
|
with verifiedType, user{"verification", "verified_type"}:
|
||||||
result.verifiedType = parseEnum[VerifiedType](verifiedType)
|
result.verifiedType = parseEnum[VerifiedType](verifiedType.getStr)
|
||||||
|
|
||||||
proc parseGraphList*(js: JsonNode): List =
|
proc parseGraphList*(js: JsonNode): List =
|
||||||
if js.isNull: return
|
if js.isNull: return
|
||||||
@@ -106,16 +99,24 @@ proc parsePoll(js: JsonNode): Poll =
|
|||||||
result.leader = result.values.find(max(result.values))
|
result.leader = result.values.find(max(result.values))
|
||||||
result.votes = result.values.sum
|
result.votes = result.values.sum
|
||||||
|
|
||||||
proc parseGif(js: JsonNode): Gif =
|
proc parseVideoVariants(variants: JsonNode): seq[VideoVariant] =
|
||||||
result = Gif(
|
result = @[]
|
||||||
url: js{"video_info", "variants"}[0]{"url"}.getImageStr,
|
for v in variants:
|
||||||
thumb: js{"media_url_https"}.getImageStr
|
let
|
||||||
)
|
url = v{"url"}.getStr
|
||||||
|
contentType = parseEnum[VideoType](v{"content_type"}.getStr("video/mp4"))
|
||||||
|
bitrate = v{"bit_rate"}.getInt(v{"bitrate"}.getInt(0))
|
||||||
|
|
||||||
|
result.add VideoVariant(
|
||||||
|
contentType: contentType,
|
||||||
|
bitrate: bitrate,
|
||||||
|
url: url,
|
||||||
|
resolution: if contentType == mp4: getMp4Resolution(url) else: 0
|
||||||
|
)
|
||||||
|
|
||||||
proc parseVideo(js: JsonNode): Video =
|
proc parseVideo(js: JsonNode): Video =
|
||||||
result = Video(
|
result = Video(
|
||||||
thumb: js{"media_url_https"}.getImageStr,
|
thumb: js{"media_url_https"}.getImageStr,
|
||||||
views: getVideoViewCount(js),
|
|
||||||
available: true,
|
available: true,
|
||||||
title: js{"ext_alt_text"}.getStr,
|
title: js{"ext_alt_text"}.getStr,
|
||||||
durationMs: js{"video_info", "duration_millis"}.getInt
|
durationMs: js{"video_info", "duration_millis"}.getInt
|
||||||
@@ -132,17 +133,62 @@ proc parseVideo(js: JsonNode): Video =
|
|||||||
with description, js{"additional_media_info", "description"}:
|
with description, js{"additional_media_info", "description"}:
|
||||||
result.description = description.getStr
|
result.description = description.getStr
|
||||||
|
|
||||||
for v in js{"video_info", "variants"}:
|
result.variants = parseVideoVariants(js{"video_info", "variants"})
|
||||||
let
|
|
||||||
contentType = parseEnum[VideoType](v{"content_type"}.getStr("summary"))
|
|
||||||
url = v{"url"}.getStr
|
|
||||||
|
|
||||||
result.variants.add VideoVariant(
|
proc parseLegacyMediaEntities(js: JsonNode; result: var Tweet) =
|
||||||
contentType: contentType,
|
with jsMedia, js{"extended_entities", "media"}:
|
||||||
bitrate: v{"bitrate"}.getInt,
|
for m in jsMedia:
|
||||||
url: url,
|
case m.getTypeName:
|
||||||
resolution: if contentType == mp4: getMp4Resolution(url) else: 0
|
of "photo":
|
||||||
)
|
result.photos.add m{"media_url_https"}.getImageStr
|
||||||
|
of "video":
|
||||||
|
result.video = some(parseVideo(m))
|
||||||
|
with user, m{"additional_media_info", "source_user"}:
|
||||||
|
if user{"id"}.getInt > 0:
|
||||||
|
result.attribution = some(parseUser(user))
|
||||||
|
else:
|
||||||
|
result.attribution = some(parseGraphUser(user))
|
||||||
|
of "animated_gif":
|
||||||
|
result.gif = some Gif(
|
||||||
|
url: m{"video_info", "variants"}[0]{"url"}.getImageStr,
|
||||||
|
thumb: m{"media_url_https"}.getImageStr
|
||||||
|
)
|
||||||
|
else: discard
|
||||||
|
|
||||||
|
with url, m{"url"}:
|
||||||
|
if result.text.endsWith(url.getStr):
|
||||||
|
result.text.removeSuffix(url.getStr)
|
||||||
|
result.text = result.text.strip()
|
||||||
|
|
||||||
|
proc parseMediaEntities(js: JsonNode; result: var Tweet) =
|
||||||
|
with mediaEntities, js{"media_entities"}:
|
||||||
|
for mediaEntity in mediaEntities:
|
||||||
|
with mediaInfo, mediaEntity{"media_results", "result", "media_info"}:
|
||||||
|
case mediaInfo.getTypeName
|
||||||
|
of "ApiImage":
|
||||||
|
result.photos.add mediaInfo{"original_img_url"}.getImageStr
|
||||||
|
of "ApiVideo":
|
||||||
|
let status = mediaEntity{"media_results", "result", "media_availability_v2", "status"}
|
||||||
|
result.video = some Video(
|
||||||
|
available: status.getStr == "Available",
|
||||||
|
thumb: mediaInfo{"preview_image", "original_img_url"}.getImageStr,
|
||||||
|
durationMs: mediaInfo{"duration_millis"}.getInt,
|
||||||
|
variants: parseVideoVariants(mediaInfo{"variants"})
|
||||||
|
)
|
||||||
|
of "ApiGif":
|
||||||
|
result.gif = some Gif(
|
||||||
|
url: mediaInfo{"variants"}[0]{"url"}.getImageStr,
|
||||||
|
thumb: mediaInfo{"preview_image", "original_img_url"}.getImageStr
|
||||||
|
)
|
||||||
|
else: discard
|
||||||
|
|
||||||
|
# Remove media URLs from text
|
||||||
|
with mediaList, js{"legacy", "entities", "media"}:
|
||||||
|
for url in mediaList:
|
||||||
|
let expandedUrl = url.getExpandedUrl
|
||||||
|
if result.text.endsWith(expandedUrl):
|
||||||
|
result.text.removeSuffix(expandedUrl)
|
||||||
|
result.text = result.text.strip()
|
||||||
|
|
||||||
proc parsePromoVideo(js: JsonNode): Video =
|
proc parsePromoVideo(js: JsonNode): Video =
|
||||||
result = Video(
|
result = Video(
|
||||||
@@ -222,7 +268,7 @@ proc parseCard(js: JsonNode; urls: JsonNode): Card =
|
|||||||
|
|
||||||
for u in ? urls:
|
for u in ? urls:
|
||||||
if u{"url"}.getStr == result.url:
|
if u{"url"}.getStr == result.url:
|
||||||
result.url = u{"expanded_url"}.getStr
|
result.url = u.getExpandedUrl(result.url)
|
||||||
break
|
break
|
||||||
|
|
||||||
if kind in {videoDirectMessage, imageDirectMessage}:
|
if kind in {videoDirectMessage, imageDirectMessage}:
|
||||||
@@ -234,20 +280,26 @@ proc parseCard(js: JsonNode; urls: JsonNode): Card =
|
|||||||
|
|
||||||
proc parseTweet(js: JsonNode; jsCard: JsonNode = newJNull()): Tweet =
|
proc parseTweet(js: JsonNode; jsCard: JsonNode = newJNull()): Tweet =
|
||||||
if js.isNull: return
|
if js.isNull: return
|
||||||
|
|
||||||
|
let time =
|
||||||
|
if js{"created_at"}.notNull: js{"created_at"}.getTime
|
||||||
|
else: js{"created_at_ms"}.getTimeFromMs
|
||||||
|
|
||||||
result = Tweet(
|
result = Tweet(
|
||||||
id: js{"id_str"}.getId,
|
id: js{"id_str"}.getId,
|
||||||
threadId: js{"conversation_id_str"}.getId,
|
threadId: js{"conversation_id_str"}.getId,
|
||||||
replyId: js{"in_reply_to_status_id_str"}.getId,
|
replyId: js{"in_reply_to_status_id_str"}.getId,
|
||||||
text: js{"full_text"}.getStr,
|
text: js{"full_text"}.getStr,
|
||||||
time: js{"created_at"}.getTime,
|
time: time,
|
||||||
hasThread: js{"self_thread"}.notNull,
|
hasThread: js{"self_thread"}.notNull,
|
||||||
|
sensitive: js{"possibly_sensitive"}.getBool,
|
||||||
available: true,
|
available: true,
|
||||||
user: User(id: js{"user_id_str"}.getStr),
|
user: User(id: js{"user_id_str"}.getStr),
|
||||||
stats: TweetStats(
|
stats: TweetStats(
|
||||||
replies: js{"reply_count"}.getInt,
|
replies: js{"reply_count"}.getInt,
|
||||||
retweets: js{"retweet_count"}.getInt,
|
retweets: js{"retweet_count"}.getInt,
|
||||||
likes: js{"favorite_count"}.getInt,
|
likes: js{"favorite_count"}.getInt,
|
||||||
quotes: js{"quote_count"}.getInt
|
views: js{"views_count"}.getInt
|
||||||
)
|
)
|
||||||
)
|
)
|
||||||
|
|
||||||
@@ -272,6 +324,12 @@ proc parseTweet(js: JsonNode; jsCard: JsonNode = newJNull()): Tweet =
|
|||||||
result.retweet = some parseGraphTweet(rt)
|
result.retweet = some parseGraphTweet(rt)
|
||||||
return
|
return
|
||||||
|
|
||||||
|
with reposts, js{"repostedStatusResults"}:
|
||||||
|
with rt, reposts{"result"}:
|
||||||
|
if "legacy" in rt:
|
||||||
|
result.retweet = some parseGraphTweet(rt)
|
||||||
|
return
|
||||||
|
|
||||||
if jsCard.kind != JNull:
|
if jsCard.kind != JNull:
|
||||||
let name = jsCard{"name"}.getStr
|
let name = jsCard{"name"}.getStr
|
||||||
if "poll" in name:
|
if "poll" in name:
|
||||||
@@ -285,27 +343,7 @@ proc parseTweet(js: JsonNode; jsCard: JsonNode = newJNull()): Tweet =
|
|||||||
result.card = some parseCard(jsCard, js{"entities", "urls"})
|
result.card = some parseCard(jsCard, js{"entities", "urls"})
|
||||||
|
|
||||||
result.expandTweetEntities(js)
|
result.expandTweetEntities(js)
|
||||||
|
parseLegacyMediaEntities(js, result)
|
||||||
with jsMedia, js{"extended_entities", "media"}:
|
|
||||||
for m in jsMedia:
|
|
||||||
case m{"type"}.getStr
|
|
||||||
of "photo":
|
|
||||||
result.photos.add m{"media_url_https"}.getImageStr
|
|
||||||
of "video":
|
|
||||||
result.video = some(parseVideo(m))
|
|
||||||
with user, m{"additional_media_info", "source_user"}:
|
|
||||||
if user{"id"}.getInt > 0:
|
|
||||||
result.attribution = some(parseUser(user))
|
|
||||||
else:
|
|
||||||
result.attribution = some(parseGraphUser(user))
|
|
||||||
of "animated_gif":
|
|
||||||
result.gif = some(parseGif(m))
|
|
||||||
else: discard
|
|
||||||
|
|
||||||
with url, m{"url"}:
|
|
||||||
if result.text.endsWith(url.getStr):
|
|
||||||
result.text.removeSuffix(url.getStr)
|
|
||||||
result.text = result.text.strip()
|
|
||||||
|
|
||||||
with jsWithheld, js{"withheld_in_countries"}:
|
with jsWithheld, js{"withheld_in_countries"}:
|
||||||
let withheldInCountries: seq[string] =
|
let withheldInCountries: seq[string] =
|
||||||
@@ -321,91 +359,108 @@ proc parseTweet(js: JsonNode; jsCard: JsonNode = newJNull()): Tweet =
|
|||||||
result.text.removeSuffix(" Learn more.")
|
result.text.removeSuffix(" Learn more.")
|
||||||
result.available = false
|
result.available = false
|
||||||
|
|
||||||
proc parseGraphTweet(js: JsonNode; isLegacy=false): Tweet =
|
proc parseGraphTweet(js: JsonNode): Tweet =
|
||||||
if js.kind == JNull:
|
if js.kind == JNull:
|
||||||
return Tweet()
|
return Tweet()
|
||||||
|
|
||||||
case js{"__typename"}.getStr
|
case js.getTypeName:
|
||||||
of "TweetUnavailable":
|
of "TweetUnavailable":
|
||||||
return Tweet()
|
return Tweet()
|
||||||
of "TweetTombstone":
|
of "TweetTombstone":
|
||||||
with text, js{"tombstone", "richText"}:
|
with text, select(js{"tombstone", "richText"}, js{"tombstone", "text"}):
|
||||||
return Tweet(text: text.getTombstone)
|
|
||||||
with text, js{"tombstone", "text"}:
|
|
||||||
return Tweet(text: text.getTombstone)
|
return Tweet(text: text.getTombstone)
|
||||||
return Tweet()
|
return Tweet()
|
||||||
of "TweetPreviewDisplay":
|
of "TweetPreviewDisplay":
|
||||||
return Tweet(text: "You're unable to view this Tweet because it's only available to the Subscribers of the account owner.")
|
return Tweet(text: "You're unable to view this Tweet because it's only available to the Subscribers of the account owner.")
|
||||||
of "TweetWithVisibilityResults":
|
of "TweetWithVisibilityResults":
|
||||||
return parseGraphTweet(js{"tweet"}, isLegacy)
|
return parseGraphTweet(js{"tweet"})
|
||||||
else:
|
else:
|
||||||
discard
|
discard
|
||||||
|
|
||||||
if not js.hasKey("legacy"):
|
if not js.hasKey("legacy"):
|
||||||
return Tweet()
|
return Tweet()
|
||||||
|
|
||||||
var jsCard = copy(js{if isLegacy: "card" else: "tweet_card", "legacy"})
|
var jsCard = select(js{"card"}, js{"tweet_card"}, js{"legacy", "tweet_card"})
|
||||||
if jsCard.kind != JNull:
|
if jsCard.kind != JNull:
|
||||||
var values = newJObject()
|
let legacyCard = jsCard{"legacy"}
|
||||||
for val in jsCard["binding_values"]:
|
if legacyCard.kind != JNull:
|
||||||
values[val["key"].getStr] = val["value"]
|
let bindingArray = legacyCard{"binding_values"}
|
||||||
jsCard["binding_values"] = values
|
if bindingArray.kind == JArray:
|
||||||
|
var bindingObj: seq[(string, JsonNode)]
|
||||||
|
for item in bindingArray:
|
||||||
|
bindingObj.add((item{"key"}.getStr, item{"value"}))
|
||||||
|
# Create a new card object with flattened structure
|
||||||
|
jsCard = %*{
|
||||||
|
"name": legacyCard{"name"},
|
||||||
|
"url": legacyCard{"url"},
|
||||||
|
"binding_values": %bindingObj
|
||||||
|
}
|
||||||
|
|
||||||
result = parseTweet(js{"legacy"}, jsCard)
|
result = parseTweet(js{"legacy"}, jsCard)
|
||||||
result.id = js{"rest_id"}.getId
|
result.id = js{"rest_id"}.getId
|
||||||
result.user = parseGraphUser(js{"core"})
|
result.user = parseGraphUser(js{"core"})
|
||||||
|
|
||||||
|
if result.replyId == 0:
|
||||||
|
result.replyId = js{"reply_to_results", "rest_id"}.getId
|
||||||
|
|
||||||
|
with count, js{"views", "count"}:
|
||||||
|
result.stats.views = count.getStr("0").parseInt
|
||||||
|
|
||||||
with noteTweet, js{"note_tweet", "note_tweet_results", "result"}:
|
with noteTweet, js{"note_tweet", "note_tweet_results", "result"}:
|
||||||
result.expandNoteTweetEntities(noteTweet)
|
result.expandNoteTweetEntities(noteTweet)
|
||||||
|
|
||||||
|
parseMediaEntities(js, result)
|
||||||
|
|
||||||
if result.quote.isSome:
|
if result.quote.isSome:
|
||||||
result.quote = some(parseGraphTweet(js{"quoted_status_result", "result"}, isLegacy))
|
result.quote = some(parseGraphTweet(js{"quoted_status_result", "result"}))
|
||||||
|
|
||||||
|
with quoted, js{"quotedPostResults", "result"}:
|
||||||
|
result.quote = some(parseGraphTweet(quoted))
|
||||||
|
|
||||||
proc parseGraphThread(js: JsonNode): tuple[thread: Chain; self: bool] =
|
proc parseGraphThread(js: JsonNode): tuple[thread: Chain; self: bool] =
|
||||||
for t in js{"content", "items"}:
|
for t in ? js{"content", "items"}:
|
||||||
let entryId = t{"entryId"}.getStr
|
let entryId = t.getEntryId
|
||||||
if "cursor-showmore" in entryId:
|
if "cursor-showmore" in entryId:
|
||||||
let cursor = t{"item", "content", "value"}
|
let cursor = t{"item", "content", "value"}
|
||||||
result.thread.cursor = cursor.getStr
|
result.thread.cursor = cursor.getStr
|
||||||
result.thread.hasMore = true
|
result.thread.hasMore = true
|
||||||
elif "tweet" in entryId and "promoted" notin entryId:
|
elif "tweet" in entryId and "promoted" notin entryId:
|
||||||
let
|
with tweet, t.getTweetResult("item"):
|
||||||
isLegacy = t{"item"}.hasKey("itemContent")
|
result.thread.content.add parseGraphTweet(tweet)
|
||||||
(contentKey, resultKey) = if isLegacy: ("itemContent", "tweet_results")
|
|
||||||
else: ("content", "tweetResult")
|
|
||||||
|
|
||||||
with content, t{"item", contentKey}:
|
let tweetDisplayType = select(
|
||||||
result.thread.content.add parseGraphTweet(content{resultKey, "result"}, isLegacy)
|
t{"item", "content", "tweet_display_type"},
|
||||||
|
t{"item", "itemContent", "tweetDisplayType"}
|
||||||
if content{"tweetDisplayType"}.getStr == "SelfThread":
|
)
|
||||||
|
if tweetDisplayType.getStr == "SelfThread":
|
||||||
result.self = true
|
result.self = true
|
||||||
|
|
||||||
proc parseGraphTweetResult*(js: JsonNode): Tweet =
|
proc parseGraphTweetResult*(js: JsonNode): Tweet =
|
||||||
with tweet, js{"data", "tweet_result", "result"}:
|
with tweet, js{"data", "tweet_result", "result"}:
|
||||||
result = parseGraphTweet(tweet, false)
|
result = parseGraphTweet(tweet)
|
||||||
|
|
||||||
proc parseGraphConversation*(js: JsonNode; tweetId: string; v2=true): Conversation =
|
proc parseGraphConversation*(js: JsonNode; tweetId: string): Conversation =
|
||||||
result = Conversation(replies: Result[Chain](beginning: true))
|
result = Conversation(replies: Result[Chain](beginning: true))
|
||||||
|
|
||||||
let
|
let instructions = ? select(
|
||||||
rootKey = if v2: "timeline_response" else: "threaded_conversation_with_injections_v2"
|
js{"data", "timelineResponse", "instructions"},
|
||||||
contentKey = if v2: "content" else: "itemContent"
|
js{"data", "timeline_response", "instructions"},
|
||||||
resultKey = if v2: "tweetResult" else: "tweet_results"
|
js{"data", "threaded_conversation_with_injections_v2", "instructions"}
|
||||||
|
)
|
||||||
let instructions = ? js{"data", rootKey, "instructions"}
|
|
||||||
if instructions.len == 0:
|
if instructions.len == 0:
|
||||||
return
|
return
|
||||||
|
|
||||||
for i in instructions:
|
for i in instructions:
|
||||||
if i{"__typename"}.getStr == "TimelineAddEntries":
|
if i.getTypeName == "TimelineAddEntries":
|
||||||
for e in i{"entries"}:
|
for e in i{"entries"}:
|
||||||
let entryId = e{"entryId"}.getStr
|
let entryId = e.getEntryId
|
||||||
if entryId.startsWith("tweet"):
|
if entryId.startsWith("tweet"):
|
||||||
with tweetResult, e{"content", contentKey, resultKey, "result"}:
|
let tweetResult = getTweetResult(e)
|
||||||
let tweet = parseGraphTweet(tweetResult, not v2)
|
if tweetResult.notNull:
|
||||||
|
let tweet = parseGraphTweet(tweetResult)
|
||||||
|
|
||||||
if not tweet.available:
|
if not tweet.available:
|
||||||
tweet.id = parseBiggestInt(entryId.getId())
|
tweet.id = entryId.getId
|
||||||
|
|
||||||
if $tweet.id == tweetId:
|
if $tweet.id == tweetId:
|
||||||
result.tweet = tweet
|
result.tweet = tweet
|
||||||
@@ -418,50 +473,67 @@ proc parseGraphConversation*(js: JsonNode; tweetId: string; v2=true): Conversati
|
|||||||
elif thread.content.len > 0:
|
elif thread.content.len > 0:
|
||||||
result.replies.content.add thread
|
result.replies.content.add thread
|
||||||
elif entryId.startsWith("tombstone"):
|
elif entryId.startsWith("tombstone"):
|
||||||
let id = entryId.getId()
|
let
|
||||||
let tweet = Tweet(
|
content = select(e{"content", "content"}, e{"content", "itemContent"})
|
||||||
id: parseBiggestInt(id),
|
tweet = Tweet(
|
||||||
available: false,
|
id: entryId.getId,
|
||||||
text: e{"content", contentKey, "tombstoneInfo", "richText"}.getTombstone
|
available: false,
|
||||||
)
|
text: content{"tombstoneInfo", "richText"}.getTombstone
|
||||||
|
)
|
||||||
|
|
||||||
if id == tweetId:
|
if $tweet.id == tweetId:
|
||||||
result.tweet = tweet
|
result.tweet = tweet
|
||||||
else:
|
else:
|
||||||
result.before.content.add tweet
|
result.before.content.add tweet
|
||||||
elif entryId.startsWith("cursor-bottom"):
|
elif entryId.startsWith("cursor-bottom"):
|
||||||
result.replies.bottom = e{"content", contentKey, "value"}.getStr
|
var cursorValue = select(
|
||||||
|
e{"content", "value"},
|
||||||
|
e{"content", "content", "value"},
|
||||||
|
e{"content", "itemContent", "value"}
|
||||||
|
)
|
||||||
|
result.replies.bottom = cursorValue.getStr
|
||||||
|
|
||||||
|
proc extractTweetsFromEntry*(e: JsonNode): seq[Tweet] =
|
||||||
|
with tweetResult, getTweetResult(e):
|
||||||
|
var tweet = parseGraphTweet(tweetResult)
|
||||||
|
if not tweet.available:
|
||||||
|
tweet.id = e.getEntryId.getId
|
||||||
|
result.add tweet
|
||||||
|
return
|
||||||
|
|
||||||
|
for item in e{"content", "items"}:
|
||||||
|
with tweetResult, item.getTweetResult("item"):
|
||||||
|
var tweet = parseGraphTweet(tweetResult)
|
||||||
|
if not tweet.available:
|
||||||
|
tweet.id = item.getEntryId.getId
|
||||||
|
result.add tweet
|
||||||
|
|
||||||
proc parseGraphTimeline*(js: JsonNode; after=""): Profile =
|
proc parseGraphTimeline*(js: JsonNode; after=""): Profile =
|
||||||
result = Profile(tweets: Timeline(beginning: after.len == 0))
|
result = Profile(tweets: Timeline(beginning: after.len == 0))
|
||||||
|
|
||||||
let instructions =
|
let instructions = ? select(
|
||||||
if js{"data", "list"}.notNull:
|
js{"data", "list", "timeline_response", "timeline", "instructions"},
|
||||||
? js{"data", "list", "timeline_response", "timeline", "instructions"}
|
js{"data", "user", "result", "timeline", "timeline", "instructions"},
|
||||||
elif js{"data", "user"}.notNull:
|
js{"data", "user_result", "result", "timeline_response", "timeline", "instructions"}
|
||||||
? js{"data", "user", "result", "timeline", "timeline", "instructions"}
|
)
|
||||||
else:
|
|
||||||
? js{"data", "user_result", "result", "timeline_response", "timeline", "instructions"}
|
|
||||||
|
|
||||||
if instructions.len == 0:
|
if instructions.len == 0:
|
||||||
return
|
return
|
||||||
|
|
||||||
for i in instructions:
|
for i in instructions:
|
||||||
# TimelineAddToModule instruction is used by UserMedia
|
|
||||||
if i{"moduleItems"}.notNull:
|
if i{"moduleItems"}.notNull:
|
||||||
for item in i{"moduleItems"}:
|
for item in i{"moduleItems"}:
|
||||||
with tweetResult, item{"item", "itemContent", "tweet_results", "result"}:
|
with tweetResult, item.getTweetResult("item"):
|
||||||
let tweet = parseGraphTweet(tweetResult, false)
|
let tweet = parseGraphTweet(tweetResult)
|
||||||
if not tweet.available:
|
if not tweet.available:
|
||||||
tweet.id = parseBiggestInt(item{"entryId"}.getStr.getId())
|
tweet.id = item.getEntryId.getId
|
||||||
result.tweets.content.add tweet
|
result.tweets.content.add tweet
|
||||||
continue
|
continue
|
||||||
|
|
||||||
if i{"entries"}.notNull:
|
if i{"entries"}.notNull:
|
||||||
for e in i{"entries"}:
|
for e in i{"entries"}:
|
||||||
let entryId = e{"entryId"}.getStr
|
let entryId = e.getEntryId
|
||||||
if entryId.startsWith("tweet") or entryId.startsWith("profile-grid"):
|
if entryId.startsWith("tweet") or entryId.startsWith("profile-grid"):
|
||||||
for tweet in extractTweetsFromEntry(e, entryId):
|
for tweet in extractTweetsFromEntry(e):
|
||||||
result.tweets.content.add tweet
|
result.tweets.content.add tweet
|
||||||
elif "-conversation-" in entryId or entryId.startsWith("homeConversation"):
|
elif "-conversation-" in entryId or entryId.startsWith("homeConversation"):
|
||||||
let (thread, self) = parseGraphThread(e)
|
let (thread, self) = parseGraphThread(e)
|
||||||
@@ -469,44 +541,50 @@ proc parseGraphTimeline*(js: JsonNode; after=""): Profile =
|
|||||||
elif entryId.startsWith("cursor-bottom"):
|
elif entryId.startsWith("cursor-bottom"):
|
||||||
result.tweets.bottom = e{"content", "value"}.getStr
|
result.tweets.bottom = e{"content", "value"}.getStr
|
||||||
|
|
||||||
if after.len == 0 and i{"__typename"}.getStr == "TimelinePinEntry":
|
if after.len == 0:
|
||||||
with tweetResult, i{"entry", "content", "content", "tweetResult", "result"}:
|
if i.getTypeName == "TimelinePinEntry":
|
||||||
let tweet = parseGraphTweet(tweetResult, false)
|
let tweets = extractTweetsFromEntry(i{"entry"})
|
||||||
tweet.pinned = true
|
if tweets.len > 0:
|
||||||
if not tweet.available and tweet.tombstone.len == 0:
|
var tweet = tweets[0]
|
||||||
let entryId = i{"entry", "entryId"}.getEntryId
|
tweet.pinned = true
|
||||||
if entryId.len > 0:
|
result.pinned = some tweet
|
||||||
tweet.id = parseBiggestInt(entryId)
|
|
||||||
result.pinned = some tweet
|
|
||||||
|
|
||||||
proc parseGraphPhotoRail*(js: JsonNode): PhotoRail =
|
proc parseGraphPhotoRail*(js: JsonNode): PhotoRail =
|
||||||
result = @[]
|
result = @[]
|
||||||
|
|
||||||
var instructions = ? js{"data", "user", "result", "timeline", "timeline", "instructions"}
|
let instructions = select(
|
||||||
|
js{"data", "user", "result", "timeline", "timeline", "instructions"},
|
||||||
|
js{"data", "user_result", "result", "timeline_response", "timeline", "instructions"}
|
||||||
|
)
|
||||||
if instructions.len == 0:
|
if instructions.len == 0:
|
||||||
instructions = ? js{"data", "user_result", "result", "timeline_response", "timeline", "instructions"}
|
return
|
||||||
|
|
||||||
for i in instructions:
|
for i in instructions:
|
||||||
let instrType = i{"type"}.getStr
|
if i{"moduleItems"}.notNull:
|
||||||
if instrType.len == 0:
|
for item in i{"moduleItems"}:
|
||||||
if i{"__typename"}.getStr != "TimelineAddEntries":
|
with tweetResult, item.getTweetResult("item"):
|
||||||
continue
|
let t = parseGraphTweet(tweetResult)
|
||||||
elif instrType != "TimelineAddEntries":
|
if not t.available:
|
||||||
|
t.id = item.getEntryId.getId
|
||||||
|
|
||||||
|
let photo = extractGalleryPhoto(t)
|
||||||
|
if photo.url.len > 0:
|
||||||
|
result.add photo
|
||||||
|
|
||||||
|
if result.len == 16:
|
||||||
|
return
|
||||||
|
continue
|
||||||
|
|
||||||
|
if i.getTypeName != "TimelineAddEntries":
|
||||||
continue
|
continue
|
||||||
|
|
||||||
for e in i{"entries"}:
|
for e in i{"entries"}:
|
||||||
let entryId = e{"entryId"}.getStr
|
let entryId = e.getEntryId
|
||||||
if entryId.startsWith("tweet") or entryId.startsWith("profile-grid"):
|
if entryId.startsWith("tweet") or entryId.startsWith("profile-grid"):
|
||||||
for t in extractTweetsFromEntry(e, entryId):
|
for t in extractTweetsFromEntry(e):
|
||||||
let url =
|
let photo = extractGalleryPhoto(t)
|
||||||
if t.photos.len > 0: t.photos[0]
|
if photo.url.len > 0:
|
||||||
elif t.video.isSome: get(t.video).thumb
|
result.add photo
|
||||||
elif t.gif.isSome: get(t.gif).thumb
|
|
||||||
elif t.card.isSome: get(t.card).image
|
|
||||||
else: ""
|
|
||||||
|
|
||||||
if url.len > 0:
|
|
||||||
result.add GalleryPhoto(url: url, tweetId: $t.id)
|
|
||||||
|
|
||||||
if result.len == 16:
|
if result.len == 16:
|
||||||
return
|
return
|
||||||
@@ -514,21 +592,24 @@ proc parseGraphPhotoRail*(js: JsonNode): PhotoRail =
|
|||||||
proc parseGraphSearch*[T: User | Tweets](js: JsonNode; after=""): Result[T] =
|
proc parseGraphSearch*[T: User | Tweets](js: JsonNode; after=""): Result[T] =
|
||||||
result = Result[T](beginning: after.len == 0)
|
result = Result[T](beginning: after.len == 0)
|
||||||
|
|
||||||
let instructions = js{"data", "search_by_raw_query", "search_timeline", "timeline", "instructions"}
|
let instructions = select(
|
||||||
|
js{"data", "search", "timeline_response", "timeline", "instructions"},
|
||||||
|
js{"data", "search_by_raw_query", "search_timeline", "timeline", "instructions"}
|
||||||
|
)
|
||||||
if instructions.len == 0:
|
if instructions.len == 0:
|
||||||
return
|
return
|
||||||
|
|
||||||
for instruction in instructions:
|
for instruction in instructions:
|
||||||
let typ = instruction{"type"}.getStr
|
let typ = getTypeName(instruction)
|
||||||
if typ == "TimelineAddEntries":
|
if typ == "TimelineAddEntries":
|
||||||
for e in instruction{"entries"}:
|
for e in instruction{"entries"}:
|
||||||
let entryId = e{"entryId"}.getStr
|
let entryId = e.getEntryId
|
||||||
when T is Tweets:
|
when T is Tweets:
|
||||||
if entryId.startsWith("tweet"):
|
if entryId.startsWith("tweet"):
|
||||||
with tweetRes, e{"content", "itemContent", "tweet_results", "result"}:
|
with tweetRes, getTweetResult(e):
|
||||||
let tweet = parseGraphTweet(tweetRes)
|
let tweet = parseGraphTweet(tweetRes)
|
||||||
if not tweet.available:
|
if not tweet.available:
|
||||||
tweet.id = parseBiggestInt(entryId.getId())
|
tweet.id = entryId.getId
|
||||||
result.content.add tweet
|
result.content.add tweet
|
||||||
elif T is User:
|
elif T is User:
|
||||||
if entryId.startsWith("user"):
|
if entryId.startsWith("user"):
|
||||||
|
|||||||
@@ -36,6 +36,12 @@ template `?`*(js: JsonNode): untyped =
|
|||||||
if j.isNull: return
|
if j.isNull: return
|
||||||
j
|
j
|
||||||
|
|
||||||
|
template select*(a, b: JsonNode): untyped =
|
||||||
|
if a.notNull: a else: b
|
||||||
|
|
||||||
|
template select*(a, b, c: JsonNode): untyped =
|
||||||
|
if a.notNull: a elif b.notNull: b else: c
|
||||||
|
|
||||||
template with*(ident, value, body): untyped =
|
template with*(ident, value, body): untyped =
|
||||||
if true:
|
if true:
|
||||||
let ident {.inject.} = value
|
let ident {.inject.} = value
|
||||||
@@ -44,8 +50,7 @@ template with*(ident, value, body): untyped =
|
|||||||
template with*(ident; value: JsonNode; body): untyped =
|
template with*(ident; value: JsonNode; body): untyped =
|
||||||
if true:
|
if true:
|
||||||
let ident {.inject.} = value
|
let ident {.inject.} = value
|
||||||
# value.notNull causes a compilation error for versions < 1.6.14
|
if value.notNull: body
|
||||||
if notNull(value): body
|
|
||||||
|
|
||||||
template getCursor*(js: JsonNode): string =
|
template getCursor*(js: JsonNode): string =
|
||||||
js{"content", "operation", "cursor", "value"}.getStr
|
js{"content", "operation", "cursor", "value"}.getStr
|
||||||
@@ -54,6 +59,20 @@ template getError*(js: JsonNode): Error =
|
|||||||
if js.kind != JArray or js.len == 0: null
|
if js.kind != JArray or js.len == 0: null
|
||||||
else: Error(js[0]{"code"}.getInt)
|
else: Error(js[0]{"code"}.getInt)
|
||||||
|
|
||||||
|
proc getTweetResult*(js: JsonNode; root="content"): JsonNode =
|
||||||
|
select(
|
||||||
|
js{root, "content", "tweet_results", "result"},
|
||||||
|
js{root, "itemContent", "tweet_results", "result"},
|
||||||
|
js{root, "content", "tweetResult", "result"}
|
||||||
|
)
|
||||||
|
|
||||||
|
template getTypeName*(js: JsonNode): string =
|
||||||
|
js{"__typename"}.getStr(js{"type"}.getStr)
|
||||||
|
|
||||||
|
template getEntryId*(e: JsonNode): string =
|
||||||
|
e{"entryId"}.getStr(e{"entry_id"}.getStr)
|
||||||
|
|
||||||
|
|
||||||
template parseTime(time: string; f: static string; flen: int): DateTime =
|
template parseTime(time: string; f: static string; flen: int): DateTime =
|
||||||
if time.len != flen: return
|
if time.len != flen: return
|
||||||
parse(time, f, utc())
|
parse(time, f, utc())
|
||||||
@@ -64,29 +83,24 @@ proc getDateTime*(js: JsonNode): DateTime =
|
|||||||
proc getTime*(js: JsonNode): DateTime =
|
proc getTime*(js: JsonNode): DateTime =
|
||||||
parseTime(js.getStr, "ddd MMM dd hh:mm:ss \'+0000\' yyyy", 30)
|
parseTime(js.getStr, "ddd MMM dd hh:mm:ss \'+0000\' yyyy", 30)
|
||||||
|
|
||||||
proc getId*(id: string): string {.inline.} =
|
proc getTimeFromMs*(js: JsonNode): DateTime =
|
||||||
|
let ms = js.getInt(0)
|
||||||
|
if ms == 0: return
|
||||||
|
let seconds = ms div 1000
|
||||||
|
return fromUnix(seconds).utc()
|
||||||
|
|
||||||
|
proc getId*(id: string): int64 {.inline.} =
|
||||||
let start = id.rfind("-")
|
let start = id.rfind("-")
|
||||||
if start < 0: return id
|
if start < 0:
|
||||||
id[start + 1 ..< id.len]
|
return parseBiggestInt(id)
|
||||||
|
return parseBiggestInt(id[start + 1 ..< id.len])
|
||||||
|
|
||||||
proc getId*(js: JsonNode): int64 {.inline.} =
|
proc getId*(js: JsonNode): int64 {.inline.} =
|
||||||
case js.kind
|
case js.kind
|
||||||
of JString: return parseBiggestInt(js.getStr("0"))
|
of JString: return js.getStr("0").getId
|
||||||
of JInt: return js.getBiggestInt()
|
of JInt: return js.getBiggestInt()
|
||||||
else: return 0
|
else: return 0
|
||||||
|
|
||||||
proc getEntryId*(js: JsonNode): string {.inline.} =
|
|
||||||
let entry = js{"entryId"}.getStr
|
|
||||||
if entry.len == 0: return
|
|
||||||
|
|
||||||
if "tweet" in entry or "sq-I-t" in entry:
|
|
||||||
return entry.getId
|
|
||||||
elif "tombstone" in entry:
|
|
||||||
return js{"content", "item", "content", "tombstone", "tweet", "id"}.getStr
|
|
||||||
else:
|
|
||||||
echo "unknown entry: ", entry
|
|
||||||
return
|
|
||||||
|
|
||||||
template getStrVal*(js: JsonNode; default=""): string =
|
template getStrVal*(js: JsonNode; default=""): string =
|
||||||
js{"string_value"}.getStr(default)
|
js{"string_value"}.getStr(default)
|
||||||
|
|
||||||
@@ -98,6 +112,9 @@ proc getImageStr*(js: JsonNode): string =
|
|||||||
template getImageVal*(js: JsonNode): string =
|
template getImageVal*(js: JsonNode): string =
|
||||||
js{"image_value", "url"}.getImageStr
|
js{"image_value", "url"}.getImageStr
|
||||||
|
|
||||||
|
template getExpandedUrl*(js: JsonNode; fallback=""): string =
|
||||||
|
js{"expanded_url"}.getStr(js{"url"}.getStr(fallback))
|
||||||
|
|
||||||
proc getCardUrl*(js: JsonNode; kind: CardKind): string =
|
proc getCardUrl*(js: JsonNode; kind: CardKind): string =
|
||||||
result = js{"website_url"}.getStrVal
|
result = js{"website_url"}.getStrVal
|
||||||
if kind == promoVideoConvo:
|
if kind == promoVideoConvo:
|
||||||
@@ -157,19 +174,13 @@ proc getMp4Resolution*(url: string): int =
|
|||||||
# cannot determine resolution (e.g. m3u8/non-mp4 video)
|
# cannot determine resolution (e.g. m3u8/non-mp4 video)
|
||||||
return 0
|
return 0
|
||||||
|
|
||||||
proc getVideoViewCount*(js: JsonNode): string =
|
|
||||||
with stats, js{"ext_media_stats"}:
|
|
||||||
return stats{"view_count"}.getStr($stats{"viewCount"}.getInt)
|
|
||||||
|
|
||||||
return $js{"mediaStats", "viewCount"}.getInt(0)
|
|
||||||
|
|
||||||
proc extractSlice(js: JsonNode): Slice[int] =
|
proc extractSlice(js: JsonNode): Slice[int] =
|
||||||
result = js["indices"][0].getInt ..< js["indices"][1].getInt
|
result = js["indices"][0].getInt ..< js["indices"][1].getInt
|
||||||
|
|
||||||
proc extractUrls(result: var seq[ReplaceSlice]; js: JsonNode;
|
proc extractUrls(result: var seq[ReplaceSlice]; js: JsonNode;
|
||||||
textLen: int; hideTwitter = false) =
|
textLen: int; hideTwitter = false) =
|
||||||
let
|
let
|
||||||
url = js["expanded_url"].getStr
|
url = js.getExpandedUrl
|
||||||
slice = js.extractSlice
|
slice = js.extractSlice
|
||||||
|
|
||||||
if hideTwitter and slice.b.succ >= textLen and url.isTwitterUrl:
|
if hideTwitter and slice.b.succ >= textLen and url.isTwitterUrl:
|
||||||
@@ -230,7 +241,7 @@ proc expandUserEntities*(user: var User; js: JsonNode) =
|
|||||||
ent = ? js{"entities"}
|
ent = ? js{"entities"}
|
||||||
|
|
||||||
with urls, ent{"url", "urls"}:
|
with urls, ent{"url", "urls"}:
|
||||||
user.website = urls[0]{"expanded_url"}.getStr
|
user.website = urls[0].getExpandedUrl
|
||||||
|
|
||||||
var replacements = newSeq[ReplaceSlice]()
|
var replacements = newSeq[ReplaceSlice]()
|
||||||
|
|
||||||
@@ -260,7 +271,7 @@ proc expandTextEntities(tweet: Tweet; entities: JsonNode; text: string; textSlic
|
|||||||
replacements.extractUrls(u, textSlice.b, hideTwitter = hasRedundantLink)
|
replacements.extractUrls(u, textSlice.b, hideTwitter = hasRedundantLink)
|
||||||
|
|
||||||
if hasCard and u{"url"}.getStr == get(tweet.card).url:
|
if hasCard and u{"url"}.getStr == get(tweet.card).url:
|
||||||
get(tweet.card).url = u{"expanded_url"}.getStr
|
get(tweet.card).url = u.getExpandedUrl
|
||||||
|
|
||||||
with media, entities{"media"}:
|
with media, entities{"media"}:
|
||||||
for m in media:
|
for m in media:
|
||||||
@@ -319,3 +330,13 @@ proc expandNoteTweetEntities*(tweet: Tweet; js: JsonNode) =
|
|||||||
tweet.expandTextEntities(entities, text, textSlice)
|
tweet.expandTextEntities(entities, text, textSlice)
|
||||||
|
|
||||||
tweet.text = tweet.text.multiReplace((unicodeOpen, xmlOpen), (unicodeClose, xmlClose))
|
tweet.text = tweet.text.multiReplace((unicodeOpen, xmlOpen), (unicodeClose, xmlClose))
|
||||||
|
|
||||||
|
proc extractGalleryPhoto*(t: Tweet): GalleryPhoto =
|
||||||
|
let url =
|
||||||
|
if t.photos.len > 0: t.photos[0]
|
||||||
|
elif t.video.isSome: get(t.video).thumb
|
||||||
|
elif t.gif.isSome: get(t.gif).thumb
|
||||||
|
elif t.card.isSome: get(t.card).image
|
||||||
|
else: ""
|
||||||
|
|
||||||
|
result = GalleryPhoto(url: url, tweetId: $t.id)
|
||||||
|
|||||||
@@ -1,5 +1,5 @@
|
|||||||
# SPDX-License-Identifier: AGPL-3.0-only
|
# SPDX-License-Identifier: AGPL-3.0-only
|
||||||
import tables
|
import tables, strutils, sequtils
|
||||||
import types, prefs_impl
|
import types, prefs_impl
|
||||||
from config import get
|
from config import get
|
||||||
from parsecfg import nil
|
from parsecfg import nil
|
||||||
@@ -13,6 +13,8 @@ proc updateDefaultPrefs*(cfg: parsecfg.Config) =
|
|||||||
|
|
||||||
proc getPrefs*(cookies: Table[string, string]): Prefs =
|
proc getPrefs*(cookies: Table[string, string]): Prefs =
|
||||||
result = defaultPrefs
|
result = defaultPrefs
|
||||||
|
if "nitter_following" in cookies:
|
||||||
|
result.following = cookies["nitter_following"].split(',').filterIt(it.len > 0)
|
||||||
genCookiePrefs(cookies)
|
genCookiePrefs(cookies)
|
||||||
|
|
||||||
template getPref*(cookies: Table[string, string], pref): untyped =
|
template getPref*(cookies: Table[string, string], pref): untyped =
|
||||||
|
|||||||
@@ -54,6 +54,10 @@ genPrefs:
|
|||||||
theme(select, "Nitter"):
|
theme(select, "Nitter"):
|
||||||
"Theme"
|
"Theme"
|
||||||
|
|
||||||
|
verifiedBadge(select, "Show all"):
|
||||||
|
"Verified badges"
|
||||||
|
options: @["Show all", "Show official only", "Hide all"]
|
||||||
|
|
||||||
infiniteScroll(checkbox, false):
|
infiniteScroll(checkbox, false):
|
||||||
"Infinite scrolling (experimental, requires JavaScript)"
|
"Infinite scrolling (experimental, requires JavaScript)"
|
||||||
|
|
||||||
@@ -78,6 +82,9 @@ genPrefs:
|
|||||||
squareAvatars(checkbox, false):
|
squareAvatars(checkbox, false):
|
||||||
"Square profile pictures"
|
"Square profile pictures"
|
||||||
|
|
||||||
|
hideNsfw(checkbox, true):
|
||||||
|
"Hide NSFW content"
|
||||||
|
|
||||||
Media:
|
Media:
|
||||||
mp4Playback(checkbox, true):
|
mp4Playback(checkbox, true):
|
||||||
"Enable mp4 video playback (only for gifs)"
|
"Enable mp4 video playback (only for gifs)"
|
||||||
@@ -107,6 +114,18 @@ genPrefs:
|
|||||||
"Reddit -> Teddit/Libreddit"
|
"Reddit -> Teddit/Libreddit"
|
||||||
placeholder: "Teddit hostname"
|
placeholder: "Teddit hostname"
|
||||||
|
|
||||||
|
replaceImgur(input, ""):
|
||||||
|
"Imgur -> Rimgo"
|
||||||
|
placeholder: "Rimgo hostname"
|
||||||
|
|
||||||
|
replaceFandom(input, ""):
|
||||||
|
"Fandom -> Phantom"
|
||||||
|
placeholder: "Phantom hostname"
|
||||||
|
|
||||||
|
replaceSoundCloud(input, ""):
|
||||||
|
"SoundCloud -> SoundCloak"
|
||||||
|
placeholder: "SoundCloak hostname"
|
||||||
|
|
||||||
iterator allPrefs*(): Pref =
|
iterator allPrefs*(): Pref =
|
||||||
for k, v in prefList:
|
for k, v in prefList:
|
||||||
for pref in v:
|
for pref in v:
|
||||||
@@ -206,6 +225,7 @@ macro genPrefsType*(): untyped =
|
|||||||
let name = nnkPostfix.newTree(ident("*"), ident("Prefs"))
|
let name = nnkPostfix.newTree(ident("*"), ident("Prefs"))
|
||||||
result = quote do:
|
result = quote do:
|
||||||
type `name` = object
|
type `name` = object
|
||||||
|
following*: seq[string]
|
||||||
discard
|
discard
|
||||||
|
|
||||||
for pref in allPrefs():
|
for pref in allPrefs():
|
||||||
|
|||||||
@@ -6,10 +6,9 @@ import types
|
|||||||
const
|
const
|
||||||
validFilters* = @[
|
validFilters* = @[
|
||||||
"media", "images", "twimg", "videos",
|
"media", "images", "twimg", "videos",
|
||||||
"native_video", "consumer_video", "pro_video",
|
"native_video", "consumer_video", "spaces",
|
||||||
"links", "news", "quote", "mentions",
|
"links", "news", "quote", "mentions",
|
||||||
"replies", "retweets", "nativeretweets",
|
"replies", "retweets", "nativeretweets"
|
||||||
"verified", "safe"
|
|
||||||
]
|
]
|
||||||
|
|
||||||
emptyQuery* = "include:nativeretweets"
|
emptyQuery* = "include:nativeretweets"
|
||||||
@@ -18,6 +17,11 @@ template `@`(param: string): untyped =
|
|||||||
if param in pms: pms[param]
|
if param in pms: pms[param]
|
||||||
else: ""
|
else: ""
|
||||||
|
|
||||||
|
proc validateNumber(value: string): string =
|
||||||
|
if value.anyIt(not it.isDigit):
|
||||||
|
return ""
|
||||||
|
return value
|
||||||
|
|
||||||
proc initQuery*(pms: Table[string, string]; name=""): Query =
|
proc initQuery*(pms: Table[string, string]; name=""): Query =
|
||||||
result = Query(
|
result = Query(
|
||||||
kind: parseEnum[QueryKind](@"f", tweets),
|
kind: parseEnum[QueryKind](@"f", tweets),
|
||||||
@@ -26,7 +30,8 @@ proc initQuery*(pms: Table[string, string]; name=""): Query =
|
|||||||
excludes: validFilters.filterIt("e-" & it in pms),
|
excludes: validFilters.filterIt("e-" & it in pms),
|
||||||
since: @"since",
|
since: @"since",
|
||||||
until: @"until",
|
until: @"until",
|
||||||
near: @"near"
|
near: @"near",
|
||||||
|
minLikes: validateNumber(@"min_faves")
|
||||||
)
|
)
|
||||||
|
|
||||||
if name.len > 0:
|
if name.len > 0:
|
||||||
@@ -59,8 +64,11 @@ proc genQueryParam*(query: Query): string =
|
|||||||
if i < query.fromUser.high:
|
if i < query.fromUser.high:
|
||||||
param &= "OR "
|
param &= "OR "
|
||||||
|
|
||||||
if query.fromUser.len > 0 and query.kind in {posts, media}:
|
if query.fromUser.len > 0:
|
||||||
param &= "filter:self_threads OR -filter:replies "
|
if query.kind in {posts, media}:
|
||||||
|
param &= "filter:self_threads OR -filter:replies "
|
||||||
|
elif query.kind == tweets and query.fromUser.len > 1:
|
||||||
|
param &= "filter:self_threads OR -filter:replies "
|
||||||
|
|
||||||
if "nativeretweets" notin query.excludes:
|
if "nativeretweets" notin query.excludes:
|
||||||
param &= "include:nativeretweets "
|
param &= "include:nativeretweets "
|
||||||
@@ -79,7 +87,9 @@ proc genQueryParam*(query: Query): string =
|
|||||||
if query.until.len > 0:
|
if query.until.len > 0:
|
||||||
result &= " until:" & query.until
|
result &= " until:" & query.until
|
||||||
if query.near.len > 0:
|
if query.near.len > 0:
|
||||||
result &= &" near:\"{query.near}\" within:15mi"
|
result &= " near:\"" & query.near & "\""
|
||||||
|
if query.minLikes.len > 0:
|
||||||
|
result &= " min_faves:" & query.minLikes
|
||||||
if query.text.len > 0:
|
if query.text.len > 0:
|
||||||
if result.len > 0:
|
if result.len > 0:
|
||||||
result &= " " & query.text
|
result &= " " & query.text
|
||||||
@@ -105,6 +115,8 @@ proc genQueryUrl*(query: Query): string =
|
|||||||
params.add "until=" & query.until
|
params.add "until=" & query.until
|
||||||
if query.near.len > 0:
|
if query.near.len > 0:
|
||||||
params.add "near=" & query.near
|
params.add "near=" & query.near
|
||||||
|
if query.minLikes.len > 0:
|
||||||
|
params.add "min_faves=" & query.minLikes
|
||||||
|
|
||||||
if params.len > 0:
|
if params.len > 0:
|
||||||
result &= params.join("&")
|
result &= params.join("&")
|
||||||
|
|||||||
@@ -1,5 +1,5 @@
|
|||||||
# SPDX-License-Identifier: AGPL-3.0-only
|
# SPDX-License-Identifier: AGPL-3.0-only
|
||||||
import asyncdispatch, times, strformat, strutils, tables, hashes
|
import asyncdispatch, times, strformat, strutils, tables, hashes, logging
|
||||||
import redis, redpool, flatty, supersnappy
|
import redis, redpool, flatty, supersnappy
|
||||||
|
|
||||||
import types, api
|
import types, api
|
||||||
@@ -59,8 +59,7 @@ proc initRedisPool*(cfg: Config) {.async.} =
|
|||||||
await r.configSet("hash-max-ziplist-entries", "1000")
|
await r.configSet("hash-max-ziplist-entries", "1000")
|
||||||
|
|
||||||
except OSError:
|
except OSError:
|
||||||
stdout.write "Failed to connect to Redis.\n"
|
fatal "Failed to connect to Redis."
|
||||||
stdout.flushFile
|
|
||||||
quit(1)
|
quit(1)
|
||||||
|
|
||||||
template uidKey(name: string): string = "pid:" & $(hash(name) div 1_000_000)
|
template uidKey(name: string): string = "pid:" & $(hash(name) div 1_000_000)
|
||||||
@@ -112,7 +111,7 @@ template deserialize(data, T) =
|
|||||||
try:
|
try:
|
||||||
result = fromFlatty(uncompress(data), T)
|
result = fromFlatty(uncompress(data), T)
|
||||||
except:
|
except:
|
||||||
echo "Decompression failed($#): '$#'" % [astToStr(T), data]
|
error "Decompression failed($#): '$#'" % [astToStr(T), data]
|
||||||
|
|
||||||
proc getUserId*(username: string): Future[string] {.async.} =
|
proc getUserId*(username: string): Future[string] {.async.} =
|
||||||
let name = toLower(username)
|
let name = toLower(username)
|
||||||
@@ -189,6 +188,6 @@ proc getCachedRss*(key: string): Future[Rss] {.async.} =
|
|||||||
let feed = await r.hGet(k, "rss")
|
let feed = await r.hGet(k, "rss")
|
||||||
if feed.len > 0 and feed != redisNil:
|
if feed.len > 0 and feed != redisNil:
|
||||||
try: result.feed = uncompress feed
|
try: result.feed = uncompress feed
|
||||||
except: echo "Decompressing RSS failed: ", feed
|
except: error "Decompressing RSS failed: ", feed
|
||||||
else:
|
else:
|
||||||
result.cursor.setLen 0
|
result.cursor.setLen 0
|
||||||
|
|||||||
23
src/routes/follow.nim
Normal file
23
src/routes/follow.nim
Normal file
@@ -0,0 +1,23 @@
|
|||||||
|
# SPDX-License-Identifier: AGPL-3.0-only
|
||||||
|
import strutils, sequtils
|
||||||
|
import jester
|
||||||
|
import router_utils
|
||||||
|
import ".."/[types]
|
||||||
|
|
||||||
|
proc createFollowRouter*(cfg: Config) =
|
||||||
|
router follow:
|
||||||
|
post "/follow":
|
||||||
|
let user = @"user"
|
||||||
|
var prefs = cookiePrefs()
|
||||||
|
if user.len > 0 and user notin prefs.following:
|
||||||
|
prefs.following.add(user)
|
||||||
|
setCookie("nitter_following", prefs.following.join(","), daysForward(360), path="/", httpOnly=true, secure=cfg.useHttps, sameSite=None)
|
||||||
|
redirect(refPath())
|
||||||
|
|
||||||
|
post "/unfollow":
|
||||||
|
let user = @"user"
|
||||||
|
var prefs = cookiePrefs()
|
||||||
|
if user.len > 0 and user in prefs.following:
|
||||||
|
prefs.following.keepItIf(it != user)
|
||||||
|
setCookie("nitter_following", prefs.following.join(","), daysForward(360), path="/", httpOnly=true, secure=cfg.useHttps, sameSite=None)
|
||||||
|
redirect(refPath())
|
||||||
@@ -1,5 +1,5 @@
|
|||||||
# SPDX-License-Identifier: AGPL-3.0-only
|
# SPDX-License-Identifier: AGPL-3.0-only
|
||||||
import uri, strutils, httpclient, os, hashes, base64, re
|
import uri, strutils, httpclient, os, hashes, base64, re, logging
|
||||||
import asynchttpserver, asyncstreams, asyncfile, asyncnet
|
import asynchttpserver, asyncstreams, asyncfile, asyncnet
|
||||||
|
|
||||||
import jester
|
import jester
|
||||||
@@ -38,7 +38,7 @@ proc proxyMedia*(req: jester.Request; url: string): Future[HttpCode] {.async.} =
|
|||||||
let res = await client.get(url)
|
let res = await client.get(url)
|
||||||
if res.status != "200 OK":
|
if res.status != "200 OK":
|
||||||
if res.status != "404 Not Found":
|
if res.status != "404 Not Found":
|
||||||
echo "[media] Proxying failed, status: $1, url: $2" % [res.status, url]
|
warn "[media] Proxying failed, status: $1, url: $2" % [res.status, url]
|
||||||
return Http404
|
return Http404
|
||||||
|
|
||||||
let hashed = $hash(url)
|
let hashed = $hash(url)
|
||||||
@@ -67,7 +67,7 @@ proc proxyMedia*(req: jester.Request; url: string): Future[HttpCode] {.async.} =
|
|||||||
await request.client.send(data)
|
await request.client.send(data)
|
||||||
data.setLen 0
|
data.setLen 0
|
||||||
except HttpRequestError, ProtocolError, OSError:
|
except HttpRequestError, ProtocolError, OSError:
|
||||||
echo "[media] Proxying exception, error: $1, url: $2" % [getCurrentExceptionMsg(), url]
|
error "[media] Proxying exception, error: $1, url: $2" % [getCurrentExceptionMsg(), url]
|
||||||
result = Http404
|
result = Http404
|
||||||
finally:
|
finally:
|
||||||
client.close()
|
client.close()
|
||||||
|
|||||||
@@ -32,7 +32,7 @@ proc createSearchRouter*(cfg: Config) =
|
|||||||
users = await getGraphUserSearch(query, getCursor())
|
users = await getGraphUserSearch(query, getCursor())
|
||||||
except InternalError:
|
except InternalError:
|
||||||
users = Result[User](beginning: true, query: query)
|
users = Result[User](beginning: true, query: query)
|
||||||
resp renderMain(renderUserSearch(users, prefs), request, cfg, prefs, title)
|
resp renderMain(renderUserSearch(users, prefs, getPath()), request, cfg, prefs, title)
|
||||||
of tweets:
|
of tweets:
|
||||||
let
|
let
|
||||||
tweets = await getGraphTweetSearch(query, getCursor())
|
tweets = await getGraphTweetSearch(query, getCursor())
|
||||||
|
|||||||
@@ -31,8 +31,6 @@ proc createStatusRouter*(cfg: Config) =
|
|||||||
resp $renderReplies(replies, prefs, getPath())
|
resp $renderReplies(replies, prefs, getPath())
|
||||||
|
|
||||||
let conv = await getTweet(id, getCursor())
|
let conv = await getTweet(id, getCursor())
|
||||||
if conv == nil:
|
|
||||||
echo "nil conv"
|
|
||||||
|
|
||||||
if conv == nil or conv.tweet == nil or conv.tweet.id == 0:
|
if conv == nil or conv.tweet == nil or conv.tweet.id == 0:
|
||||||
var error = "Tweet not found"
|
var error = "Tweet not found"
|
||||||
@@ -68,7 +66,7 @@ proc createStatusRouter*(cfg: Config) =
|
|||||||
|
|
||||||
get "/@name/@s/@id/@m/?@i?":
|
get "/@name/@s/@id/@m/?@i?":
|
||||||
cond @"s" in ["status", "statuses"]
|
cond @"s" in ["status", "statuses"]
|
||||||
cond @"m" in ["video", "photo"]
|
cond @"m" in ["video", "photo", "history"]
|
||||||
redirect("/$1/status/$2" % [@"name", @"id"])
|
redirect("/$1/status/$2" % [@"name", @"id"])
|
||||||
|
|
||||||
get "/@name/statuses/@id/?":
|
get "/@name/statuses/@id/?":
|
||||||
|
|||||||
@@ -105,6 +105,12 @@ proc createTimelineRouter*(cfg: Config) =
|
|||||||
get "/intent/user":
|
get "/intent/user":
|
||||||
respUserId()
|
respUserId()
|
||||||
|
|
||||||
|
get "/intent/follow/?":
|
||||||
|
let username = request.params.getOrDefault("screen_name")
|
||||||
|
if username.len == 0:
|
||||||
|
resp Http400, showError("Missing screen_name parameter", cfg)
|
||||||
|
redirect("/" & username)
|
||||||
|
|
||||||
get "/@name/?@tab?/?":
|
get "/@name/?@tab?/?":
|
||||||
cond '.' notin @"name"
|
cond '.' notin @"name"
|
||||||
cond @"name" notin ["pic", "gif", "video", "search", "settings", "login", "intent", "i"]
|
cond @"name" notin ["pic", "gif", "video", "search", "settings", "login", "intent", "i"]
|
||||||
|
|||||||
@@ -17,7 +17,7 @@ proc createUnsupportedRouter*(cfg: Config) =
|
|||||||
get "/@name/lists/?": feature()
|
get "/@name/lists/?": feature()
|
||||||
|
|
||||||
get "/intent/?@i?":
|
get "/intent/?@i?":
|
||||||
cond @"i" notin ["user"]
|
cond @"i" notin ["user", "follow"]
|
||||||
feature()
|
feature()
|
||||||
|
|
||||||
get "/i/@i?/?@j?":
|
get "/i/@i?/?@j?":
|
||||||
|
|||||||
@@ -37,3 +37,52 @@
|
|||||||
height: unset;
|
height: unset;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
.follow-form {
|
||||||
|
display: inline-block;
|
||||||
|
pointer-events: all;
|
||||||
|
}
|
||||||
|
|
||||||
|
.follow-button {
|
||||||
|
background-color: transparent;
|
||||||
|
color: var(--accent);
|
||||||
|
border: 1px solid var(--accent);
|
||||||
|
border-radius: 9999px;
|
||||||
|
padding: 4px 12px;
|
||||||
|
font-weight: 700;
|
||||||
|
font-size: 14px;
|
||||||
|
cursor: pointer;
|
||||||
|
line-height: 1.2;
|
||||||
|
transition: background-color 0.2s;
|
||||||
|
outline: none;
|
||||||
|
|
||||||
|
&:hover {
|
||||||
|
background-color: var(--bg_hover);
|
||||||
|
}
|
||||||
|
|
||||||
|
&.unfollow {
|
||||||
|
color: #e0245e;
|
||||||
|
border-color: #e0245e;
|
||||||
|
|
||||||
|
&:hover {
|
||||||
|
background-color: rgba(224, 36, 94, 0.1);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
.profile-header {
|
||||||
|
display: flex;
|
||||||
|
justify-content: space-between;
|
||||||
|
align-items: flex-start;
|
||||||
|
flex: 1;
|
||||||
|
min-width: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
.tweet-name-row .follow-form {
|
||||||
|
margin-left: 10px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.tweet-name-row .follow-button {
|
||||||
|
padding: 2px 10px;
|
||||||
|
font-size: 13px;
|
||||||
|
}
|
||||||
|
|||||||
53
src/sass/homepage.scss
Normal file
53
src/sass/homepage.scss
Normal file
@@ -0,0 +1,53 @@
|
|||||||
|
@import '_variables';
|
||||||
|
@import '_mixins';
|
||||||
|
|
||||||
|
.homepage-container {
|
||||||
|
display: flex;
|
||||||
|
gap: 5px;
|
||||||
|
max-width: 1200px;
|
||||||
|
margin: 0 auto;
|
||||||
|
justify-content: center;
|
||||||
|
}
|
||||||
|
|
||||||
|
.following-column,
|
||||||
|
.timeline-users-column {
|
||||||
|
width: 280px;
|
||||||
|
flex-shrink: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
.timeline-users-column {
|
||||||
|
.timeline-item {
|
||||||
|
flex-direction: column;
|
||||||
|
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
.profile-cards {
|
||||||
|
display: flex;
|
||||||
|
flex-direction: column;
|
||||||
|
gap: 5px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.timeline-users-column > :first-child,
|
||||||
|
.homepage-container .timeline-container > .timeline > :first-child {
|
||||||
|
margin-top: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
@media (max-width: 1200px) {
|
||||||
|
.homepage-container {
|
||||||
|
max-width: 100%;
|
||||||
|
padding: 0 10px;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@media (max-width: 1100px) {
|
||||||
|
.following-column {
|
||||||
|
display: none;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@media (max-width: 800px) {
|
||||||
|
.timeline-users-column {
|
||||||
|
display: none;
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -61,23 +61,8 @@
|
|||||||
|
|
||||||
@mixin search-resize($width, $rows) {
|
@mixin search-resize($width, $rows) {
|
||||||
@media(max-width: $width) {
|
@media(max-width: $width) {
|
||||||
.search-toggles {
|
|
||||||
grid-template-columns: repeat($rows, auto);
|
|
||||||
}
|
|
||||||
|
|
||||||
#search-panel-toggle:checked ~ .search-panel {
|
#search-panel-toggle:checked ~ .search-panel {
|
||||||
@if $rows == 6 {
|
max-height: 80vh !important;
|
||||||
max-height: 200px !important;
|
|
||||||
}
|
|
||||||
@if $rows == 5 {
|
|
||||||
max-height: 300px !important;
|
|
||||||
}
|
|
||||||
@if $rows == 4 {
|
|
||||||
max-height: 300px !important;
|
|
||||||
}
|
|
||||||
@if $rows == 3 {
|
|
||||||
max-height: 365px !important;
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -7,6 +7,7 @@
|
|||||||
@import 'inputs';
|
@import 'inputs';
|
||||||
@import 'timeline';
|
@import 'timeline';
|
||||||
@import 'search';
|
@import 'search';
|
||||||
|
@import 'homepage';
|
||||||
|
|
||||||
body {
|
body {
|
||||||
// colors
|
// colors
|
||||||
@@ -51,7 +52,7 @@ body {
|
|||||||
background-color: var(--bg_color);
|
background-color: var(--bg_color);
|
||||||
color: var(--fg_color);
|
color: var(--fg_color);
|
||||||
font-family: $font_stack;
|
font-family: $font_stack;
|
||||||
font-size: 14px;
|
font-size: 15px;
|
||||||
line-height: 1.3;
|
line-height: 1.3;
|
||||||
margin: 0;
|
margin: 0;
|
||||||
}
|
}
|
||||||
@@ -114,7 +115,7 @@ ul {
|
|||||||
display: flex;
|
display: flex;
|
||||||
flex-wrap: wrap;
|
flex-wrap: wrap;
|
||||||
box-sizing: border-box;
|
box-sizing: border-box;
|
||||||
padding-top: 50px;
|
padding-top: 55px;
|
||||||
margin: auto;
|
margin: auto;
|
||||||
min-height: 100vh;
|
min-height: 100vh;
|
||||||
}
|
}
|
||||||
@@ -127,7 +128,6 @@ ul {
|
|||||||
max-width: 600px;
|
max-width: 600px;
|
||||||
width: 100%;
|
width: 100%;
|
||||||
margin: 0 auto;
|
margin: 0 auto;
|
||||||
margin-top: 10px;
|
|
||||||
background-color: var(--bg_overlays);
|
background-color: var(--bg_overlays);
|
||||||
padding: 10px 15px;
|
padding: 10px 15px;
|
||||||
align-self: start;
|
align-self: start;
|
||||||
@@ -169,6 +169,14 @@ ul {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
body.hide-verified-all .verified-icon {
|
||||||
|
display: none !important;
|
||||||
|
}
|
||||||
|
|
||||||
|
body.hide-verified-blue .verified-icon.blue {
|
||||||
|
display: none !important;
|
||||||
|
}
|
||||||
|
|
||||||
@media(max-width: 600px) {
|
@media(max-width: 600px) {
|
||||||
.preferences-container {
|
.preferences-container {
|
||||||
max-width: 95vw;
|
max-width: 95vw;
|
||||||
|
|||||||
@@ -14,6 +14,7 @@ button {
|
|||||||
|
|
||||||
input[type="text"],
|
input[type="text"],
|
||||||
input[type="date"],
|
input[type="date"],
|
||||||
|
input[type="number"],
|
||||||
select {
|
select {
|
||||||
@include input-colors;
|
@include input-colors;
|
||||||
background-color: var(--bg_elements);
|
background-color: var(--bg_elements);
|
||||||
@@ -24,7 +25,12 @@ select {
|
|||||||
font-size: 14px;
|
font-size: 14px;
|
||||||
}
|
}
|
||||||
|
|
||||||
input[type="text"] {
|
input[type="number"] {
|
||||||
|
-moz-appearance: textfield;
|
||||||
|
}
|
||||||
|
|
||||||
|
input[type="text"],
|
||||||
|
input[type="number"] {
|
||||||
height: 16px;
|
height: 16px;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -38,6 +44,17 @@ input[type="date"]::-webkit-inner-spin-button {
|
|||||||
display: none;
|
display: none;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
input[type="number"] {
|
||||||
|
-moz-appearance: textfield;
|
||||||
|
}
|
||||||
|
|
||||||
|
input[type="number"]::-webkit-inner-spin-button,
|
||||||
|
input[type="number"]::-webkit-outer-spin-button {
|
||||||
|
display: none;
|
||||||
|
-webkit-appearance: none;
|
||||||
|
margin: 0;
|
||||||
|
}
|
||||||
|
|
||||||
input[type="date"]::-webkit-clear-button {
|
input[type="date"]::-webkit-clear-button {
|
||||||
margin-left: 17px;
|
margin-left: 17px;
|
||||||
filter: grayscale(100%);
|
filter: grayscale(100%);
|
||||||
@@ -137,7 +154,7 @@ input::-webkit-datetime-edit-year-field:focus {
|
|||||||
bottom: 0;
|
bottom: 0;
|
||||||
font-size: 13px;
|
font-size: 13px;
|
||||||
font-family: $font_icon;
|
font-family: $font_icon;
|
||||||
content: '\e803';
|
content: '\e804';
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -162,9 +179,22 @@ input::-webkit-datetime-edit-year-field:focus {
|
|||||||
-moz-appearance: none;
|
-moz-appearance: none;
|
||||||
-webkit-appearance: none;
|
-webkit-appearance: none;
|
||||||
appearance: none;
|
appearance: none;
|
||||||
|
padding-right: 18px;
|
||||||
}
|
}
|
||||||
|
|
||||||
input[type="text"] {
|
.pref-select:after {
|
||||||
|
content: '\e80b'; /* icon-down */
|
||||||
|
font-family: $font_icon;
|
||||||
|
font-size: 10px;
|
||||||
|
pointer-events: none;
|
||||||
|
position: absolute;
|
||||||
|
right: 4px;
|
||||||
|
top: 5px;
|
||||||
|
color: var(--fg_color);
|
||||||
|
}
|
||||||
|
|
||||||
|
input[type="text"],
|
||||||
|
input[type="number"] {
|
||||||
position: absolute;
|
position: absolute;
|
||||||
right: 0;
|
right: 0;
|
||||||
max-width: 140px;
|
max-width: 140px;
|
||||||
|
|||||||
@@ -25,6 +25,14 @@ nav {
|
|||||||
align-items: center;
|
align-items: center;
|
||||||
flex-basis: 920px;
|
flex-basis: 920px;
|
||||||
height: 50px;
|
height: 50px;
|
||||||
|
gap: 15px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.inner-nav .search-field {
|
||||||
|
flex: 1;
|
||||||
|
margin: 0 auto;
|
||||||
|
max-width: 350px;
|
||||||
|
min-width: 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
.site-name {
|
.site-name {
|
||||||
@@ -46,11 +54,11 @@ nav {
|
|||||||
|
|
||||||
.nav-item {
|
.nav-item {
|
||||||
display: flex;
|
display: flex;
|
||||||
flex: 1;
|
flex: 0 0 auto;
|
||||||
line-height: 50px;
|
line-height: 50px;
|
||||||
height: 50px;
|
height: 50px;
|
||||||
overflow: hidden;
|
overflow: hidden;
|
||||||
flex-wrap: wrap;
|
flex-wrap: nowrap;
|
||||||
align-items: center;
|
align-items: center;
|
||||||
|
|
||||||
&.right {
|
&.right {
|
||||||
|
|||||||
@@ -15,7 +15,7 @@
|
|||||||
}
|
}
|
||||||
|
|
||||||
.profile-banner {
|
.profile-banner {
|
||||||
margin: 4px 0 4px 0;
|
margin-bottom: 5px;
|
||||||
background-color: var(--bg_panel);
|
background-color: var(--bg_panel);
|
||||||
|
|
||||||
a {
|
a {
|
||||||
|
|||||||
@@ -9,70 +9,111 @@
|
|||||||
|
|
||||||
.search-field {
|
.search-field {
|
||||||
display: flex;
|
display: flex;
|
||||||
flex-wrap: wrap;
|
flex-wrap: nowrap;
|
||||||
|
position: relative;
|
||||||
|
|
||||||
button {
|
button {
|
||||||
margin: 0 2px 0 0;
|
margin: 0 2px 0 0;
|
||||||
height: 23px;
|
height: 23px;
|
||||||
display: flex;
|
display: flex;
|
||||||
align-items: center;
|
align-items: center;
|
||||||
|
flex: 0 0 auto;
|
||||||
}
|
}
|
||||||
|
|
||||||
.pref-input {
|
.pref-input {
|
||||||
margin: 0 4px 0 0;
|
margin: 0 4px 0 0;
|
||||||
flex-grow: 1;
|
flex-grow: 1;
|
||||||
height: 23px;
|
height: 23px;
|
||||||
|
min-width: 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
input[type="text"] {
|
input[type="text"],
|
||||||
|
input[type="number"] {
|
||||||
height: calc(100% - 4px);
|
height: calc(100% - 4px);
|
||||||
width: calc(100% - 8px);
|
width: calc(100% - 8px);
|
||||||
}
|
}
|
||||||
|
|
||||||
> label {
|
> label {
|
||||||
display: inline;
|
display: flex;
|
||||||
|
align-items: center;
|
||||||
|
height: 23px;
|
||||||
background-color: var(--bg_elements);
|
background-color: var(--bg_elements);
|
||||||
color: var(--fg_color);
|
color: var(--fg_color);
|
||||||
border: 1px solid var(--accent_border);
|
border: 1px solid var(--accent_border);
|
||||||
padding: 1px 6px 2px 6px;
|
padding: 0 6px;
|
||||||
font-size: 14px;
|
font-size: 14px;
|
||||||
cursor: pointer;
|
cursor: pointer;
|
||||||
margin-bottom: 2px;
|
margin-bottom: 0;
|
||||||
|
box-sizing: border-box;
|
||||||
|
|
||||||
@include input-colors;
|
@include input-colors;
|
||||||
}
|
}
|
||||||
|
|
||||||
@include create-toggle(search-panel, 200px);
|
@include create-toggle(search-panel, 600px);
|
||||||
}
|
}
|
||||||
|
|
||||||
.search-panel {
|
.search-panel {
|
||||||
width: 100%;
|
width: 100%;
|
||||||
|
margin-top: 5px;
|
||||||
|
border: 1px solid var(--accent_border);
|
||||||
max-height: 0;
|
max-height: 0;
|
||||||
overflow: hidden;
|
overflow-y: auto;
|
||||||
|
overflow-x: hidden;
|
||||||
transition: max-height 0.4s;
|
transition: max-height 0.4s;
|
||||||
|
|
||||||
flex-grow: 1;
|
position: absolute;
|
||||||
|
top: 100%;
|
||||||
|
left: 0;
|
||||||
|
background-color: var(--bg_overlays);
|
||||||
|
box-shadow: 0 4px 6px rgba(0,0,0,0.3);
|
||||||
|
border-radius: 0 0 4px 4px;
|
||||||
|
z-index: 2000;
|
||||||
|
padding: 5px 10px;
|
||||||
|
box-sizing: border-box;
|
||||||
|
|
||||||
|
opacity: 0;
|
||||||
|
visibility: hidden;
|
||||||
|
transition: max-height 0.4s, opacity 0.4s, visibility 0.4s;
|
||||||
|
|
||||||
font-weight: initial;
|
font-weight: initial;
|
||||||
text-align: left;
|
text-align: left;
|
||||||
|
font-size: 13px;
|
||||||
|
|
||||||
> div {
|
> div {
|
||||||
line-height: 1.7em;
|
line-height: 1.4em;
|
||||||
|
margin-bottom: 4px;
|
||||||
}
|
}
|
||||||
|
|
||||||
.checkbox-container {
|
.checkbox-container {
|
||||||
display: inline;
|
display: inline-flex;
|
||||||
|
align-items: center;
|
||||||
padding-right: unset;
|
padding-right: unset;
|
||||||
margin-bottom: unset;
|
margin-bottom: 2px;
|
||||||
margin-left: 23px;
|
margin-left: 18px;
|
||||||
|
margin-right: 0;
|
||||||
|
white-space: nowrap;
|
||||||
}
|
}
|
||||||
|
|
||||||
.checkbox {
|
.checkbox {
|
||||||
right: unset;
|
right: unset;
|
||||||
left: -22px;
|
left: -18px;
|
||||||
|
width: 15px;
|
||||||
|
height: 15px;
|
||||||
}
|
}
|
||||||
|
|
||||||
.checkbox-container .checkbox:after {
|
.checkbox-container .checkbox:after {
|
||||||
top: -4px;
|
top: 0;
|
||||||
|
left: 1px;
|
||||||
|
bottom: unset;
|
||||||
|
font-size: 13px;
|
||||||
|
width: auto;
|
||||||
|
height: auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
.search-title {
|
||||||
|
font-size: 13px;
|
||||||
|
margin-top: 2px;
|
||||||
|
margin-bottom: 2px;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -92,11 +133,11 @@
|
|||||||
|
|
||||||
.pref-input {
|
.pref-input {
|
||||||
display: block;
|
display: block;
|
||||||
padding-bottom: 5px;
|
padding-bottom: 2px;
|
||||||
|
|
||||||
input {
|
input {
|
||||||
height: 21px;
|
height: 21px;
|
||||||
margin-top: 1px;
|
margin-top: 0;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -104,19 +145,36 @@
|
|||||||
.search-toggles {
|
.search-toggles {
|
||||||
flex-grow: 1;
|
flex-grow: 1;
|
||||||
display: grid;
|
display: grid;
|
||||||
grid-template-columns: repeat(6, auto);
|
grid-template-columns: repeat(auto-fill, minmax(110px, 1fr));
|
||||||
grid-column-gap: 10px;
|
gap: 5px 10px;
|
||||||
|
}
|
||||||
|
|
||||||
|
#search-panel-toggle:checked ~ .search-panel {
|
||||||
|
opacity: 1;
|
||||||
|
visibility: visible;
|
||||||
}
|
}
|
||||||
|
|
||||||
.profile-tabs {
|
.profile-tabs {
|
||||||
@include search-resize(820px, 5);
|
@include search-resize(820px, 5);
|
||||||
@include search-resize(725px, 4);
|
@include search-resize(715px, 4);
|
||||||
@include search-resize(600px, 6);
|
@include search-resize(700px, 5);
|
||||||
@include search-resize(560px, 5);
|
@include search-resize(485px, 4);
|
||||||
@include search-resize(480px, 4);
|
|
||||||
@include search-resize(410px, 3);
|
@include search-resize(410px, 3);
|
||||||
}
|
}
|
||||||
|
|
||||||
@include search-resize(560px, 5);
|
@include search-resize(700px, 5);
|
||||||
@include search-resize(480px, 4);
|
@include search-resize(485px, 4);
|
||||||
@include search-resize(410px, 3);
|
@include search-resize(410px, 3);
|
||||||
|
|
||||||
|
@media(max-width: 600px) {
|
||||||
|
.search-panel {
|
||||||
|
position: fixed;
|
||||||
|
top: 50px;
|
||||||
|
left: 0;
|
||||||
|
right: 0;
|
||||||
|
width: 100%;
|
||||||
|
border-radius: 0;
|
||||||
|
border-top: 1px solid var(--accent_border);
|
||||||
|
box-shadow: 0 4px 6px rgba(0,0,0,0.3);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|||||||
@@ -2,13 +2,14 @@
|
|||||||
|
|
||||||
.timeline-container {
|
.timeline-container {
|
||||||
@include panel(100%, 600px);
|
@include panel(100%, 600px);
|
||||||
|
background-color: transparent;
|
||||||
}
|
}
|
||||||
|
|
||||||
.timeline {
|
.timeline {
|
||||||
background-color: var(--bg_panel);
|
background-color: transparent;
|
||||||
|
|
||||||
> div:not(:first-child) {
|
> div:not(:first-child) {
|
||||||
border-top: 1px solid var(--border_grey);
|
border-top: none;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -25,6 +26,25 @@
|
|||||||
button {
|
button {
|
||||||
float: unset;
|
float: unset;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
&.timeline-default {
|
||||||
|
background-color: var(--bg_panel);
|
||||||
|
border-bottom: 1px solid var(--bg_elements);
|
||||||
|
margin-bottom: 5px;
|
||||||
|
|
||||||
|
.timeline-default-message {
|
||||||
|
color: var(--fg_color);
|
||||||
|
font-size: 16px;
|
||||||
|
font-weight: normal;
|
||||||
|
margin: 0;
|
||||||
|
padding: 5px;
|
||||||
|
|
||||||
|
strong {
|
||||||
|
font-weight: bold;
|
||||||
|
color: var(--accent);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
.timeline-banner img {
|
.timeline-banner img {
|
||||||
@@ -159,4 +179,6 @@
|
|||||||
padding: .75em;
|
padding: .75em;
|
||||||
display: flex;
|
display: flex;
|
||||||
position: relative;
|
position: relative;
|
||||||
|
margin-top: 5px;
|
||||||
|
background-color: var(--bg_panel);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -72,6 +72,7 @@
|
|||||||
display: flex;
|
display: flex;
|
||||||
flex-shrink: 0;
|
flex-shrink: 0;
|
||||||
margin-left: 4px;
|
margin-left: 4px;
|
||||||
|
font-size: smaller;
|
||||||
}
|
}
|
||||||
|
|
||||||
.tweet-date a, .username, .show-more a {
|
.tweet-date a, .username, .show-more a {
|
||||||
@@ -83,6 +84,7 @@
|
|||||||
margin-top: 5px;
|
margin-top: 5px;
|
||||||
color: var(--grey);
|
color: var(--grey);
|
||||||
pointer-events: all;
|
pointer-events: all;
|
||||||
|
font-size: smaller;
|
||||||
}
|
}
|
||||||
|
|
||||||
.tweet-avatar {
|
.tweet-avatar {
|
||||||
@@ -172,7 +174,8 @@
|
|||||||
|
|
||||||
.replying-to {
|
.replying-to {
|
||||||
color: var(--fg_faded);
|
color: var(--fg_faded);
|
||||||
margin: -2px 0 4px;
|
margin: -2px 0 5px;
|
||||||
|
font-size: smaller;
|
||||||
|
|
||||||
a {
|
a {
|
||||||
pointer-events: all;
|
pointer-events: all;
|
||||||
@@ -200,15 +203,22 @@
|
|||||||
|
|
||||||
.tweet-stats {
|
.tweet-stats {
|
||||||
margin-bottom: -3px;
|
margin-bottom: -3px;
|
||||||
|
padding-top: 5px;
|
||||||
-webkit-user-select: none;
|
-webkit-user-select: none;
|
||||||
|
|
||||||
a {
|
a {
|
||||||
pointer-events: all;
|
pointer-events: all;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
.tweet-published {
|
||||||
|
margin-left: auto;
|
||||||
|
margin-top: 0;
|
||||||
|
font-weight: 400;
|
||||||
|
align-self: center;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
.tweet-stat {
|
.tweet-stat {
|
||||||
padding-top: 5px;
|
|
||||||
min-width: 1em;
|
min-width: 1em;
|
||||||
margin-right: 0.8em;
|
margin-right: 0.8em;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -42,6 +42,7 @@
|
|||||||
|
|
||||||
.card-description {
|
.card-description {
|
||||||
margin: 0.3em 0;
|
margin: 0.3em 0;
|
||||||
|
white-space: pre-wrap;
|
||||||
}
|
}
|
||||||
|
|
||||||
.card-destination {
|
.card-destination {
|
||||||
|
|||||||
@@ -10,15 +10,10 @@
|
|||||||
}
|
}
|
||||||
|
|
||||||
.main-thread {
|
.main-thread {
|
||||||
margin-bottom: 20px;
|
margin-bottom: 5px;
|
||||||
background-color: var(--bg_panel);
|
background-color: var(--bg_panel);
|
||||||
}
|
}
|
||||||
|
|
||||||
.main-tweet, .replies {
|
|
||||||
padding-top: 50px;
|
|
||||||
margin-top: -50px;
|
|
||||||
}
|
|
||||||
|
|
||||||
.main-tweet .tweet-content {
|
.main-tweet .tweet-content {
|
||||||
font-size: 18px;
|
font-size: 18px;
|
||||||
}
|
}
|
||||||
@@ -31,13 +26,13 @@
|
|||||||
|
|
||||||
.reply {
|
.reply {
|
||||||
background-color: var(--bg_panel);
|
background-color: var(--bg_panel);
|
||||||
margin-bottom: 10px;
|
margin-bottom: 5px;
|
||||||
}
|
}
|
||||||
|
|
||||||
.thread-line {
|
.thread-line {
|
||||||
.timeline-item::before,
|
.timeline-item::before,
|
||||||
&.timeline-item::before {
|
&.timeline-item::before {
|
||||||
background: var(--accent_dark);
|
background: var(--dark_grey);
|
||||||
content: '';
|
content: '';
|
||||||
position: relative;
|
position: relative;
|
||||||
min-width: 3px;
|
min-width: 3px;
|
||||||
|
|||||||
62
src/tid.nim
Normal file
62
src/tid.nim
Normal file
@@ -0,0 +1,62 @@
|
|||||||
|
import std/[asyncdispatch, base64, httpclient, random, strutils, sequtils, times]
|
||||||
|
import nimcrypto
|
||||||
|
import experimental/parser/tid
|
||||||
|
|
||||||
|
randomize()
|
||||||
|
|
||||||
|
const defaultKeyword = "obfiowerehiring";
|
||||||
|
const pairsUrl =
|
||||||
|
"https://raw.githubusercontent.com/fa0311/x-client-transaction-id-pair-dict/refs/heads/main/pair.json";
|
||||||
|
|
||||||
|
var
|
||||||
|
cachedPairs: seq[TidPair] = @[]
|
||||||
|
lastCached = 0
|
||||||
|
# refresh every hour
|
||||||
|
ttlSec = 60 * 60
|
||||||
|
|
||||||
|
proc getPair(): Future[TidPair] {.async.} =
|
||||||
|
if cachedPairs.len == 0 or int(epochTime()) - lastCached > ttlSec:
|
||||||
|
lastCached = int(epochTime())
|
||||||
|
|
||||||
|
let client = newAsyncHttpClient()
|
||||||
|
defer: client.close()
|
||||||
|
|
||||||
|
let resp = await client.get(pairsUrl)
|
||||||
|
if resp.status == $Http200:
|
||||||
|
cachedPairs = parseTidPairs(await resp.body)
|
||||||
|
|
||||||
|
return sample(cachedPairs)
|
||||||
|
|
||||||
|
proc encodeSha256(text: string): array[32, byte] =
|
||||||
|
let
|
||||||
|
data = cast[ptr byte](addr text[0])
|
||||||
|
dataLen = uint(len(text))
|
||||||
|
digest = sha256.digest(data, dataLen)
|
||||||
|
return digest.data
|
||||||
|
|
||||||
|
proc encodeBase64[T](data: T): string =
|
||||||
|
return encode(data).replace("=", "")
|
||||||
|
|
||||||
|
proc decodeBase64(data: string): seq[byte] =
|
||||||
|
return cast[seq[byte]](decode(data))
|
||||||
|
|
||||||
|
proc genTid*(path: string): Future[string] {.async.} =
|
||||||
|
let
|
||||||
|
pair = await getPair()
|
||||||
|
|
||||||
|
timeNow = int(epochTime() - 1682924400)
|
||||||
|
timeNowBytes = @[
|
||||||
|
byte(timeNow and 0xff),
|
||||||
|
byte((timeNow shr 8) and 0xff),
|
||||||
|
byte((timeNow shr 16) and 0xff),
|
||||||
|
byte((timeNow shr 24) and 0xff)
|
||||||
|
]
|
||||||
|
|
||||||
|
data = "GET!" & path & "!" & $timeNow & defaultKeyword & pair.animationKey
|
||||||
|
hashBytes = encodeSha256(data)
|
||||||
|
keyBytes = decodeBase64(pair.verification)
|
||||||
|
bytesArr = keyBytes & timeNowBytes & hashBytes[0 ..< 16] & @[3'u8]
|
||||||
|
randomNum = byte(rand(256))
|
||||||
|
tid = @[randomNum] & bytesArr.mapIt(it xor randomNum)
|
||||||
|
|
||||||
|
return encodeBase64(tid)
|
||||||
@@ -1,5 +1,5 @@
|
|||||||
# SPDX-License-Identifier: AGPL-3.0-only
|
# SPDX-License-Identifier: AGPL-3.0-only
|
||||||
import times, sequtils, options, tables, uri
|
import times, sequtils, options, tables
|
||||||
import prefs_impl
|
import prefs_impl
|
||||||
|
|
||||||
genPrefsType()
|
genPrefsType()
|
||||||
@@ -13,19 +13,13 @@ type
|
|||||||
TimelineKind* {.pure.} = enum
|
TimelineKind* {.pure.} = enum
|
||||||
tweets, replies, media
|
tweets, replies, media
|
||||||
|
|
||||||
Api* {.pure.} = enum
|
ApiUrl* = object
|
||||||
tweetDetail
|
endpoint*: string
|
||||||
tweetResult
|
params*: seq[(string, string)]
|
||||||
search
|
|
||||||
list
|
ApiReq* = object
|
||||||
listBySlug
|
oauth*: ApiUrl
|
||||||
listMembers
|
cookie*: ApiUrl
|
||||||
listTweets
|
|
||||||
userRestId
|
|
||||||
userScreenName
|
|
||||||
userTweets
|
|
||||||
userTweetsAndReplies
|
|
||||||
userMedia
|
|
||||||
|
|
||||||
RateLimit* = object
|
RateLimit* = object
|
||||||
limit*: int
|
limit*: int
|
||||||
@@ -38,10 +32,11 @@ type
|
|||||||
|
|
||||||
Session* = ref object
|
Session* = ref object
|
||||||
id*: int64
|
id*: int64
|
||||||
|
username*: string
|
||||||
pending*: int
|
pending*: int
|
||||||
limited*: bool
|
limited*: bool
|
||||||
limitedAt*: int
|
limitedAt*: int
|
||||||
apis*: Table[Api, RateLimit]
|
apis*: Table[string, RateLimit]
|
||||||
case kind*: SessionKind
|
case kind*: SessionKind
|
||||||
of oauth:
|
of oauth:
|
||||||
oauthToken*: string
|
oauthToken*: string
|
||||||
@@ -50,10 +45,6 @@ type
|
|||||||
authToken*: string
|
authToken*: string
|
||||||
ct0*: string
|
ct0*: string
|
||||||
|
|
||||||
SessionAwareUrl* = object
|
|
||||||
oauthUrl*: Uri
|
|
||||||
cookieUrl*: Uri
|
|
||||||
|
|
||||||
Error* = enum
|
Error* = enum
|
||||||
null = 0
|
null = 0
|
||||||
noUserMatches = 17
|
noUserMatches = 17
|
||||||
@@ -102,6 +93,7 @@ type
|
|||||||
media*: int
|
media*: int
|
||||||
verifiedType*: VerifiedType
|
verifiedType*: VerifiedType
|
||||||
protected*: bool
|
protected*: bool
|
||||||
|
sensitive*: bool
|
||||||
suspended*: bool
|
suspended*: bool
|
||||||
joinDate*: DateTime
|
joinDate*: DateTime
|
||||||
|
|
||||||
@@ -120,7 +112,6 @@ type
|
|||||||
durationMs*: int
|
durationMs*: int
|
||||||
url*: string
|
url*: string
|
||||||
thumb*: string
|
thumb*: string
|
||||||
views*: string
|
|
||||||
available*: bool
|
available*: bool
|
||||||
reason*: string
|
reason*: string
|
||||||
title*: string
|
title*: string
|
||||||
@@ -141,6 +132,7 @@ type
|
|||||||
since*: string
|
since*: string
|
||||||
until*: string
|
until*: string
|
||||||
near*: string
|
near*: string
|
||||||
|
minLikes*: string
|
||||||
sep*: string
|
sep*: string
|
||||||
|
|
||||||
Gif* = object
|
Gif* = object
|
||||||
@@ -201,7 +193,7 @@ type
|
|||||||
replies*: int
|
replies*: int
|
||||||
retweets*: int
|
retweets*: int
|
||||||
likes*: int
|
likes*: int
|
||||||
quotes*: int
|
views*: int
|
||||||
|
|
||||||
Tweet* = ref object
|
Tweet* = ref object
|
||||||
id*: int64
|
id*: int64
|
||||||
@@ -212,6 +204,7 @@ type
|
|||||||
time*: DateTime
|
time*: DateTime
|
||||||
reply*: seq[string]
|
reply*: seq[string]
|
||||||
pinned*: bool
|
pinned*: bool
|
||||||
|
sensitive*: bool
|
||||||
hasThread*: bool
|
hasThread*: bool
|
||||||
available*: bool
|
available*: bool
|
||||||
tombstone*: string
|
tombstone*: string
|
||||||
@@ -283,8 +276,11 @@ type
|
|||||||
minTokens*: int
|
minTokens*: int
|
||||||
enableRss*: bool
|
enableRss*: bool
|
||||||
enableDebug*: bool
|
enableDebug*: bool
|
||||||
|
logLevel*: string
|
||||||
proxy*: string
|
proxy*: string
|
||||||
proxyAuth*: string
|
proxyAuth*: string
|
||||||
|
defaultFollowedAccounts*: seq[string]
|
||||||
|
disableTid*: bool
|
||||||
|
|
||||||
rssCacheTime*: int
|
rssCacheTime*: int
|
||||||
listCacheTime*: int
|
listCacheTime*: int
|
||||||
|
|||||||
@@ -2,8 +2,8 @@
|
|||||||
import uri, strutils, strformat
|
import uri, strutils, strformat
|
||||||
import karax/[karaxdsl, vdom]
|
import karax/[karaxdsl, vdom]
|
||||||
|
|
||||||
import renderutils
|
import renderutils, search_panel
|
||||||
import ../utils, ../types, ../prefs, ../formatters
|
import ../utils, ../types, ../prefs, ../formatters, ../query, tables
|
||||||
|
|
||||||
import jester
|
import jester
|
||||||
|
|
||||||
@@ -20,25 +20,27 @@ proc renderNavbar(cfg: Config; req: Request; rss, canonical: string): VNode =
|
|||||||
path = $(parseUri(req.path) ? filterParams(req.params))
|
path = $(parseUri(req.path) ? filterParams(req.params))
|
||||||
if "/status/" in path: path.add "#m"
|
if "/status/" in path: path.add "#m"
|
||||||
|
|
||||||
|
let query = initQuery(req.params)
|
||||||
|
|
||||||
buildHtml(nav):
|
buildHtml(nav):
|
||||||
tdiv(class="inner-nav"):
|
tdiv(class="inner-nav"):
|
||||||
tdiv(class="nav-item"):
|
tdiv(class="nav-item"):
|
||||||
a(class="site-name", href="/"): text cfg.title
|
a(class="site-name", href="/"): text cfg.title
|
||||||
|
a(href="/about"): text "(donate)"
|
||||||
|
|
||||||
a(href="/"): img(class="site-logo", src="/logo.png", alt="Logo")
|
renderSearchPanel(query)
|
||||||
|
|
||||||
tdiv(class="nav-item right"):
|
tdiv(class="nav-item right"):
|
||||||
icon "search", title="Search", href="/search"
|
|
||||||
if cfg.enableRss and rss.len > 0:
|
if cfg.enableRss and rss.len > 0:
|
||||||
icon "rss-feed", title="RSS Feed", href=rss
|
icon "rss", title="RSS Feed", href=rss
|
||||||
icon "bird", title="Open in Twitter", href=canonical
|
icon "bird", title="Open in X", href=canonical
|
||||||
a(href="https://liberapay.com/zedeus"): verbatim lp
|
a(href="https://buymeacoffee.com/kuu7o"): verbatim lp
|
||||||
icon "info", title="About", href="/about"
|
icon "info", title="About", href="/about"
|
||||||
icon "cog", title="Preferences", href=("/settings?referer=" & encodeUrl(path))
|
icon "cog", title="Preferences", href=("/settings?referer=" & encodeUrl(path))
|
||||||
|
|
||||||
proc renderHead*(prefs: Prefs; cfg: Config; req: Request; titleText=""; desc="";
|
proc renderHead*(prefs: Prefs; cfg: Config; req: Request; titleText=""; desc="";
|
||||||
video=""; images: seq[string] = @[]; banner=""; ogTitle="";
|
video=""; images: seq[string] = @[]; banner=""; ogTitle="";
|
||||||
rss=""; canonical=""): VNode =
|
rss=""; alternate=""): VNode =
|
||||||
var theme = prefs.theme.toTheme
|
var theme = prefs.theme.toTheme
|
||||||
if "theme" in req.params:
|
if "theme" in req.params:
|
||||||
theme = req.params["theme"].toTheme
|
theme = req.params["theme"].toTheme
|
||||||
@@ -52,8 +54,8 @@ proc renderHead*(prefs: Prefs; cfg: Config; req: Request; titleText=""; desc="";
|
|||||||
let opensearchUrl = getUrlPrefix(cfg) & "/opensearch"
|
let opensearchUrl = getUrlPrefix(cfg) & "/opensearch"
|
||||||
|
|
||||||
buildHtml(head):
|
buildHtml(head):
|
||||||
link(rel="stylesheet", type="text/css", href="/css/style.css?v=19")
|
link(rel="stylesheet", type="text/css", href="/css/style.css?v=21")
|
||||||
link(rel="stylesheet", type="text/css", href="/css/fontello.css?v=2")
|
link(rel="stylesheet", type="text/css", href="/css/fontello.css?v=3")
|
||||||
|
|
||||||
if theme.len > 0:
|
if theme.len > 0:
|
||||||
link(rel="stylesheet", type="text/css", href=(&"/css/themes/{theme}.css"))
|
link(rel="stylesheet", type="text/css", href=(&"/css/themes/{theme}.css"))
|
||||||
@@ -66,8 +68,8 @@ proc renderHead*(prefs: Prefs; cfg: Config; req: Request; titleText=""; desc="";
|
|||||||
link(rel="search", type="application/opensearchdescription+xml", title=cfg.title,
|
link(rel="search", type="application/opensearchdescription+xml", title=cfg.title,
|
||||||
href=opensearchUrl)
|
href=opensearchUrl)
|
||||||
|
|
||||||
if canonical.len > 0:
|
if alternate.len > 0:
|
||||||
link(rel="canonical", href=canonical)
|
link(rel="alternate", href=alternate, title="View on X")
|
||||||
|
|
||||||
if cfg.enableRss and rss.len > 0:
|
if cfg.enableRss and rss.len > 0:
|
||||||
link(rel="alternate", type="application/rss+xml", href=rss, title="RSS feed")
|
link(rel="alternate", type="application/rss+xml", href=rss, title="RSS feed")
|
||||||
@@ -119,20 +121,26 @@ proc renderHead*(prefs: Prefs; cfg: Config; req: Request; titleText=""; desc="";
|
|||||||
# this is last so images are also preloaded
|
# this is last so images are also preloaded
|
||||||
# if this is done earlier, Chrome only preloads one image for some reason
|
# if this is done earlier, Chrome only preloads one image for some reason
|
||||||
link(rel="preload", type="font/woff2", `as`="font",
|
link(rel="preload", type="font/woff2", `as`="font",
|
||||||
href="/fonts/fontello.woff2?21002321", crossorigin="anonymous")
|
href="/fonts/fontello.woff2?61663884", crossorigin="anonymous")
|
||||||
|
|
||||||
|
if prefs.hideNsfw:
|
||||||
|
style:
|
||||||
|
verbatim ".nsfw { display: none !important; }"
|
||||||
|
|
||||||
proc renderMain*(body: VNode; req: Request; cfg: Config; prefs=defaultPrefs;
|
proc renderMain*(body: VNode; req: Request; cfg: Config; prefs=defaultPrefs;
|
||||||
titleText=""; desc=""; ogTitle=""; rss=""; video="";
|
titleText=""; desc=""; ogTitle=""; rss=""; video="";
|
||||||
images: seq[string] = @[]; banner=""): string =
|
images: seq[string] = @[]; banner=""): string =
|
||||||
|
|
||||||
let canonical = getTwitterLink(req.path, req.params)
|
let twitterLink = getTwitterLink(req.path, req.params)
|
||||||
|
|
||||||
let node = buildHtml(html(lang="en")):
|
let node = buildHtml(html(lang="en")):
|
||||||
renderHead(prefs, cfg, req, titleText, desc, video, images, banner, ogTitle,
|
renderHead(prefs, cfg, req, titleText, desc, video, images, banner, ogTitle,
|
||||||
rss, canonical)
|
rss, twitterLink)
|
||||||
|
|
||||||
body:
|
body(class=if prefs.verifiedBadge == "Hide all": "hide-verified-all"
|
||||||
renderNavbar(cfg, req, rss, canonical)
|
elif prefs.verifiedBadge == "Show official only": "hide-verified-blue"
|
||||||
|
else: ""):
|
||||||
|
renderNavbar(cfg, req, rss, twitterLink)
|
||||||
|
|
||||||
tdiv(class="container"):
|
tdiv(class="container"):
|
||||||
body
|
body
|
||||||
|
|||||||
19
src/views/homepage.nim
Normal file
19
src/views/homepage.nim
Normal file
@@ -0,0 +1,19 @@
|
|||||||
|
# SPDX-License-Identifier: AGPL-3.0-only
|
||||||
|
import karax/[karaxdsl, vdom]
|
||||||
|
|
||||||
|
import timeline, profile
|
||||||
|
import ".."/[types]
|
||||||
|
|
||||||
|
proc renderHomepage*(users: seq[User]; timeline: VNode; prefs: Prefs; path: string): VNode =
|
||||||
|
buildHtml(tdiv(class="homepage-container")):
|
||||||
|
tdiv(class="timeline-users-column"):
|
||||||
|
for user in users:
|
||||||
|
renderUser(user, prefs, path)
|
||||||
|
|
||||||
|
tdiv(class="timeline"):
|
||||||
|
timeline
|
||||||
|
|
||||||
|
tdiv(class="following-column"):
|
||||||
|
tdiv(class="profile-cards"):
|
||||||
|
for user in users:
|
||||||
|
renderUserCard(user, prefs, path)
|
||||||
@@ -12,8 +12,9 @@ proc renderStat(num: int; class: string; text=""): VNode =
|
|||||||
span(class="profile-stat-num"):
|
span(class="profile-stat-num"):
|
||||||
text insertSep($num, ',')
|
text insertSep($num, ',')
|
||||||
|
|
||||||
proc renderUserCard*(user: User; prefs: Prefs): VNode =
|
proc renderUserCard*(user: User; prefs: Prefs; path: string): VNode =
|
||||||
buildHtml(tdiv(class="profile-card")):
|
let class = if user.sensitive: "profile-card nsfw" else: "profile-card"
|
||||||
|
buildHtml(tdiv(class=class)):
|
||||||
tdiv(class="profile-card-info"):
|
tdiv(class="profile-card-info"):
|
||||||
let
|
let
|
||||||
url = getPicUrl(user.getUserPic())
|
url = getPicUrl(user.getUserPic())
|
||||||
@@ -24,9 +25,12 @@ proc renderUserCard*(user: User; prefs: Prefs): VNode =
|
|||||||
a(class="profile-card-avatar", href=url, target="_blank"):
|
a(class="profile-card-avatar", href=url, target="_blank"):
|
||||||
genImg(user.getUserPic(size))
|
genImg(user.getUserPic(size))
|
||||||
|
|
||||||
tdiv(class="profile-card-tabs-name"):
|
tdiv(class="profile-header"):
|
||||||
linkUser(user, class="profile-card-fullname")
|
tdiv(class="profile-card-tabs-name"):
|
||||||
linkUser(user, class="profile-card-username")
|
linkUser(user, class="profile-card-fullname")
|
||||||
|
linkUser(user, class="profile-card-username")
|
||||||
|
|
||||||
|
renderFollowButton(user, prefs, path)
|
||||||
|
|
||||||
tdiv(class="profile-card-extra"):
|
tdiv(class="profile-card-extra"):
|
||||||
if user.bio.len > 0:
|
if user.bio.len > 0:
|
||||||
@@ -109,7 +113,7 @@ proc renderProfile*(profile: var Profile; prefs: Prefs; path: string): VNode =
|
|||||||
|
|
||||||
let sticky = if prefs.stickyProfile: " sticky" else: ""
|
let sticky = if prefs.stickyProfile: " sticky" else: ""
|
||||||
tdiv(class=("profile-tab" & sticky)):
|
tdiv(class=("profile-tab" & sticky)):
|
||||||
renderUserCard(profile.user, prefs)
|
renderUserCard(profile.user, prefs, path)
|
||||||
if profile.photoRail.len > 0:
|
if profile.photoRail.len > 0:
|
||||||
renderPhotoRail(profile)
|
renderPhotoRail(profile)
|
||||||
|
|
||||||
|
|||||||
@@ -77,7 +77,7 @@ proc genInput*(pref, label, state, placeholder: string; class=""; autofocus=true
|
|||||||
input(name=pref, `type`="text", placeholder=p, value=state, autofocus=(autofocus and state.len == 0))
|
input(name=pref, `type`="text", placeholder=p, value=state, autofocus=(autofocus and state.len == 0))
|
||||||
|
|
||||||
proc genSelect*(pref, label, state: string; options: seq[string]): VNode =
|
proc genSelect*(pref, label, state: string; options: seq[string]): VNode =
|
||||||
buildHtml(tdiv(class="pref-group pref-input")):
|
buildHtml(tdiv(class="pref-group pref-input pref-select")):
|
||||||
label(`for`=pref): text label
|
label(`for`=pref): text label
|
||||||
select(name=pref):
|
select(name=pref):
|
||||||
for opt in options:
|
for opt in options:
|
||||||
@@ -89,6 +89,13 @@ proc genDate*(pref, state: string): VNode =
|
|||||||
input(name=pref, `type`="date", value=state)
|
input(name=pref, `type`="date", value=state)
|
||||||
icon "calendar"
|
icon "calendar"
|
||||||
|
|
||||||
|
proc genNumberInput*(pref, label, state, placeholder: string; class=""; autofocus=true; min="0"): VNode =
|
||||||
|
let p = placeholder
|
||||||
|
buildHtml(tdiv(class=("pref-group pref-input " & class))):
|
||||||
|
if label.len > 0:
|
||||||
|
label(`for`=pref): text label
|
||||||
|
input(name=pref, `type`="number", placeholder=p, value=state, autofocus=(autofocus and state.len == 0), min=min, step="1")
|
||||||
|
|
||||||
proc genImg*(url: string; class=""): VNode =
|
proc genImg*(url: string; class=""): VNode =
|
||||||
buildHtml():
|
buildHtml():
|
||||||
img(src=getPicUrl(url), class=class, alt="", loading="lazy")
|
img(src=getPicUrl(url), class=class, alt="", loading="lazy")
|
||||||
@@ -100,3 +107,15 @@ proc getTabClass*(query: Query; tab: QueryKind): string =
|
|||||||
proc getAvatarClass*(prefs: Prefs): string =
|
proc getAvatarClass*(prefs: Prefs): string =
|
||||||
if prefs.squareAvatars: "avatar"
|
if prefs.squareAvatars: "avatar"
|
||||||
else: "avatar round"
|
else: "avatar round"
|
||||||
|
|
||||||
|
proc renderFollowButton*(user: User; prefs: Prefs; path: string): VNode =
|
||||||
|
let
|
||||||
|
isFollowing = user.username in prefs.following
|
||||||
|
action = if isFollowing: "/unfollow" else: "/follow"
|
||||||
|
text = if isFollowing: "Unfollow" else: "Follow"
|
||||||
|
class = if isFollowing: "follow-button unfollow" else: "follow-button"
|
||||||
|
|
||||||
|
buildHtml(form(action=action, `method`="post", class="follow-form")):
|
||||||
|
refererField path
|
||||||
|
hiddenField("user", user.username)
|
||||||
|
button(class=class, `type`="submit"): text text
|
||||||
|
|||||||
@@ -9,9 +9,9 @@
|
|||||||
#elif tweet.reply.len > 0: result = &"R to @{tweet.reply[0]}: "
|
#elif tweet.reply.len > 0: result = &"R to @{tweet.reply[0]}: "
|
||||||
#end if
|
#end if
|
||||||
#var text = stripHtml(tweet.text)
|
#var text = stripHtml(tweet.text)
|
||||||
##if unicode.runeLen(text) > 32:
|
#if unicode.runeLen(text) > 100:
|
||||||
## text = unicode.runeSubStr(text, 0, 32) & "..."
|
# text = unicode.runeSubStr(text, 0, 64) & "..."
|
||||||
##end if
|
#end if
|
||||||
#result &= xmltree.escape(text)
|
#result &= xmltree.escape(text)
|
||||||
#if result.len > 0: return
|
#if result.len > 0: return
|
||||||
#end if
|
#end if
|
||||||
@@ -25,7 +25,7 @@
|
|||||||
#end proc
|
#end proc
|
||||||
#
|
#
|
||||||
#proc getDescription(desc: string; cfg: Config): string =
|
#proc getDescription(desc: string; cfg: Config): string =
|
||||||
Twitter feed for: ${desc}. Generated by ${cfg.hostname}
|
Twitter feed for: ${desc}. Generated by ${getUrlPrefix(cfg)}
|
||||||
#end proc
|
#end proc
|
||||||
#
|
#
|
||||||
#proc getTweetsWithPinned(profile: Profile): seq[Tweets] =
|
#proc getTweetsWithPinned(profile: Profile): seq[Tweets] =
|
||||||
@@ -56,7 +56,10 @@ Twitter feed for: ${desc}. Generated by ${cfg.hostname}
|
|||||||
<img src="${urlPrefix}${getPicUrl(photo)}" style="max-width:250px;" />
|
<img src="${urlPrefix}${getPicUrl(photo)}" style="max-width:250px;" />
|
||||||
# end for
|
# end for
|
||||||
#elif tweet.video.isSome:
|
#elif tweet.video.isSome:
|
||||||
<img src="${urlPrefix}${getPicUrl(get(tweet.video).thumb)}" style="max-width:250px;" />
|
<a href="${urlPrefix}${tweet.getLink}">
|
||||||
|
<br>Video<br>
|
||||||
|
<img src="${urlPrefix}${getPicUrl(get(tweet.video).thumb)}" style="max-width:250px;" />
|
||||||
|
</a>
|
||||||
#elif tweet.gif.isSome:
|
#elif tweet.gif.isSome:
|
||||||
# let thumb = &"{urlPrefix}{getPicUrl(get(tweet.gif).thumb)}"
|
# let thumb = &"{urlPrefix}{getPicUrl(get(tweet.gif).thumb)}"
|
||||||
# let url = &"{urlPrefix}{getPicUrl(get(tweet.gif).url)}"
|
# let url = &"{urlPrefix}{getPicUrl(get(tweet.gif).url)}"
|
||||||
@@ -69,14 +72,17 @@ Twitter feed for: ${desc}. Generated by ${cfg.hostname}
|
|||||||
# end if
|
# end if
|
||||||
#end if
|
#end if
|
||||||
#if tweet.quote.isSome and get(tweet.quote).available:
|
#if tweet.quote.isSome and get(tweet.quote).available:
|
||||||
# let quoteLink = getLink(get(tweet.quote))
|
# let quoteTweet = get(tweet.quote)
|
||||||
|
# let quoteLink = urlPrefix & getLink(quoteTweet)
|
||||||
|
<hr/>
|
||||||
<blockquote>
|
<blockquote>
|
||||||
<p>
|
<b>${quoteTweet.user.fullname} (@${quoteTweet.user.username})</b>
|
||||||
${renderRssTweet(get(tweet.quote), cfg)}
|
<p>
|
||||||
</p>
|
${renderRssTweet(quoteTweet, cfg)}
|
||||||
<footer>
|
</p>
|
||||||
— <cite><a href="${urlPrefix}${quoteLink}">${cfg.hostname}${quoteLink}</a></cite>
|
<footer>
|
||||||
</footer>
|
— <cite><a href="${quoteLink}">${quoteLink}</a>
|
||||||
|
</footer>
|
||||||
</blockquote>
|
</blockquote>
|
||||||
#end if
|
#end if
|
||||||
#end proc
|
#end proc
|
||||||
@@ -101,6 +107,18 @@ Twitter feed for: ${desc}. Generated by ${cfg.hostname}
|
|||||||
<title>${getTitle(tweet, retweet)}</title>
|
<title>${getTitle(tweet, retweet)}</title>
|
||||||
<dc:creator>@${tweet.user.username}</dc:creator>
|
<dc:creator>@${tweet.user.username}</dc:creator>
|
||||||
<description><![CDATA[${renderRssTweet(tweet, cfg).strip(chars={'\n'})}]]></description>
|
<description><![CDATA[${renderRssTweet(tweet, cfg).strip(chars={'\n'})}]]></description>
|
||||||
|
# let desc = renderRssTweet(tweet, cfg).strip(chars={'\n'})
|
||||||
|
# if retweet.len > 0:
|
||||||
|
<description><![CDATA[
|
||||||
|
<blockquote>
|
||||||
|
<b>${tweet.user.fullname} (@${tweet.user.username})</b>
|
||||||
|
<p>${desc}</p>
|
||||||
|
<footer>— <cite><a href="${urlPrefix & link}">${urlPrefix & link}</a></footer>
|
||||||
|
</blockquote>
|
||||||
|
]]></description>
|
||||||
|
# else:
|
||||||
|
<description><![CDATA[${desc}]]></description>
|
||||||
|
# end if
|
||||||
<pubDate>${getRfc822Time(tweet)}</pubDate>
|
<pubDate>${getRfc822Time(tweet)}</pubDate>
|
||||||
<guid>${urlPrefix & link}</guid>
|
<guid>${urlPrefix & link}</guid>
|
||||||
<link>${urlPrefix & link}</link>
|
<link>${urlPrefix & link}</link>
|
||||||
|
|||||||
@@ -1,33 +1,13 @@
|
|||||||
# SPDX-License-Identifier: AGPL-3.0-only
|
# SPDX-License-Identifier: AGPL-3.0-only
|
||||||
import strutils, strformat, sequtils, unicode, tables, options
|
import strutils, options
|
||||||
import karax/[karaxdsl, vdom]
|
import karax/[karaxdsl, vdom]
|
||||||
|
|
||||||
import renderutils, timeline
|
import renderutils, timeline
|
||||||
import ".."/[types, query]
|
import ".."/[types, query]
|
||||||
|
|
||||||
const toggles = {
|
|
||||||
"nativeretweets": "Retweets",
|
|
||||||
"media": "Media",
|
|
||||||
"videos": "Videos",
|
|
||||||
"news": "News",
|
|
||||||
"verified": "Verified",
|
|
||||||
"native_video": "Native videos",
|
|
||||||
"replies": "Replies",
|
|
||||||
"links": "Links",
|
|
||||||
"images": "Images",
|
|
||||||
"safe": "Safe",
|
|
||||||
"quote": "Quotes",
|
|
||||||
"pro_video": "Pro videos"
|
|
||||||
}.toOrderedTable
|
|
||||||
|
|
||||||
proc renderSearch*(): VNode =
|
proc renderSearch*(): VNode =
|
||||||
buildHtml(tdiv(class="panel-container")):
|
buildHtml(tdiv(class="panel-container")):
|
||||||
tdiv(class="search-bar"):
|
discard
|
||||||
form(`method`="get", action="/search", autocomplete="off"):
|
|
||||||
hiddenField("f", "tweets")
|
|
||||||
input(`type`="text", name="q", autofocus="",
|
|
||||||
placeholder="Search...", dir="auto")
|
|
||||||
button(`type`="submit"): icon "search"
|
|
||||||
|
|
||||||
proc renderProfileTabs*(query: Query; username: string): VNode =
|
proc renderProfileTabs*(query: Query; username: string): VNode =
|
||||||
let link = "/" & username
|
let link = "/" & username
|
||||||
@@ -51,43 +31,6 @@ proc renderSearchTabs*(query: Query): VNode =
|
|||||||
q.kind = users
|
q.kind = users
|
||||||
a(href=("?" & genQueryUrl(q))): text "Users"
|
a(href=("?" & genQueryUrl(q))): text "Users"
|
||||||
|
|
||||||
proc isPanelOpen(q: Query): bool =
|
|
||||||
q.fromUser.len == 0 and (q.filters.len > 0 or q.excludes.len > 0 or
|
|
||||||
@[q.near, q.until, q.since].anyIt(it.len > 0))
|
|
||||||
|
|
||||||
proc renderSearchPanel*(query: Query): VNode =
|
|
||||||
let user = query.fromUser.join(",")
|
|
||||||
let action = if user.len > 0: &"/{user}/search" else: "/search"
|
|
||||||
buildHtml(form(`method`="get", action=action,
|
|
||||||
class="search-field", autocomplete="off")):
|
|
||||||
hiddenField("f", "tweets")
|
|
||||||
genInput("q", "", query.text, "Enter search...", class="pref-inline")
|
|
||||||
button(`type`="submit"): icon "search"
|
|
||||||
|
|
||||||
input(id="search-panel-toggle", `type`="checkbox", checked=isPanelOpen(query))
|
|
||||||
label(`for`="search-panel-toggle"): icon "down"
|
|
||||||
|
|
||||||
tdiv(class="search-panel"):
|
|
||||||
for f in @["filter", "exclude"]:
|
|
||||||
span(class="search-title"): text capitalize(f)
|
|
||||||
tdiv(class="search-toggles"):
|
|
||||||
for k, v in toggles:
|
|
||||||
let state =
|
|
||||||
if f == "filter": k in query.filters
|
|
||||||
else: k in query.excludes
|
|
||||||
genCheckbox(&"{f[0]}-{k}", v, state)
|
|
||||||
|
|
||||||
tdiv(class="search-row"):
|
|
||||||
tdiv:
|
|
||||||
span(class="search-title"): text "Time range"
|
|
||||||
tdiv(class="date-range"):
|
|
||||||
genDate("since", query.since)
|
|
||||||
span(class="search-title"): text "-"
|
|
||||||
genDate("until", query.until)
|
|
||||||
tdiv:
|
|
||||||
span(class="search-title"): text "Near"
|
|
||||||
genInput("near", "", query.near, "Location...", autofocus=false)
|
|
||||||
|
|
||||||
proc renderTweetSearch*(results: Timeline; prefs: Prefs; path: string;
|
proc renderTweetSearch*(results: Timeline; prefs: Prefs; path: string;
|
||||||
pinned=none(Tweet)): VNode =
|
pinned=none(Tweet)): VNode =
|
||||||
let query = results.query
|
let query = results.query
|
||||||
@@ -100,21 +43,42 @@ proc renderTweetSearch*(results: Timeline; prefs: Prefs; path: string;
|
|||||||
renderProfileTabs(query, query.fromUser.join(","))
|
renderProfileTabs(query, query.fromUser.join(","))
|
||||||
|
|
||||||
if query.fromUser.len == 0 or query.kind == tweets:
|
if query.fromUser.len == 0 or query.kind == tweets:
|
||||||
tdiv(class="timeline-header"):
|
discard
|
||||||
renderSearchPanel(query)
|
|
||||||
|
|
||||||
if query.fromUser.len == 0:
|
if query.fromUser.len == 0:
|
||||||
renderSearchTabs(query)
|
renderSearchTabs(query)
|
||||||
|
|
||||||
renderTimelineTweets(results, prefs, path, pinned)
|
renderTimelineTweets(results, prefs, path, pinned)
|
||||||
|
|
||||||
proc renderUserSearch*(results: Result[User]; prefs: Prefs): VNode =
|
proc renderHomepageTabs*(query: Query): VNode =
|
||||||
buildHtml(tdiv(class="timeline-container")):
|
buildHtml(ul(class="tab")):
|
||||||
tdiv(class="timeline-header"):
|
li(class=if query.kind == tweets: "tab-item active" else: "tab-item"):
|
||||||
form(`method`="get", action="/search", class="search-field", autocomplete="off"):
|
a(href="/?f=tweets"): text "Tweets"
|
||||||
hiddenField("f", "users")
|
|
||||||
genInput("q", "", results.query.text, "Enter username...", class="pref-inline")
|
|
||||||
button(`type`="submit"): icon "search"
|
|
||||||
|
|
||||||
|
li(class=if query.kind == replies: "tab-item active" else: "tab-item"):
|
||||||
|
a(href="/?f=replies"): text "Tweets & Replies"
|
||||||
|
|
||||||
|
proc renderHomepageTimeline*(results: Timeline; prefs: Prefs; path: string): VNode =
|
||||||
|
let query = results.query
|
||||||
|
buildHtml(tdiv(class="timeline-container")):
|
||||||
|
renderHomepageTabs(query)
|
||||||
|
|
||||||
|
renderTimelineTweets(results, prefs, path)
|
||||||
|
|
||||||
|
proc renderDefaultTimeline*(results: Timeline; prefs: Prefs; path: string): VNode =
|
||||||
|
let query = results.query
|
||||||
|
buildHtml(tdiv(class="timeline-container")):
|
||||||
|
tdiv(class="timeline-header timeline-default"):
|
||||||
|
h2(class="timeline-default-message"):
|
||||||
|
text "Follow people to populate your "
|
||||||
|
strong: text "own"
|
||||||
|
text " feed"
|
||||||
|
|
||||||
|
renderHomepageTabs(query)
|
||||||
|
|
||||||
|
renderTimelineTweets(results, prefs, path)
|
||||||
|
|
||||||
|
proc renderUserSearch*(results: Result[User]; prefs: Prefs; path: string): VNode =
|
||||||
|
buildHtml(tdiv(class="timeline-container")):
|
||||||
renderSearchTabs(results.query)
|
renderSearchTabs(results.query)
|
||||||
renderTimelineUsers(results, prefs)
|
renderTimelineUsers(results, prefs, path)
|
||||||
|
|||||||
58
src/views/search_panel.nim
Normal file
58
src/views/search_panel.nim
Normal file
@@ -0,0 +1,58 @@
|
|||||||
|
# SPDX-License-Identifier: AGPL-3.0-only
|
||||||
|
import strutils, strformat, sequtils, unicode, tables
|
||||||
|
import karax/[karaxdsl, vdom]
|
||||||
|
|
||||||
|
import renderutils
|
||||||
|
import ".."/[types]
|
||||||
|
|
||||||
|
const toggles = {
|
||||||
|
"nativeretweets": "Retweets",
|
||||||
|
"media": "Media",
|
||||||
|
"videos": "Videos",
|
||||||
|
"news": "News",
|
||||||
|
"verified": "Verified",
|
||||||
|
"native_video": "Native videos",
|
||||||
|
"replies": "Replies",
|
||||||
|
"links": "Links",
|
||||||
|
"images": "Images",
|
||||||
|
"safe": "Safe",
|
||||||
|
"quote": "Quotes",
|
||||||
|
"pro_video": "Pro videos"
|
||||||
|
}.toOrderedTable
|
||||||
|
|
||||||
|
proc isPanelOpen(q: Query): bool =
|
||||||
|
q.fromUser.len == 0 and (q.filters.len > 0 or q.excludes.anyIt(it != "nativeretweets") or
|
||||||
|
@[q.near, q.until, q.since].anyIt(it.len > 0))
|
||||||
|
|
||||||
|
proc renderSearchPanel*(query: Query): VNode =
|
||||||
|
let user = query.fromUser.join(",")
|
||||||
|
let action = if user.len > 0: &"/{user}/search" else: "/search"
|
||||||
|
buildHtml(form(`method`="get", action=action,
|
||||||
|
class="search-field", autocomplete="off")):
|
||||||
|
hiddenField("f", "tweets")
|
||||||
|
genInput("q", "", query.text, "Enter search...", class="pref-inline")
|
||||||
|
button(`type`="submit"): icon "search"
|
||||||
|
|
||||||
|
input(id="search-panel-toggle", `type`="checkbox", checked=isPanelOpen(query))
|
||||||
|
label(`for`="search-panel-toggle"): icon "down"
|
||||||
|
|
||||||
|
tdiv(class="search-panel"):
|
||||||
|
for f in @["filter", "exclude"]:
|
||||||
|
span(class="search-title"): text capitalize(f)
|
||||||
|
tdiv(class="search-toggles"):
|
||||||
|
for k, v in toggles:
|
||||||
|
let state =
|
||||||
|
if f == "filter": k in query.filters
|
||||||
|
else: k in query.excludes
|
||||||
|
genCheckbox(&"{f[0]}-{k}", v, state)
|
||||||
|
|
||||||
|
tdiv(class="search-row"):
|
||||||
|
tdiv:
|
||||||
|
span(class="search-title"): text "Time range"
|
||||||
|
tdiv(class="date-range"):
|
||||||
|
genDate("since", query.since)
|
||||||
|
span(class="search-title"): text "-"
|
||||||
|
genDate("until", query.until)
|
||||||
|
tdiv:
|
||||||
|
span(class="search-title"): text "Near"
|
||||||
|
genInput("near", "", query.near, "Location...", autofocus=false)
|
||||||
@@ -55,8 +55,9 @@ proc renderThread(thread: Tweets; prefs: Prefs; path: string): VNode =
|
|||||||
renderTweet(tweet, prefs, path, class=(header & "thread"),
|
renderTweet(tweet, prefs, path, class=(header & "thread"),
|
||||||
index=i, last=(i == thread.high), showThread=show)
|
index=i, last=(i == thread.high), showThread=show)
|
||||||
|
|
||||||
proc renderUser(user: User; prefs: Prefs): VNode =
|
proc renderUser*(user: User; prefs: Prefs; path: string): VNode =
|
||||||
buildHtml(tdiv(class="timeline-item")):
|
let class = if user.sensitive: "timeline-item nsfw" else: "timeline-item"
|
||||||
|
buildHtml(tdiv(class=class, data-username=user.username)):
|
||||||
a(class="tweet-link", href=("/" & user.username))
|
a(class="tweet-link", href=("/" & user.username))
|
||||||
tdiv(class="tweet-body profile-result"):
|
tdiv(class="tweet-body profile-result"):
|
||||||
tdiv(class="tweet-header"):
|
tdiv(class="tweet-header"):
|
||||||
@@ -66,6 +67,7 @@ proc renderUser(user: User; prefs: Prefs): VNode =
|
|||||||
tdiv(class="tweet-name-row"):
|
tdiv(class="tweet-name-row"):
|
||||||
tdiv(class="fullname-and-username"):
|
tdiv(class="fullname-and-username"):
|
||||||
linkUser(user, class="fullname")
|
linkUser(user, class="fullname")
|
||||||
|
renderFollowButton(user, prefs, path)
|
||||||
linkUser(user, class="username")
|
linkUser(user, class="username")
|
||||||
|
|
||||||
tdiv(class="tweet-content media-body", dir="auto"):
|
tdiv(class="tweet-content media-body", dir="auto"):
|
||||||
@@ -78,7 +80,7 @@ proc renderTimelineUsers*(results: Result[User]; prefs: Prefs; path=""): VNode =
|
|||||||
|
|
||||||
if results.content.len > 0:
|
if results.content.len > 0:
|
||||||
for user in results.content:
|
for user in results.content:
|
||||||
renderUser(user, prefs)
|
renderUser(user, prefs, path)
|
||||||
if results.bottom.len > 0:
|
if results.bottom.len > 0:
|
||||||
renderMore(results.query, results.bottom)
|
renderMore(results.query, results.bottom)
|
||||||
renderToTop()
|
renderToTop()
|
||||||
|
|||||||
@@ -1,5 +1,5 @@
|
|||||||
# SPDX-License-Identifier: AGPL-3.0-only
|
# SPDX-License-Identifier: AGPL-3.0-only
|
||||||
import strutils, sequtils, strformat, options, algorithm, uri
|
import strutils, sequtils, strformat, options, algorithm
|
||||||
import karax/[karaxdsl, vdom, vstyles]
|
import karax/[karaxdsl, vdom, vstyles]
|
||||||
from jester import Request
|
from jester import Request
|
||||||
|
|
||||||
@@ -178,14 +178,12 @@ func formatStat(stat: int): string =
|
|||||||
if stat > 0: insertSep($stat, ',')
|
if stat > 0: insertSep($stat, ',')
|
||||||
else: ""
|
else: ""
|
||||||
|
|
||||||
proc renderStats(tweet_id: int64; stats: TweetStats; views: string): VNode =
|
proc renderStats(stats: TweetStats): VNode =
|
||||||
buildHtml(tdiv(class="tweet-stats")):
|
buildHtml(tdiv(class="tweet-stats")):
|
||||||
span(class="tweet-stat"): icon "comment", formatStat(stats.replies)
|
span(class="tweet-stat"): icon "comment", formatStat(stats.replies)
|
||||||
span(class="tweet-stat"): icon "retweet", formatStat(stats.retweets)
|
span(class="tweet-stat"): icon "retweet", formatStat(stats.retweets)
|
||||||
a(class="tweet-stat", href=("/search?q=" & encodeUrl(&"-from:quotedreplies url:{tweet_id}") & "&e-nativeretweets=on")): icon "quote", formatStat(stats.quotes)
|
|
||||||
span(class="tweet-stat"): icon "heart", formatStat(stats.likes)
|
span(class="tweet-stat"): icon "heart", formatStat(stats.likes)
|
||||||
if views.len > 0:
|
span(class="tweet-stat"): icon "views", formatStat(stats.views)
|
||||||
span(class="tweet-stat"): icon "play", insertSep(views, ',')
|
|
||||||
|
|
||||||
proc renderReply(tweet: Tweet): VNode =
|
proc renderReply(tweet: Tweet): VNode =
|
||||||
buildHtml(tdiv(class="replying-to")):
|
buildHtml(tdiv(class="replying-to")):
|
||||||
@@ -273,8 +271,11 @@ proc renderTweet*(tweet: Tweet; prefs: Prefs; path: string; class=""; index=0;
|
|||||||
if index == -1 or last:
|
if index == -1 or last:
|
||||||
divClass = "thread-last " & class
|
divClass = "thread-last " & class
|
||||||
|
|
||||||
|
if tweet.sensitive:
|
||||||
|
divClass.add " nsfw"
|
||||||
|
|
||||||
if not tweet.available:
|
if not tweet.available:
|
||||||
return buildHtml(tdiv(class=divClass & "unavailable timeline-item")):
|
return buildHtml(tdiv(class=divClass & "unavailable timeline-item", data-username=tweet.user.username)):
|
||||||
tdiv(class="unavailable-box"):
|
tdiv(class="unavailable-box"):
|
||||||
if tweet.tombstone.len > 0:
|
if tweet.tombstone.len > 0:
|
||||||
text tweet.tombstone
|
text tweet.tombstone
|
||||||
@@ -296,12 +297,11 @@ proc renderTweet*(tweet: Tweet; prefs: Prefs; path: string; class=""; index=0;
|
|||||||
tweet = tweet.retweet.get
|
tweet = tweet.retweet.get
|
||||||
retweet = fullTweet.user.fullname
|
retweet = fullTweet.user.fullname
|
||||||
|
|
||||||
buildHtml(tdiv(class=("timeline-item " & divClass))):
|
buildHtml(tdiv(class=("timeline-item " & divClass), data-username=tweet.user.username)):
|
||||||
if not mainTweet:
|
if not mainTweet:
|
||||||
a(class="tweet-link", href=getLink(tweet))
|
a(class="tweet-link", href=getLink(tweet))
|
||||||
|
|
||||||
tdiv(class="tweet-body"):
|
tdiv(class="tweet-body"):
|
||||||
var views = ""
|
|
||||||
renderHeader(tweet, retweet, pinned, prefs)
|
renderHeader(tweet, retweet, pinned, prefs)
|
||||||
|
|
||||||
if not afterTweet and index == 0 and tweet.reply.len > 0 and
|
if not afterTweet and index == 0 and tweet.reply.len > 0 and
|
||||||
@@ -325,10 +325,8 @@ proc renderTweet*(tweet: Tweet; prefs: Prefs; path: string; class=""; index=0;
|
|||||||
renderAlbum(tweet)
|
renderAlbum(tweet)
|
||||||
elif tweet.video.isSome:
|
elif tweet.video.isSome:
|
||||||
renderVideo(tweet.video.get(), prefs, path)
|
renderVideo(tweet.video.get(), prefs, path)
|
||||||
views = tweet.video.get().views
|
|
||||||
elif tweet.gif.isSome:
|
elif tweet.gif.isSome:
|
||||||
renderGif(tweet.gif.get(), prefs)
|
renderGif(tweet.gif.get(), prefs)
|
||||||
views = "GIF"
|
|
||||||
|
|
||||||
if tweet.poll.isSome:
|
if tweet.poll.isSome:
|
||||||
renderPoll(tweet.poll.get())
|
renderPoll(tweet.poll.get())
|
||||||
@@ -336,14 +334,13 @@ proc renderTweet*(tweet: Tweet; prefs: Prefs; path: string; class=""; index=0;
|
|||||||
if tweet.quote.isSome:
|
if tweet.quote.isSome:
|
||||||
renderQuote(tweet.quote.get(), prefs, path)
|
renderQuote(tweet.quote.get(), prefs, path)
|
||||||
|
|
||||||
if mainTweet:
|
let published = if mainTweet: getTime(tweet) else: ""
|
||||||
p(class="tweet-published"): text &"{getTime(tweet)}"
|
|
||||||
|
|
||||||
if tweet.mediaTags.len > 0:
|
if tweet.mediaTags.len > 0:
|
||||||
renderMediaTags(tweet.mediaTags)
|
renderMediaTags(tweet.mediaTags)
|
||||||
|
|
||||||
if not prefs.hideTweetStats:
|
if not prefs.hideTweetStats:
|
||||||
renderStats(tweet.id, tweet.stats, views)
|
renderStats(tweet.stats)
|
||||||
|
|
||||||
if showThread:
|
if showThread:
|
||||||
a(class="show-thread", href=("/i/status/" & $tweet.threadId)):
|
a(class="show-thread", href=("/i/status/" & $tweet.threadId)):
|
||||||
|
|||||||
@@ -11,12 +11,7 @@ card = [
|
|||||||
['voidtarget/status/1094632512926605312',
|
['voidtarget/status/1094632512926605312',
|
||||||
'Basic OBS Studio plugin, written in nim, supporting C++ (C fine too)',
|
'Basic OBS Studio plugin, written in nim, supporting C++ (C fine too)',
|
||||||
'Basic OBS Studio plugin, written in nim, supporting C++ (C fine too) - obsplugin.nim',
|
'Basic OBS Studio plugin, written in nim, supporting C++ (C fine too) - obsplugin.nim',
|
||||||
'gist.github.com', True],
|
'gist.github.com', True]
|
||||||
|
|
||||||
['nim_lang/status/1082989146040340480',
|
|
||||||
'Nim in 2018: A short recap',
|
|
||||||
'There were several big news in the Nim world in 2018 – two new major releases, partnership with Status, and much more. But let us go chronologically.',
|
|
||||||
'nim-lang.org', True]
|
|
||||||
]
|
]
|
||||||
|
|
||||||
no_thumb = [
|
no_thumb = [
|
||||||
|
|||||||
@@ -1,23 +1,20 @@
|
|||||||
#!/usr/bin/env python3
|
#!/usr/bin/env python3
|
||||||
"""
|
"""
|
||||||
Authenticates with X.com/Twitter and extracts session cookies for use with Nitter.
|
|
||||||
Handles 2FA, extracts user info, and outputs clean JSON for sessions.jsonl.
|
|
||||||
|
|
||||||
Requirements:
|
Requirements:
|
||||||
pip install -r tools/requirements.txt
|
pip install -r tools/requirements.txt
|
||||||
|
|
||||||
Usage:
|
Usage:
|
||||||
python3 tools/get_web_session.py <username> <password> [totp_seed] [--append sessions.jsonl] [--headless]
|
python3 tools/create_session_browser.py <username> <password> [totp_seed] [--append sessions.jsonl] [--headless]
|
||||||
|
|
||||||
Examples:
|
Examples:
|
||||||
# Output to terminal
|
# Output to terminal
|
||||||
python3 tools/get_web_session.py myusername mypassword TOTP_BASE32_SECRET
|
python3 tools/create_session_browser.py myusername mypassword TOTP_SECRET
|
||||||
|
|
||||||
# Append to sessions.jsonl
|
# Append to sessions.jsonl
|
||||||
python3 tools/get_web_session.py myusername mypassword TOTP_SECRET --append sessions.jsonl
|
python3 tools/create_session_browser.py myusername mypassword TOTP_SECRET --append sessions.jsonl
|
||||||
|
|
||||||
# Headless mode (may increase detection risk)
|
# Headless mode (may increase detection risk)
|
||||||
python3 tools/get_web_session.py myusername mypassword TOTP_SECRET --headless
|
python3 tools/create_session_browser.py myusername mypassword TOTP_SECRET --headless
|
||||||
|
|
||||||
Output:
|
Output:
|
||||||
{"kind": "cookie", "username": "...", "id": "...", "auth_token": "...", "ct0": "..."}
|
{"kind": "cookie", "username": "...", "id": "...", "auth_token": "...", "ct0": "..."}
|
||||||
@@ -97,7 +94,7 @@ async def login_and_get_cookies(username, password, totp_seed=None, headless=Fal
|
|||||||
|
|
||||||
async def main():
|
async def main():
|
||||||
if len(sys.argv) < 3:
|
if len(sys.argv) < 3:
|
||||||
print('Usage: python3 twitter-auth.py username password [totp_seed] [--append sessions.jsonl] [--headless]')
|
print('Usage: python3 create_session_browser.py username password [totp_seed] [--append file.jsonl] [--headless]')
|
||||||
sys.exit(1)
|
sys.exit(1)
|
||||||
|
|
||||||
username = sys.argv[1]
|
username = sys.argv[1]
|
||||||
328
tools/create_session_curl.py
Normal file
328
tools/create_session_curl.py
Normal file
@@ -0,0 +1,328 @@
|
|||||||
|
#!/usr/bin/env python3
|
||||||
|
"""
|
||||||
|
Requirements:
|
||||||
|
pip install curl_cffi pyotp
|
||||||
|
|
||||||
|
Usage:
|
||||||
|
python3 tools/create_session_curl.py <username> <password> [totp_seed] [--append sessions.jsonl]
|
||||||
|
|
||||||
|
Examples:
|
||||||
|
# Output to terminal
|
||||||
|
python3 tools/create_session_curl.py myusername mypassword TOTP_SECRET
|
||||||
|
|
||||||
|
# Append to sessions.jsonl
|
||||||
|
python3 tools/create_session_curl.py myusername mypassword TOTP_SECRET --append sessions.jsonl
|
||||||
|
|
||||||
|
Output:
|
||||||
|
{"kind": "cookie", "username": "...", "id": "...", "auth_token": "...", "ct0": "..."}
|
||||||
|
"""
|
||||||
|
|
||||||
|
import sys
|
||||||
|
import json
|
||||||
|
import pyotp
|
||||||
|
from curl_cffi import requests
|
||||||
|
|
||||||
|
BEARER_TOKEN = "AAAAAAAAAAAAAAAAAAAAAFQODgEAAAAAVHTp76lzh3rFzcHbmHVvQxYYpTw%3DckAlMINMjmCwxUcaXbAN4XqJVdgMJaHqNOFgPMK0zN1qLqLQCF"
|
||||||
|
BASE_URL = "https://api.x.com/1.1/onboarding/task.json"
|
||||||
|
GUEST_ACTIVATE_URL = "https://api.x.com/1.1/guest/activate.json"
|
||||||
|
|
||||||
|
# Subtask versions required by API
|
||||||
|
SUBTASK_VERSIONS = {
|
||||||
|
"action_list": 2, "alert_dialog": 1, "app_download_cta": 1,
|
||||||
|
"check_logged_in_account": 2, "choice_selection": 3,
|
||||||
|
"contacts_live_sync_permission_prompt": 0, "cta": 7, "email_verification": 2,
|
||||||
|
"end_flow": 1, "enter_date": 1, "enter_email": 2, "enter_password": 5,
|
||||||
|
"enter_phone": 2, "enter_recaptcha": 1, "enter_text": 5, "generic_urt": 3,
|
||||||
|
"in_app_notification": 1, "interest_picker": 3, "js_instrumentation": 1,
|
||||||
|
"menu_dialog": 1, "notifications_permission_prompt": 2, "open_account": 2,
|
||||||
|
"open_home_timeline": 1, "open_link": 1, "phone_verification": 4,
|
||||||
|
"privacy_options": 1, "security_key": 3, "select_avatar": 4,
|
||||||
|
"select_banner": 2, "settings_list": 7, "show_code": 1, "sign_up": 2,
|
||||||
|
"sign_up_review": 4, "tweet_selection_urt": 1, "update_users": 1,
|
||||||
|
"upload_media": 1, "user_recommendations_list": 4,
|
||||||
|
"user_recommendations_urt": 1, "wait_spinner": 3, "web_modal": 1
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def get_base_headers(guest_token=None):
|
||||||
|
"""Build base headers for API requests."""
|
||||||
|
headers = {
|
||||||
|
"Authorization": f"Bearer {BEARER_TOKEN}",
|
||||||
|
"Content-Type": "application/json",
|
||||||
|
"Accept": "*/*",
|
||||||
|
"Accept-Language": "en-US",
|
||||||
|
"X-Twitter-Client-Language": "en-US",
|
||||||
|
"Origin": "https://x.com",
|
||||||
|
"Referer": "https://x.com/",
|
||||||
|
}
|
||||||
|
if guest_token:
|
||||||
|
headers["X-Guest-Token"] = guest_token
|
||||||
|
return headers
|
||||||
|
|
||||||
|
|
||||||
|
def get_cookies_dict(session):
|
||||||
|
"""Extract cookies from session."""
|
||||||
|
return session.cookies.get_dict() if hasattr(session.cookies, 'get_dict') else dict(session.cookies)
|
||||||
|
|
||||||
|
|
||||||
|
def make_request(session, headers, flow_token, subtask_data, print_msg):
|
||||||
|
"""Generic request handler for flow steps."""
|
||||||
|
print(f"[*] {print_msg}...", file=sys.stderr)
|
||||||
|
|
||||||
|
payload = {
|
||||||
|
"flow_token": flow_token,
|
||||||
|
"subtask_inputs": [subtask_data] if isinstance(subtask_data, dict) else subtask_data
|
||||||
|
}
|
||||||
|
|
||||||
|
response = session.post(BASE_URL, json=payload, headers=headers)
|
||||||
|
response.raise_for_status()
|
||||||
|
|
||||||
|
data = response.json()
|
||||||
|
new_flow_token = data.get('flow_token')
|
||||||
|
if not new_flow_token:
|
||||||
|
raise Exception(f"Failed to get flow token: {print_msg}")
|
||||||
|
|
||||||
|
return new_flow_token, data
|
||||||
|
|
||||||
|
|
||||||
|
def get_guest_token(session):
|
||||||
|
"""Get guest token for unauthenticated requests."""
|
||||||
|
print("[*] Getting guest token...", file=sys.stderr)
|
||||||
|
response = session.post(GUEST_ACTIVATE_URL, headers={"Authorization": f"Bearer {BEARER_TOKEN}"})
|
||||||
|
response.raise_for_status()
|
||||||
|
|
||||||
|
guest_token = response.json().get('guest_token')
|
||||||
|
if not guest_token:
|
||||||
|
raise Exception("Failed to obtain guest token")
|
||||||
|
|
||||||
|
print(f"[*] Got guest token: {guest_token}", file=sys.stderr)
|
||||||
|
return guest_token
|
||||||
|
|
||||||
|
|
||||||
|
def init_flow(session, guest_token):
|
||||||
|
"""Initialize the login flow."""
|
||||||
|
print("[*] Initializing login flow...", file=sys.stderr)
|
||||||
|
|
||||||
|
headers = get_base_headers(guest_token)
|
||||||
|
payload = {
|
||||||
|
"input_flow_data": {
|
||||||
|
"flow_context": {
|
||||||
|
"debug_overrides": {},
|
||||||
|
"start_location": {"location": "manual_link"}
|
||||||
|
},
|
||||||
|
"subtask_versions": SUBTASK_VERSIONS
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
response = session.post(f"{BASE_URL}?flow_name=login", json=payload, headers=headers)
|
||||||
|
response.raise_for_status()
|
||||||
|
|
||||||
|
flow_token = response.json().get('flow_token')
|
||||||
|
if not flow_token:
|
||||||
|
raise Exception("Failed to get initial flow token")
|
||||||
|
|
||||||
|
print("[*] Got initial flow token", file=sys.stderr)
|
||||||
|
return flow_token, headers
|
||||||
|
|
||||||
|
|
||||||
|
def submit_username(session, flow_token, headers, guest_token, username):
|
||||||
|
"""Submit username."""
|
||||||
|
headers = headers.copy()
|
||||||
|
headers["X-Guest-Token"] = guest_token
|
||||||
|
|
||||||
|
subtask = {
|
||||||
|
"subtask_id": "LoginEnterUserIdentifierSSO",
|
||||||
|
"settings_list": {
|
||||||
|
"setting_responses": [{
|
||||||
|
"key": "user_identifier",
|
||||||
|
"response_data": {"text_data": {"result": username}}
|
||||||
|
}],
|
||||||
|
"link": "next_link"
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
flow_token, data = make_request(session, headers, flow_token, subtask, "Submitting username")
|
||||||
|
|
||||||
|
# Check for denial (suspicious activity)
|
||||||
|
if data.get('subtasks') and 'cta' in data['subtasks'][0]:
|
||||||
|
error_msg = data['subtasks'][0]['cta'].get('primary_text', {}).get('text')
|
||||||
|
if error_msg:
|
||||||
|
raise Exception(f"Login denied: {error_msg}")
|
||||||
|
|
||||||
|
return flow_token
|
||||||
|
|
||||||
|
|
||||||
|
def submit_password(session, flow_token, headers, guest_token, password):
|
||||||
|
"""Submit password and detect if 2FA is needed."""
|
||||||
|
headers = headers.copy()
|
||||||
|
headers["X-Guest-Token"] = guest_token
|
||||||
|
|
||||||
|
subtask = {
|
||||||
|
"subtask_id": "LoginEnterPassword",
|
||||||
|
"enter_password": {"password": password, "link": "next_link"}
|
||||||
|
}
|
||||||
|
|
||||||
|
flow_token, data = make_request(session, headers, flow_token, subtask, "Submitting password")
|
||||||
|
|
||||||
|
needs_2fa = any(s.get('subtask_id') == 'LoginTwoFactorAuthChallenge' for s in data.get('subtasks', []))
|
||||||
|
if needs_2fa:
|
||||||
|
print("[*] 2FA required", file=sys.stderr)
|
||||||
|
|
||||||
|
return flow_token, needs_2fa
|
||||||
|
|
||||||
|
|
||||||
|
def submit_2fa(session, flow_token, headers, guest_token, totp_seed):
|
||||||
|
"""Submit 2FA code."""
|
||||||
|
if not totp_seed:
|
||||||
|
raise Exception("2FA required but no TOTP seed provided")
|
||||||
|
|
||||||
|
code = pyotp.TOTP(totp_seed).now()
|
||||||
|
print("[*] Generating 2FA code...", file=sys.stderr)
|
||||||
|
|
||||||
|
headers = headers.copy()
|
||||||
|
headers["X-Guest-Token"] = guest_token
|
||||||
|
|
||||||
|
subtask = {
|
||||||
|
"subtask_id": "LoginTwoFactorAuthChallenge",
|
||||||
|
"enter_text": {"text": code, "link": "next_link"}
|
||||||
|
}
|
||||||
|
|
||||||
|
flow_token, _ = make_request(session, headers, flow_token, subtask, "Submitting 2FA code")
|
||||||
|
return flow_token
|
||||||
|
|
||||||
|
|
||||||
|
def submit_js_instrumentation(session, flow_token, headers, guest_token):
|
||||||
|
"""Submit JS instrumentation response."""
|
||||||
|
headers = headers.copy()
|
||||||
|
headers["X-Guest-Token"] = guest_token
|
||||||
|
|
||||||
|
subtask = {
|
||||||
|
"subtask_id": "LoginJsInstrumentationSubtask",
|
||||||
|
"js_instrumentation": {
|
||||||
|
"response": '{"rf":{"a4fc506d24bb4843c48a1966940c2796bf4fb7617a2d515ad3297b7df6b459b6":121,"bff66e16f1d7ea28c04653dc32479cf416a9c8b67c80cb8ad533b2a44fee82a3":-1,"ac4008077a7e6ca03210159dbe2134dea72a616f03832178314bb9931645e4f7":-22,"c3a8a81a9b2706c6fec42c771da65a9597c537b8e4d9b39e8e58de9fe31ff239":-12},"s":"ZHYaDA9iXRxOl2J3AZ9cc23iJx-Fg5E82KIBA_fgeZFugZGYzRtf8Bl3EUeeYgsK30gLFD2jTQx9fAMsnYCw0j8ahEy4Pb5siM5zD6n7YgOeWmFFaXoTwaGY4H0o-jQnZi5yWZRAnFi4lVuCVouNz_xd2BO2sobCO7QuyOsOxQn2CWx7bjD8vPAzT5BS1mICqUWyjZDjLnRZJU6cSQG5YFIHEPBa8Kj-v1JFgkdAfAMIdVvP7C80HWoOqYivQR7IBuOAI4xCeLQEdxlGeT-JYStlP9dcU5St7jI6ExyMeQnRicOcxXLXsan8i5Joautk2M8dAJFByzBaG4wtrPhQ3QAAAZEi-_t7"}',
|
||||||
|
"link": "next_link"
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
flow_token, _ = make_request(session, headers, flow_token, subtask, "Submitting JS instrumentation")
|
||||||
|
return flow_token
|
||||||
|
|
||||||
|
|
||||||
|
def complete_flow(session, flow_token, headers):
|
||||||
|
"""Complete the login flow."""
|
||||||
|
cookies = get_cookies_dict(session)
|
||||||
|
|
||||||
|
headers = headers.copy()
|
||||||
|
headers["X-Twitter-Auth-Type"] = "OAuth2Session"
|
||||||
|
if cookies.get('ct0'):
|
||||||
|
headers["X-Csrf-Token"] = cookies['ct0']
|
||||||
|
|
||||||
|
subtask = {
|
||||||
|
"subtask_id": "AccountDuplicationCheck",
|
||||||
|
"check_logged_in_account": {"link": "AccountDuplicationCheck_false"}
|
||||||
|
}
|
||||||
|
|
||||||
|
make_request(session, headers, flow_token, subtask, "Completing login flow")
|
||||||
|
|
||||||
|
|
||||||
|
def extract_user_id(cookies_dict):
|
||||||
|
"""Extract user ID from twid cookie."""
|
||||||
|
twid = cookies_dict.get('twid', '').strip('"')
|
||||||
|
|
||||||
|
for prefix in ['u=', 'u%3D']:
|
||||||
|
if prefix in twid:
|
||||||
|
return twid.split(prefix)[1].split('&')[0].strip('"')
|
||||||
|
|
||||||
|
return None
|
||||||
|
|
||||||
|
|
||||||
|
def login_and_get_cookies(username, password, totp_seed=None):
|
||||||
|
"""Authenticate with X.com and extract session cookies."""
|
||||||
|
session = requests.Session(impersonate="chrome")
|
||||||
|
|
||||||
|
try:
|
||||||
|
guest_token = get_guest_token(session)
|
||||||
|
flow_token, headers = init_flow(session, guest_token)
|
||||||
|
flow_token = submit_js_instrumentation(session, flow_token, headers, guest_token)
|
||||||
|
flow_token = submit_username(session, flow_token, headers, guest_token, username)
|
||||||
|
flow_token, needs_2fa = submit_password(session, flow_token, headers, guest_token, password)
|
||||||
|
|
||||||
|
if needs_2fa:
|
||||||
|
flow_token = submit_2fa(session, flow_token, headers, guest_token, totp_seed)
|
||||||
|
|
||||||
|
complete_flow(session, flow_token, headers)
|
||||||
|
|
||||||
|
cookies_dict = get_cookies_dict(session)
|
||||||
|
cookies_dict['username'] = username
|
||||||
|
|
||||||
|
user_id = extract_user_id(cookies_dict)
|
||||||
|
if user_id:
|
||||||
|
cookies_dict['id'] = user_id
|
||||||
|
|
||||||
|
print("[*] Successfully authenticated", file=sys.stderr)
|
||||||
|
return cookies_dict
|
||||||
|
|
||||||
|
finally:
|
||||||
|
session.close()
|
||||||
|
|
||||||
|
|
||||||
|
def main():
|
||||||
|
if len(sys.argv) < 3:
|
||||||
|
print('Usage: python3 create_session_curl.py username password [totp_seed] [--append sessions.jsonl]', file=sys.stderr)
|
||||||
|
sys.exit(1)
|
||||||
|
|
||||||
|
username = sys.argv[1]
|
||||||
|
password = sys.argv[2]
|
||||||
|
totp_seed = None
|
||||||
|
append_file = None
|
||||||
|
|
||||||
|
# Parse optional arguments
|
||||||
|
i = 3
|
||||||
|
while i < len(sys.argv):
|
||||||
|
arg = sys.argv[i]
|
||||||
|
if arg == '--append':
|
||||||
|
if i + 1 < len(sys.argv):
|
||||||
|
append_file = sys.argv[i + 1]
|
||||||
|
i += 2
|
||||||
|
else:
|
||||||
|
print('[!] Error: --append requires a filename', file=sys.stderr)
|
||||||
|
sys.exit(1)
|
||||||
|
elif not arg.startswith('--'):
|
||||||
|
if totp_seed is None:
|
||||||
|
totp_seed = arg
|
||||||
|
i += 1
|
||||||
|
else:
|
||||||
|
print(f'[!] Warning: Unknown argument: {arg}', file=sys.stderr)
|
||||||
|
i += 1
|
||||||
|
|
||||||
|
try:
|
||||||
|
cookies = login_and_get_cookies(username, password, totp_seed)
|
||||||
|
|
||||||
|
session = {
|
||||||
|
'kind': 'cookie',
|
||||||
|
'username': cookies['username'],
|
||||||
|
'id': cookies.get('id'),
|
||||||
|
'auth_token': cookies['auth_token'],
|
||||||
|
'ct0': cookies['ct0']
|
||||||
|
}
|
||||||
|
|
||||||
|
output = json.dumps(session)
|
||||||
|
|
||||||
|
if append_file:
|
||||||
|
with open(append_file, 'a') as f:
|
||||||
|
f.write(output + '\n')
|
||||||
|
print(f'✓ Session appended to {append_file}', file=sys.stderr)
|
||||||
|
else:
|
||||||
|
print(output)
|
||||||
|
|
||||||
|
sys.exit(0)
|
||||||
|
|
||||||
|
except Exception as error:
|
||||||
|
print(f'[!] Error: {error}', file=sys.stderr)
|
||||||
|
import traceback
|
||||||
|
traceback.print_exc(file=sys.stderr)
|
||||||
|
sys.exit(1)
|
||||||
|
|
||||||
|
|
||||||
|
if __name__ == '__main__':
|
||||||
|
main()
|
||||||
@@ -1,2 +1,3 @@
|
|||||||
nodriver>=0.48.0
|
nodriver>=0.48.0
|
||||||
pyotp
|
pyotp
|
||||||
|
curl_cffi
|
||||||
|
|||||||
Reference in New Issue
Block a user